pdf string | doi string | doi_sourse string | supplementary int64 | title string | publisher string | year int64 | access int64 | compound_id string | compound_name string | SMILES string | SMILES_type string | metal string | target string | page_smiles int64 | origin_smiles string | page_metal int64 | origin_metal string | page_target_value float64 | origin_target_value string |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1021/bc800538s | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | DOTA-NHS | O=C(O)CN1CCN(CC(=O)O)CCN(CC(=O)ON2C(=O)CCC2=O)CCN(CC(=O)O)CC1 | ligand | Ga | null | 11 | table 7 | 1 | title | null | null |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1021/ol100774p | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | Clickable DOTA | [N-]=[N+]=NCCCNC(=O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 | ligand | Ga | null | 11 | table 7 | 1 | title | null | null |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1002/chem.201200132 | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | DOTAGA-anhydride | O=C(O)CN1CCN(CC(=O)O)CCN(C2CCC(=O)OC2=O)CCN(CC(=O)O)CC1 | ligand | Ga | null | 11 | table 7 | 1 | title | null | null |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1021/bc900443a | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | oxo-DO3A | O=C(O)CN1CCOCCN(CC(=O)O)CCN(CC(=O)O)CC1 | ligand | Ga | null | 12 | table 7 | 1 | title | null | null |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1021/bc900443a | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | PCTA | O=C(O)CN1CCN(CC(=O)O)Cc2cccc(n2)CN(CC(=O)O)CC1 | ligand | Ga | null | 12 | table 7 | 1 | title | null | null |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1021/bc900443a | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | p-SCN-Bn-DOTA | O=C(O)CN1CCN(CC(=O)O)CCN(CC(=O)O)C(Cc2ccc(N=C=S)cc2)CN(CC(=O)O)CC1 | ligand | Ga | null | 12 | table 7 | 1 | title | null | null |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1021/bc900443a | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | p-NH2-Bn-DOTA | Nc1ccc(CC2CN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CCN2CC(=O)O)cc1 | ligand | Ga | null | 12 | table 7 | 1 | title | null | null |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1021/bc010074f | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | NODAGA | O=C(O)CCC(C(=O)O)N1CCN(CC(=O)O)CCN(CC(=O)O)CC1 | ligand | Ga | null | 13 | table 8 | 1 | title | null | null |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1039/A801294F | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | NODASA | O=C(O)CC(C(=O)O)N1CCN(CC(=O)O)CCN(CC(=O)O)CC1 | ligand | Ga | null | 13 | table 8 | 1 | title | null | null |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.2967/jnumed.107.047423 | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | p-SCN-benzyl NOTA | N#CSc1ccc(CC2CN(CC(=O)O)CCN(CC(=O)O)CCN2CC(=O)O)cc1 | ligand | Ga | null | 13 | table 8 | 1 | title | null | null |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1002/chem.200903281 | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | TRAP | O=C(O)CCP(=O)(O)CN1CCN(CP(=O)(O)CCC(=O)O)CCN(CP(=O)(O)CCC(=O)O)CC1 | ligand | Ga | null | 13 | table 8 | 1 | title | null | null |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1021/mp400642s | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | NOPO | O=C(O)CCP(=O)(O)CN1CCN(CP(=O)(O)CO)CCN(CP(=O)(O)CO)CC1 | ligand | Ga | null | 13 | table 8 | 1 | title | null | null |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1186/s13550-015-0154-7 | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | AAZTA-C9 | O=C(O)CCCCCCCCCC1(N(CC(=O)O)CC(=O)O)CN(CC(=O)O)CCN(CC(=O)O)C1 | ligand | Ga | null | 14 | table 9 | 1 | title | null | null |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1002/cmdc.201200043 | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | AAZTA-C4 | O=C(O)CCCCC1(N(CC(=O)O)CC(=O)O)CN(CC(=O)O)CCN(CC(=O)O)C1 | ligand | Ga | null | 14 | table 9 | 1 | title | null | null |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1016/j.apradiso.2015.01.023 | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | DATA5m | CN(CC(=O)O)C1(CCCCC(=O)O)CN(CC(=O)O)CCN(CC(=O)O)C1 | ligand | Ga | null | 14 | table 9 | 1 | title | null | null |
mcinnes2017 | 10.1016/j.ccr.2017.05.011 | 10.1021/jm9505977 | 0 | Copper, gallium and zirconium positron emission tomography imaging agents: The importance of metal ion speciation | Elsevier BV | 2,017 | 0 | null | 6SS | CC(C)(S)CN(CCN(CC(C)(C)S)C(=O)O)C(=O)O | ligand | Ga | null | 10 | figure 7 | 7 | subtitle 3 | null | null |
mcinnes2017 | 10.1016/j.ccr.2017.05.011 | 10.1007/s00259-008-0816-z | 0 | Copper, gallium and zirconium positron emission tomography imaging agents: The importance of metal ion speciation | Elsevier BV | 2,017 | 0 | null | HBED | O=C(O)CN(CCN(CC(=O)O)Cc1ccccc1O)Cc1ccccc1O | ligand | Ga | null | 10 | figure 7 | 7 | subtitle 3 | null | null |
mcinnes2017 | 10.1016/j.ccr.2017.05.011 | 10.1007/s00259-011-1778-0 | 0 | Copper, gallium and zirconium positron emission tomography imaging agents: The importance of metal ion speciation | Elsevier BV | 2,017 | 0 | null | NODAGA | O=C(O)CCC(C(=O)O)N1CCN(CC(=O)O)CCN(CC(=O)O)CC1 | ligand | Ga | null | 10 | figure 7 | 7 | subtitle 3 | null | null |
mcinnes2017 | 10.1016/j.ccr.2017.05.011 | 10.1007/s00259-004-1702-y | 0 | Copper, gallium and zirconium positron emission tomography imaging agents: The importance of metal ion speciation | Elsevier BV | 2,017 | 0 | null | DOTA | O=C(O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 | ligand | Ga | null | 6 | figure 3 | 7 | subtitle 3 | null | null |
mcinnes2017 | 10.1016/j.ccr.2017.05.011 | 10.1021/bc200319q | 0 | Copper, gallium and zirconium positron emission tomography imaging agents: The importance of metal ion speciation | Elsevier BV | 2,017 | 0 | null | (CO2H)2sar | O=C(O)CCCC(=O)NC12CNCCNCC(NC(=O)CCCC(=O)O)(CNCCNC1)CNCCNC2 | ligand | Ga | null | 10 | figure 7 | 7 | subtitle 3 | null | null |
mcinnes2017 | 10.1016/j.ccr.2017.05.011 | 10.1038/nprot.2008.22 | 0 | Copper, gallium and zirconium positron emission tomography imaging agents: The importance of metal ion speciation | Elsevier BV | 2,017 | 0 | null | DFO | CC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCN | ligand | Ga | null | 10 | figure 7 | 7 | subtitle 3 | null | null |
mcinnes2017 | 10.1016/j.ccr.2017.05.011 | 10.1007/s00259-013-2397-8 | 0 | Copper, gallium and zirconium positron emission tomography imaging agents: The importance of metal ion speciation | Elsevier BV | 2,017 | 0 | null | DTPA | O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CCN(CC(=O)O)CC(=O)O | ligand | Ga | null | 10 | figure 7 | 7 | subtitle 3 | null | null |
mcinnes2017 | 10.1016/j.ccr.2017.05.011 | 10.1021/acs.bioconjchem.5b00335 | 0 | Copper, gallium and zirconium positron emission tomography imaging agents: The importance of metal ion speciation | Elsevier BV | 2,017 | 0 | null | YM103 | Cc1cc(=O)c(O)c(CNC(=O)CCC(CCC(=O)NCc2c(O)c(=O)cc(C)n2C)(CCC(=O)NCc2c(O)c(=O)cc(C)n2C)NC(=O)CCNC(=O)CCN2C(=O)C=CC2=O)n1C | ligand | Ga | null | 10 | figure 7 | 7 | subtitle 3 | null | null |
mcinnes2017 | 10.1016/j.ccr.2017.05.011 | 10.1021/acs.bioconjchem.5b00335 | 0 | Copper, gallium and zirconium positron emission tomography imaging agents: The importance of metal ion speciation | Elsevier BV | 2,017 | 0 | null | c(RGDfK) | N=C(N)NCCCC1NC(=O)C(CCCCN)NC(=O)C(Cc2ccccc2)NC(=O)C(CC(=O)O)NC(=O)CNC1=O | ligand | Ga | null | 10 | figure 7 | 7 | subtitle 3 | null | null |
price2016 | 10.1039/c5dt04706d | 10.1021/cr900325h | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | NOTA | O=C(O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CC1 | ligand | Ga | 31 | 4 | figure 2 | 4 | table 3 (caption) | 4 | table 3 |
price2016 | 10.1039/c5dt04706d | 10.1021/cr900325h | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | TACN-TM | SCN1CCN(CS)CCN(CS)CC1 | ligand | Ga | 34,2 | 4 | figure 2 | 4 | table 3 (caption) | 4 | table 3 |
price2016 | 10.1039/c5dt04706d | 10.1021/ic101378s | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | DOTA | O=C(O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 | ligand | Ga | 26,1 | 4 | figure 2 | 4 | table 3 (caption) | 4 | table 3 |
price2016 | 10.1039/c5dt04706d | 10.1021/cr900325h | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | TETA | O=C(O)CN1CCCN(CC(=O)O)CCN(CC(=O)O)CCCN(CC(=O)O)CC1 | ligand | Ga | 19,7 | 4 | figure 2 | 4 | table 3 (caption) | 4 | table 3 |
price2016 | 10.1039/c5dt04706d | 10.1016/S0039-9140(97)00157-4 | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | EDTA | O=C(O)CN(CCN(CC(=O)O)C(=O)O)C(=O)O | ligand | Ga | 22 | 4 | figure 2 | 4 | table 3 (caption) | 4 | table 3 |
price2016 | 10.1039/c5dt04706d | 10.1021/jm9505977 | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | ED2A2M | CC(C)(S)N(CCN(CC(=O)O)C(C)(C)S)CC(=O)O | ligand | Ga | 31,6 | 4 | figure 2 | 4 | table 3 (caption) | 4 | table 3 |
price2016 | 10.1039/c5dt04706d | 10.1021/cr900325h | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | HBED | O=C(O)CN(CCN(CC(=O)O)Cc1ccccc1O)Cc1ccccc1O | ligand | Ga | 37,7 | 4 | figure 2 | 4 | table 3 (caption) | 4 | table 3 |
price2016 | 10.1039/c5dt04706d | 10.1021/ic941330l | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | EC | O=C(O)C(CS)NCCNC(CS)C(=O)O | ligand | Ga | 31,5 | 4 | figure 2 | 4 | table 3 (caption) | 4 | table 3 |
price2016 | 10.1039/c5dt04706d | 10.1016/S0039-9140(97)00157-4 | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | DTPA | O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CCN(CC(=O)O)CC(=O)O | ligand | Ga | 25,1 | 4 | figure 2 | 4 | table 3 (caption) | 4 | table 3 |
price2016 | 10.1039/c5dt04706d | 10.1021/ic951019j | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | SBAD | O=S(=O)=C1C=CC(O)=C(CNCCNCCNCCNCC2=C(O)C=CC(=S(=O)=O)C2)C1 | ligand | Ga | 28,3 | 4 | figure 2 | 4 | table 3 (caption) | 4 | table 3 |
price2016 | 10.1039/c5dt04706d | 10.1021/ic202103v | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | TRAP-OH | O=P(O)(CO)CN1CCN(CP(=O)(O)CO)CCN(CP(=O)(O)CO)CC1 | ligand | Ga | 23,3 | 5 | figure 3 | 4 | table 3 (caption) | 6 | table 4 |
price2016 | 10.1039/c5dt04706d | 10.1002/chem.201103503 | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | TRAP-Ph | O=P(O)(CN1CCN(CP(=O)(O)c2ccccc2)CCN(CP(=O)(O)c2ccccc2)CC1)c1ccccc1 | ligand | Ga | null | 5 | figure 3 | 4 | table 3 (caption) | null | null |
price2016 | 10.1039/c5dt04706d | 10.1002/chem.200903281 | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | TRAP-Pr | O=C(O)CCP(=O)(O)CN1CCN(CP(=O)(O)CCC(=O)O)CCN(CP(=O)(O)CCC(=O)O)CC1 | ligand | Ga | 26,2 | 5 | figure 3 | 4 | table 3 (caption) | 6 | table 4 |
price2016 | 10.1039/c5dt04706d | 10.1002/chem.201302751 | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | TRAP-(HMDA-DOTA)3 | O=C(O)CN1CCN(CC(=O)O)CCN(CC(=O)NCCCCCCNC(=O)CCP(=O)(O)CN2CCN(CP(=O)(O)CCC(=O)NCCCCCCNC(=O)CN3CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC3)CCN(CP(=O)(O)CCC(=O)NCCCCCCNC(=O)CN3CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC3)CC2)CCN(CC(=O)O)CC1 | ligand | Ga | null | 5 | figure 3 | 4 | table 3 (caption) | null | null |
price2016 | 10.1039/c5dt04706d | 10.1021/mp400642s | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | NOPO | O=C(O)CCP(=O)(O)CN1CCN(CP(=O)(O)CO)CCN(CP(=O)(O)CO)CC1 | ligand | Ga | 25 | 5 | figure 3 | 4 | table 3 (caption) | 6 | table 4 |
price2016 | 10.1039/c5dt04706d | 10.1021/bc900443a | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | PCTA | O=C(O)CN1CCN(CC(=O)O)Cc2cccc(n2)CN(CC(=O)O)CC1 | ligand | Ga | null | 5 | figure 3 | 4 | table 3 (caption) | null | null |
price2016 | 10.1039/c5dt04706d | 10.1021/bc900443a | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | Oxo | O=C(O)CN1CCOCCN(CC(=O)O)CCN(CC(=O)O)CC1 | ligand | Ga | null | 5 | figure 3 | 4 | table 3 (caption) | null | null |
price2016 | 10.1039/c5dt04706d | 10.1021/bc200319q | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | (NH2)2Sar | NC12CNCCNCC(N)(CNCCNC1)CNCCNC2 | ligand | Ga | null | 5 | figure 3 | 4 | table 3 (caption) | null | null |
price2016 | 10.1039/c5dt04706d | 10.1016/j.nucmedbio.2012.11.006 | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | L1 | null | CC1=C(CCC(=O)O)c2cc3[nH]c(cc4[nH]c(cc5nc(cc1n2)C(C(C)O)=C5C)c(C(C)O)c4C)c(C)c3CCC(=O)O | ligand | Ga | null | 5 | figure 3 | 4 | table 3 (caption) | null | null |
price2016 | 10.1039/c5dt04706d | 10.1016/j.nucmedbio.2012.11.006 | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | L2 | null | CCC1=C(C)c2cc3[nH]c(cc4[nH]c(cc5nc(cc1n2)C(C)=C5CCC(=O)O)c(CCC(=O)O)c4C)c(C)c3CC | ligand | Ga | null | 5 | figure 3 | 4 | table 3 (caption) | null | null |
price2016 | 10.1039/c5dt04706d | 10.1016/j.nucmedbio.2012.11.006 | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | L3 | null | C1=Cc2nc1c(-c1ccccc1)c1nc(c(-c3ccccc3)c3ccc([nH]3)c(-c3ccccc3)c3ccc([nH]3)c2-c2ccccc2)C=C1 | ligand | Ga | null | 5 | figure 3 | 4 | table 3 (caption) | null | null |
price2016 | 10.1039/c5dt04706d | 10.1016/j.nucmedbio.2012.11.006 | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | L4 | null | CCCCCCC(O)c1c(C)c2cc3[nH]c(cc4nc(cc5nc(cc1[nH]2)C(C)=C5CC)C(C)=C4CCC(=O)OC)c(CCC(=O)OC)c3C | ligand | Ga | null | 5 | figure 3 | 4 | table 3 (caption) | null | null |
price2016 | 10.1039/c5dt04706d | 10.1016/j.nucmedbio.2012.11.006 | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | L5 | null | COC(=O)CCC1=C(C)c2cc3nc(cc4[nH]c(cc5[nH]c(cc1n2)c(CCC(=O)OC)c5C)C(C)(CC(=O)OC)C4=O)C(C)=C3 | ligand | Ga | null | 5 | figure 3 | 4 | table 3 (caption) | null | null |
price2016 | 10.1039/c5dt04706d | 10.1007/s11307-014-0760-1 | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | TeMP | C[n+]1ccc(-c2c3nc(c(-c4cc[n+](C)cc4)c4ccc([nH]4)c(-c4cc[n+](C)cc4)c4ccc([nH]4)c(-c4cc[n+](C)cc4)c4nc2C=C4)C=C3)cc1 | ligand | Ga | null | 5 | figure 3 | 4 | table 3 (caption) | null | null |
price2016 | 10.1039/c5dt04706d | 10.1039/C4DT02949F | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | TriMPN3 | C[n+]1ccc(-c2c3nc(c(-c4ccc(N=[N+]=[N-])cc4)c4ccc([nH]4)c(-c4cc[n+](C)cc4)c4ccc([nH]4)c(-c4cc[n+](C)cc4)c4nc2C=C4)C=C3)cc1 | ligand | Ga | null | 5 | figure 3 | 4 | table 3 (caption) | null | null |
price2016 | 10.1039/c5dt04706d | 10.1039/C4DT02949F | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | TriMPEG | C[n+]1ccc(-c2c3nc(c(-c4ccc(C(=O)NCCOCCOCCN=[N+]=[N-])cc4)c4ccc([nH]4)c(-c4cc[n+](C)cc4)c4ccc([nH]4)c(-c4cc[n+](C)cc4)c4nc2C=C4)C=C3)cc1 | ligand | Ga | null | 5 | figure 3 | 4 | table 3 (caption) | null | null |
price2016 | 10.1039/c5dt04706d | 10.1007/s13139-011-0109-5 | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | TFPP | Fc1c(F)c(F)c(-c2c3nc(c(-c4c(F)c(F)c(F)c(F)c4F)c4ccc([nH]4)c(-c4c(F)c(F)c(F)c(F)c4F)c4nc(c(-c5c(F)c(F)c(F)c(F)c5F)c5ccc2[nH]5)C=C4)C=C3)c(F)c1F | ligand | Ga | null | 5 | figure 3 | 4 | table 3 (caption) | null | null |
price2016 | 10.1039/c5dt04706d | 10.1002/jlcr.3286 | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | FSC | CC1=CC(=O)N(O)CCCC(N)C(=O)OCCC(C)=CC(=O)N(O)CCCC(N)C(=O)OCCC(C)=CC(=O)N(O)CCCC(N)C(=O)OCC1 | ligand | Ga | null | 5 | figure 3 | 4 | table 3 (caption) | null | null |
price2016 | 10.1039/c5dt04706d | 10.2967/jnumed.109.072462 | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | TAFC | CC(=O)NC1CCCN(O)C(=O)C=C(C)CCOC(=O)C(NC(C)=O)CCCN(O)C(=O)C=C(C)CCOC(=O)C(NC(C)=O)CCCN(O)C(=O)C=C(C)CCOC1=O | ligand | Ga | null | 5 | figure 3 | 4 | table 3 (caption) | null | null |
price2016 | 10.1039/c5dt04706d | 10.1016/j.nucmedbio.2011.09.012 | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | FOXE | O=C1CCC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCN1 | ligand | Ga | null | 5 | figure 3 | 4 | table 3 (caption) | null | null |
price2016 | 10.1039/c5dt04706d | 10.1021/ja106399h | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | H2dedpa | O=C(O)c1cccc(CNCCNCc2cccc(C(=O)O)n2)n1 | ligand | Ga | 28,11 | 7 | figure 4 | 4 | table 3 (caption) | 9 | table 5 |
price2016 | 10.1039/c5dt04706d | 10.1021/ic502942a | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | H2CHXdedpa | O=C(O)c1cccc(CNC2CCCCC2NCc2cccc(C(=O)O)n2)n1 | ligand | Ga | 27,61 | 7 | figure 4 | 4 | table 3 (caption) | 9 | table 5 |
price2016 | 10.1039/c5dt04706d | 10.1021/ja106399h | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | H2azapa | O=C(O)c1cccc(CN(CCN(Cc2cn(Cc3ccccc3)nn2)Cc2cccc(C(=O)O)n2)Cc2cn(Cc3ccccc3)nn2)n1 | ligand | Ga | null | 7 | figure 4 | 4 | table 3 (caption) | null | null |
price2016 | 10.1039/c5dt04706d | 10.1021/ic502942a | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | H4AAZTA | CC1(N(CC(=O)O)CC(=O)O)CN(CC(=O)O)CCN(CC(=O)O)C1 | ligand | Ga | 22,2 | 7 | figure 4 | 4 | table 3 (caption) | 9 | table 5 |
price2016 | 10.1039/c5dt04706d | 10.1002/cmdc.201500092 | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | DATAM | CN(CC(=O)O)C1(C)CN(CC(=O)O)CCN(CC(=O)O)C1 | ligand | Ga | null | 7 | figure 4 | 4 | table 3 (caption) | null | null |
price2016 | 10.1039/c5dt04706d | 10.1002/cmdc.201500092 | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | DATAP | CC(NC1(C)CN(C(C)C(=O)O)CCN(C(C)C(=O)O)C1)C(=O)O | ligand | Ga | null | 7 | figure 4 | 4 | table 3 (caption) | null | null |
price2016 | 10.1039/c5dt04706d | 10.1002/cmdc.201500092 | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | DATAPh | O=C(O)CNC1(c2ccccc2)CN(CC(=O)O)CCN(CC(=O)O)C1 | ligand | Ga | null | 7 | figure 4 | 4 | table 3 (caption) | null | null |
price2016 | 10.1039/c5dt04706d | 10.1002/cmdc.201500092 | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | DATAPPh | CC(NC1(c2ccccc2)CN(C(C)C(=O)O)CCN(C(C)C(=O)O)C1)C(=O)O | ligand | Ga | null | 7 | figure 4 | 4 | table 3 (caption) | null | null |
price2016 | 10.1039/c5dt04706d | 10.1039/C4DT02274B | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | H2LpzNH | Oc1ccccc1CNCN(CCn1cccn1)CNCc1ccccc1O | ligand | Ga | null | 7 | figure 4 | 4 | table 3 (caption) | null | null |
price2016 | 10.1039/c5dt04706d | 10.1039/C4DT02274B | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | H2LpyNH | Oc1ccccc1CNCN(CNCc1ccccc1O)Cc1ccccn1 | ligand | Ga | null | 7 | figure 4 | 4 | table 3 (caption) | null | null |
price2016 | 10.1039/c5dt04706d | 10.1039/C1CC12123E | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | CP256 | CC(=O)NC(CCC(=O)NCc1c(O)c(=O)cc(C)n1C)(CCC(=O)NCc1c(O)c(=O)cc(C)n1C)CCC(=O)NCc1c(O)c(=O)cc(C)n1C | ligand | Ga | null | 7 | figure 4 | 4 | table 3 (caption) | null | null |
price2016 | 10.1039/c5dt04706d | 10.1039/C1DT10126A | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | H2ATSM | CNC(S)=NN=C(C)C(C)=NN=C(S)NC | ligand | Ga | null | 7 | figure 4 | 4 | table 3 (caption) | null | null |
price2016 | 10.1039/c5dt04706d | 10.1039/C1DT10126A | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | H2ATSMNa | CNC(S)=NN=C1C(=NN=C(S)NC)c2cccc3cccc1c23 | ligand | Ga | null | 7 | figure 4 | 4 | table 3 (caption) | null | null |
price2016 | 10.1039/c5dt04706d | 10.1007/s11307-014-0750-3 | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | BADED-2 | COc1cccc(C=NCC(C)(C)CN2CCN(CC(C)(C)CN=Cc3cccc(OC)c3O)C2c2cccc(OC)c2O)c1O | ligand | Ga | null | 7 | figure 4 | 4 | table 3 (caption) | null | null |
price2016 | 10.1039/c5dt04706d | 10.1007/s11307-014-0750-3 | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | BADED-3 | CC(C)(CN=Cc1cc(Br)ccc1O)CN1CCN(CC(C)(C)CN=Cc2cc(Br)ccc2O)C1c1cc(Br)ccc1O | ligand | Ga | null | 7 | figure 4 | 4 | table 3 (caption) | null | null |
price2016 | 10.1039/c5dt04706d | 10.1007/s11307-014-0750-3 | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | BADED-4 | CC(C)(CN=Cc1ccccc1O)CN1CCN(CC(C)(C)CN=Cc2ccccc2O)C1c1ccccc1O | ligand | Ga | null | 7 | figure 4 | 4 | table 3 (caption) | null | null |
price2016 | 10.1039/c5dt04706d | 10.1007/s11307-014-0750-3 | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | BADED-5 | CCOc1cccc(C=NCC(C)(C)CN2CCN(CC(C)(C)CN=Cc3cccc(OCC)c3O)C2c2cccc(OCC)c2O)c1O | ligand | Ga | null | 7 | figure 4 | 4 | table 3 (caption) | null | null |
price2016 | 10.1039/c5dt04706d | 10.1007/s11307-014-0750-3 | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | BADED-6 | CC(C)(CN=Cc1cc([N+](=O)[O-])ccc1O)CN1CCN(CC(C)(C)CN=Cc2cc([N+](=O)[O-])ccc2O)C1c1cc([N+](=O)[O-])ccc1O | ligand | Ga | null | 7 | figure 4 | 4 | table 3 (caption) | null | null |
price2016 | 10.1039/c5dt04706d | 10.1007/s11307-014-0750-3 | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | BADED-7 | CCN(CC)c1cccc(C=NCC(C)(C)CN2CCN(CC(C)(C)CN=Cc3cccc(N(CC)CC)c3O)C2c2cccc(N(CC)CC)c2O)c1O | ligand | Ga | null | 7 | figure 4 | 4 | table 3 (caption) | null | null |
price2016 | 10.1039/c5dt04706d | 10.1007/s11307-014-0750-3 | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | BADED-8 | COc1cc(Br)cc(C=NCC(C)(C)CN2CCN(CC(C)(C)CN=Cc3cc(Br)cc(OC)c3O)C2c2cc(Br)cc(OC)c2O)c1O | ligand | Ga | null | 7 | figure 4 | 4 | table 3 (caption) | null | null |
price2016 | 10.1039/c5dt04706d | 10.1007/s11307-014-0750-3 | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | BADED-9 | CC(C)(CN=Cc1cc(C(C)(C)C)ccc1O)CN1CCN(CC(C)(C)CN=Cc2cc(C(C)(C)C)ccc2O)C1c1cc(C(C)(C)C)ccc1O | ligand | Ga | null | 7 | figure 4 | 4 | table 3 (caption) | null | null |
price2016 | 10.1039/c5dt04706d | 10.1007/s11307-010-0410-1 | 0 | Current advances in ligand design for inorganic positron emission tomography tracers <sup>68</sup>Ga, <sup>64</sup>Cu, <sup>89</sup>Zr and <sup>44</sup>Sc | Royal Society of Chemistry (RSC) | 2,016 | 0 | null | MFL3MZ | CC(C)(CN=Cc1cc(C(C)(C)C)cc(C(C)(C)C)c1O)CN1CCN(CC(C)(C)CN=Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2O)C1c1cc(C(C)(C)C)cc(C(C)(C)C)c1O | ligand | Ga | null | 7 | figure 4 | 4 | table 3 (caption) | null | null |
uzal2022 | 10.1016/j.ccr.2022.214606 | 10.1002/ejic.200901261 | 0 | Prediction of Gd(III) complex thermodynamic stability | Elsevier BV | 2,022 | 1 | A1 | H5DTPA | O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CCN(CC(=O)O)CC(=O)O | ligand | Gd | 22,03 | 3 | figure 1 | 1 | title | 4 | table 1 |
uzal2022 | 10.1016/j.ccr.2022.214606 | 10.1002/mrm.1910080208 | 0 | Prediction of Gd(III) complex thermodynamic stability | Elsevier BV | 2,022 | 1 | A1 | null | O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CCN(CC(=O)O)CC(=O)O | ligand | Gd | 22,26 | 3 | figure 1 | 1 | title | 4 | table 1 |
uzal2022 | 10.1016/j.ccr.2022.214606 | 10.1016/0022-1902(62)80236-x | 0 | Prediction of Gd(III) complex thermodynamic stability | Elsevier BV | 2,022 | 1 | A1 | null | O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CCN(CC(=O)O)CC(=O)O | ligand | Gd | 22,46 | 3 | figure 1 | 1 | title | 4 | table 1 |
uzal2022 | 10.1016/j.ccr.2022.214606 | 10.1016/S0010-8545(99)00237-4 | 0 | Prediction of Gd(III) complex thermodynamic stability | Elsevier BV | 2,022 | 1 | A2 | null | O=C(O)CCC(C(=O)O)N(CCN(CC(=O)O)CC(=O)O)CCN(CC(=O)O)CC(=O)O | ligand | Gd | 21,66 | 3 | figure 1 | 1 | title | 4 | table 1 |
uzal2022 | 10.1016/j.ccr.2022.214606 | 10.1016/S0010-8545(99)00237-4 | 0 | Prediction of Gd(III) complex thermodynamic stability | Elsevier BV | 2,022 | 1 | A3 | null | O=C(O)CN(CCN(CCN(CC(=O)O)CC(=O)O)C(COCc1ccccc1)C(=O)O)CC(=O)O | ligand | Gd | 22,23 | 3 | figure 1 | 1 | title | 4 | table 1 |
uzal2022 | 10.1016/j.ccr.2022.214606 | 10.1021/jm9602118 | 0 | Prediction of Gd(III) complex thermodynamic stability | Elsevier BV | 2,022 | 1 | A4 | null | Nc1ccc(CC(C(=O)O)N(CCN(CC(=O)O)CC(=O)O)CCN(CC(=O)O)CC(=O)O)cc1 | ligand | Gd | 22 | 3 | figure 1 | 1 | title | 4 | table 1 |
uzal2022 | 10.1016/j.ccr.2022.214606 | 10.1021/ic800512k | 0 | Prediction of Gd(III) complex thermodynamic stability | Elsevier BV | 2,022 | 1 | A5 | null | CN(CCN(CC(=O)O)CC(=O)O)CCN(CC(=O)O)CC(=O)O | ligand | Gd | 18,6 | 3 | figure 1 | 1 | title | 4 | table 1 |
uzal2022 | 10.1016/j.ccr.2022.214606 | 10.1021/ic00212a005 | 0 | Prediction of Gd(III) complex thermodynamic stability | Elsevier BV | 2,022 | 1 | A6 | null | CCN(CCN(CC(=O)O)CC(=O)O)CCN(CC(=O)O)CC(=O)O | ligand | Gd | 17,79 | 3 | figure 1 | 1 | title | 4 | table 1 |
uzal2022 | 10.1016/j.ccr.2022.214606 | 10.1002/cmmi.131 | 0 | Prediction of Gd(III) complex thermodynamic stability | Elsevier BV | 2,022 | 1 | A7 | null | O=C(O)CN(CCN(CCN(CC(=O)O)CC(=O)O)CP(=O)(O)O)CC(=O)O | ligand | Gd | 22,79 | 3 | figure 1 | 1 | title | 4 | table 1 |
uzal2022 | 10.1016/j.ccr.2022.214606 | 10.1002/cmmi.131 | 0 | Prediction of Gd(III) complex thermodynamic stability | Elsevier BV | 2,022 | 1 | A8 | null | NCCC(N(CCN(CC(=O)O)CC(=O)O)CCN(CC(=O)O)CC(=O)O)P(=O)(O)O | ligand | Gd | 22,34 | 3 | figure 1 | 1 | title | 4 | table 1 |
uzal2022 | 10.1016/j.ccr.2022.214606 | 10.1039/b005298l | 0 | Prediction of Gd(III) complex thermodynamic stability | Elsevier BV | 2,022 | 1 | A9 | null | CNC(=O)CN(CCN(CC(=O)O)CC(=O)O)CCN(CC(=O)O)CC(=O)O | ligand | Gd | 19,9 | 3 | figure 1 | 1 | title | 4 | table 1 |
uzal2022 | 10.1016/j.ccr.2022.214606 | 10.1016/S0277-5387(00)00502-7 | 0 | Prediction of Gd(III) complex thermodynamic stability | Elsevier BV | 2,022 | 1 | A10 | null | O=C(O)CN(CCN(CCN(CC(=O)O)CC(=O)O)Cc1ccccn1)CC(=O)O | ligand | Gd | 21,59 | 3 | figure 1 | 1 | title | 4 | table 1 |
uzal2022 | 10.1016/j.ccr.2022.214606 | 10.1016/S0010-8545(99)00237-4 | 0 | Prediction of Gd(III) complex thermodynamic stability | Elsevier BV | 2,022 | 1 | A11 | null | O=C(O)CN(CCN(CC(=O)O)C(COCc1ccccc1)C(=O)O)CCN(CC(=O)O)C(COCc1ccccc1)C(=O)O | ligand | Gd | 21,72 | 3 | figure 1 | 1 | title | 4 | table 1 |
uzal2022 | 10.1016/j.ccr.2022.214606 | 10.1002/mrm.1910080208 | 0 | Prediction of Gd(III) complex thermodynamic stability | Elsevier BV | 2,022 | 1 | A12 | null | CCCOC(=O)CN(CCN(CCN(CC(=O)O)CC(=O)OCCC)CC(=O)O)CC(=O)O | ligand | Gd | 16,03 | 3 | figure 1 | 1 | title | 4 | table 1 |
uzal2022 | 10.1016/j.ccr.2022.214606 | 10.1021/ic00110a019 | 0 | Prediction of Gd(III) complex thermodynamic stability | Elsevier BV | 2,022 | 1 | A13 | null | CN(CCN(CCN(C)CC(=O)O)CC(=O)O)CC(=O)O | ligand | Gd | 13,12 | 3 | figure 1 | 1 | title | 4 | table 1 |
uzal2022 | 10.1016/j.ccr.2022.214606 | 10.1039/B514173G | 0 | Prediction of Gd(III) complex thermodynamic stability | Elsevier BV | 2,022 | 1 | A14 | null | NC(=O)CN(CCN(CCN(CC(N)=O)CC(=O)O)CC(=O)O)CC(=O)O | ligand | Gd | 14,6 | 3 | figure 1 | 1 | title | 4 | table 1 |
uzal2022 | 10.1016/j.ccr.2022.214606 | 10.1097/00004424-199111001-00077 | 0 | Prediction of Gd(III) complex thermodynamic stability | Elsevier BV | 2,022 | 1 | A15 | H3DTPA-BMEA | COCCNC(=O)CN(CCN(CCN(CC(=O)O)CC(=O)NCCOC)CC(=O)O)CC(=O)O | ligand | Gd | 16,84 | 3 | figure 1 | 1 | title | 4 | table 1 |
uzal2022 | 10.1016/j.ccr.2022.214606 | 10.1002/chem.201405967 | 0 | Prediction of Gd(III) complex thermodynamic stability | Elsevier BV | 2,022 | 1 | A16 | H3DTPA-BMA | CNC(=O)CN(CCN(CCN(CC(=O)O)CC(=O)NC)CC(=O)O)CC(=O)O | ligand | Gd | 16,72 | 3 | figure 1 | 1 | title | 4 | table 1 |
uzal2022 | 10.1016/j.ccr.2022.214606 | 10.1016/0730-725X(90)90055-7 | 0 | Prediction of Gd(III) complex thermodynamic stability | Elsevier BV | 2,022 | 1 | A16 | H3DTPA-BMA | CNC(=O)CN(CCN(CCN(CC(=O)O)CC(=O)NC)CC(=O)O)CC(=O)O | ligand | Gd | 16,85 | 3 | figure 1 | 1 | title | 4 | table 1 |
uzal2022 | 10.1016/j.ccr.2022.214606 | 10.1002/mrm.1910080208 | 0 | Prediction of Gd(III) complex thermodynamic stability | Elsevier BV | 2,022 | 1 | A17 | H3DTPA-BPA | CCCNC(=O)CN(CCN(CCN(CC(=O)O)CC(=O)NCCC)CC(=O)O)CC(=O)O | ligand | Gd | 16,23 | 3 | figure 1 | 1 | title | 4 | table 1 |
uzal2022 | 10.1016/j.ccr.2022.214606 | 10.1039/B514173G | 0 | Prediction of Gd(III) complex thermodynamic stability | Elsevier BV | 2,022 | 1 | A18 | null | CCCCNC(=O)CN(CCN(CCN(CC(=O)O)CC(=O)NCCCC)CC(=O)O)CC(=O)O | ligand | Gd | 16,5 | 3 | figure 1 | 1 | title | 4 | table 1 |
uzal2022 | 10.1016/j.ccr.2022.214606 | 10.1021/acs.inorgchem.6b02158 | 0 | Prediction of Gd(III) complex thermodynamic stability | Elsevier BV | 2,022 | 1 | A19 | null | CCOC(=O)CNC(=O)CN(CCN(CCN(CC(=O)O)CC(=O)NCC(=O)OCC)CC(=O)O)CC(=O)O | ligand | Gd | 16,7 | 3 | figure 1 | 1 | title | 4 | table 1 |
uzal2022 | 10.1016/j.ccr.2022.214606 | 10.1021/acs.inorgchem.6b02158 | 0 | Prediction of Gd(III) complex thermodynamic stability | Elsevier BV | 2,022 | 1 | A20 | null | O=C(O)CNC(=O)CN(CCN(CCN(CC(=O)O)CC(=O)NCC(=O)O)CC(=O)O)CC(=O)O | ligand | Gd | 16,17 | 3 | figure 1 | 1 | title | 4 | table 1 |
uzal2022 | 10.1016/j.ccr.2022.214606 | 10.1097/00004424-199111001-00077 | 0 | Prediction of Gd(III) complex thermodynamic stability | Elsevier BV | 2,022 | 1 | A21 | null | COCCN(C)C(=O)CN(CCN(CCN(CC(=O)O)CC(=O)N(C)CCOC)CC(=O)O)CC(=O)O | ligand | Gd | 17,68 | 3 | figure 1 | 1 | title | 4 | table 1 |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.