uid stringlengths 13 13 | task_type stringclasses 3
values | features stringclasses 100
values | question stringlengths 96 828 | target stringlengths 4 802 | constraints stringlengths 56 496 ⌀ | original_smiles stringclasses 855
values | complexity_bin stringclasses 4
values | multi_task_load int64 1 5 | metadata stringlengths 45 184 |
|---|---|---|---|---|---|---|---|---|---|
task_00002413 | count | multi_count_nbr_2 | How many rotatable bonds and how many sp3-hybridized carbon atoms are in CCCCCC[O][Sn]([CH2]CCC)([O]CCCCCC)[O]CCCCCC? Provide the counts as a JSON object using the keys rotatable_bond_count and csp3_carbon_count. | {"rotatable_bond_count": 21, "csp3_carbon_count": 22} | null | CCCCCC[O][Sn]([CH2]CCC)([O]CCCCCC)[O]CCCCCC | 0-250 | 2 | {"smiles": "CCCCCC[O][Sn]([CH2]CCC)([O]CCCCCC)[O]CCCCCC", "is_randomized": false, "is_kekulized": false} |
task_00003373 | index | multi_index_nbr_3 | In the molecule C(CCCCCCC(CCCCC)(O)C)CCCCCC, which atom indices correspond to the longest carbon chain, the unspecified stereocenters, and the halogen atoms? Provide your answer as a JSON object mapping longest_carbon_chain_index, unspecified_stereocenter_index, and halogen_atom_index to the lists of indices for each. | {"longest_carbon_chain_index": [12, 11, 10, 9, 8, 7, 6, 5, 4, 3, 2, 1, 0, 15, 16, 17, 18, 19, 20], "unspecified_stereocenter_index": [7], "halogen_atom_index": []} | null | CCCCCCCCCCCCCC(C)(O)CCCCC | 0-250 | 3 | {"smiles": "C(CCCCCCC(CCCCC)(O)C)CCCCCC", "is_randomized": true, "is_kekulized": false} |
task_00001139 | index | single_index_murcko_scaffold | Which atoms in CCCCN1C(=O)C(=C2Sc3ccc(OC)cc3N2CC)S/C1=N\c1ccc(C)c(Cl)c1 are part of the Murcko scaffold? Provide your answer with murcko_scaffold_index containing the indices of these atoms. | {"murcko_scaffold_index": [4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 16, 17, 18, 21, 22, 23, 24, 25, 26, 27, 29, 31]} | null | CCCCN1C(=O)C(=C2Sc3ccc(OC)cc3N2CC)S/C1=N\c1ccc(C)c(Cl)c1 | 1000-inf | 1 | {"smiles": "CCCCN1C(=O)C(=C2Sc3ccc(OC)cc3N2CC)S/C1=N\\c1ccc(C)c(Cl)c1", "is_randomized": false, "is_kekulized": false} |
task_00002321 | count | multi_count_nbr_5 | How many halogen atoms, branch points, sp3 carbons, hydrogen atoms, and hydrogen bond acceptors are present in FC(F)(C(F)(F)F)C1=CC(N)(N)C=C(C(C(F)(F)F)(F)F)C1=C1C(C(F)(C(F)(F)F)F)=CC(N)(C=C1C(C(F)(F)F)(F)F)N? Please provide your answer for halogen_atom_count, branch_point_count, csp3_carbon_count, hydrogen_atom_count,... | {"halogen_atom_count": 20, "branch_point_count": 16, "csp3_carbon_count": 10, "hydrogen_atom_count": 12, "hba_count": 4} | null | NC1(N)C=C(C(F)(F)C(F)(F)F)C(=C2C(C(F)(F)C(F)(F)F)=CC(N)(N)C=C2C(F)(F)C(F)(F)F)C(C(F)(F)C(F)(F)F)=C1 | 1000-inf | 5 | {"smiles": "FC(F)(C(F)(F)F)C1=CC(N)(N)C=C(C(C(F)(F)F)(F)F)C1=C1C(C(F)(C(F)(F)F)F)=CC(N)(C=C1C(C(F)(F)F)(F)F)N", "is_randomized": true, "is_kekulized": false} |
task_00000675 | index | single_index_chain_termini | Which atoms in O(C(CC)CC)C(O[C@@H](C)OC(=O)C1=C(CS[C@@H]2[C@@H](C(N21)=O)NC(=O)/C(=N\O)C1=CSC(N)=N1)/C=C\C1=CC=CN=C1)=O are the terminal (chain-end) carbons? Identify their positions and give the index values as JSON using the key chain_termini_index. | {"chain_termini_index": [3, 5, 9]} | null | CCC(CC)OC(=O)O[C@@H](C)OC(=O)C1=C(/C=C\c2cccnc2)CS[C@@H]2[C@H](NC(=O)/C(=N\O)c3csc(N)n3)C(=O)N12 | 1000-inf | 1 | {"smiles": "O(C(CC)CC)C(O[C@@H](C)OC(=O)C1=C(CS[C@@H]2[C@@H](C(N21)=O)NC(=O)/C(=N\\O)C1=CSC(N)=N1)/C=C\\C1=CC=CN=C1)=O", "is_randomized": true, "is_kekulized": true} |
task_00001988 | count | multi_count_nbr_5 | How many aliphatic rings, heterocycles, bridgehead atoms, heavy atoms, and oxygens at minimum oxidation state are present in C1COC[C@H]2OCC3O[C@@H](COCCOC[C@H]4OCC5O[C@H](CO1)OCC5O4)OCC3O2? Please provide your answer as a JSON with aliphatic_ring_count, heterocycle_count, bridgehead_count, heavy_atom_count, and oxidati... | {"aliphatic_ring_count": 12, "heterocycle_count": 12, "heavy_atom_count": 32, "oxidation_state_O_min_count": 12, "bridgehead_count": 8} | null | C1COC[C@H]2OCC3O[C@@H](COCCOC[C@H]4OCC5O[C@H](CO1)OCC5O4)OCC3O2 | 250-1000 | 5 | {"smiles": "C1COC[C@H]2OCC3O[C@@H](COCCOC[C@H]4OCC5O[C@H](CO1)OCC5O4)OCC3O2", "is_randomized": false, "is_kekulized": false} |
task_00003000 | index | multi_index_nbr_2 | Which atoms in CCCCCCCCc1ccc2sc(-c3cc4sc5cc(-c6cc7cc(CCCCCCCC)ccc7s6)sc5c4s3)cc2c1 are part of fused ring systems, and which atoms belong to the largest ring? Please provide your answer showing the positions for fused_ring_index and smallest_largest_ring_size_largest_index. | {"fused_ring_index": [8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44], "smallest_largest_ring_size_largest_index": [8, 9, 10, 11, 23, 24, 25, 34, 35, 36, 43, 44]} | null | CCCCCCCCc1ccc2sc(-c3cc4sc5cc(-c6cc7cc(CCCCCCCC)ccc7s6)sc5c4s3)cc2c1 | 1000-inf | 2 | {"smiles": "CCCCCCCCc1ccc2sc(-c3cc4sc5cc(-c6cc7cc(CCCCCCCC)ccc7s6)sc5c4s3)cc2c1", "is_randomized": false, "is_kekulized": false} |
task_00000741 | index | single_index_heterocycle | Identify the atom indices that belong to heterocycles in C1C2OC3=CC=C4C5N(C6[N+](C7(C8C9C(N%10C=8C(=C(C8C%10=NC=CC=8)C=1)[N+]=27)=CC=CC=9)C3=5)=CC=CC=6)C1C4=CC=CC=1. Return the answer as a JSON object with heterocycle_index giving the list of those indices. | {"heterocycle_index": [0, 1, 2, 3, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 31, 32, 33, 34, 35, 36, 37]} | null | c1cc[n+]2c(c1)-n1c3ccccc3c3ccc4c(c31)C21c2c3ccccc3n3c5ncccc5c5ccc([n+]1c5c23)O4 | 1000-inf | 1 | {"smiles": "C1C2OC3=CC=C4C5N(C6[N+](C7(C8C9C(N%10C=8C(=C(C8C%10=NC=CC=8)C=1)[N+]=27)=CC=CC=9)C3=5)=CC=CC=6)C1C4=CC=CC=1", "is_randomized": true, "is_kekulized": true} |
task_00000630 | count | single_count_bridgehead | How many bridgehead atoms are present in C1n2c3c4c5cc([Si](O[Si](c6ccc7c(c6)c6c(n7COCCOCCO1)ccc(c6)[Si](C)(O[Si](C)(c(c4)cc3)C)C)(C)C)(C)C)ccc52? Please provide your answer as a JSON object with bridgehead_count. | {"bridgehead_count": 14} | null | C[Si]1(C)O[Si](C)(C)c2ccc3c(c2)c2cc4ccc2n3COCCOCCOCn2c3ccc1cc3c1cc(ccc12)[Si](C)(C)O[Si]4(C)C | 1000-inf | 1 | {"smiles": "C1n2c3c4c5cc([Si](O[Si](c6ccc7c(c6)c6c(n7COCCOCCO1)ccc(c6)[Si](C)(O[Si](C)(c(c4)cc3)C)C)(C)C)(C)C)ccc52", "is_randomized": true, "is_kekulized": false} |
task_00000095 | index | single_index_chain_termini | Which atoms in C(CC1=CC=C2C(=C1)OC(N2)=O)NC(C)(C)C are the terminal (chain-end) carbons? Identify their index positions and give the answer as JSON under the key chain_termini_index. | {"chain_termini_index": [14, 15, 16]} | null | CC(C)(C)NCCc1ccc2[nH]c(=O)oc2c1 | 250-1000 | 1 | {"smiles": "C(CC1=CC=C2C(=C1)OC(N2)=O)NC(C)(C)C", "is_randomized": true, "is_kekulized": true} |
task_00000238 | count | single_count_longest_carbon_chain | How many carbon atoms make up the longest carbon chain in O=C(O)[C@@H]1C[C@@H](O)CN1C(=O)NCCC1=CC=CS1? Provide your answer using longest_carbon_chain_count. | {"longest_carbon_chain_count": 6} | null | O=C(O)[C@@H]1C[C@@H](O)CN1C(=O)NCCc1cccs1 | 250-1000 | 1 | {"smiles": "O=C(O)[C@@H]1C[C@@H](O)CN1C(=O)NCCC1=CC=CS1", "is_randomized": false, "is_kekulized": true} |
task_00002729 | index | multi_index_nbr_2 | Which atoms in C1OC(C)CN(S(=O)(c2ccc(CN)c(c2)Cl)=O)C1C are part of saturated rings, and which ones belong to the longest carbon chain? Provide your answer with saturated_ring_index and longest_carbon_chain_index. | {"saturated_ring_index": [0, 1, 2, 4, 5, 18], "longest_carbon_chain_index": [10, 9, 8, 15, 14, 11, 12]} | null | CC1CN(S(=O)(=O)c2ccc(CN)c(Cl)c2)C(C)CO1 | 250-1000 | 2 | {"smiles": "C1OC(C)CN(S(=O)(c2ccc(CN)c(c2)Cl)=O)C1C", "is_randomized": true, "is_kekulized": false} |
task_00000078 | count | single_count_smallest_largest_ring_size | How many atoms make up the smallest ring in C1CCCCCCCCC(=O)NC(=N)N(C)CC(OCCCCCCCC1)=C? Provide your answer as smallest_largest_ring_size_smallest_count. | {"smallest_largest_ring_size_smallest_count": 24} | null | C=C1CN(C)C(=N)NC(=O)CCCCCCCCCCCCCCCCCO1 | 250-1000 | 1 | {"smiles": "C1CCCCCCCCC(=O)NC(=N)N(C)CC(OCCCCCCCC1)=C", "is_randomized": true, "is_kekulized": false} |
task_00000010 | count | single_count_ring | How many rings are present in [C@H]12[C@H]3[C@H]4[C@@]5(C(=CC(CC5)OC([C@H]([C@]1(CC4)C)CC2)CO)[C@@H](C3)O)C? Please provide your answer as ring_count. | {"ring_count": 9} | null | C[C@@]12CC[C@H]3[C@H]4C[C@@H](O)C5=CC(CC[C@@]53C)OC(CO)[C@H]1CC[C@@H]42 | 250-1000 | 1 | {"smiles": "[C@H]12[C@H]3[C@H]4[C@@]5(C(=CC(CC5)OC([C@H]([C@]1(CC4)C)CC2)CO)[C@@H](C3)O)C", "is_randomized": true, "is_kekulized": false} |
task_00000685 | index | single_index_branch_point | Which atoms in O=C(c1ccc(nc1)-n1cncn1)N1CCN(CC(=O)Nc2cccc(c2C)C)CC1 are branch points? Identify and list the atom indices of all branch points, and return the answer as a JSON object with branch_point_index mapping to those indices. | {"branch_point_index": [1, 2, 5, 18, 21, 25, 26]} | null | Cc1cccc(NC(=O)CN2CCN(C(=O)c3ccc(-n4cncn4)nc3)CC2)c1C | 1000-inf | 1 | {"smiles": "O=C(c1ccc(nc1)-n1cncn1)N1CCN(CC(=O)Nc2cccc(c2C)C)CC1", "is_randomized": true, "is_kekulized": false} |
task_00001860 | count | multi_count_nbr_3 | For the molecule C=C1C[C@]23C[C@@]1(O)CC[C@H]2[C@@]12C=CC(=O)[C@@](C)(C(=O)O1)[C@H]2[C@@H]3C(=O)O, how many bridgehead atoms, stereocenters, and heavy atoms are there? Provide the answer as a JSON object with bridgehead_count, stereocenter_count, and heavy_atom_count, each holding a numerical count. | {"bridgehead_count": 4, "stereocenter_count": 7, "heavy_atom_count": 25} | null | C=C1C[C@]23C[C@@]1(O)CC[C@H]2[C@@]12C=CC(=O)[C@@](C)(C(=O)O1)[C@H]2[C@@H]3C(=O)O | 250-1000 | 3 | {"smiles": "C=C1C[C@]23C[C@@]1(O)CC[C@H]2[C@@]12C=CC(=O)[C@@](C)(C(=O)O1)[C@H]2[C@@H]3C(=O)O", "is_randomized": false, "is_kekulized": true} |
task_00000180 | count | single_count_saturated_ring | How many saturated rings are in C1C2C3C(C4(C)C5C(C3)CC(=C)C3CCC(C53)(CCOC)CC4)(C)CCC2C(CC1)(C)C? Return the result as a JSON object using the key saturated_ring_count. | {"saturated_ring_count": 6} | null | C=C1CC2CC3C4CCCC(C)(C)C4CCC3(C)C3(C)CCC4(CCOC)CCC1C4C23 | 250-1000 | 1 | {"smiles": "C1C2C3C(C4(C)C5C(C3)CC(=C)C3CCC(C53)(CCOC)CC4)(C)CCC2C(CC1)(C)C", "is_randomized": true, "is_kekulized": true} |
task_00000165 | index | single_index_heterocycle | Which atoms in C1COC[C@H]2OCC3O[C@@H](COCCOC[C@H]4OCC5O[C@H](CO1)OCC5O4)OCC3O2 are part of heterocyclic rings? Please provide your answer with heterocycle_index containing these atom positions. | {"heterocycle_index": [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31]} | null | C1COC[C@H]2OCC3O[C@@H](COCCOC[C@H]4OCC5O[C@H](CO1)OCC5O4)OCC3O2 | 250-1000 | 1 | {"smiles": "C1COC[C@H]2OCC3O[C@@H](COCCOC[C@H]4OCC5O[C@H](CO1)OCC5O4)OCC3O2", "is_randomized": false, "is_kekulized": false} |
task_00000968 | count | single_count_halogen_atom | How many halogen atoms are present in FC(F)(F)C(F)(F)C1=CC(N)(N)C=C(C1=C1C(C(F)(F)C(F)(F)F)=CC(C=C1C(F)(F)C(F)(F)F)(N)N)C(C(F)(F)F)(F)F? Please provide your answer as a JSON with halogen_atom_count. | {"halogen_atom_count": 20} | null | NC1(N)C=C(C(F)(F)C(F)(F)F)C(=C2C(C(F)(F)C(F)(F)F)=CC(N)(N)C=C2C(F)(F)C(F)(F)F)C(C(F)(F)C(F)(F)F)=C1 | 1000-inf | 1 | {"smiles": "FC(F)(F)C(F)(F)C1=CC(N)(N)C=C(C1=C1C(C(F)(F)C(F)(F)F)=CC(C=C1C(F)(F)C(F)(F)F)(N)N)C(C(F)(F)F)(F)F", "is_randomized": true, "is_kekulized": false} |
task_00000391 | index | single_index_halogen_atom | Which atoms in CC(c1ccccc1)[Si](I)([Si](I)(I)I)[Si](I)(I)I are halogens? Please identify their positions and provide your answer as a JSON object with halogen_atom_index containing these indices. | {"halogen_atom_index": [9, 11, 12, 13, 15, 16, 17]} | null | CC(c1ccccc1)[Si](I)([Si](I)(I)I)[Si](I)(I)I | 250-1000 | 1 | {"smiles": "CC(c1ccccc1)[Si](I)([Si](I)(I)I)[Si](I)(I)I", "is_randomized": false, "is_kekulized": false} |
task_00000170 | count | single_count_heterocycle | How many heterocycles are in O[C@]12CCN3CCC[C@]45CC6OC(C4)N(c4ccccc41)[C@@]2(O6)[C@H]35? Provide the answer as a JSON mapping with heterocycle_count containing the numerical count. | {"heterocycle_count": 7} | null | O[C@]12CCN3CCC[C@]45CC6OC(C4)N(c4ccccc41)[C@@]2(O6)[C@H]35 | 250-1000 | 1 | {"smiles": "O[C@]12CCN3CCC[C@]45CC6OC(C4)N(c4ccccc41)[C@@]2(O6)[C@H]35", "is_randomized": false, "is_kekulized": false} |
task_00002783 | index | multi_index_nbr_3 | Which atoms in O=S(=O)(N(C)C)[C@H]1[C@H](C(F)(F)F)CN(c2nc(ccc2)C(=O)O)C1 are in saturated rings, which atoms are unspecified stereocenters, and which atoms are in rings? Return a JSON object with saturated_ring_index, unspecified_stereocenter_index, and ring_index containing lists of the corresponding atom indices. | {"saturated_ring_index": [6, 7, 12, 13, 23], "unspecified_stereocenter_index": [], "ring_index": [6, 7, 12, 13, 14, 15, 16, 17, 18, 19, 23]} | null | CN(C)S(=O)(=O)[C@@H]1CN(c2cccc(C(=O)O)n2)C[C@H]1C(F)(F)F | 250-1000 | 3 | {"smiles": "O=S(=O)(N(C)C)[C@H]1[C@H](C(F)(F)F)CN(c2nc(ccc2)C(=O)O)C1", "is_randomized": true, "is_kekulized": false} |
task_00001698 | count | single_count_brics_decomposition | For CCOCCCNCC(C)N(CCN(C)C)CC(C)C, how many BRICS fragments are present? Return the answer as a JSON object with the key brics_decomposition_count. | {"brics_decomposition_count": 9} | null | CCOCCCNCC(C)N(CCN(C)C)CC(C)C | 0-250 | 1 | {"smiles": "CCOCCCNCC(C)N(CCN(C)C)CC(C)C", "is_randomized": false, "is_kekulized": true} |
task_00001813 | count | multi_count_nbr_2 | How many branch points and hydrogen bond acceptors are present in CC(=O)O[C@]1(C(=O)CCl)C(C)C[C@H]2[C@@H]3CC(F)C4=C(F)C(=O)C=C[C@]4(C)[C@@]3(F)C(O)C[C@@]21C? Please provide your answer as a JSON object with branch_point_count and hba_count. | {"branch_point_count": 14, "hba_count": 5} | null | CC(=O)O[C@]1(C(=O)CCl)C(C)C[C@H]2[C@@H]3CC(F)C4=C(F)C(=O)C=C[C@]4(C)[C@@]3(F)C(O)C[C@@]21C | 250-1000 | 2 | {"smiles": "CC(=O)O[C@]1(C(=O)CCl)C(C)C[C@H]2[C@@H]3CC(F)C4=C(F)C(=O)C=C[C@]4(C)[C@@]3(F)C(O)C[C@@]21C", "is_randomized": false, "is_kekulized": false} |
task_00001137 | index | single_index_murcko_scaffold | Which atoms in Cc1cc2c(cn1)c(=O)n(C)c1cc(OCC(CC(C)C)NC(=O)O)c(Cl)cc21 are part of the Murcko scaffold? List the atom indices that define the scaffold and respond with a JSON mapping using murcko_scaffold_index for the index list. | {"murcko_scaffold_index": [1, 2, 3, 4, 5, 6, 7, 8, 9, 11, 12, 13, 25, 27, 28]} | null | Cc1cc2c(cn1)c(=O)n(C)c1cc(OCC(CC(C)C)NC(=O)O)c(Cl)cc21 | 1000-inf | 1 | {"smiles": "Cc1cc2c(cn1)c(=O)n(C)c1cc(OCC(CC(C)C)NC(=O)O)c(Cl)cc21", "is_randomized": false, "is_kekulized": false} |
task_00002072 | count | multi_count_nbr_2 | How many rotatable bonds and how many atoms are in the Murcko scaffold of C(N[C@@H](C(N[C@@H](CO)C(=O)O)=O)CC(O)=O)(CNC([C@H](NC(CNC(=O)CCCCCN=[N+]=[N-])=O)CCCN=C(N)N)=O)=O? Provide the answer as a JSON object with rotatable_bond_count and murcko_scaffold_count. | {"rotatable_bond_count": 23, "murcko_scaffold_count": 0} | null | [N-]=[N+]=NCCCCCC(=O)NCC(=O)N[C@H](CCCN=C(N)N)C(=O)NCC(=O)N[C@H](CC(=O)O)C(=O)N[C@@H](CO)C(=O)O | 1000-inf | 2 | {"smiles": "C(N[C@@H](C(N[C@@H](CO)C(=O)O)=O)CC(O)=O)(CNC([C@H](NC(CNC(=O)CCCCCN=[N+]=[N-])=O)CCCN=C(N)N)=O)=O", "is_randomized": true, "is_kekulized": false} |
task_00002720 | index | multi_index_nbr_2 | In the molecule C[C@]12CCC3(C=C1C[C@@H](CCCI)[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@@]2(O)C(F)(F)C(F)(F)F)SCCS3, which atoms are S-stereocenters and which atoms are part of fused rings? Please provide your answer showing the positions for r_s_stereocenter_s_index and fused_ring_index. | {"r_s_stereocenter_s_index": [14, 17, 19, 22], "fused_ring_index": [1, 2, 3, 4, 5, 6, 7, 8, 13, 14, 15, 16, 17, 19, 20, 21, 22]} | null | C[C@]12CCC3(C=C1C[C@@H](CCCI)[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@@]2(O)C(F)(F)C(F)(F)F)SCCS3 | 250-1000 | 2 | {"smiles": "C[C@]12CCC3(C=C1C[C@@H](CCCI)[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@@]2(O)C(F)(F)C(F)(F)F)SCCS3", "is_randomized": false, "is_kekulized": true} |
task_00002671 | index | multi_index_nbr_2 | Which atoms in CN(CC1CCOCC1)CC1(CNC2CC2)CCOCC1 are heavy atoms, and which atoms are part of aromatic rings? Identify the atom positions (indices) for each and return a JSON object with aromatic_ring_index and heavy_atom_index containing the respective index lists. | {"aromatic_ring_index": [], "heavy_atom_index": [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20]} | null | CN(CC1CCOCC1)CC1(CNC2CC2)CCOCC1 | 250-1000 | 2 | {"smiles": "CN(CC1CCOCC1)CC1(CNC2CC2)CCOCC1", "is_randomized": false, "is_kekulized": false} |
task_00001433 | index | single_index_unspecified_stereocenter | Which atoms in O1C(CCC1C)C(CN)OC(C(C)O)C are unspecified stereocenters? Please provide the indices of these positions in your answer under unspecified_stereocenter_index. | {"unspecified_stereocenter_index": [1, 4, 6, 10, 11]} | null | CC1CCC(C(CN)OC(C)C(C)O)O1 | 0-250 | 1 | {"smiles": "O1C(CCC1C)C(CN)OC(C(C)O)C", "is_randomized": true, "is_kekulized": true} |
task_00002327 | count | multi_count_nbr_5 | For the molecule O=C1CC23C[C@@]45C6C(=C(OC(=S)OC7=C(F)C(F)=C(F)C(F)=C7F)C=CC6C[C@@H](N2CC2CC2)[C@]34O)O[C@@H]15, how many of each of the following are there? Provide your answer as JSON with aliphatic_ring_count, molecular_formula_count, oxidation_state_N_min_count, r_s_stereocenter_r_count, and brics_decomposition_cou... | {"aliphatic_ring_count": 8, "molecular_formula_count": "C26H20F5NO5S", "oxidation_state_N_min_count": 1, "r_s_stereocenter_r_count": 2, "brics_decomposition_count": 4} | null | O=C1CC23C[C@@]45C6C(=C(OC(=S)Oc7c(F)c(F)c(F)c(F)c7F)C=CC6C[C@@H](N2CC2CC2)[C@]34O)O[C@@H]15 | 1000-inf | 5 | {"smiles": "O=C1CC23C[C@@]45C6C(=C(OC(=S)OC7=C(F)C(F)=C(F)C(F)=C7F)C=CC6C[C@@H](N2CC2CC2)[C@]34O)O[C@@H]15", "is_randomized": false, "is_kekulized": true} |
task_00002893 | index | multi_index_nbr_5 | Which atom indices in C[C@@]12CC[C@H]3[C@H]4C[C@@H](O)C5=CC(CC[C@@]53C)OC(CO)[C@H]1CC[C@@H]42 correspond to: atoms in aliphatic rings, atoms in rings, atoms in saturated rings, bridgehead atoms, and terminal carbons? Provide the answer as a JSON object mapping aliphatic_ring_index, ring_index, saturated_ring_index, bri... | {"aliphatic_ring_index": [1, 2, 3, 4, 5, 6, 7, 9, 10, 11, 12, 13, 14, 16, 17, 20, 21, 22, 23], "ring_index": [1, 2, 3, 4, 5, 6, 7, 9, 10, 11, 12, 13, 14, 16, 17, 20, 21, 22, 23], "saturated_ring_index": [1, 2, 3, 4, 5, 6, 7, 9, 11, 12, 13, 14, 16, 17, 20, 21, 22, 23], "bridgehead_index": [1, 4, 5, 9, 11, 14, 20, 23], "... | null | C[C@@]12CC[C@H]3[C@H]4C[C@@H](O)C5=CC(CC[C@@]53C)OC(CO)[C@H]1CC[C@@H]42 | 250-1000 | 5 | {"smiles": "C[C@@]12CC[C@H]3[C@H]4C[C@@H](O)C5=CC(CC[C@@]53C)OC(CO)[C@H]1CC[C@@H]42", "is_randomized": false, "is_kekulized": true} |
task_00001622 | count | single_count_hbd | How many hydrogen bond donors are present in the molecule C(=O)(CCN1C(CC)N(NC1S)CCO)O? Provide the numerical answer as a JSON object using the field hbd_count. | {"hbd_count": 4} | null | CCC1N(CCO)NC(S)N1CCC(=O)O | 0-250 | 1 | {"smiles": "C(=O)(CCN1C(CC)N(NC1S)CCO)O", "is_randomized": true, "is_kekulized": true} |
task_00002750 | index | multi_index_nbr_3 | In the molecule O=C(C1=NC=CC2=CC=CC=C12)C1N(C)C(=NC=1)C, which atoms can act as hydrogen bond acceptors, which are halogen atoms, and which represent branch points? Please provide the indices for hba_index, halogen_atom_index, and branch_point_index. | {"hba_index": [0, 3, 13, 16], "halogen_atom_index": [], "branch_point_index": [1, 2, 6, 11, 12, 15]} | null | Cc1ncc(C(=O)c2nccc3ccccc23)n1C | 250-1000 | 3 | {"smiles": "O=C(C1=NC=CC2=CC=CC=C12)C1N(C)C(=NC=1)C", "is_randomized": true, "is_kekulized": true} |
task_00003278 | index | multi_index_nbr_2 | Which atoms in C[Si](C)(C)CCC12CC3CC(CC1C3)C2 are part of saturated rings, and which atoms are bridgehead atoms? Please provide the indices for bridgehead_index and saturated_ring_index. | {"bridgehead_index": [6, 8, 10, 12], "saturated_ring_index": [6, 7, 8, 9, 10, 11, 12, 13, 14]} | null | C[Si](C)(C)CCC12CC3CC(CC1C3)C2 | 0-250 | 2 | {"smiles": "C[Si](C)(C)CCC12CC3CC(CC1C3)C2", "is_randomized": false, "is_kekulized": false} |
task_00000695 | index | single_index_branch_point | Which atoms in Cc1ccc(C(=O)c2cn(Cc3cc(OCC(=O)O)ccc3Cl)c3nc(C(F)(F)F)ccc23)cc1 serve as branch points? Please identify the positions of these branching atoms and provide your answer with branch_point_index. | {"branch_point_index": [1, 4, 5, 7, 11, 13, 16, 21, 23, 25, 26, 32]} | null | Cc1ccc(C(=O)c2cn(Cc3cc(OCC(=O)O)ccc3Cl)c3nc(C(F)(F)F)ccc23)cc1 | 1000-inf | 1 | {"smiles": "Cc1ccc(C(=O)c2cn(Cc3cc(OCC(=O)O)ccc3Cl)c3nc(C(F)(F)F)ccc23)cc1", "is_randomized": false, "is_kekulized": false} |
task_00002267 | count | multi_count_nbr_5 | For the molecule COc1cc(Oc2nc(-c3ccc(NC(=O)C(C)O)cc3)nn3c(C)nc(C)c23)cc(OC)c1OC, count how many heavy atoms, how many carbon atoms, give the molecular formula (the molecular formula itself, not a numeric count), how many hydrogen atoms, and how many heteroatoms. Provide your answers as a JSON object with keys heavy_ato... | {"heavy_atom_count": 36, "carbon_atom_count": 25, "molecular_formula_count": "C25H27N5O6", "hydrogen_atom_count": 27, "hetero_atom_count": 11} | null | COc1cc(Oc2nc(-c3ccc(NC(=O)C(C)O)cc3)nn3c(C)nc(C)c23)cc(OC)c1OC | 1000-inf | 5 | {"smiles": "COc1cc(Oc2nc(-c3ccc(NC(=O)C(C)O)cc3)nn3c(C)nc(C)c23)cc(OC)c1OC", "is_randomized": false, "is_kekulized": false} |
task_00001513 | index | single_index_carbon_atom | Which carbon atoms are present in OC(CN1CCC(CC1)C)CNC(CCC)C1CC1? Please provide your answer using carbon_atom_index for the list of their positions. | {"carbon_atom_index": [1, 2, 4, 5, 6, 7, 8, 9, 10, 12, 13, 14, 15, 16, 17, 18]} | null | CCCC(NCC(O)CN1CCC(C)CC1)C1CC1 | 0-250 | 1 | {"smiles": "OC(CN1CCC(CC1)C)CNC(CCC)C1CC1", "is_randomized": true, "is_kekulized": false} |
task_00000284 | count | single_count_stereocenter | How many stereocenters are present in CCCC(CC)CC(C)C(C)CC1CC1C(C)C(C)CCC12CCC(C(C)C(C)(C3CC3)C(C)C(C)(C)CCCC3CC3C)C1C2? Provide your answer as a JSON object with the key stereocenter_count and a numeric value. | {"stereocenter_count": 15} | null | CCCC(CC)CC(C)C(C)CC1CC1C(C)C(C)CCC12CCC(C(C)C(C)(C3CC3)C(C)C(C)(C)CCCC3CC3C)C1C2 | 250-1000 | 1 | {"smiles": "CCCC(CC)CC(C)C(C)CC1CC1C(C)C(C)CCC12CCC(C(C)C(C)(C3CC3)C(C)C(C)(C)CCCC3CC3C)C1C2", "is_randomized": false, "is_kekulized": true} |
task_00002010 | count | multi_count_nbr_5 | How many heterocycles, stereocenters, carbon atoms, and phosphorus atoms at minimum oxidation are in CCCNC(C1=CN=CN=C1)C(C(F)(F)F)C(F)(F)F? Also, what is the molecular formula? Please provide your answer using molecular_formula_count, heterocycle_count, stereocenter_count, carbon_atom_count, and oxidation_state_P_min_c... | {"molecular_formula_count": "C11H13F6N3", "heterocycle_count": 1, "stereocenter_count": 1, "carbon_atom_count": 11, "oxidation_state_P_min_count": 0} | null | CCCNC(c1cncnc1)C(C(F)(F)F)C(F)(F)F | 250-1000 | 5 | {"smiles": "CCCNC(C1=CN=CN=C1)C(C(F)(F)F)C(F)(F)F", "is_randomized": false, "is_kekulized": true} |
task_00003382 | index | multi_index_nbr_3 | Which atoms in C1CCC1(CC)NCC(=CCl)C are heavy atoms (non-hydrogen), which atoms are part of any aromatic ring, and which atoms lie in the largest ring? List the index positions for each feature. Provide your answer as a JSON object with heavy_atom_index, aromatic_ring_index, and smallest_largest_ring_size_largest_index... | {"heavy_atom_index": [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11], "aromatic_ring_index": [], "smallest_largest_ring_size_largest_index": [0, 1, 2, 3]} | null | CCC1(NCC(C)=CCl)CCC1 | 0-250 | 3 | {"smiles": "C1CCC1(CC)NCC(=CCl)C", "is_randomized": true, "is_kekulized": true} |
task_00001057 | index | single_index_hbd | Which atoms in c1(cc(/N=N/c2cc(ccc2S(=O)(O)=O)S(O)(O)O)c(OCCO)cc1/N=N/c1c(S(O)(O)O)cc2c(c1O)cc(N)cc2)OCCO can act as hydrogen bond donors? Please provide the indices of these atoms in your answer using hbd_index. | {"hbd_index": [13, 16, 17, 18, 23, 31, 32, 33, 38, 41, 47]} | null | Nc1ccc2cc(S(O)(O)O)c(/N=N/c3cc(OCCO)c(/N=N/c4cc(S(O)(O)O)ccc4S(=O)(=O)O)cc3OCCO)c(O)c2c1 | 1000-inf | 1 | {"smiles": "c1(cc(/N=N/c2cc(ccc2S(=O)(O)=O)S(O)(O)O)c(OCCO)cc1/N=N/c1c(S(O)(O)O)cc2c(c1O)cc(N)cc2)OCCO", "is_randomized": true, "is_kekulized": false} |
task_00000256 | count | single_count_r_s_stereocenter | How many S-stereocenters does C[C@]12[C@@](C(F)(C(F)(F)F)F)(O)CC[C@H]2[C@H]2[C@@H]([C@]3(C)C(C[C@H]2CCCI)=CC2(CC3)SCCS2)CC1 have? Provide the answer as a JSON mapping with the field r_s_stereocenter_s_count containing the count. | {"r_s_stereocenter_s_count": 4} | null | C[C@]12CCC3(C=C1C[C@@H](CCCI)[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@@]2(O)C(F)(F)C(F)(F)F)SCCS3 | 250-1000 | 1 | {"smiles": "C[C@]12[C@@](C(F)(C(F)(F)F)F)(O)CC[C@H]2[C@H]2[C@@H]([C@]3(C)C(C[C@H]2CCCI)=CC2(CC3)SCCS2)CC1", "is_randomized": true, "is_kekulized": true} |
task_00002857 | index | multi_index_nbr_5 | Identify the atom indices in NCC(O)C(=O)NC1CC(N)C(C2OC(CN)C(O)C(O)C2NCC2CC(N)C2)C(O)C1OC1OC(CO)C(O)C(N)C1O for the following categories: hydrogen bond donors, BRICS breakpoints, branch points, unspecified stereocenters, and atoms that are part of saturated rings. Provide the results as a JSON object with the keys hbd_i... | {"hbd_index": [0, 3, 6, 10, 16, 18, 20, 22, 27, 30, 37, 39, 41, 43], "brics_decomposition_index": [4, 6, 7, 11, 12, 14, 15, 21, 22, 23, 24, 31, 32, 33, 35, 36], "branch_point_index": [2, 4, 7, 9, 11, 12, 14, 17, 19, 21, 24, 26, 29, 31, 33, 35, 38, 40, 42], "unspecified_stereocenter_index": [2, 7, 9, 11, 12, 14, 17, 19,... | null | NCC(O)C(=O)NC1CC(N)C(C2OC(CN)C(O)C(O)C2NCC2CC(N)C2)C(O)C1OC1OC(CO)C(O)C(N)C1O | 250-1000 | 5 | {"smiles": "NCC(O)C(=O)NC1CC(N)C(C2OC(CN)C(O)C(O)C2NCC2CC(N)C2)C(O)C1OC1OC(CO)C(O)C(N)C1O", "is_randomized": false, "is_kekulized": true} |
task_00001283 | index | single_index_aromatic_ring | Which atoms in c1cc[nH]c1-c1ccco1 are part of aromatic rings? Please provide your answer as a JSON object with aromatic_ring_index containing the indices of these atoms. | {"aromatic_ring_index": [0, 1, 2, 3, 4, 5, 6, 7, 8, 9]} | null | c1c[nH]c(-c2ccco2)c1 | 0-250 | 1 | {"smiles": "c1cc[nH]c1-c1ccco1", "is_randomized": true, "is_kekulized": false} |
task_00003392 | index | multi_index_nbr_3 | Which atoms in C([C@H]1CC[C@H]2OC(=O)[C@@H]1C2)(OC)=O are bridgehead atoms, which carbons have reached their maximum oxidation state, and which atoms form the longest carbon chain? Please provide your answer with bridgehead_index, oxidation_state_C_max_index, and longest_carbon_chain_index. | {"bridgehead_index": [4, 8], "oxidation_state_C_max_index": [0, 6], "longest_carbon_chain_index": [0, 1, 2, 3, 4, 9, 8, 6]} | null | COC(=O)[C@H]1CC[C@@H]2C[C@H]1C(=O)O2 | 0-250 | 3 | {"smiles": "C([C@H]1CC[C@H]2OC(=O)[C@@H]1C2)(OC)=O", "is_randomized": true, "is_kekulized": false} |
task_00001501 | index | single_index_carbon_atom | Which atom indices in NCC1(C(N)C(C)C)CC1 correspond to carbon atoms? Provide your answer as a JSON object with carbon_atom_index containing the list of carbon atom indices. | {"carbon_atom_index": [1, 2, 3, 5, 6, 7, 8, 9]} | null | CC(C)C(N)C1(CN)CC1 | 0-250 | 1 | {"smiles": "NCC1(C(N)C(C)C)CC1", "is_randomized": true, "is_kekulized": true} |
task_00001226 | count | single_count_smallest_largest_ring_size | How many atoms make up the smallest ring in OC1CCCCCCCCCCCCCCCCCCCCCCCCC1? Provide your answer as a JSON object with the key smallest_largest_ring_size_smallest_count and a numeric value. | {"smallest_largest_ring_size_smallest_count": 26} | null | OC1CCCCCCCCCCCCCCCCCCCCCCCCC1 | 0-250 | 1 | {"smiles": "OC1CCCCCCCCCCCCCCCCCCCCCCCCC1", "is_randomized": false, "is_kekulized": true} |
task_00001636 | count | single_count_hbd | How many hydrogen bond donors are present in O=C(CCCCN)NC1CC(C)CC(C)C1? Provide your answer with hbd_count. | {"hbd_count": 2} | null | CC1CC(C)CC(NC(=O)CCCCN)C1 | 0-250 | 1 | {"smiles": "O=C(CCCCN)NC1CC(C)CC(C)C1", "is_randomized": true, "is_kekulized": true} |
task_00000086 | count | single_count_chain_termini | How many terminal carbons are present in C=C[Si]1(C(C)(C)C)O[Si](C=C)(C(C)(C)C)O[Si](C=C)(C(C)(C)C)O[Si](C=C)(C(C)(C)C)O1? Please provide your answer for chain_termini_count. | {"chain_termini_count": 16} | null | C=C[Si]1(C(C)(C)C)O[Si](C=C)(C(C)(C)C)O[Si](C=C)(C(C)(C)C)O[Si](C=C)(C(C)(C)C)O1 | 250-1000 | 1 | {"smiles": "C=C[Si]1(C(C)(C)C)O[Si](C=C)(C(C)(C)C)O[Si](C=C)(C(C)(C)C)O[Si](C=C)(C(C)(C)C)O1", "is_randomized": false, "is_kekulized": true} |
task_00002861 | index | multi_index_nbr_5 | Which atoms in C1OC2C(N(C1)C(CN1CC3N(CC1)C(=O)OC3)=O)=CC=CC=2 are in fused rings, which carbon atoms are at the maximum oxidation state, which atoms are R-stereocenters, which atoms belong to the smallest ring, and which atoms form the longest carbon chain? Provide the indices as JSON using keys fused_ring_index, oxida... | {"fused_ring_index": [0, 1, 2, 3, 4, 5, 8, 9, 10, 11, 12, 13, 14, 16, 17, 19, 20, 21, 22], "oxidation_state_C_max_index": [14], "r_s_stereocenter_r_index": [], "smallest_largest_ring_size_smallest_index": [10, 11, 14, 16, 17], "longest_carbon_chain_index": [2, 3, 19, 20, 21, 22]} | null | O=C(CN1CCN2C(=O)OCC2C1)N1CCOc2ccccc21 | 250-1000 | 5 | {"smiles": "C1OC2C(N(C1)C(CN1CC3N(CC1)C(=O)OC3)=O)=CC=CC=2", "is_randomized": true, "is_kekulized": true} |
task_00001729 | index | single_index_functional_group | Which atoms in C(C#C)NC(=S)N[NH3+] form the carbodiimide functional group? Identify their atom indices and give the result as a JSON mapping with functional_group_carbodiimide_index containing the list of indices. | {"functional_group_carbodiimide_index": []} | null | C#CCNC(=S)N[NH3+] | 0-250 | 1 | {"smiles": "C(C#C)NC(=S)N[NH3+]", "is_randomized": true, "is_kekulized": true} |
task_00002605 | count | multi_count_nbr_5 | How many hydrogen-bond donors, E (E‑stereochemistry) double bonds, terminal (chain-end) carbon atoms, rotatable bonds, and carbon atoms are in OCC(=O)N1CCC[C@@H](C)C1? Provide the result as a JSON object with the fields hbd_count, e_z_stereochemistry_double_bond_e_count, chain_termini_count, rotatable_bond_count, and c... | {"hbd_count": 1, "e_z_stereochemistry_double_bond_e_count": 0, "chain_termini_count": 1, "rotatable_bond_count": 1, "carbon_atom_count": 8} | null | C[C@@H]1CCCN(C(=O)CO)C1 | 0-250 | 5 | {"smiles": "OCC(=O)N1CCC[C@@H](C)C1", "is_randomized": true, "is_kekulized": false} |
task_00000393 | index | single_index_halogen_atom | Which atoms in CCO/C(=C\C(=O)OCCOCCOCCOC)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F are halogens? Please identify all their positions and provide your answer as halogen_atom_index. | {"halogen_atom_index": [19, 20, 22, 23, 25, 26, 28, 29, 31, 32, 33]} | null | CCO/C(=C\C(=O)OCCOCCOCCOC)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F | 250-1000 | 1 | {"smiles": "CCO/C(=C\\C(=O)OCCOCCOCCOC)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F", "is_randomized": false, "is_kekulized": true} |
task_00000833 | index | single_index_r_s_stereocenter | Which atoms in C(=N/[C@H]1CCCC[C@@H]1n1nnc(-c2ccccc2)n1)\c1cccc(/C=N/[C@H]2CCCC[C@@H]2n2nnc(-c3ccccc3)n2)n1 are S-configured stereocenters? Identify their positions by index and list those index values. Return the result as a JSON object with r_s_stereocenter_s_index containing the indices. | {"r_s_stereocenter_s_index": [2, 7, 26, 31]} | null | C(=N/[C@H]1CCCC[C@@H]1n1nnc(-c2ccccc2)n1)\c1cccc(/C=N/[C@H]2CCCC[C@@H]2n2nnc(-c3ccccc3)n2)n1 | 1000-inf | 1 | {"smiles": "C(=N/[C@H]1CCCC[C@@H]1n1nnc(-c2ccccc2)n1)\\c1cccc(/C=N/[C@H]2CCCC[C@@H]2n2nnc(-c3ccccc3)n2)n1", "is_randomized": false, "is_kekulized": false} |
task_00001206 | count | single_count_bridgehead | How many bridgehead atoms are present in CC12CCCC3CC1CCC3(C)C2O? Please provide your answer with bridgehead_count. | {"bridgehead_count": 4} | null | CC12CCCC3CC1CCC3(C)C2O | 0-250 | 1 | {"smiles": "CC12CCCC3CC1CCC3(C)C2O", "is_randomized": false, "is_kekulized": true} |
task_00002060 | count | multi_count_nbr_2 | How many aromatic rings and heavy atoms are present in N(C(=O)c1nc(ccc1)Br)c1ccc(cc1)-n1cc(nn1)-c1cc(ccc1)NC(C=C)=O? Please provide your answer for heavy_atom_count and aromatic_ring_count. | {"heavy_atom_count": 32, "aromatic_ring_count": 4} | null | C=CC(=O)Nc1cccc(-c2cn(-c3ccc(NC(=O)c4cccc(Br)n4)cc3)nn2)c1 | 1000-inf | 2 | {"smiles": "N(C(=O)c1nc(ccc1)Br)c1ccc(cc1)-n1cc(nn1)-c1cc(ccc1)NC(C=C)=O", "is_randomized": true, "is_kekulized": false} |
task_00002272 | count | multi_count_nbr_5 | How many heteroatoms, hydrogen atoms, rotatable bonds, and halogen atoms are in the structure O=C(O)CN(CC(=O)O)C(=O)CN(CC(=O)N(CC(=O)O)CC(=O)O)C(=O)COCC(CC(F)(F)F)(CC(F)(F)F)CC(F)(F)F, and what is the molecular formula for O=C(O)CN(CC(=O)O)C(=O)CN(CC(=O)N(CC(=O)O)CC(=O)O)C(=O)COCC(CC(F)(F)F)(CC(F)(F)F)CC(F)(F)F? Provid... | {"hetero_atom_count": 24, "hydrogen_atom_count": 26, "rotatable_bond_count": 19, "halogen_atom_count": 9, "molecular_formula_count": "C22H26F9N3O12"} | null | O=C(O)CN(CC(=O)O)C(=O)CN(CC(=O)N(CC(=O)O)CC(=O)O)C(=O)COCC(CC(F)(F)F)(CC(F)(F)F)CC(F)(F)F | 1000-inf | 5 | {"smiles": "O=C(O)CN(CC(=O)O)C(=O)CN(CC(=O)N(CC(=O)O)CC(=O)O)C(=O)COCC(CC(F)(F)F)(CC(F)(F)F)CC(F)(F)F", "is_randomized": false, "is_kekulized": false} |
task_00000196 | count | single_count_saturated_ring | How many saturated rings are present in the molecule [C@H]12[C@]3([C@@H](C([C@H](C(=O)C1)C3)=C)O)[C@H]1C[C@@H]3[C@@]24[C@H](CC[C@@]3(C)CN(CC)[C@@H]14)O? Please provide your answer as saturated_ring_count. | {"saturated_ring_count": 6} | null | C=C1[C@H]2C[C@]3([C@@H]1O)[C@@H](CC2=O)[C@@]12[C@@H]4[C@@H]3C[C@H]1[C@@](C)(CC[C@@H]2O)CN4CC | 250-1000 | 1 | {"smiles": "[C@H]12[C@]3([C@@H](C([C@H](C(=O)C1)C3)=C)O)[C@H]1C[C@@H]3[C@@]24[C@H](CC[C@@]3(C)CN(CC)[C@@H]14)O", "is_randomized": true, "is_kekulized": false} |
task_00002115 | count | multi_count_nbr_2 | How many sp3 carbon atoms and how many heteroatoms are in O=C(COC1=CC=C(/C=N/NC(=O)C2=CC([N+](=O)[O-])=CC([N+](=O)[O-])=C2)C=C1)NC1=CC=CC([N+](=O)[O-])=C1? Provide the answer as a JSON object with hetero_atom_count and csp3_carbon_count, each value being the corresponding numerical count. | {"hetero_atom_count": 15, "csp3_carbon_count": 1} | null | O=C(COc1ccc(/C=N/NC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)cc1)Nc1cccc([N+](=O)[O-])c1 | 1000-inf | 2 | {"smiles": "O=C(COC1=CC=C(/C=N/NC(=O)C2=CC([N+](=O)[O-])=CC([N+](=O)[O-])=C2)C=C1)NC1=CC=CC([N+](=O)[O-])=C1", "is_randomized": false, "is_kekulized": true} |
task_00002472 | count | multi_count_nbr_3 | How many atoms are in phosphonium groups, how many heteroatoms are there, and how many rotatable bonds are present in C([P+](CC)(CC(CO)(O)Br)CC)C? Provide your answer as JSON with functional_group_phosphonium_count, hetero_atom_count, and rotatable_bond_count. | {"functional_group_phosphonium_count": 1, "hetero_atom_count": 4, "rotatable_bond_count": 6} | null | CC[P+](CC)(CC)CC(O)(Br)CO | 0-250 | 3 | {"smiles": "C([P+](CC)(CC(CO)(O)Br)CC)C", "is_randomized": true, "is_kekulized": false} |
task_00000930 | count | single_count_carbon_atom | How many carbon atoms are present in c1c(ccc(c1)F)-c1ccc2oc(cc2c1)COC(=O)Nc1c(cc(-c2ccc(F)cc2)cc1)C(=O)O? Please provide your answer using carbon_atom_count. | {"carbon_atom_count": 29} | null | O=C(Nc1ccc(-c2ccc(F)cc2)cc1C(=O)O)OCc1cc2cc(-c3ccc(F)cc3)ccc2o1 | 1000-inf | 1 | {"smiles": "c1c(ccc(c1)F)-c1ccc2oc(cc2c1)COC(=O)Nc1c(cc(-c2ccc(F)cc2)cc1)C(=O)O", "is_randomized": true, "is_kekulized": false} |
task_00000042 | count | single_count_bridgehead | How many bridgehead atoms are in C123CCC(C(C1O)=C)C(OC(=O)C)C2C12C4C5(C(OC1CC5)N(C2C3C4)CC)C? Provide the answer as a JSON object with the key bridgehead_count containing the numerical count. | {"bridgehead_count": 9} | null | C=C1C2CCC3(C1O)C1CC4C5(C)CCC6OC5N(CC)C1C64C3C2OC(C)=O | 250-1000 | 1 | {"smiles": "C123CCC(C(C1O)=C)C(OC(=O)C)C2C12C4C5(C(OC1CC5)N(C2C3C4)CC)C", "is_randomized": true, "is_kekulized": false} |
task_00002514 | count | multi_count_nbr_3 | For C#CCNC(=S)N[NH3+], how many atoms are part of carbodiimide groups, how many hydrogen-bond acceptors are present, and what is the molecular formula count? Provide your answer as a JSON mapping with functional_group_carbodiimide_count, hba_count, and molecular_formula_count. | {"functional_group_carbodiimide_count": 0, "hba_count": 1, "molecular_formula_count": "C4H8N3S+"} | null | C#CCNC(=S)N[NH3+] | 0-250 | 3 | {"smiles": "C#CCNC(=S)N[NH3+]", "is_randomized": false, "is_kekulized": true} |
task_00000432 | count | single_count_molecular_formula | What is the molecular formula for the compound with structure O=S(=O)([C@H]1[C@H](C(F)(F)F)CN(C1)C1N=C(C=CC=1)C(O)=O)N(C)C? Provide your answer as the complete molecular formula (like C₆H₁₂O₆), not as a count.
Return the answer as JSON with key `molecular_formula_count`. | {"molecular_formula_count": "C13H16F3N3O4S"} | null | CN(C)S(=O)(=O)[C@@H]1CN(c2cccc(C(=O)O)n2)C[C@H]1C(F)(F)F | 250-1000 | 1 | {"smiles": "O=S(=O)([C@H]1[C@H](C(F)(F)F)CN(C1)C1N=C(C=CC=1)C(O)=O)N(C)C", "is_randomized": true, "is_kekulized": true} |
task_00003062 | index | multi_index_nbr_3 | Which atoms in c1(sc2c(C)c3c(c(C)c4c5c(sc4c3cc2c1C)c(c1c(c2c(c(C)c1c5C)sc(c2C)C)C)C)C)C are terminal carbons, which atoms are part of rings, and which atoms are bridgehead atoms? Identify the atom indices for each category and return them as a JSON object with the keys chain_termini_index, ring_index, and bridgehead_in... | {"chain_termini_index": [4, 8, 18, 25, 28, 32, 33, 34, 35, 36, 37], "ring_index": [0, 1, 2, 3, 5, 6, 7, 9, 10, 11, 12, 13, 14, 15, 16, 17, 19, 20, 21, 22, 23, 24, 26, 27, 29, 30, 31], "bridgehead_index": []} | null | Cc1sc2c(C)c3c(C)c(C)c4c(sc5c(C)c6c(C)c7c(C)c(C)sc7c(C)c6c(C)c54)c3cc2c1C | 1000-inf | 3 | {"smiles": "c1(sc2c(C)c3c(c(C)c4c5c(sc4c3cc2c1C)c(c1c(c2c(c(C)c1c5C)sc(c2C)C)C)C)C)C", "is_randomized": true, "is_kekulized": false} |
task_00003488 | index | multi_index_nbr_5 | Which atoms in C(C)N(C(=O)CN(CCN)CCCC)CC are located at the following positions? List their indices for each case:
- atoms in fused rings,
- heavy atoms,
- atoms in the longest carbon chain,
- hydrogen bond donors,
- atoms involved in rotatable bonds.
Provide the answer as a JSON object with fused_ring_index, heavy_at... | {"fused_ring_index": [], "heavy_atom_index": [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15], "longest_carbon_chain_index": [10, 11, 12, 13], "hbd_index": [9], "rotatable_bond_index": [0, 2, 3, 5, 6, 7, 8, 10, 11, 12, 14]} | null | CCCCN(CCN)CC(=O)N(CC)CC | 0-250 | 5 | {"smiles": "C(C)N(C(=O)CN(CCN)CCCC)CC", "is_randomized": true, "is_kekulized": true} |
task_00000202 | count | single_count_csp3_carbon | How many sp3 carbons are in C(CCCCCCCC1N(C=C[N+]=1CCCCCCCCCCCCCCCCCC)CCCCCCCCCCCCCCCCCC)C? Give the integer count and return it as a JSON object with the key csp3_carbon_count. | {"csp3_carbon_count": 45} | null | CCCCCCCCCCCCCCCCCCn1cc[n+](CCCCCCCCCCCCCCCCCC)c1CCCCCCCCC | 250-1000 | 1 | {"smiles": "C(CCCCCCCC1N(C=C[N+]=1CCCCCCCCCCCCCCCCCC)CCCCCCCCCCCCCCCCCC)C", "is_randomized": true, "is_kekulized": true} |
task_00003490 | index | multi_index_nbr_5 | Which atoms in [C@@H]12OC(C)(O[C@H]2CCCC1)C correspond to saturated rings, heteroatoms, heavy atoms, atoms in the largest ring, and sulfur atoms at their maximum oxidation state? Provide your answer as a JSON structure with saturated_ring_index, hetero_atom_index, heavy_atom_index, smallest_largest_ring_size_largest_in... | {"saturated_ring_index": [0, 1, 2, 4, 5, 6, 7, 8, 9], "hetero_atom_index": [1, 4], "heavy_atom_index": [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10], "smallest_largest_ring_size_largest_index": [0, 5, 6, 7, 8, 9], "oxidation_state_S_max_index": []} | null | CC1(C)O[C@H]2CCCC[C@H]2O1 | 0-250 | 5 | {"smiles": "[C@@H]12OC(C)(O[C@H]2CCCC1)C", "is_randomized": true, "is_kekulized": false} |
task_00001773 | count | multi_count_nbr_2 | How many atoms make up the longest carbon chain in O=C1CC[C@@]2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CCC3CC2CCC2)[C@H]1O5, and how many sp3 carbon atoms are present? Provide the answer as a JSON object with longest_carbon_chain_count and csp3_carbon_count. | {"longest_carbon_chain_count": 22, "csp3_carbon_count": 15} | null | O=C1CC[C@@]2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CCC3CC2CCC2)[C@H]1O5 | 250-1000 | 2 | {"smiles": "O=C1CC[C@@]2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CCC3CC2CCC2)[C@H]1O5", "is_randomized": false, "is_kekulized": false} |
task_00000862 | count | single_count_stereocenter | How many stereocenters are present in CC1CN(C2=C(C3=CC=C(F)C=C3)C(=O)N(C3=CC=CC(N(C)C)=C3)C2=O)CC(C)O1? Please provide your answer as stereocenter_count. | {"stereocenter_count": 2} | null | CC1CN(C2=C(c3ccc(F)cc3)C(=O)N(c3cccc(N(C)C)c3)C2=O)CC(C)O1 | 1000-inf | 1 | {"smiles": "CC1CN(C2=C(C3=CC=C(F)C=C3)C(=O)N(C3=CC=CC(N(C)C)=C3)C2=O)CC(C)O1", "is_randomized": false, "is_kekulized": true} |
task_00003200 | index | multi_index_nbr_5 | Which atoms in CC(=O)NC12CC(CN3C(C#N)=CC4=C(C)C(CN5CCC6(CC5)CN(C5=NC=NC7=CC=C(CC(F)(F)F)C=C57)C6)=CC=C43)(C1)C2 are in aliphatic rings, in saturated rings, which atoms are carbon, which are in aromatic rings, and which atoms participate in Z-configured (Z) double bonds? Provide the atom indices as JSON using the keys a... | {"aliphatic_ring_index": [4, 5, 6, 18, 19, 20, 21, 22, 23, 24, 25, 41, 45, 46], "saturated_ring_index": [4, 5, 6, 18, 19, 20, 21, 22, 23, 24, 25, 41, 45, 46], "carbon_atom_index": [0, 1, 4, 5, 6, 7, 9, 10, 12, 13, 14, 15, 16, 17, 19, 20, 21, 22, 23, 24, 26, 28, 30, 31, 32, 33, 34, 35, 39, 40, 41, 42, 43, 44, 45, 46], "... | null | CC(=O)NC12CC(Cn3c(C#N)cc4c(C)c(CN5CCC6(CC5)CN(c5ncnc7ccc(CC(F)(F)F)cc57)C6)ccc43)(C1)C2 | 1000-inf | 5 | {"smiles": "CC(=O)NC12CC(CN3C(C#N)=CC4=C(C)C(CN5CCC6(CC5)CN(C5=NC=NC7=CC=C(CC(F)(F)F)C=C57)C6)=CC=C43)(C1)C2", "is_randomized": false, "is_kekulized": true} |
task_00000680 | count | single_count_branch_point | How many branch points are in c1(c(c(c(c2C(c3c(F)c(F)c(F)c(c3F)F)(c3c(F)c(c(c(c3C(F)(c12)F)F)F)F)F)F)F)F)F? Respond with a JSON object using branch_point_count and give a numerical count. | {"branch_point_count": 20} | null | Fc1c(F)c(F)c(C2(F)c3c(F)c(F)c(F)c(F)c3C(F)(F)c3c(F)c(F)c(F)c(F)c32)c(F)c1F | 1000-inf | 1 | {"smiles": "c1(c(c(c(c2C(c3c(F)c(F)c(F)c(c3F)F)(c3c(F)c(c(c(c3C(F)(c12)F)F)F)F)F)F)F)F)F", "is_randomized": true, "is_kekulized": false} |
task_00001049 | index | single_index_hbd | Which atoms in O/C(c1c(CO)ooc2c(c(O)c(O)c(c2O)/C(C(O)=C)=C(C(/O)=C(\CO)O)\O)[nH]1)=C(\O)C(c1c(c(c(c(O)c1O)O)O)O)=C are hydrogen bond donors? Identify and list the atom indices of all hydrogen bond donors. Provide your answer as a JSON mapping with hbd_index containing the list of indices. | {"hbd_index": [0, 5, 11, 13, 16, 19, 23, 26, 27, 28, 29, 31, 38, 40, 41, 42, 43]} | null | C=C(O)/C(=C(O)\C(O)=C(\O)CO)c1c(O)c(O)c2[nH]c(/C(O)=C(/O)C(=C)c3c(O)c(O)c(O)c(O)c3O)c(CO)ooc2c1O | 1000-inf | 1 | {"smiles": "O/C(c1c(CO)ooc2c(c(O)c(O)c(c2O)/C(C(O)=C)=C(C(/O)=C(\\CO)O)\\O)[nH]1)=C(\\O)C(c1c(c(c(c(O)c1O)O)O)O)=C", "is_randomized": true, "is_kekulized": false} |
task_00001915 | count | multi_count_nbr_3 | How many unspecified stereocenters, rings, and oxygens at maximum oxidation are present in O1C(CCC(O)C(C1C(C(C)O)C)NC(=O)C)(C(=O)O)C? Please provide your answer as a JSON with unspecified_stereocenter_count, ring_count, and oxidation_state_O_max_count. | {"unspecified_stereocenter_count": 6, "ring_count": 1, "oxidation_state_O_max_count": 6} | null | CC(=O)NC1C(O)CCC(C)(C(=O)O)OC1C(C)C(C)O | 250-1000 | 3 | {"smiles": "O1C(CCC(O)C(C1C(C(C)O)C)NC(=O)C)(C(=O)O)C", "is_randomized": true, "is_kekulized": false} |
task_00000917 | index | single_index_stereochemistry_unspecified_double_bond | Which atoms in CCOC(=O)c1c(C)nc(C)c(OC)c1-c1ccc(-c2ccccc2)c(C(=O)OC(C)(C)C)c1 are involved in double bonds whose E/Z stereochemistry is unspecified? Identify their atom indices and return a JSON object with stereochemistry_unspecified_double_bond_index containing those indices. | {"stereochemistry_unspecified_double_bond_index": []} | null | CCOC(=O)c1c(C)nc(C)c(OC)c1-c1ccc(-c2ccccc2)c(C(=O)OC(C)(C)C)c1 | 1000-inf | 1 | {"smiles": "CCOC(=O)c1c(C)nc(C)c(OC)c1-c1ccc(-c2ccccc2)c(C(=O)OC(C)(C)C)c1", "is_randomized": false, "is_kekulized": false} |
task_00001314 | count | single_count_aliphatic_ring | How many aliphatic rings are in C12C(O1)C1C(C)(C=C)CC2C1? Provide the numeric answer as a JSON object using the key aliphatic_ring_count. | {"aliphatic_ring_count": 3} | null | C=CC1(C)CC2CC1C1OC21 | 0-250 | 1 | {"smiles": "C12C(O1)C1C(C)(C=C)CC2C1", "is_randomized": true, "is_kekulized": true} |
task_00000846 | count | single_count_unspecified_stereocenter | How many stereocenters with unspecified configuration does C1C([C@@H]2C=C[C@@H](CC2)N2C3CCC(CC3C3CCCCC32)C2CC3C(CC2)N(C2CCCCC32)C2CCC(C3CCCCC3)CC2)C=CCC1 contain? Please provide your answer as unspecified_stereocenter_count. | {"unspecified_stereocenter_count": 11} | null | C1=CC([C@@H]2C=C[C@H](N3C4CCCCC4C4CC(C5CCC6C(C5)C5CCCCC5N6C5CCC(C6CCCCC6)CC5)CCC43)CC2)CCC1 | 1000-inf | 1 | {"smiles": "C1C([C@@H]2C=C[C@@H](CC2)N2C3CCC(CC3C3CCCCC32)C2CC3C(CC2)N(C2CCCCC32)C2CCC(C3CCCCC3)CC2)C=CCC1", "is_randomized": true, "is_kekulized": false} |
task_00001232 | count | single_count_smallest_largest_ring_size | How many atoms are in the smallest ring of C1CCOCCCOCCCCOCCCOCCCOCCCCOCCCOC1? Provide the numeric answer as a JSON object with the field smallest_largest_ring_size_smallest_count. | {"smallest_largest_ring_size_smallest_count": 31} | null | C1CCOCCCOCCCCOCCCOCCCOCCCCOCCCOC1 | 0-250 | 1 | {"smiles": "C1CCOCCCOCCCCOCCCOCCCOCCCCOCCCOC1", "is_randomized": false, "is_kekulized": true} |
task_00001779 | count | multi_count_nbr_2 | How many rotatable bonds are in CC(CNS(=O)(=O)C1=CC=CC=C1N)CN1CCCCC1, and what is the molecular formula? Please provide your answer with rotatable_bond_count and molecular_formula_count. | {"rotatable_bond_count": 6, "molecular_formula_count": "C15H25N3O2S"} | null | CC(CNS(=O)(=O)c1ccccc1N)CN1CCCCC1 | 250-1000 | 2 | {"smiles": "CC(CNS(=O)(=O)C1=CC=CC=C1N)CN1CCCCC1", "is_randomized": false, "is_kekulized": true} |
task_00002873 | index | multi_index_nbr_5 | Which atoms in C(C)(C/C(=C/C=C/C(C)CC1C(O1)C(C(O)CC)C)C)/C=C/C(OC(=O)C)C(C)(O)CCC(CC)O[Si](CC)(CC)CC are part of E-double bonds, which ones are heteroatoms, which ones are carbon atoms, which ones are bridgehead atoms, and which ones are heavy atoms? Provide your answer as a JSON object with e_z_stereochemistry_double_... | {"e_z_stereochemistry_double_bond_e_index": [3, 4, 5, 6, 20, 21], "hetero_atom_index": [12, 15, 23, 25, 29, 35, 36], "carbon_atom_index": [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 13, 14, 16, 17, 18, 19, 20, 21, 22, 24, 26, 27, 28, 30, 31, 32, 33, 34, 37, 38, 39, 40, 41, 42], "bridgehead_index": [], "heavy_atom_index": [0... | null | CCC(CCC(C)(O)C(/C=C/C(C)C/C(C)=C/C=C/C(C)CC1OC1C(C)C(O)CC)OC(C)=O)O[Si](CC)(CC)CC | 250-1000 | 5 | {"smiles": "C(C)(C/C(=C/C=C/C(C)CC1C(O1)C(C(O)CC)C)C)/C=C/C(OC(=O)C)C(C)(O)CCC(CC)O[Si](CC)(CC)CC", "is_randomized": true, "is_kekulized": true} |
task_00003220 | index | multi_index_nbr_5 | Looking at the molecule c1c(OC)c(C(NC2C3CC(CC3)C2C(=O)NCC2(CCC2)OC)=O)cc(OC2CCC(C(=O)O)(CC2)C)c1C#N, which atoms would you identify for each of the following features: unspecified stereocenters, atoms that are part of aliphatic rings, atoms involved in Z-double bonds, heteroatoms, and bridgehead atoms? Please provide y... | {"unspecified_stereocenter_index": [7, 8, 10, 13], "aliphatic_ring_index": [7, 8, 9, 10, 11, 12, 13, 18, 19, 20, 21, 28, 29, 30, 31, 35, 36], "e_z_stereochemistry_double_bond_z_index": [], "hetero_atom_index": [2, 6, 15, 16, 22, 24, 27, 33, 34, 40], "bridgehead_index": [8, 10]} | null | COc1cc(C#N)c(OC2CCC(C)(C(=O)O)CC2)cc1C(=O)NC1C2CCC(C2)C1C(=O)NCC1(OC)CCC1 | 1000-inf | 5 | {"smiles": "c1c(OC)c(C(NC2C3CC(CC3)C2C(=O)NCC2(CCC2)OC)=O)cc(OC2CCC(C(=O)O)(CC2)C)c1C#N", "is_randomized": true, "is_kekulized": false} |
task_00002420 | count | multi_count_nbr_2 | How many carbon atoms and how many oxygens at their minimum oxidation state are in CCCCCCCCCCCCCCCCCCC(C)CCCCC? Provide the answer as a JSON object with keys carbon_atom_count and oxidation_state_O_min_count, giving numerical counts. | {"carbon_atom_count": 25, "oxidation_state_O_min_count": 0} | null | CCCCCCCCCCCCCCCCCCC(C)CCCCC | 0-250 | 2 | {"smiles": "CCCCCCCCCCCCCCCCCCC(C)CCCCC", "is_randomized": false, "is_kekulized": true} |
task_00001357 | index | single_index_saturated_ring | Which atoms in C1C2N3C(CC(C2)C(=O)C3)C1 are part of saturated rings? Provide a JSON object with saturated_ring_index containing the indices of those atoms. | {"saturated_ring_index": [0, 1, 2, 3, 4, 5, 6, 7, 9, 10]} | null | O=C1CN2C3CCC2CC1C3 | 0-250 | 1 | {"smiles": "C1C2N3C(CC(C2)C(=O)C3)C1", "is_randomized": true, "is_kekulized": true} |
task_00000069 | index | single_index_smallest_largest_ring_size | Which atoms form the smallest ring in C1CCCCCCCC(CC1)C(C(C)CC)C(C(N)=O)C#N? Identify their positions by index and return a JSON object with smallest_largest_ring_size_smallest_index containing those indices. | {"smallest_largest_ring_size_smallest_index": [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10]} | null | CCC(C)C(C1CCCCCCCCCC1)C(C#N)C(N)=O | 250-1000 | 1 | {"smiles": "C1CCCCCCCC(CC1)C(C(C)CC)C(C(N)=O)C#N", "is_randomized": true, "is_kekulized": false} |
task_00003120 | index | multi_index_nbr_3 | For the molecule CN[C@@H](C)C(=O)Nc1cnc(-c2ccc3c(c2)OCO3)n(Cc2cncc(C(=O)c3ccc(F)cc3)c2)c1=O, identify which atom indices correspond to each of the following:
- atoms that are part of aromatic rings — put their indices under aromatic_ring_index
- atoms involved in Z-configured (Z) double bonds — put their indices under... | {"aromatic_ring_index": [7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 20, 22, 23, 24, 25, 26, 29, 30, 31, 32, 34, 35, 36, 37], "e_z_stereochemistry_double_bond_z_index": [], "stereocenter_index": [2]} | null | CN[C@@H](C)C(=O)Nc1cnc(-c2ccc3c(c2)OCO3)n(Cc2cncc(C(=O)c3ccc(F)cc3)c2)c1=O | 1000-inf | 3 | {"smiles": "CN[C@@H](C)C(=O)Nc1cnc(-c2ccc3c(c2)OCO3)n(Cc2cncc(C(=O)c3ccc(F)cc3)c2)c1=O", "is_randomized": false, "is_kekulized": false} |
task_00000409 | index | single_index_heavy_atom | Which atoms in C1CC[C@H](C(O1)CCC(=O)C(F)(CCCC)F)O[C@@H]1CCC(C1CC=CCCCCCC(OCc1ccccc1)=O)=O are heavy atoms (i.e., non-hydrogen)? List their atom indices. Provide the answer as a JSON mapping with heavy_atom_index containing the index list. | {"heavy_atom_index": [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41]} | null | CCCCC(F)(F)C(=O)CCC1OCCC[C@H]1O[C@@H]1CCC(=O)C1CC=CCCCCCC(=O)OCc1ccccc1 | 250-1000 | 1 | {"smiles": "C1CC[C@H](C(O1)CCC(=O)C(F)(CCCC)F)O[C@@H]1CCC(C1CC=CCCCCCC(OCc1ccccc1)=O)=O", "is_randomized": true, "is_kekulized": false} |
task_00003363 | index | multi_index_nbr_3 | Which atoms in CC(CN)C(O)C1CCCCC1C(F)(F)F serve as branch points, which atoms are involved in unspecified E/Z double bonds, and which atoms can act as hydrogen bond acceptors? Provide your answer as a JSON mapping with branch_point_index, stereochemistry_unspecified_double_bond_index, and hba_index containing the respe... | {"branch_point_index": [1, 4, 6, 11, 12], "stereochemistry_unspecified_double_bond_index": [], "hba_index": [3, 5]} | null | CC(CN)C(O)C1CCCCC1C(F)(F)F | 0-250 | 3 | {"smiles": "CC(CN)C(O)C1CCCCC1C(F)(F)F", "is_randomized": false, "is_kekulized": true} |
task_00001877 | count | multi_count_nbr_3 | Looking at N1(C(C(=O)N2CC3CCC(N3C)CC2)=CC(=C1)Br)C, I need you to determine three things: how many atoms make up the longest carbon chain, how many heterocycles are present, and how many bridgehead atoms there are. Please provide your answer with longest_carbon_chain_count, heterocycle_count, and bridgehead_count. | {"longest_carbon_chain_count": 7, "heterocycle_count": 3, "bridgehead_count": 2} | null | CN1C2CCC1CN(C(=O)c1cc(Br)cn1C)CC2 | 250-1000 | 3 | {"smiles": "N1(C(C(=O)N2CC3CCC(N3C)CC2)=CC(=C1)Br)C", "is_randomized": true, "is_kekulized": true} |
task_00002958 | index | multi_index_nbr_2 | Which atoms in C1=C2C3C4=C5C(C(=O)C6=C(Br)C=C(C(=C6C5=C2Br)Br)Br)=CC=C4C=C2C=3C(C(C3C2=CC=CC=3)=O)=C1 serve as branch points, and which atoms are part of aliphatic rings? Please identify the specific positions for each and provide your answer with branch_point_index and aliphatic_ring_index. | {"branch_point_index": [1, 2, 3, 4, 5, 6, 8, 9, 12, 13, 14, 15, 16, 22, 24, 25, 26, 27, 28, 29], "aliphatic_ring_index": []} | null | O=c1c2ccccc2c2cc3ccc4c(=O)c5c(Br)cc(Br)c(Br)c5c5c(Br)c6ccc1c2c6c3c45 | 1000-inf | 2 | {"smiles": "C1=C2C3C4=C5C(C(=O)C6=C(Br)C=C(C(=C6C5=C2Br)Br)Br)=CC=C4C=C2C=3C(C(C3C2=CC=CC=3)=O)=C1", "is_randomized": true, "is_kekulized": true} |
task_00003225 | index | multi_index_nbr_5 | Which atoms in FC(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(C(F)(F)C(F)(C(F)(F)CCc1ccc(cc1)/C(=N/c1ccccn1)c1ccccc1)F)F)F are heteroatoms, halogen atoms, part of aromatic rings, part of the Murcko scaffold, and involved in Z-double bonds? Please provide the positions of each as hetero_atom_index, halogen_atom_index, aromatic_ring_in... | {"hetero_atom_index": [0, 2, 3, 5, 6, 8, 9, 11, 13, 15, 16, 18, 20, 21, 31, 37, 44, 45, 46], "halogen_atom_index": [0, 2, 3, 5, 6, 8, 9, 11, 13, 15, 16, 18, 20, 21, 44, 45, 46], "aromatic_ring_index": [24, 25, 26, 27, 28, 29, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43], "murcko_scaffold_index": [24, 25, 26, 27, 28,... | null | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCc1ccc(/C(=N/c2ccccn2)c2ccccc2)cc1 | 1000-inf | 5 | {"smiles": "FC(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(C(F)(F)C(F)(C(F)(F)CCc1ccc(cc1)/C(=N/c1ccccn1)c1ccccc1)F)F)F", "is_randomized": true, "is_kekulized": false} |
task_00002819 | index | multi_index_nbr_3 | In the molecule C(/C=C\C/C=C\CCCCCCCCCC(=O)OC(CO)COC(=O)CCCCC/C=C\C/C=C\C/C=C\CC)/C=C\CC, which atoms are part of Z (cis) double bonds, which atoms are heavy (non-hydrogen) atoms, and which atoms belong to aromatic rings? List the atom indices (positions) and return them as a JSON object with the keys e_z_stereochemist... | {"e_z_stereochemistry_double_bond_z_index": [1, 2, 4, 5, 30, 31, 33, 34, 36, 37, 40, 41], "heavy_atom_index": [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43], "aromatic_ring_index": []} | null | CC/C=C\C/C=C\C/C=C\CCCCCCCCCC(=O)OC(CO)COC(=O)CCCCC/C=C\C/C=C\C/C=C\CC | 250-1000 | 3 | {"smiles": "C(/C=C\\C/C=C\\CCCCCCCCCC(=O)OC(CO)COC(=O)CCCCC/C=C\\C/C=C\\C/C=C\\CC)/C=C\\CC", "is_randomized": true, "is_kekulized": true} |
task_00000559 | index | single_index_murcko_scaffold | Which atom indices make up the Murcko scaffold in S([C@@]12C(=O)CC(C1(C)C)CC2)(NC(C)C)(=O)=O? List the indices that define the scaffold and return the answer as a JSON object with murcko_scaffold_index mapped to those indices. | {"murcko_scaffold_index": [1, 2, 3, 4, 5, 6, 9, 10]} | null | CC(C)NS(=O)(=O)[C@@]12CCC(CC1=O)C2(C)C | 250-1000 | 1 | {"smiles": "S([C@@]12C(=O)CC(C1(C)C)CC2)(NC(C)C)(=O)=O", "is_randomized": true, "is_kekulized": true} |
task_00001491 | index | single_index_stereochemistry_unspecified_double_bond | Which atoms in C(\Cl)=C/CN[C@@H](C)C1CCCCCC1 are part of double bonds that have unspecified E/Z stereochemistry? Identify their atom indices and return a JSON object with stereochemistry_unspecified_double_bond_index containing the list of those indices. | {"stereochemistry_unspecified_double_bond_index": []} | null | C[C@H](NC/C=C/Cl)C1CCCCCC1 | 0-250 | 1 | {"smiles": "C(\\Cl)=C/CN[C@@H](C)C1CCCCCC1", "is_randomized": true, "is_kekulized": false} |
task_00000296 | count | single_count_stereocenter | How many stereocenters are present in CC1CC(C)(C)C2CCC3(C)C(CCC4C5(C)CCC(C(C)CC(O)C(O)C(O)C(O)CO)C5CCC43C)C2(C)C1? Please provide your answer as JSON with the key stereocenter_count. | {"stereocenter_count": 15} | null | CC1CC(C)(C)C2CCC3(C)C(CCC4C5(C)CCC(C(C)CC(O)C(O)C(O)C(O)CO)C5CCC43C)C2(C)C1 | 250-1000 | 1 | {"smiles": "CC1CC(C)(C)C2CCC3(C)C(CCC4C5(C)CCC(C(C)CC(O)C(O)C(O)C(O)CO)C5CCC43C)C2(C)C1", "is_randomized": false, "is_kekulized": true} |
task_00000963 | index | single_index_halogen_atom | Which atoms in [N-]=[N+]=NCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)C(F)(CCN=[N+]=[N-])C(F)(F)F are halogen atoms? Identify their positions (atom indices) and provide the indices as JSON using the key halogen_atom_index. | {"halogen_atom_index": [6, 7, 9, 10, 12, 13, 15, 16, 18, 19, 21, 23, 24, 25, 27, 28, 30, 37, 38, 39]} | null | [N-]=[N+]=NCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)C(F)(CCN=[N+]=[N-])C(F)(F)F | 1000-inf | 1 | {"smiles": "[N-]=[N+]=NCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)C(F)(CCN=[N+]=[N-])C(F)(F)F", "is_randomized": false, "is_kekulized": true} |
task_00002972 | index | multi_index_nbr_2 | Which bonds in [N-]=[N+]=NCCCCCC(=O)NCC(=O)N[C@H](CCCN=C(N)N)C(=O)NCC(=O)N[C@H](CC(=O)O)C(=O)N[C@@H](CO)C(=O)O are rotatable, and which atom indices make up the Murcko scaffold? List the exact positions and provide the answer as JSON using the keys rotatable_bond_index and murcko_scaffold_index. | {"rotatable_bond_index": [2, 3, 4, 5, 6, 7, 8, 10, 11, 12, 14, 15, 16, 17, 18, 19, 23, 25, 26, 27, 29, 30, 31, 32, 35, 37, 38, 39, 41], "murcko_scaffold_index": []} | null | [N-]=[N+]=NCCCCCC(=O)NCC(=O)N[C@H](CCCN=C(N)N)C(=O)NCC(=O)N[C@H](CC(=O)O)C(=O)N[C@@H](CO)C(=O)O | 1000-inf | 2 | {"smiles": "[N-]=[N+]=NCCCCCC(=O)NCC(=O)N[C@H](CCCN=C(N)N)C(=O)NCC(=O)N[C@H](CC(=O)O)C(=O)N[C@@H](CO)C(=O)O", "is_randomized": false, "is_kekulized": false} |
task_00001756 | count | multi_count_nbr_2 | How many R-stereocenters and how many fused rings are in c1c(cc2c(CCNC2=O)c1)S(=O)(N[C@H]1c2n(nc(n2)C(C)C)CCC1)=O? Provide your answer as a JSON object with fused_ring_count and r_s_stereocenter_r_count. | {"fused_ring_count": 2, "r_s_stereocenter_r_count": 1} | null | CC(C)c1nc2n(n1)CCC[C@H]2NS(=O)(=O)c1ccc2c(c1)C(=O)NCC2 | 250-1000 | 2 | {"smiles": "c1c(cc2c(CCNC2=O)c1)S(=O)(N[C@H]1c2n(nc(n2)C(C)C)CCC1)=O", "is_randomized": true, "is_kekulized": false} |
task_00002951 | index | multi_index_nbr_2 | Which atoms in c12c3OC4(C)CC(COC4)N(C)c1nc(OC[C@]14N(C[C@H](F)C4)CCC1)nc2c(F)c(n3)-c1c(c(cc(N)c1)Cl)C(F)(F)F are part of saturated rings, and which atoms are part of any rings? Please provide your answer indicating saturated_ring_index and ring_index in your response. | {"saturated_ring_index": [3, 5, 6, 7, 8, 9, 17, 18, 19, 20, 22, 23, 24, 25], "ring_index": [0, 1, 2, 3, 5, 6, 7, 8, 9, 10, 12, 13, 14, 17, 18, 19, 20, 22, 23, 24, 25, 26, 27, 28, 30, 31, 32, 33, 34, 35, 36, 38]} | null | CN1c2nc(OC[C@@]34CCCN3C[C@H](F)C4)nc3c(F)c(-c4cc(N)cc(Cl)c4C(F)(F)F)nc(c23)OC2(C)COCC1C2 | 1000-inf | 2 | {"smiles": "c12c3OC4(C)CC(COC4)N(C)c1nc(OC[C@]14N(C[C@H](F)C4)CCC1)nc2c(F)c(n3)-c1c(c(cc(N)c1)Cl)C(F)(F)F", "is_randomized": true, "is_kekulized": false} |
task_00001389 | index | single_index_longest_carbon_chain | Which atom indices correspond to the atoms in the longest carbon chain of C(CCCCCCCCC/C=C\CCCCCCO)CC=C? Return your answer as a JSON object mapping longest_carbon_chain_index to the list of those indices. | {"longest_carbon_chain_index": [17, 16, 15, 14, 13, 12, 11, 10, 9, 8, 7, 6, 5, 4, 3, 2, 1, 0, 19, 20, 21]} | null | C=CCCCCCCCCCCC/C=C\CCCCCCO | 0-250 | 1 | {"smiles": "C(CCCCCCCCC/C=C\\CCCCCCO)CC=C", "is_randomized": true, "is_kekulized": false} |
task_00002313 | count | multi_count_nbr_5 | For the molecule N1C2=C(N(C(OC(C)(C)C)=O)C(OC(C)(C)C)=O)N=CN=C2N(C=1)CC1C(=CC(Cl)=CC=1Br)N1CCC(NC(=O)OC(C)(C)C)(COC)C1, count the following: how many atoms are part of Boc groups, what is the molecular formula (as given by the SMILES), how many hydrogen atoms are present, how many unspecified E/Z (double-bond) stereoch... | {"functional_group_boc_count": 23, "molecular_formula_count": "C33H45BrClN7O7", "hydrogen_atom_count": 45, "stereochemistry_unspecified_double_bond_count": 0, "halogen_atom_count": 2} | null | COCC1(NC(=O)OC(C)(C)C)CCN(c2cc(Cl)cc(Br)c2Cn2cnc3c(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)ncnc32)C1 | 1000-inf | 5 | {"smiles": "N1C2=C(N(C(OC(C)(C)C)=O)C(OC(C)(C)C)=O)N=CN=C2N(C=1)CC1C(=CC(Cl)=CC=1Br)N1CCC(NC(=O)OC(C)(C)C)(COC)C1", "is_randomized": true, "is_kekulized": true} |
End of preview. Expand in Data Studio
README.md exists but content is empty.
- Downloads last month
- 5