Dataset Viewer
Auto-converted to Parquet Duplicate
CID
int64
1
147M
SMILES
stringlengths
2
1.55k
description
stringlengths
188
1.47k
sequence
stringlengths
89
34.2k
129,626,631
CCCCC[C@H]1[C@H](O1)/C=C/C(C/C=C\\C/C=C\\CCCC(=O)[O-])O
This is a description of a molecule: The molecule is an epoxy(hydroxy)icosatrienoate that is the conjugate base of 11 hydroxy-(14R,15S)-epoxy-(5Z,8Z,12E)-icosatrienoic acid, obtained by deprotonation of the carboxy group; major species at pH 7.3. It is a conjugate base of an 11 hydroxy-(14R,15S)-epoxy-(5Z,8Z,12E)-icosa...
<graph>g_359molecule#node#0#5molecule#edge#0g_360molecule#node#0#5molecule#edge#0#0g_361molecule#node#0#5molecule#edge#0#0g_360molecule#node#0#5molecule#edge#0#0g_359molecule#node#0#5molecule#edge#0#0g_362molecule#node#0#5molecule#edge#0#0g_363molecule#node#0#5molecule#edge#0#0g_364molecule#node#0#5molecule#edge#0#0g_3...
10,906,239
CC(=O)O[C@@H]1C[C@@H]2[C@](C=CC(=O)C2(C)C)([C@@H]3[C@@]1(C4=CC[C@H]([C@@]4(CC3)C)C5=COC=C5)C)C
This is a description of a molecule: The molecule is a tetracyclic triterpenoid that is 4,4,8-trimethylandrosta-1,14-diene substituted by an oxo group at position 3, an acetoxy group at position 7 and a furan-3-yl group at position 17. Isolated from Azadirachta indica, it exhibits antiplasmodial and antineoplastic acti...
<graph>g_281molecule#node#0#5molecule#edge#0g_282molecule#node#0#5molecule#edge#0#0g_283molecule#node#0#5molecule#edge#0#0g_284molecule#node#0#5molecule#edge#0#0g_285molecule#node#0#5molecule#edge#0#0g_286molecule#node#0#7molecule#edge#0#0g_287molecule#node#0#5molecule#edge#0#0g_288molecule#node#0#5molecule#edge#0#0g_2...
12,699
CN(C(=O)N)N=O
This is a description of a molecule: The molecule is a member of the class of N-nitrosoureas that is urea in which one of the nitrogens is substituted by methyl and nitroso groups. It has a role as a carcinogenic agent, a mutagen, a teratogenic agent and an alkylating agent. Generate this molecule graph between <graph>...
<graph>g_293molecule#node#0#6molecule#edge#0g_294molecule#node#0#6molecule#edge#0#0g_295molecule#node#0#5molecule#edge#0#0g_294molecule#node#0#6molecule#edge#0#0g_296molecule#node#0#5molecule#edge#0#0g_297molecule#node#0#7molecule#edge#0#1g_296molecule#node#0#5molecule#edge#0#1g_298molecule#node#0#6molecule#edge#0#0g_2...
636,970
C1=CC=C2C(=C1)C(=CN2)C3=NC=CS3
This is a description of a molecule: The molecule is an indole phytoalexin that is indole substituted at position 3 by a 1,3-thiazol-2-yl group. It has a role as a metabolite. It is an indole phytoalexin and a member of 1,3-thiazoles. Generate this molecule graph between <graph> </graph>:
<graph>g_396molecule#node#0#5molecule#edge#0g_397molecule#node#0#5molecule#edge#0#3g_398molecule#node#0#5molecule#edge#0#3g_399molecule#node#0#5molecule#edge#0#3g_400molecule#node#0#5molecule#edge#0#3g_401molecule#node#0#5molecule#edge#0#3g_400molecule#node#0#5molecule#edge#0#3g_402molecule#node#0#6molecule#edge#0#3g_4...
45,266,651
C([C@@H]1[C@H]([C@H](C(O1)NC(=O)C[NH3+])O)O)OP(=O)([O-])[O-]
This is a description of a molecule: The molecule is conjugate base of N(1)-(5-phospho-D-ribosyl)glycinamide. It has a role as a human metabolite and a Saccharomyces cerevisiae metabolite. It is a conjugate base of a N(1)-(5-phospho-D-ribosyl)glycinamide. Generate this molecule graph between <graph> </graph>:
<graph>g_145molecule#node#0#6molecule#edge#0g_146molecule#node#0#5molecule#edge#0#0g_147molecule#node#0#5molecule#edge#0#0g_148molecule#node#0#6molecule#edge#0#0g_149molecule#node#0#5molecule#edge#0#0g_150molecule#node#0#5molecule#edge#0#0g_151molecule#node#0#7molecule#edge#0#0g_150molecule#node#0#5molecule#edge#0#0g_1...
65,127
C([C@@H]1[C@H]([C@@H]([C@@H](C(O1)O)O)O)O)OP(=O)(O)O
This is a description of a molecule: The molecule is the pyranose form of D-mannose 6-phosphate. It is a D-mannose 6-phosphate and a D-hexopyranose 6-phosphate. It is a conjugate acid of a D-mannopyranose 6-phosphate(2-). Generate this molecule graph between <graph> </graph>:
<graph>g_228molecule#node#0#5molecule#edge#0g_229molecule#node#0#5molecule#edge#0#0g_230molecule#node#0#7molecule#edge#0#0g_229molecule#node#0#5molecule#edge#0#0g_231molecule#node#0#5molecule#edge#0#0g_232molecule#node#0#7molecule#edge#0#0g_231molecule#node#0#5molecule#edge#0#0g_233molecule#node#0#5molecule#edge#0#0g_2...
53,354,913
COC1=CC(=O)[C@@]2(C[C@]1([C@H](C3=CC(=C(C=C32)OC)O)C=C)OC)O
This is a description of a molecule: The molecule is an organic heterotricyclic compound found in Pterocarpus santalinus. It has a role as a metabolite and a plant metabolite. It is an organic heterotricyclic compound, an aromatic ether, a cyclic ketone, a member of phenols, a tertiary alcohol and a tertiary alpha-hydr...
<graph>g_36molecule#node#0#5molecule#edge#0g_37molecule#node#0#7molecule#edge#0#0g_38molecule#node#0#5molecule#edge#0#0g_37molecule#node#0#7molecule#edge#0#0g_36molecule#node#0#5molecule#edge#0#0g_39molecule#node#0#5molecule#edge#0#1g_40molecule#node#0#5molecule#edge#0#0g_41molecule#node#0#7molecule#edge#0#1g_40molecul...
12,620
CCCCCCCCCCCCCCCCCCCCCCO
This is a description of a molecule: The molecule is a long-chain primary fatty alcohol that is docosane substituted by a hydroxy group at position 1. It has a role as an antiviral agent. It is a long-chain primary fatty alcohol and a fatty alcohol 22:0. It derives from a hydride of a docosane. Generate this molecule g...
<graph>g_296molecule#node#0#5molecule#edge#0g_297molecule#node#0#5molecule#edge#0#0g_298molecule#node#0#5molecule#edge#0#0g_299molecule#node#0#5molecule#edge#0#0g_300molecule#node#0#5molecule#edge#0#0g_301molecule#node#0#5molecule#edge#0#0g_302molecule#node#0#5molecule#edge#0#0g_303molecule#node#0#5molecule#edge#0#0g_3...
45,109,803
C([C@@H]1[C@H]([C@@H](C(O1)(CO)OP(=O)(O)O)O)O)OP(=O)(O)O
This is a description of a molecule: The molecule is a ketohexose bisphosphate that is D-fructofuranose carrying phosphate groups at positions 2 and 6. It derives from a D-fructofuranose. Generate this molecule graph between <graph> </graph>:
<graph>g_134molecule#node#0#7molecule#edge#0g_135molecule#node#0#5molecule#edge#0#0g_136molecule#node#0#5molecule#edge#0#0g_137molecule#node#0#5molecule#edge#0#0g_138molecule#node#0#7molecule#edge#0#0g_137molecule#node#0#5molecule#edge#0#0g_139molecule#node#0#5molecule#edge#0#0g_140molecule#node#0#7molecule#edge#0#0g_1...
441,006
C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)OP(=O)(O)OC4[C@H]([C@H]([C@@H]([C@H](O4)[C@@H](CO)O)O)O)O)O)O)N
This is a description of a molecule: The molecule is an ADP-glycero-D-manno-heptose. It has a role as an Escherichia coli metabolite. It is a conjugate acid of an ADP-D-glycero-D-manno-heptose(2-). Generate this molecule graph between <graph> </graph>:
<graph>g_477molecule#node#0#7molecule#edge#0g_478molecule#node#0#14molecule#edge#0#0g_479molecule#node#0#7molecule#edge#0#0g_480molecule#node#0#14molecule#edge#0#0g_481molecule#node#0#7molecule#edge#0#0g_482molecule#node#0#5molecule#edge#0#0g_483molecule#node#0#5molecule#edge#0#0g_484molecule#node#0#5molecule#edge#0#0g...
11,954,133
C1=CC(=C2C3=C(C(=C(C=C3)Cl)Cl)OC2=C1)O
This is a description of a molecule: The molecule is a member of the class of dibenzofurans that is dibenzo[b,d]furan substituted by a hydroxy group at position 1 and chloro groups at positions 6 and 7. It is a member of dibenzofurans, an organochlorine compound and a member of phenols. It derives from a hydride of a d...
<graph>g_100molecule#node#0#5molecule#edge#0g_101molecule#node#0#5molecule#edge#0#3g_102molecule#node#0#5molecule#edge#0#3g_103molecule#node#0#7molecule#edge#0#0g_102molecule#node#0#5molecule#edge#0#0g_104molecule#node#0#5molecule#edge#0#3g_105molecule#node#0#5molecule#edge#0#3g_106molecule#node#0#5molecule#edge#0#3g_1...
31,155
CC1=CC=CC=C1CC#N
This is a description of a molecule: The molecule is a nitrile that is acetonitrile where one of the methyl hydrogens is substituted by a 2-methylphenyl group. It derives from an acetonitrile. Generate this molecule graph between <graph> </graph>:
<graph>g_399molecule#node#0#5molecule#edge#0g_400molecule#node#0#5molecule#edge#0#0g_399molecule#node#0#5molecule#edge#0#0g_401molecule#node#0#5molecule#edge#0#3g_402molecule#node#0#5molecule#edge#0#3g_403molecule#node#0#5molecule#edge#0#3g_404molecule#node#0#5molecule#edge#0#3g_405molecule#node#0#5molecule#edge#0#3g_4...
6,918,078
CCN(C)C(=O)OC1=CC=CC(=C1)[C@H](C)N(C)C.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O
This is a description of a molecule: The molecule is a tartrate salt obtained by reaction of rivastigmine with one equivalent of (R,R)-tartaric acid. A reversible cholinesterase inhibitor. It has a role as a cholinergic drug, an EC 3.1.1.8 (cholinesterase) inhibitor and a neuroprotective agent. It contains a rivastigmi...
<graph>g_43molecule#node#0#5molecule#edge#0g_44molecule#node#0#5molecule#edge#0#3g_45molecule#node#0#5molecule#edge#0#3g_46molecule#node#0#5molecule#edge#0#3g_47molecule#node#0#7molecule#edge#0#0g_48molecule#node#0#5molecule#edge#0#0g_49molecule#node#0#6molecule#edge#0#0g_50molecule#node#0#5molecule#edge#0#0g_51molecul...
86,289,352
COC1=C(C(=C2C(=C1)OC(=C(C2=O)OC)C3=CC(=C(C=C3)O)O)[O-])O
This is a description of a molecule: The molecule is a flavonoid oxoanion obtained by deprotonation of the 5-hydroxy group of 3',4',5,6-tetrahydroxy-3,7-dimethoxyflavone. It is the major microspecies at pH 7.3 (according to Marvin v 6.2.0.). It is a conjugate base of a 3',4',5,6-tetrahydroxy-3,7-dimethoxyflavone. Gener...
<graph>g_213molecule#node#0#5molecule#edge#0g_214molecule#node#0#5molecule#edge#0#3g_215molecule#node#0#7molecule#edge#0#0g_216molecule#node#0#5molecule#edge#0#0g_215molecule#node#0#7molecule#edge#0#0g_214molecule#node#0#5molecule#edge#0#0g_217molecule#node#0#5molecule#edge#0#3g_218molecule#node#0#5molecule#edge#0#3g_2...
71,768,140
CC1=CN(C(=O)NC1=O)[C@H]2C[C@@H]([C@H](O2)CO)OP(=O)(O)OC[C@@H]3[C@H](C[C@@H](O3)N4C=CC(=NC4=O)N)OP(=O)(O)OC[C@@H]5[C@H](C[C@@H](O5)N6C=NC7=C(N=CN=C76)N)OP(=O)(O)OC[C@@H]8[C@H](C[C@@H](O8)N9C=NC1=C(N=CN=C19)N)OP(=O)(O)OC[C@@H]1[C@H](C[C@@H](O1)N1C=CC(=NC1=O)N)OP(=O)(O)OC[C@@H]1[C@H](C[C@@H](O1)N1C=CC(=NC1=O)N)O
This is a description of a molecule: The molecule is a single-stranded DNA oligonucleotide comprised of two deoxyadenosine, one thymidine and three deoxycytidine residues connected by 3'->5' phosphodiester linkages in the sequence TCAACC. It has a role as an antigen. Generate this molecule graph between <graph> </graph...
<graph>g_479molecule#node#0#7molecule#edge#0g_480molecule#node#0#5molecule#edge#0#0g_481molecule#node#0#5molecule#edge#0#0g_482molecule#node#0#5molecule#edge#0#0g_483molecule#node#0#6molecule#edge#0#0g_484molecule#node#0#5molecule#edge#0#3g_485molecule#node#0#5molecule#edge#0#3g_486molecule#node#0#5molecule#edge#0#0g_4...
23,623,724
C[C@@H](CCCC(=C)C)CCOC(=O)CC1=CC=CC=C1
This is a description of a molecule: The molecule is a carboxylic ester resulting from the formal condensation of phenylacetic acid with (3S)-3,7-dimethyloct-7-en-1-ol. It has a role as a flavouring agent. It is a carboxylic ester and an olefinic compound. It derives from a phenylacetic acid. Generate this molecule gra...
<graph>g_116molecule#node#0#7molecule#edge#0g_117molecule#node#0#5molecule#edge#0#1g_118molecule#node#0#7molecule#edge#0#0g_119molecule#node#0#5molecule#edge#0#0g_120molecule#node#0#5molecule#edge#0#0g_121molecule#node#0#5molecule#edge#0#0g_122molecule#node#0#5molecule#edge#0#0g_121molecule#node#0#5molecule#edge#0#0g_1...
8,914
CCCCCCCCCO
This is a description of a molecule: The molecule is a fatty alcohol consisting of a hydroxy function at C-1 of an unbranched saturated chain of nine carbon atoms. It has been isolated as a component of volatile oils from plants like Hordeum vulgare. It has a role as a plant metabolite and a volatile oil component. It ...
<graph>g_102molecule#node#0#5molecule#edge#0g_103molecule#node#0#5molecule#edge#0#0g_102molecule#node#0#5molecule#edge#0#0g_104molecule#node#0#5molecule#edge#0#0g_105molecule#node#0#5molecule#edge#0#0g_106molecule#node#0#5molecule#edge#0#0g_107molecule#node#0#5molecule#edge#0#0g_108molecule#node#0#5molecule#edge#0#0g_1...
33,360
CCOC1C(C2=C(O1)C=CC(=C2)OS(=O)(=O)C)(C)C
This is a description of a molecule: The molecule is a methanesulfonate ester that is methanesulfonic acid in which the hydrogen of the hydroxy group has been replaced by a 2-ethoxy-3,3-dimethyl-2,3-dihydro-1-benzofuran-5-yl group. It is an ether, a methanesulfonate ester and a member of 1-benzofurans. Generate this mo...
<graph>g_384molecule#node#0#5molecule#edge#0g_385molecule#node#0#5molecule#edge#0#0g_386molecule#node#0#5molecule#edge#0#0g_387molecule#node#0#7molecule#edge#0#0g_388molecule#node#0#5molecule#edge#0#0g_389molecule#node#0#5molecule#edge#0#0g_388molecule#node#0#5molecule#edge#0#0g_387molecule#node#0#7molecule#edge#0#0g_3...
195,429
CCN(CC)C(=O)N1C=NC(=N1)S(=O)(=O)C2=C(C=C(C=C2C)C)C
This is a description of a molecule: The molecule is a member of benzenes, a sulfone and a member of triazoles. It has a role as an antimitotic, a herbicide and an agrochemical. Generate this molecule graph between <graph> </graph>:
<graph>g_123molecule#node#0#5molecule#edge#0g_124molecule#node#0#6molecule#edge#0#3g_125molecule#node#0#5molecule#edge#0#0g_126molecule#node#0#6molecule#edge#0#0g_127molecule#node#0#5molecule#edge#0#0g_128molecule#node#0#5molecule#edge#0#0g_127molecule#node#0#5molecule#edge#0#0g_126molecule#node#0#6molecule#edge#0#0g_1...
122,391,316
CC/C=C\\C/C=C\\C/C=C\\C=C\\C(C/C=C\\C/C=C\\CCC(=O)O)OO
This is a description of a molecule: The molecule is a docosanoid that is (4Z,7Z,11E,13Z,16Z,19Z)-docosahexaenoic acid carrying a hydroperoxy substituent at position 10. It is a docosanoid, a hydroperoxy fatty acid and a long-chain fatty acid. It derives from an all-cis-docosa-4,7,10,13,16,19-hexaenoic acid. It is a co...
<graph>g_445molecule#node#0#5molecule#edge#0g_446molecule#node#0#5molecule#edge#0#1g_447molecule#node#0#5molecule#edge#0#0g_448molecule#node#0#5molecule#edge#0#1g_449molecule#node#0#5molecule#edge#0#0g_450molecule#node#0#5molecule#edge#0#0g_451molecule#node#0#5molecule#edge#0#1g_452molecule#node#0#5molecule#edge#0#0g_4...
527,024
CCC(=O)N(C1CCN(CC1)C)C2=CC=CC=C2
This is a description of a molecule: The molecule is the monocarboxylic acid amide resulting from the formal condensation of the aryl amino group of 1-methyl-N-phenylpiperidin-4-amine with propanoic acid. It is a member of piperidines and a monocarboxylic acid amide. Generate this molecule graph between <graph> </graph...
<graph>g_261molecule#node#0#5molecule#edge#0g_262molecule#node#0#5molecule#edge#0#0g_263molecule#node#0#5molecule#edge#0#0g_264molecule#node#0#7molecule#edge#0#1g_263molecule#node#0#5molecule#edge#0#1g_265molecule#node#0#6molecule#edge#0#0g_266molecule#node#0#5molecule#edge#0#0g_267molecule#node#0#5molecule#edge#0#0g_2...
525
C(C(C(=O)O)O)C(=O)O
This is a description of a molecule: The molecule is a 2-hydroxydicarboxylic acid that is succinic acid in which one of the hydrogens attached to a carbon is replaced by a hydroxy group. It has a role as a food acidity regulator and a fundamental metabolite. It is a 2-hydroxydicarboxylic acid and a C4-dicarboxylic acid...
<graph>g_329molecule#node#0#7molecule#edge#0g_330molecule#node#0#5molecule#edge#0#0g_331molecule#node#0#5molecule#edge#0#0g_332molecule#node#0#5molecule#edge#0#0g_333molecule#node#0#5molecule#edge#0#0g_334molecule#node#0#7molecule#edge#0#1g_333molecule#node#0#5molecule#edge#0#1g_335molecule#node#0#7molecule#edge#0#0g_3...
91,828,206
CC(=O)N[C@@H]1[C@H]([C@@H]([C@H](O[C@H]1NC(=O)C[C@@H](C(=O)O)N)CO)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O[C@H]3[C@H]([C@H]([C@@H]([C@H](O3)CO[C@@H]4[C@H]([C@H]([C@@H]([C@H](O4)CO[C@@H]5[C@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)O)O[C@@H]6[C@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)O)O)O[C@@H]7[C@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)O...
This is a description of a molecule: The molecule is a glucosaminoglycan consisting of L-asparagine having the heptasaccharide alpha-D-Man-(1->3)-[alpha-D-Man-(1->3)-[alpha-D-Man-(1->6)]-alpha-D-Man-(1->6)]-beta-D-Man-(1->4)-beta-D-GlcNAc-(1->4)-beta-D-GlcNAc attached at the N(4)-position It is a N(4)-glycosyl-L-aspara...
<graph>g_306molecule#node#0#5molecule#edge#0g_307molecule#node#0#7molecule#edge#0#0g_308molecule#node#0#5molecule#edge#0#0g_309molecule#node#0#5molecule#edge#0#0g_310molecule#node#0#7molecule#edge#0#0g_309molecule#node#0#5molecule#edge#0#0g_311molecule#node#0#5molecule#edge#0#0g_312molecule#node#0#7molecule#edge#0#0g_3...
20,055,509
CN1[C@@H]2CC(C[C@H]1[C@H]3[C@@H]2O3)OC(=O)[C@H](CO)C4=CC=CC=C4.O.O.O.Br
This is a description of a molecule: The molecule is a hydrate that is the trihydrate form of scopolamine hydrobromide. It has a role as a mydriatic agent, a muscarinic antagonist, an anaesthesia adjuvant, an antispasmodic drug and an antiemetic. It contains a scopolamine hydrobromide (anhydrous). Generate this molecul...
<graph>g_225molecule#node#0#5molecule#edge#0g_226molecule#node#0#5molecule#edge#0#0g_227molecule#node#0#7molecule#edge#0#0g_228molecule#node#0#5molecule#edge#0#0g_229molecule#node#0#5molecule#edge#0#0g_230molecule#node#0#5molecule#edge#0#0g_231molecule#node#0#6molecule#edge#0#0g_232molecule#node#0#5molecule#edge#0#0g_2...
51,644,315
C(=O)([O-])P(=O)(O)[O-]
This is a description of a molecule: The molecule is a organophosphonate oxoanion obtained by deprotonation of the carboxy and one of the ohopsphonate OH groups of phosphonoformic acid. It is the major microspecies at pH 7.3 (according to Marvin v 6.2.0.). It is an organophosphonate oxoanion and a monocarboxylic acid a...
<graph>g_18molecule#node#0#7molecule#edge#0g_19molecule#node#0#5molecule#edge#0#1g_20molecule#node#0#7molecule#edge#0#0g_19molecule#node#0#5molecule#edge#0#0g_21molecule#node#0#14molecule#edge#0#0g_22molecule#node#0#7molecule#edge#0#1g_21molecule#node#0#14molecule#edge#0#1g_23molecule#node#0#7molecule#edge#0#0g_21molec...
11,487
C1=CC=C(C=C1)NC2=CC=CC=C2
This is a description of a molecule: The molecule is an aromatic amine containing two phenyl substituents. It has been used as a fungicide for the treatment of superficial scald in apples and pears, but is no longer approved for this purpose within the European Union. It has a role as a carotogenesis inhibitor, an anti...
<graph>g_73molecule#node#0#5molecule#edge#0g_74molecule#node#0#6molecule#edge#0#0g_75molecule#node#0#5molecule#edge#0#0g_76molecule#node#0#5molecule#edge#0#3g_77molecule#node#0#5molecule#edge#0#3g_78molecule#node#0#5molecule#edge#0#3g_79molecule#node#0#5molecule#edge#0#3g_80molecule#node#0#5molecule#edge#0#3g_75molecul...
20,803
CCN(CC1=CC(=CC=C1)S(=O)(=O)[O-])C2=CC=C(C=C2)C(=C3C=CC(=[N+](CC)CC4=CC(=CC=C4)S(=O)(=O)[O-])C=C3)C5=CC=CC=C5.[Na+]
This is a description of a molecule: The molecule is an organic sodium salt having 3-[(ethyl{4-[(4-{ethyl[(3-sulfonatophenyl)methyl]amino}phenyl)(phenyl)methylidene]cyclohexa-2,5-dien-1-ylidene}azaniumyl)methyl]benzene-1-sulfonate. Used as a substitute for Light green SF yellowish in Masson's trichrome, although it is ...
<graph>g_61molecule#node#0#5molecule#edge#0g_62molecule#node#0#5molecule#edge#0#3g_63molecule#node#0#5molecule#edge#0#0g_64molecule#node#0#5molecule#edge#0#1g_65molecule#node#0#5molecule#edge#0#0g_66molecule#node#0#5molecule#edge#0#1g_67molecule#node#0#5molecule#edge#0#0g_68molecule#node#0#6molecule#edge#0#1g_69molecul...
131,801,253
C[C@H](CCC=C(C)C)[C@H]1CC[C@@]2([C@@]1(C[C@H]([C@@]3([C@H]2CC=C4[C@H]3CC[C@@H](C4(C)C)O)C)O)C)C
This is a description of a molecule: The molecule is a tetracyclic triterpenoid that is 4,9-cyclo-9,10-secocholesta-5,24-diene substituted by methyl groups at positions 9beta, 10, and 14, and by hydroxy groups at positions 1 and 11alpha. It has a role as a plant metabolite. It is a tetracyclic triterpenoid, a secondary...
<graph>g_221molecule#node#0#5molecule#edge#0g_222molecule#node#0#5molecule#edge#0#0g_223molecule#node#0#7molecule#edge#0#0g_222molecule#node#0#5molecule#edge#0#0g_224molecule#node#0#5molecule#edge#0#0g_225molecule#node#0#5molecule#edge#0#0g_226molecule#node#0#5molecule#edge#0#0g_227molecule#node#0#5molecule#edge#0#0g_2...
136,254,572
C1=NC2=C(N1[C@H]3[C@H]4[C@@H]([C@H](O3)COP(=O)(O)O)OP(=O)(O4)O)N=C(NC2=O)N
This is a description of a molecule: The molecule is a 2',3'-cyclic purine nucleotide that is GMP in which the hydroxy groups at the 2' and 3' positions have been converted into the corresponding cyclic phosphate. It is a 2',3'-cyclic purine nucleotide, a guanyl ribonucleotide and a guanosine bisphosphate. It derives f...
<graph>g_148molecule#node#0#6molecule#edge#0g_149molecule#node#0#5molecule#edge#0#3g_150molecule#node#0#6molecule#edge#0#3g_151molecule#node#0#5molecule#edge#0#3g_152molecule#node#0#5molecule#edge#0#3g_151molecule#node#0#5molecule#edge#0#3g_153molecule#node#0#5molecule#edge#0#3g_154molecule#node#0#7molecule#edge#0#1g_1...
50,909,811
C[C@H]1[C@H]([C@H]([C@@H]([C@@H](O1)O[C@H]2[C@@H]([C@@H]([C@@H](O[C@H]2O[C@H]3[C@@H]([C@H](OC([C@@H]3NC(=O)C)O)CO)O[C@H]4[C@@H]([C@H]([C@H]([C@H](O4)CO)O)O)NC(=O)C)C)O)O)O)O)O
This is a description of a molecule: The molecule is a branched amino tetrasaccharide consisting of N-acetyl-glucosamine at the reducing end with an alpha-fucosyl-(1->2)-alpha-fucosyl group attached at the 3-position and an N-acetyl-beta-glucosaminyl residue attached at the 4-position. It has a role as an epitope. It i...
<graph>g_496molecule#node#0#5molecule#edge#0g_497molecule#node#0#5molecule#edge#0#0g_498molecule#node#0#7molecule#edge#0#0g_499molecule#node#0#5molecule#edge#0#0g_500molecule#node#0#5molecule#edge#0#0g_501molecule#node#0#7molecule#edge#0#0g_500molecule#node#0#5molecule#edge#0#0g_502molecule#node#0#5molecule#edge#0#0g_5...
7,439
CC1=CCC(CC1=O)C(=C)C
This is a description of a molecule: The molecule is a p-menthane monoterpenoid that consists of cyclohex-2-enone having methyl and isopropenyl substituents at positions 2 and 5, respectively. It has a role as an allergen. It is a member of carvones and a botanical anti-fungal agent. Generate this molecule graph betwee...
<graph>g_362molecule#node#0#7molecule#edge#0g_363molecule#node#0#5molecule#edge#0#1g_364molecule#node#0#5molecule#edge#0#0g_365molecule#node#0#5molecule#edge#0#0g_364molecule#node#0#5molecule#edge#0#0g_366molecule#node#0#5molecule#edge#0#1g_367molecule#node#0#5molecule#edge#0#0g_368molecule#node#0#5molecule#edge#0#0g_3...
49,787,019
CC1=C(C(=CC2=CC3=C(C(=C12)O)C(=O)[C@@]4(C(=O)C=C([C@H]([C@@]4(C3=O)O)O)OC)O)O)C(=O)OC
This is a description of a molecule: The molecule is a member of the class of tetracenes that is tetracenomycin C in which the methoxy group at position 3 is replaced by a phenolic OH. It has a role as a bacterial metabolite. It is an enol ether, an enone, a triol, a polyphenol, a methyl ester, a tetracenomycin and a t...
<graph>g_131molecule#node#0#7molecule#edge#0g_132molecule#node#0#5molecule#edge#0#0g_133molecule#node#0#5molecule#edge#0#1g_134molecule#node#0#5molecule#edge#0#0g_135molecule#node#0#7molecule#edge#0#1g_134molecule#node#0#5molecule#edge#0#1g_136molecule#node#0#5molecule#edge#0#0g_137molecule#node#0#5molecule#edge#0#0g_1...
3,985
CCCCCCCCCCCCCCCCCCOCC(COP(=O)([O-])OCC[N+](C)(C)C)O
This is a description of a molecule: The molecule is a 1-alkylglycero-3-phosphocholine in which the alkyl group is specified as octadecyl. It has a role as a human metabolite. Generate this molecule graph between <graph> </graph>:
<graph>g_13molecule#node#0#5molecule#edge#0g_14molecule#node#0#7molecule#edge#0#0g_15molecule#node#0#14molecule#edge#0#0g_16molecule#node#0#7molecule#edge#0#0g_17molecule#node#0#5molecule#edge#0#0g_18molecule#node#0#5molecule#edge#0#0g_19molecule#node#0#5molecule#edge#0#0g_20molecule#node#0#7molecule#edge#0#0g_21molecu...
44,259,636
COC1=CC(=C2C(=C1)OC(=C(C2=O)O)C3=CC(=C(C(=C3)O)O)O)O
This is a description of a molecule: The molecule is a monomethoxyflavone that is myricetin in which the hydroxy group at position 7 is substituted by a methoxy group. It has a role as a plant metabolite. It is a pentahydroxyflavone and a monomethoxyflavone. It derives from a myricetin. Generate this molecule graph bet...
<graph>g_144molecule#node#0#5molecule#edge#0g_145molecule#node#0#5molecule#edge#0#3g_146molecule#node#0#5molecule#edge#0#0g_147molecule#node#0#5molecule#edge#0#3g_148molecule#node#0#5molecule#edge#0#3g_149molecule#node#0#7molecule#edge#0#0g_148molecule#node#0#5molecule#edge#0#0g_150molecule#node#0#5molecule#edge#0#3g_1...
439,399
C([C@@H]([C@@H](C(=O)CO)O)O)OP(=O)(O)O
This is a description of a molecule: The molecule is a ribulose 5-phosphate. It has a role as an Escherichia coli metabolite. It derives from a L-ribulose. It is a conjugate acid of a L-ribulose 5-phosphate(2-). Generate this molecule graph between <graph> </graph>:
<graph>g_170molecule#node#0#7molecule#edge#0g_171molecule#node#0#5molecule#edge#0#0g_172molecule#node#0#5molecule#edge#0#0g_173molecule#node#0#5molecule#edge#0#0g_174molecule#node#0#5molecule#edge#0#0g_175molecule#node#0#7molecule#edge#0#1g_174molecule#node#0#5molecule#edge#0#1g_176molecule#node#0#5molecule#edge#0#0g_1...
70,680,285
C([C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)O)O)O)O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)C(=O)O)O)O)O
This is a description of a molecule: The molecule is a glycosylgalactose consisting of beta-D-galactose substituted on O-6 with a beta-D-glucopyranuronosyl (beta-D-glucopyranosyluronic acid) group. It has a role as an epitope. Generate this molecule graph between <graph> </graph>:
<graph>g_12molecule#node#0#5molecule#edge#0g_13molecule#node#0#7molecule#edge#0#0g_14molecule#node#0#5molecule#edge#0#0g_15molecule#node#0#5molecule#edge#0#0g_16molecule#node#0#5molecule#edge#0#0g_17molecule#node#0#7molecule#edge#0#0g_16molecule#node#0#5molecule#edge#0#0g_18molecule#node#0#5molecule#edge#0#0g_19molecul...
132,282,508
C[C@H]1[C@@H](C[C@H]([C@@H](O1)OCCCCC(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)COP(=O)([O-])OP(=O)([O-])OC[C@@H]2[C@H]([C@H]([C@@H](O2)N3C=NC4=C(N=CN=C43)N)O)OP(=O)([O-])[O-])O)O)O
This is a description of a molecule: The molecule is an acyl-CoA(4-) obtained by deprotonation of the phosphate and diphosphate groups of oscr#9-CoA; major species at pH 7.3. It is a conjugate base of an oscr#9-CoA. Generate this molecule graph between <graph> </graph>:
<graph>g_239molecule#node#0#5molecule#edge#0g_240molecule#node#0#5molecule#edge#0#0g_241molecule#node#0#5molecule#edge#0#0g_242molecule#node#0#5molecule#edge#0#0g_243molecule#node#0#5molecule#edge#0#0g_244molecule#node#0#7molecule#edge#0#0g_245molecule#node#0#5molecule#edge#0#0g_246molecule#node#0#5molecule#edge#0#0g_2...
21,580,418
C[C@]12CC=C3[C@]([C@@H]1C[C@@]4(C(=C)[C@]2(C(=O)[C@@](C4=O)(C)O)C(=O)OC)C)([C@@H](CC(=O)C3(C)C)O)C
This is a description of a molecule: The molecule is a meroterpenoid found in Penicillium rubrum and has been shown to exhibit inhibitory activity against caspase-1. It has a role as a cysteine protease inhibitor and a Penicillium metabolite. It is a cyclic terpene ketone, a meroterpenoid, a tertiary alcohol, a carbopo...
<graph>g_345molecule#node#0#5molecule#edge#0g_346molecule#node#0#5molecule#edge#0#0g_347molecule#node#0#5molecule#edge#0#0g_348molecule#node#0#7molecule#edge#0#1g_347molecule#node#0#5molecule#edge#0#1g_349molecule#node#0#5molecule#edge#0#0g_350molecule#node#0#5molecule#edge#0#0g_351molecule#node#0#5molecule#edge#0#0g_3...
13,962,928
COC1=C(C=CC(=C1)/C=C/C(=O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)O
This is a description of a molecule: The molecule is a beta-D-glucoside resulting from the formal condensation of the carboxy group of ferulic acid with the anomeric hydroxy group of beta-D-glucose. It has a role as an antioxidant and a plant metabolite. It is a beta-D-glucoside, a cinnamate ester, a member of phenols ...
<graph>g_507molecule#node#0#5molecule#edge#0g_508molecule#node#0#5molecule#edge#0#0g_509molecule#node#0#5molecule#edge#0#1g_510molecule#node#0#5molecule#edge#0#0g_511molecule#node#0#5molecule#edge#0#3g_0molecule#node#0#5molecule#edge#0#3g_1molecule#node#0#5molecule#edge#0#3g_2molecule#node#0#7molecule#edge#0#0g_1molecu...
5,460,209
C[C@]1(CCC[C@@]2([C@@H]1[C@@H]([C@]34[C@H]2CC[C@](C3)(C(=C)C4)O)C(=O)O)C=O)C(=O)O
This is a description of a molecule: The molecule is a C20-gibberellin. It has a role as a plant metabolite. It is a dicarboxylic acid and a C20-gibberellin. It is a conjugate acid of a gibberellin A19(2-). Generate this molecule graph between <graph> </graph>:
<graph>g_457molecule#node#0#5molecule#edge#0g_458molecule#node#0#5molecule#edge#0#0g_459molecule#node#0#5molecule#edge#0#0g_460molecule#node#0#5molecule#edge#0#0g_461molecule#node#0#5molecule#edge#0#0g_462molecule#node#0#5molecule#edge#0#0g_461molecule#node#0#5molecule#edge#0#0g_463molecule#node#0#5molecule#edge#0#0g_4...
52,931,120
CCCCCCCCCCCCCCCCCCCC(=O)N[C@@H](CO)[C@@H](/C=C/CCCCCCCC/C=C\\CCC)O
This is a description of a molecule: The molecule is a ceramide obtained by formal condensation of the carboxy group of icosanoic acid with the amino group of (4E,14Z)-sphinga-4,14-dienine. It has a role as a Papio hamadryas metabolite. It derives from an icosanoic acid. Generate this molecule graph between <graph> </g...
<graph>g_491molecule#node#0#5molecule#edge#0g_492molecule#node#0#5molecule#edge#0#0g_493molecule#node#0#5molecule#edge#0#0g_494molecule#node#0#5molecule#edge#0#0g_495molecule#node#0#5molecule#edge#0#0g_496molecule#node#0#5molecule#edge#0#0g_497molecule#node#0#5molecule#edge#0#0g_498molecule#node#0#5molecule#edge#0#0g_4...
91,820,488
CC/C(=C\\CC/C(=C/C(=O)[O-])/C)/CC[C@@H]1[C@](O1)(C)CC
This is a description of a molecule: The molecule is a polyunsaturated fatty acid anion that is the conjugate base of juvenile hormone I carboxylic acid, obtained by deprotonation of the carboxy group; major species at pH 7.3. It is a polyunsaturated fatty acid anion and a branched-chain fatty acid anion. It is a conju...
<graph>g_31molecule#node#0#5molecule#edge#0g_32molecule#node#0#5molecule#edge#0#0g_33molecule#node#0#5molecule#edge#0#0g_34molecule#node#0#5molecule#edge#0#1g_35molecule#node#0#5molecule#edge#0#0g_36molecule#node#0#5molecule#edge#0#0g_37molecule#node#0#5molecule#edge#0#0g_38molecule#node#0#5molecule#edge#0#1g_39molecul...
91,828,200
C[C@H]1CC[C@@]2([C@H]3CC[C@@H]4[C@]5(CC[C@@H]([C@@H]5CC[C@]4([C@@]3(CC[C@H]2C1(C)C)C)C)[C@H](C)C[C@H]([C@H]([C@H]([C@H](CN)O)O)O)O)C)C
This is a description of a molecule: The molecule is a member of the class of hopanoids that is bacteriohopane-31,32,33,34-tetrol carrying additional methyl and amino substituents at positions 3 and 35 respectively. Isolated from Methylococcus capsulatus. It has a role as a bacterial metabolite. It is a hopanoid, a tet...
<graph>g_402molecule#node#0#5molecule#edge#0g_403molecule#node#0#5molecule#edge#0#0g_404molecule#node#0#5molecule#edge#0#0g_405molecule#node#0#5molecule#edge#0#0g_406molecule#node#0#5molecule#edge#0#0g_407molecule#node#0#5molecule#edge#0#0g_408molecule#node#0#5molecule#edge#0#0g_409molecule#node#0#5molecule#edge#0#0g_4...
46,174,039
C[C@@H]1[C@H](CC[C@H](O1)OP(=O)(O)OP(=O)(O)OC[C@@H]2[C@H](C[C@@H](O2)N3C=C(C(=O)NC3=O)C)O)N
This is a description of a molecule: The molecule is a pyrimidine nucleotide-sugar having thymine as the nucleobase and 4-amino-2,3,4,6-tetradeoxy-alpha-D-glucose as the sugar component. It has a role as a bacterial metabolite. It is a conjugate acid of a dTDP-4-ammonio-2,3,4,6-tetradeoxy-alpha-D-glucose(1-). Generate ...
<graph>g_163molecule#node#0#6molecule#edge#0g_164molecule#node#0#5molecule#edge#0#0g_165molecule#node#0#5molecule#edge#0#0g_166molecule#node#0#5molecule#edge#0#0g_165molecule#node#0#5molecule#edge#0#0g_167molecule#node#0#7molecule#edge#0#0g_168molecule#node#0#5molecule#edge#0#0g_169molecule#node#0#7molecule#edge#0#0g_1...
135,497,143
CC1=CC(=CC(=C1C2=C(C3=C(C=C2O)OC4=CC(=O)C(=C(C4=N3)C)C5=C(C=C(C=C5C)O)O)C)O)O
This is a description of a molecule: The molecule is a member of the class of phenoxazines that is 1,9-dimethyl-3H-phenoxazin-3-one carrying an additional hydroxy substituent at position 7 as well as two 2,4-dihydroxy-6-methylphenyl substituents at positions 2 and 8. The isomer in which the hydroxy groups at positions ...
<graph>g_490molecule#node#0#7molecule#edge#0g_491molecule#node#0#5molecule#edge#0#0g_492molecule#node#0#5molecule#edge#0#3g_493molecule#node#0#5molecule#edge#0#3g_494molecule#node#0#7molecule#edge#0#0g_493molecule#node#0#5molecule#edge#0#0g_495molecule#node#0#5molecule#edge#0#3g_496molecule#node#0#5molecule#edge#0#3g_4...
35,970
CN(C)C1CSSSC1
This is a description of a molecule: The molecule is an organosulfur heterocyclic compound that is 1,2,3-trithiane in which one of the hydrogens at position 5 has been replaced by a dimethylamino group. A nicotinic acetylcholine receptor agonist, it was used (particularly as its hydrogen oxalate salt, known as thyocycl...
<graph>g_478molecule#node#0#5molecule#edge#0g_479molecule#node#0#6molecule#edge#0#0g_480molecule#node#0#5molecule#edge#0#0g_479molecule#node#0#6molecule#edge#0#0g_481molecule#node#0#5molecule#edge#0#0g_479molecule#node#0#6molecule#edge#0#0g_478molecule#node#0#5molecule#edge#0#0g_482molecule#node#0#5molecule#edge#0#0g_4...
91,861,143
C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O)NS(=O)(=O)O)O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)C(=O)O)O)O)OS(=O)(=O)O)OS(=O)(=O)O
This is a description of a molecule: The molecule is an oligosaccharide sulfate consisting of 2-O-sulfo-beta-D-glucopyranuronic acid and 2-deoxy-6-O-sulfo-2-(sulfoamino)-alpha-D-glucopyranose residues joined in sequence by a (1->4) glycosidic bond. It is a disaccharide derivative, an oligosaccharide sulfate and a membe...
<graph>g_402molecule#node#0#7molecule#edge#0g_403molecule#node#0#5molecule#edge#0#0g_404molecule#node#0#5molecule#edge#0#0g_405molecule#node#0#7molecule#edge#0#0g_406molecule#node#0#5molecule#edge#0#0g_407molecule#node#0#5molecule#edge#0#0g_408molecule#node#0#7molecule#edge#0#0g_409molecule#node#0#15molecule#edge#0#0g_...
31,226
CC(=O)OCCCC1=CC=CC=C1
This is a description of a molecule: The molecule is the acetate ester of 3-phenylpropan-1-ol. It has a role as a metabolite and a fragrance. It is a member of benzenes and an acetate ester. Generate this molecule graph between <graph> </graph>:
<graph>g_25molecule#node#0#5molecule#edge#0g_26molecule#node#0#5molecule#edge#0#3g_27molecule#node#0#5molecule#edge#0#3g_28molecule#node#0#5molecule#edge#0#0g_29molecule#node#0#5molecule#edge#0#0g_30molecule#node#0#5molecule#edge#0#0g_31molecule#node#0#7molecule#edge#0#0g_32molecule#node#0#5molecule#edge#0#0g_33molecul...
126,456,490
C(C(=O)[C@H](C(=O)[O-])O)OP(=O)([O-])[O-]
This is a description of a molecule: The molecule is a hydroxy monocarboxylic acid anion obtained by deprotonation of the carboxy and phosphate OH groups of (R)-2-hydroxy-3-oxo-4-(phosphonooxy)butanoic acid; major species at pH 7.3. It is a hydroxy monocarboxylic acid anion, an organophosphate oxoanion and a 3-oxo mono...
<graph>g_71molecule#node#0#7molecule#edge#0g_72molecule#node#0#14molecule#edge#0#1g_73molecule#node#0#7molecule#edge#0#0g_74molecule#node#0#5molecule#edge#0#0g_75molecule#node#0#5molecule#edge#0#0g_76molecule#node#0#7molecule#edge#0#1g_75molecule#node#0#5molecule#edge#0#1g_77molecule#node#0#5molecule#edge#0#0g_78molecu...
44,581,450
CCCCC/C=C\\C=C\\C(C/C=C\\C/C=C\\C/C=C\\CCCCC(=O)O)O
This is a description of a molecule: The molecule is an oxylipin that is the 15-hydoxy derivative of (6Z,9Z,12Z,16E,18Z)-tetracosa-6,9,12,16,18-pentaenoic acid. Isolated from soft cora Sinularia numerosa, it exhibits anti-angiogenic activity. It has a role as a metabolite and an angiogenesis modulating agent. It is an ...
<graph>g_23molecule#node#0#5molecule#edge#0g_24molecule#node#0#5molecule#edge#0#0g_25molecule#node#0#5molecule#edge#0#0g_26molecule#node#0#5molecule#edge#0#0g_25molecule#node#0#5molecule#edge#0#0g_24molecule#node#0#5molecule#edge#0#0g_23molecule#node#0#5molecule#edge#0#0g_27molecule#node#0#5molecule#edge#0#0g_28molecul...
50,990,923
CCCCC/C=C\\C/C=C\\CCCCCCCC(=O)OC[C@H](COP(=O)(O)O)O
This is a description of a molecule: The molecule is a 1-acyl-sn-glycerol 3-phosphate having linoleyl (9Z,12Z-octadecadienoyl) as the 1-O-acyl group. It is a conjugate acid of a 1-linoleoyl-sn-glycero-3-phosphate(2-). Generate this molecule graph between <graph> </graph>:
<graph>g_334molecule#node#0#5molecule#edge#0g_335molecule#node#0#5molecule#edge#0#0g_336molecule#node#0#5molecule#edge#0#0g_337molecule#node#0#5molecule#edge#0#0g_338molecule#node#0#5molecule#edge#0#0g_339molecule#node#0#5molecule#edge#0#0g_340molecule#node#0#5molecule#edge#0#1g_341molecule#node#0#5molecule#edge#0#0g_3...
13,576
CCCCCCCC(=O)CC
This is a description of a molecule: The molecule is a ketone that is decane in which the methylene hydrogens at position 3 are replaced by an oxo group. It has a role as a food additive and a metabolite. It derives from a hydride of a decane. Generate this molecule graph between <graph> </graph>:
<graph>g_298molecule#node#0#5molecule#edge#0g_299molecule#node#0#5molecule#edge#0#0g_300molecule#node#0#5molecule#edge#0#0g_301molecule#node#0#5molecule#edge#0#0g_302molecule#node#0#5molecule#edge#0#0g_303molecule#node#0#5molecule#edge#0#0g_304molecule#node#0#5molecule#edge#0#0g_305molecule#node#0#5molecule#edge#0#0g_3...
5,759
C1=CC(=C(C(=C1Cl)C(=O)O)Cl)Cl
This is a description of a molecule: The molecule is a chlorobenzoic acid that is benzoic acid in which the hydrogens at positions 2, 3, and 6 have been replaced by chlorines. A synthetic auxin, it is used as a post-emergence herbicide to control weeds in various cereal crops. Not approved for use within the European U...
<graph>g_458molecule#node#0#7molecule#edge#0g_459molecule#node#0#5molecule#edge#0#0g_460molecule#node#0#5molecule#edge#0#0g_461molecule#node#0#5molecule#edge#0#3g_462molecule#node#0#16molecule#edge#0#0g_461molecule#node#0#5molecule#edge#0#0g_463molecule#node#0#5molecule#edge#0#3g_464molecule#node#0#16molecule#edge#0#0g...
71,464,653
C[C@H]([C@@H](C(=O)N1CCC[C@H]1C(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](C)N)O
This is a description of a molecule: The molecule is a tetrapeptide composed of L-alanine, L-leucine, L-threonine, and L-proline units joined in sequence. It has a role as a metabolite. It derives from a L-alanine, a L-leucine, a L-threonine and a L-proline. Generate this molecule graph between <graph> </graph>:
<graph>g_94molecule#node#0#5molecule#edge#0g_95molecule#node#0#5molecule#edge#0#0g_96molecule#node#0#6molecule#edge#0#0g_97molecule#node#0#5molecule#edge#0#0g_98molecule#node#0#5molecule#edge#0#0g_99molecule#node#0#5molecule#edge#0#0g_98molecule#node#0#5molecule#edge#0#0g_100molecule#node#0#7molecule#edge#0#0g_98molecu...
23,259,303
C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(C[C@H]([C@@H](C5(CO)CO)O)O)C)C)[C@@H]2[C@]1(C)O)C)C(=O)O
This is a description of a molecule: The molecule is a pentacyclic triterpenoid that is urs-12-ene carrying a carboxy substituent at position 28 as well as five hydroxy substituents at positions 2, 3, 19, 23 and 24 (the 2alpha,3beta stereoisomer). It has a role as a plant metabolite. It is a pentacyclic triterpenoid, a...
<graph>g_437molecule#node#0#5molecule#edge#0g_438molecule#node#0#5molecule#edge#0#0g_439molecule#node#0#5molecule#edge#0#0g_440molecule#node#0#5molecule#edge#0#0g_441molecule#node#0#5molecule#edge#0#0g_442molecule#node#0#5molecule#edge#0#0g_443molecule#node#0#5molecule#edge#0#0g_444molecule#node#0#5molecule#edge#0#0g_4...
92,136,147
C([C@@H]([C@@H](CS(=O)(=O)O)O)O)C(=O)C(=O)O
This is a description of a molecule: The molecule is a carbohydrate sulfonate that is 3-deoxy-D-erythro-hex-2-ulosonic acid in which the hydroxy group at position 6 is replaced by a sulfo group. It has a role as a bacterial xenobiotic metabolite. It is a carbohydrate acid derivative and a carbohydrate sulfonate. It is ...
<graph>g_192molecule#node#0#5molecule#edge#0g_193molecule#node#0#5molecule#edge#0#0g_194molecule#node#0#5molecule#edge#0#0g_195molecule#node#0#5molecule#edge#0#0g_196molecule#node#0#5molecule#edge#0#0g_197molecule#node#0#7molecule#edge#0#1g_196molecule#node#0#5molecule#edge#0#1g_198molecule#node#0#5molecule#edge#0#0g_1...
188,324
C([C@H]([C@H]([C@@H](C=O)O)O)O)OP(=O)(O)O
This is a description of a molecule: The molecule is the 5-phospho derivative of D-arabinose. It is an intermediate in the synthesis of lipopolysaccharides. It is a conjugate acid of an aldehydo-D-arabinose 5-phosphate(2-). Generate this molecule graph between <graph> </graph>:
<graph>g_2molecule#node#0#5molecule#edge#0g_3molecule#node#0#5molecule#edge#0#0g_4molecule#node#0#5molecule#edge#0#0g_5molecule#node#0#7molecule#edge#0#0g_6molecule#node#0#14molecule#edge#0#0g_7molecule#node#0#7molecule#edge#0#1g_6molecule#node#0#14molecule#edge#0#1g_8molecule#node#0#7molecule#edge#0#0g_6molecule#node#...
134,692,088
CCC/C=C/C=C/C=C/CCC1=CC=C(O1)OC(=O)O
This is a description of a molecule: The molecule is a carbonate ester resulting from the formal condensation of the hydroxy group of 5-(undeca-3,5,7-trien-1-yl)furan-2-ol with one of the hydroxy groups of carbonic acid. A metabolite of the endophytic fungus Emericellasp. XL029. The configuration of the double bonds of...
<graph>g_449molecule#node#0#5molecule#edge#0g_450molecule#node#0#5molecule#edge#0#1g_451molecule#node#0#5molecule#edge#0#0g_452molecule#node#0#5molecule#edge#0#1g_453molecule#node#0#5molecule#edge#0#0g_454molecule#node#0#5molecule#edge#0#0g_455molecule#node#0#5molecule#edge#0#0g_454molecule#node#0#5molecule#edge#0#0g_4...
11,014,452
CC(=O)N[C@@H]1[C@H]([C@@H]([C@H](O[C@H]1O[C@@H]2[C@H](O[C@H]([C@H]([C@H]2O)O)O)CO)CO)O)O
This is a description of a molecule: The molecule is an amino disaccharide comprised of 2-acetamido-beta-D-glucopyranose linked (1->4) to beta-D-mannopyranose. It is an amino disaccharide, a member of acetamides and a glucosamine oligosaccharide. Generate this molecule graph between <graph> </graph>:
<graph>g_192molecule#node#0#5molecule#edge#0g_193molecule#node#0#5molecule#edge#0#0g_192molecule#node#0#5molecule#edge#0#0g_194molecule#node#0#7molecule#edge#0#1g_192molecule#node#0#5molecule#edge#0#1g_195molecule#node#0#6molecule#edge#0#0g_196molecule#node#0#5molecule#edge#0#0g_197molecule#node#0#5molecule#edge#0#0g_1...
11,201,309
C[C@@H]1CC[C@H]2[C@H]1[C@](C3=CC(O[C@@]3([C@@H]2C)O)(C)C)(C(=O)[C@@H](C)CC[C@@H]4C(=CC(=O)O4)C)O
This is a description of a molecule: The molecule is a natural product found in Leucosceptrum canum. It has a role as a metabolite, an angiogenesis inhibitor and an EC 3.4.21.26 (prolyl oligopeptidase) inhibitor. It is a sesterterpenoid, an organic heterotricyclic compound, a terpene ketone, a terpene lactone, a buteno...
<graph>g_334molecule#node#0#5molecule#edge#0g_335molecule#node#0#5molecule#edge#0#1g_336molecule#node#0#5molecule#edge#0#0g_335molecule#node#0#5molecule#edge#0#0g_337molecule#node#0#5molecule#edge#0#0g_338molecule#node#0#5molecule#edge#0#0g_339molecule#node#0#5molecule#edge#0#0g_340molecule#node#0#5molecule#edge#0#0g_3...
71,768,133
CCCCCCCCCCCCCC[C@@H](C(=O)[O-])O
This is a description of a molecule: The molecule is the S-enantiomer of 2-hydroxypalmitate. It is a conjugate base of a (S)-2-hydroxyhexadecanoic acid. It is an enantiomer of a (R)-2-hydroxyhexadecanoate. Generate this molecule graph between <graph> </graph>:
<graph>g_58molecule#node#0#5molecule#edge#0g_59molecule#node#0#5molecule#edge#0#0g_60molecule#node#0#5molecule#edge#0#0g_61molecule#node#0#5molecule#edge#0#0g_62molecule#node#0#5molecule#edge#0#0g_63molecule#node#0#5molecule#edge#0#0g_64molecule#node#0#5molecule#edge#0#0g_65molecule#node#0#5molecule#edge#0#0g_66molecul...
6,538,274
CCCCCCCC/C=C/CCCCCCCC(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC3=C(N=CN=C32)N)O)OP(=O)(O)O)O
This is a description of a molecule: The molecule is an octadecenoyl-CoA that results from the formal condensation of the thiol group of coenzyme A with the carboxy group of trans-9-octadecenoic acid. It is a conjugate acid of a trans-9-octadecenoyl-CoA(4-). Generate this molecule graph between <graph> </graph>:
<graph>g_35molecule#node#0#6molecule#edge#0g_36molecule#node#0#5molecule#edge#0#0g_37molecule#node#0#5molecule#edge#0#0g_38molecule#node#0#15molecule#edge#0#0g_39molecule#node#0#5molecule#edge#0#0g_40molecule#node#0#5molecule#edge#0#0g_41molecule#node#0#5molecule#edge#0#0g_42molecule#node#0#5molecule#edge#0#0g_43molecu...
71,141
CN1C(=NN=N1)SCC2=C(N3[C@@H]([C@@](C3=O)(NC(=O)CSC[C@H](C(=O)O)N)OC)SC2)C(=O)O
This is a description of a molecule: The molecule is a second-generation cephamycin antibiotic having [(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl and 2-{[(2S)-2-amino-2-carboxyethyl]sulfanyl}acetamido side-groups located respectively at positions 3 and 7beta of the cephem nucleus. A broad-spectrum bactericide, it is es...
<graph>g_57molecule#node#0#15molecule#edge#0g_58molecule#node#0#5molecule#edge#0#0g_59molecule#node#0#6molecule#edge#0#0g_58molecule#node#0#5molecule#edge#0#0g_60molecule#node#0#5molecule#edge#0#0g_61molecule#node#0#6molecule#edge#0#0g_62molecule#node#0#5molecule#edge#0#0g_63molecule#node#0#7molecule#edge#0#1g_62molecu...
52,940,250
C/C(=C\\C=C\\C=C(\\C=C\\C=C(\\C=C\\C=C(\\C(=O)O)/C)/C)/C)/C=C/C=C(/C=C/C=C(/C(=O)O)\\C)\\C
This is a description of a molecule: The molecule is an apo carotenoid triterpenoid that is 4,4'-diapolycopene in which two of the terminal methyl groups have been oxidised to carboxy groups. It has a role as a bacterial metabolite. It is an apo carotenoid triterpenoid, an alpha,omega-dicarboxylic acid and an olefinic ...
<graph>g_365molecule#node#0#5molecule#edge#0g_366molecule#node#0#5molecule#edge#0#1g_367molecule#node#0#5molecule#edge#0#0g_368molecule#node#0#5molecule#edge#0#1g_369molecule#node#0#5molecule#edge#0#0g_370molecule#node#0#5molecule#edge#0#1g_371molecule#node#0#5molecule#edge#0#0g_372molecule#node#0#5molecule#edge#0#1g_3...
54,729,367
CCO.C[C@@H]1[C@H]2[C@@H]([C@H]3[C@@H](C(=O)C(=C([C@]3(C(=O)C2=C(C4=C1C=CC=C4O)O)O)O)C(=O)N)[NH+](C)C)O.C[C@@H]1[C@H]2[C@@H]([C@H]3[C@@H](C(=O)C(=C([C@]3(C(=O)C2=C(C4=C1C=CC=C4O)O)O)O)C(=O)N)[NH+](C)C)O.O.[Cl-].[Cl-]
This is a description of a molecule: The molecule is the hemiethanolate hemihydrate of doxycycline hydrochloride. A semi-synthetic tetracycline antibiotic, it is used to inhibit bacterial protein synthesis and treat non-gonococcal urethritis and cervicitis, exacerbations of bronchitis in patients with chronic obstructi...
<graph>g_501molecule#node#0#5molecule#edge#0g_502molecule#node#0#6molecule#edge#0#0g_503molecule#node#0#5molecule#edge#0#0g_504molecule#node#0#5molecule#edge#0#0g_505molecule#node#0#5molecule#edge#0#0g_506molecule#node#0#7molecule#edge#0#0g_505molecule#node#0#5molecule#edge#0#0g_507molecule#node#0#5molecule#edge#0#0g_5...
5,379,096
COC1=C(C=CC(=C1)C2=CC(=O)C3=C(O2)C=C(C(=C3O)OC)O)O
This is a description of a molecule: The molecule is a trihydroxyflavone that is flavone with hydroxy groups at positions 5, 7 and 4' and methoxy groups at positions 3' and 6. Isolated from Salvia tomentosa and Artemisia asiatica, it exhibits anti-allergic, anti-inflammatory and apoptosis inducing activties. It has a r...
<graph>g_365molecule#node#0#5molecule#edge#0g_366molecule#node#0#5molecule#edge#0#3g_367molecule#node#0#5molecule#edge#0#3g_368molecule#node#0#5molecule#edge#0#3g_369molecule#node#0#5molecule#edge#0#3g_370molecule#node#0#7molecule#edge#0#1g_369molecule#node#0#5molecule#edge#0#1g_371molecule#node#0#5molecule#edge#0#3g_3...
5,280,883
CCCCC[C@@H](/C=C/[C@H]1[C@H]2C[C@@H]([C@@H]1C/C=C\\CCCC(=O)O)OO2)OO
This is a description of a molecule: The molecule is a prostaglandins G. It has a role as a mouse metabolite and a human metabolite. It is a conjugate acid of a prostaglandin G2(1-). Generate this molecule graph between <graph> </graph>:
<graph>g_368molecule#node#0#5molecule#edge#0g_369molecule#node#0#5molecule#edge#0#0g_370molecule#node#0#5molecule#edge#0#0g_371molecule#node#0#5molecule#edge#0#0g_372molecule#node#0#5molecule#edge#0#0g_373molecule#node#0#5molecule#edge#0#1g_374molecule#node#0#5molecule#edge#0#0g_375molecule#node#0#5molecule#edge#0#0g_3...
27,924
CCCCCCCCCCCCCC(=O)O[C@@H]1[C@H]([C@]2([C@@H](C=C(C[C@]3([C@H]2C=C(C3=O)C)O)CO)[C@H]4[C@@]1(C4(C)C)OC(=O)C)O)C
This is a description of a molecule: The molecule is a phorbol ester that is phorbol in which the hydroxy groups at the cyclopropane ring juction (position 13) and the adjacent carbon (position 12) have been converted into the corresponding acetate and myristate esters. It has a role as a protein kinase C agonist and a...
<graph>g_437molecule#node#0#5molecule#edge#0g_438molecule#node#0#5molecule#edge#0#0g_439molecule#node#0#5molecule#edge#0#0g_440molecule#node#0#5molecule#edge#0#0g_441molecule#node#0#5molecule#edge#0#0g_440molecule#node#0#5molecule#edge#0#0g_442molecule#node#0#5molecule#edge#0#0g_443molecule#node#0#7molecule#edge#0#0g_4...
40,579,074
C[C@H](CCC[C@H](C)C(=O)[O-])[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O)C)C
This is a description of a molecule: The molecule is a steroid acid anion that is the conjugate base of (25S)-cholestenoic acid, obtained by deprotonation of the carboxy group; major species at pH 7.3. It is a conjugate base of a (25S)-cholestenoic acid. Generate this molecule graph between <graph> </graph>:
<graph>g_275molecule#node#0#5molecule#edge#0g_276molecule#node#0#5molecule#edge#0#0g_277molecule#node#0#5molecule#edge#0#0g_278molecule#node#0#5molecule#edge#0#0g_277molecule#node#0#5molecule#edge#0#0g_279molecule#node#0#5molecule#edge#0#0g_280molecule#node#0#5molecule#edge#0#0g_281molecule#node#0#5molecule#edge#0#0g_2...
272,833
CC(C(=O)N[C@H]1[C@@H]2N(C1=O)[C@H](C(S2)(C)C)C(=O)O)OC3=CC=CC=C3
This is a description of a molecule: The molecule is a penicillin in which the substituent at position 6 of the penam ring is a 2-phenoxypropanamido group. It is a penicillin and a penicillin allergen. It is a conjugate acid of a phenethicillin(1-). Generate this molecule graph between <graph> </graph>:
<graph>g_64molecule#node#0#7molecule#edge#0g_65molecule#node#0#5molecule#edge#0#0g_66molecule#node#0#5molecule#edge#0#0g_67molecule#node#0#6molecule#edge#0#0g_68molecule#node#0#5molecule#edge#0#0g_69molecule#node#0#5molecule#edge#0#0g_70molecule#node#0#6molecule#edge#0#0g_71molecule#node#0#5molecule#edge#0#0g_72molecul...
132,862
CN=C(N)NCCC[C@@H](C(=O)O)N
This is a description of a molecule: The molecule is a L-arginine derivative with a N(omega)-methyl substituent. It is a member of guanidines, a non-proteinogenic L-alpha-amino acid and a L-arginine derivative. It is a conjugate acid of a N(omega)-methyl-L-argininate. It is a tautomer of a N(omega)-methyl-L-arginine zw...
<graph>g_77molecule#node#0#5molecule#edge#0g_78molecule#node#0#5molecule#edge#0#0g_79molecule#node#0#5molecule#edge#0#0g_80molecule#node#0#5molecule#edge#0#0g_81molecule#node#0#5molecule#edge#0#0g_82molecule#node#0#6molecule#edge#0#0g_83molecule#node#0#5molecule#edge#0#0g_84molecule#node#0#6molecule#edge#0#1g_85molecul...
6,422,843
COC(=O)N(C1=CC=CC=C1COC2=NN(C=C2)C3=CC=C(C=C3)Cl)OC
This is a description of a molecule: The molecule is a carbamate ester that is the methyl ester of [2-({[1-(4-chlorophenyl)-1H-pyrazol-3-yl]oxy}methyl)phenyl]methoxycarbamic acid. A fungicide used to control major plant pathogens including Septoria tritici, Puccinia spp. and Pyrenophora teres. It has a role as a mitoch...
<graph>g_451molecule#node#0#5molecule#edge#0g_452molecule#node#0#5molecule#edge#0#3g_453molecule#node#0#16molecule#edge#0#0g_452molecule#node#0#5molecule#edge#0#0g_454molecule#node#0#5molecule#edge#0#3g_455molecule#node#0#5molecule#edge#0#3g_456molecule#node#0#5molecule#edge#0#3g_457molecule#node#0#6molecule#edge#0#0g_...
440,071
C[C@H](CCC(=O)NCCS(=O)(=O)O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC[C@H]4[C@@]3(CC[C@H](C4)OS(=O)(=O)O)C)C
This is a description of a molecule: The molecule is the steroid sulfate of taurolithocholic acid. It has a role as a human metabolite. It derives from a taurolithocholic acid. It is a conjugate acid of a taurolithocholic acid sulfate(2-). Generate this molecule graph between <graph> </graph>:
<graph>g_110molecule#node#0#7molecule#edge#0g_111molecule#node#0#15molecule#edge#0#1g_112molecule#node#0#7molecule#edge#0#0g_113molecule#node#0#5molecule#edge#0#0g_114molecule#node#0#5molecule#edge#0#0g_115molecule#node#0#5molecule#edge#0#0g_116molecule#node#0#5molecule#edge#0#0g_117molecule#node#0#5molecule#edge#0#0g_...
23,672,150
CCCCCC/C=C\\CCCCCCCCCCCCC#C[C@H](C(=O)O)OS(=O)(=O)[O-].[Na+]
This is a description of a molecule: The molecule is an organic sodium salt which is the monosodium salt of callysponginol sulfonic acid A. It is isolated from the marine sponge Callyspongia truncata as a membrane type 1 matrix metalloproteinase (MT1-MMP) inhibitor. It has a role as a metabolite and a matrix metallopro...
<graph>g_217molecule#node#0#10molecule#edge#0g_218molecule#node#0#5molecule#edge#0g_219molecule#node#0#5molecule#edge#0#0g_220molecule#node#0#5molecule#edge#0#1g_221molecule#node#0#5molecule#edge#0#0g_222molecule#node#0#5molecule#edge#0#0g_223molecule#node#0#5molecule#edge#0#0g_224molecule#node#0#5molecule#edge#0#0g_22...
5,368,642
CCC(=O)/C=C/C=C/C(=C/C=C/C=C/C1=CC=CC=C1)/C
This is a description of a molecule: The molecule is an enone that is (4E,6E,8E,10E,12E)-8-methyl-13-phenyltrideca-4,6,8,10,12-pentaene in which the two methylene hydrogens at position 3 have been replaced by an oxo group. Originally isolated from Aspergillus niger. It has a role as an Aspergillus metabolite, a lipoxyg...
<graph>g_460molecule#node#0#5molecule#edge#0g_461molecule#node#0#5molecule#edge#0#3g_462molecule#node#0#5molecule#edge#0#0g_463molecule#node#0#5molecule#edge#0#1g_464molecule#node#0#5molecule#edge#0#0g_465molecule#node#0#5molecule#edge#0#1g_466molecule#node#0#5molecule#edge#0#0g_467molecule#node#0#5molecule#edge#0#1g_4...
52,940,209
CCCCCC(C(C/C=C\\CCCCCCCC(=O)[O-])O)O
This is a description of a molecule: The molecule is a monounsaturated fatty acid anion that is the conjugate base of 12,13-DiHOME, obtained by deprotonation of the carboxy group; major species at pH 7.3. It is a long-chain fatty acid anion and a hydroxy monounsaturated fatty acid anion. It is a conjugate base of a 12,...
<graph>g_9molecule#node#0#5molecule#edge#0g_10molecule#node#0#5molecule#edge#0#0g_11molecule#node#0#5molecule#edge#0#0g_12molecule#node#0#5molecule#edge#0#0g_13molecule#node#0#5molecule#edge#0#0g_14molecule#node#0#5molecule#edge#0#0g_15molecule#node#0#5molecule#edge#0#0g_16molecule#node#0#5molecule#edge#0#0g_17molecule...
24,779,473
CCCCCCCCCCCCCCCCCCCC(=O)OC[C@H](COP(=O)([O-])OCC[N+](C)(C)C)O
This is a description of a molecule: The molecule is a 1-O-acyl-sn-glycero-3-phosphocholine in which the acyl group is specified as icosanoyl. It is a 1-O-acyl-sn-glycero-3-phosphocholine and a lysophosphatidylcholine 20:0. It derives from an icosanoic acid. Generate this molecule graph between <graph> </graph>:
<graph>g_444molecule#node#0#7molecule#edge#0g_445molecule#node#0#5molecule#edge#0#0g_446molecule#node#0#5molecule#edge#0#0g_447molecule#node#0#5molecule#edge#0#0g_448molecule#node#0#7molecule#edge#0#0g_449molecule#node#0#5molecule#edge#0#0g_450molecule#node#0#5molecule#edge#0#0g_451molecule#node#0#5molecule#edge#0#0g_4...
86,289,368
CCCCC/C=C\\C/C=C\\CCCCCCCCCCCC(=O)[O-]
This is a description of a molecule: The molecule is a long-chain unsaturated fatty acid anion that is the conjugate base of (13Z,16Z)-docosadienoic acid, obtained by deprotonation of the carboxy group; major species at pH 7.3. It is a polyunsaturated fatty acid anion, a long-chain fatty acid anion and a docosadienoate...
<graph>g_159molecule#node#0#5molecule#edge#0g_160molecule#node#0#5molecule#edge#0#0g_161molecule#node#0#5molecule#edge#0#0g_162molecule#node#0#5molecule#edge#0#0g_163molecule#node#0#5molecule#edge#0#0g_164molecule#node#0#5molecule#edge#0#0g_165molecule#node#0#5molecule#edge#0#1g_166molecule#node#0#5molecule#edge#0#0g_1...
6,432,248
CC[NH3+].[N+](=O)([O-])[O-]
This is a description of a molecule: The molecule is an organoammonium salt resulting from the mixing of equimolar amounts of nitric acid and ethylamine. First prepared in 1914, it was one of the first ionic liquids found that had a melting point below room temperature (m.p. 12℃). It has a role as a protic solvent. It ...
<graph>g_80molecule#node#0#6molecule#edge#0g_81molecule#node#0#7molecule#edge#0#1g_80molecule#node#0#6molecule#edge#0#1g_82molecule#node#0#7molecule#edge#0#0g_80molecule#node#0#6molecule#edge#0#0g_83molecule#node#0#7molecule#edge#0#0g_84molecule#node#0#5molecule#edge#0g_85molecule#node#0#5molecule#edge#0#0g_84molecule#...
644,225
C[C@@H](C(=O)O)NC(=O)CC1=CNC2=CC=CC=C21
This is a description of a molecule: The molecule is an N-acyl-L-amino acid that is the N-indole-3-acetyl derivative of L-alanine. It is an indoleacetic acid amide conjugate and a N-acyl-L-alanine. Generate this molecule graph between <graph> </graph>:
<graph>g_242molecule#node#0#5molecule#edge#0g_243molecule#node#0#5molecule#edge#0#3g_244molecule#node#0#6molecule#edge#0#3g_245molecule#node#0#5molecule#edge#0#3g_246molecule#node#0#5molecule#edge#0#3g_247molecule#node#0#5molecule#edge#0#0g_248molecule#node#0#5molecule#edge#0#0g_249molecule#node#0#6molecule#edge#0#0g_2...
11,966,175
CCCCC/C=C/C(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC3=C(N=CN=C32)N)O)OP(=O)(O)O)O
This is a description of a molecule: The molecule is an unsaturated fatty acyl-CoA that results from the formal condensation of the thiol group of coenzyme A with the carboxy group of trans-oct-2-enoic acid. It has a role as a human metabolite, an Escherichia coli metabolite and a mouse metabolite. It is a medium-chain...
<graph>g_203molecule#node#0#5molecule#edge#0g_204molecule#node#0#5molecule#edge#0#0g_205molecule#node#0#5molecule#edge#0#0g_204molecule#node#0#5molecule#edge#0#0g_203molecule#node#0#5molecule#edge#0#0g_206molecule#node#0#5molecule#edge#0#0g_207molecule#node#0#5molecule#edge#0#0g_208molecule#node#0#5molecule#edge#0#0g_2...
70,680,358
CCCCCCCCCCCCCCCCCC(=O)N[C@@H](CO)[C@@H](/C=C/CCCCCCCCCC(C)C)O
This is a description of a molecule: The molecule is an N-acyl-15-methylhexadecasphing-4-enine in which the acyl group has 18 carbons and 0 double bonds. It derives from a 15-methylhexadecasphing-4-enine. Generate this molecule graph between <graph> </graph>:
<graph>g_20molecule#node#0#5molecule#edge#0g_21molecule#node#0#5molecule#edge#0#0g_22molecule#node#0#5molecule#edge#0#0g_23molecule#node#0#5molecule#edge#0#0g_24molecule#node#0#5molecule#edge#0#0g_25molecule#node#0#5molecule#edge#0#0g_26molecule#node#0#5molecule#edge#0#0g_27molecule#node#0#5molecule#edge#0#0g_28molecul...
441,373
C1=CC=C(C(=C1)C2=C3C=C(C(=O)C=C3OC4=C(C(=C(C=C24)Br)[O-])[Hg])Br)C(=O)[O-].O.[Na+].[Na+]
This is a description of a molecule: The molecule is an organic sodium salt that is 2,7-dibromo-4-hydroxymercurifluorescein in which the carboxy group and the phenolic hydroxy group have been deprotonated and the resulting charge is neutralised by two sodium ions. It has a role as an antiseptic drug, a fluorochrome and...
<graph>g_297molecule#node#0#10molecule#edge#0g_298molecule#node#0#7molecule#edge#0g_299molecule#node#0#5molecule#edge#0#0g_300molecule#node#0#5molecule#edge#0#3g_301molecule#node#0#79molecule#edge#0#0g_300molecule#node#0#5molecule#edge#0#0g_302molecule#node#0#5molecule#edge#0#3g_303molecule#node#0#7molecule#edge#0#3g_3...
444,899
CCCCC/C=C\\C/C=C\\C/C=C\\C/C=C\\CCCC(=O)O
This is a description of a molecule: The molecule is a long-chain fatty acid that is a C20, polyunsaturated fatty acid having four (Z)-double bonds at positions 5, 8, 11 and 14. It has a role as a human metabolite, an EC 3.1.1.1 (carboxylesterase) inhibitor, a Daphnia galeata metabolite and a mouse metabolite. It is an...
<graph>g_302molecule#node#0#5molecule#edge#0g_303molecule#node#0#5molecule#edge#0#0g_304molecule#node#0#5molecule#edge#0#0g_305molecule#node#0#5molecule#edge#0#1g_306molecule#node#0#5molecule#edge#0#0g_307molecule#node#0#5molecule#edge#0#0g_308molecule#node#0#5molecule#edge#0#0g_309molecule#node#0#5molecule#edge#0#0g_3...
End of preview. Expand in Data Studio
README.md exists but content is empty.
Downloads last month
6