pdf string | doi string | doi_sourse string | supplementary int64 | title string | publisher string | year int64 | access int64 | compound_id string | compound_name string | SMILES string | SMILES_type string | metal string | target string | page_smiles int64 | origin_smiles string | page_metal int64 | origin_metal string | page_target_value float64 | origin_target_value string |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
sarbisheh2019 | 10.1007/978-3-319-98947-1_20 | 10.1007/978-3-319-98947-1_20 | 0 | The Radiopharmaceutical Chemistry of the Radioisotopes of Lutetium and Yttrium | Springer International Publishing | 2,019 | 0 | 3d | p-SCN-Bn-CHX-A''-DTPA | O=C(O)CN(CC(=O)O)C(Cc1ccc(N=C=S)cc1)CN(CC(=O)O)C1CCCCC1N(CC(=O)O)CC(=O)O | ligand | Lu | null | 6 | figure 3 | 3 | subtitle | null | null |
sarbisheh2019 | 10.1007/978-3-319-98947-1_20 | 10.1007/978-3-319-98947-1_20 | 0 | The Radiopharmaceutical Chemistry of the Radioisotopes of Lutetium and Yttrium | Springer International Publishing | 2,019 | 0 | null | CHX-A′-DTPA | O=C(O)CN(CC(=O)O)C(Cc1ccc(N=C=S)cc1)CN(CC(=O)O)C1CCCCC1N(CC(=O)O)CC(=O)O | ligand | Lu | null | 7 | figure 4 | 3 | subtitle | null | null |
sarbisheh2019 | 10.1007/978-3-319-98947-1_20 | 10.1007/978-3-319-98947-1_20 | 0 | The Radiopharmaceutical Chemistry of the Radioisotopes of Lutetium and Yttrium | Springer International Publishing | 2,019 | 0 | null | CHX-A′′-DTPA | O=C(O)CN(CC(=O)O)C(Cc1ccc(N=C=S)cc1)CN(CC(=O)O)C1CCCCC1N(CC(=O)O)CC(=O)O | ligand | Lu | null | 7 | figure 4 | 3 | subtitle | null | null |
sarbisheh2019 | 10.1007/978-3-319-98947-1_20 | 10.1007/978-3-319-98947-1_20 | 0 | The Radiopharmaceutical Chemistry of the Radioisotopes of Lutetium and Yttrium | Springer International Publishing | 2,019 | 0 | null | CHX-B′-DTPA | O=C(O)CN(CC(=O)O)C(Cc1ccc(N=C=S)cc1)CN(CC(=O)O)C1CCCCC1N(CC(=O)O)CC(=O)O | ligand | Lu | null | 7 | figure 4 | 3 | subtitle | null | null |
sarbisheh2019 | 10.1007/978-3-319-98947-1_20 | 10.1007/978-3-319-98947-1_20 | 0 | The Radiopharmaceutical Chemistry of the Radioisotopes of Lutetium and Yttrium | Springer International Publishing | 2,019 | 0 | null | CHX-B′′-DTPA | O=C(O)CN(CC(=O)O)C(Cc1ccc(N=C=S)cc1)CN(CC(=O)O)C1CCCCC1N(CC(=O)O)CC(=O)O | ligand | Lu | null | 7 | figure 4 | 3 | subtitle | null | null |
sarbisheh2019 | 10.1007/978-3-319-98947-1_20 | 10.1007/978-3-319-98947-1_20 | 0 | The Radiopharmaceutical Chemistry of the Radioisotopes of Lutetium and Yttrium | Springer International Publishing | 2,019 | 0 | null | 1B4M-DTPA | CC(CN(CC(=O)O)CC(Cc1ccc(N=C=S)cc1)N(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O | ligand | Lu | null | 7 | figure 4 | 3 | subtitle | null | null |
sarbisheh2019 | 10.1007/978-3-319-98947-1_20 | 10.1007/978-3-319-98947-1_20 | 0 | The Radiopharmaceutical Chemistry of the Radioisotopes of Lutetium and Yttrium | Springer International Publishing | 2,019 | 0 | null | DTPA | CC(CN(CC(=O)O)CC(Cc1ccc(N=C=S)cc1)N(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O | ligand | Lu | null | 7 | figure 4 | 3 | subtitle | null | null |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.