messages listlengths 2 294 | metadata dict |
|---|---|
[
{
"role": "user",
"content": "What is the SMILES notation for <IUPAC> (3R,4R)-N-benzyl-4-(2-methoxyphenyl)-1-(4-methylbenzoyl)pyrrolidine-3-carboxamide </IUPAC> ?"
},
{
"role": "assistant",
"content": "It's <SMILES> COC1=CC=CC=C1C1CN(C(=O)C2=CC=C(C)C=C2)CC1C(=O)NCC1=CC=CC=C1 </SMILES> ."
}
] | {
"source": "SMolInstruct",
"split": "train",
"task": "name_conversion-i2s",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"probl... |
[
{
"role": "user",
"content": "Predict a possible product from the listed reactants and reagents. <SMILES> CC(=O)O.COC1=CC=CC(C(C)=O)=C1.C[Si](C)(C)N[Si](C)(C)C.N#CCC#N </SMILES>"
},
{
"role": "assistant",
"content": "<SMILES> COC1=CC=CC(C(C)=C(C#N)C#N)=C1 </SMILES>"
}
] | {
"source": "SMolInstruct",
"split": "train",
"task": "forward_synthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem... |
[
{
"role": "user",
"content": "Identify possible reactants that could have been used to create the specified product. <SMILES> COCCCOC(=O)N1CCC(C2=NC(C3=CC=C4C(=C3)C(C)(C)CCC4(C)C)=CS2)CC1 </SMILES>"
},
{
"role": "assistant",
"content": "<SMILES> CC1(C)CCC(C)(C)C2=CC(C3=CSC(C4CCNCC4)=N3)=CC=C21.C... | {
"source": "SMolInstruct",
"split": "train",
"task": "retrosynthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem": ... |
[
{
"role": "user",
"content": "Can you identify the reactant(s) that might result in the given product <SMILES> O=S(=O)(C1=CC=CC=C1)N1C=C(C2=COC=C2)C2=CC(C3=CC=CS3)=CN=C21 </SMILES> ?"
},
{
"role": "assistant",
"content": "<SMILES> CCCC[Sn](CCCC)(CCCC)C1=CC=CS1.O=S(=O)(C1=CC=CC=C1)N1C=C(C2=COC=C2... | {
"source": "SMolInstruct",
"split": "train",
"task": "retrosynthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem": ... |
[
{
"role": "user",
"content": "Convert the SMILES representation of a molecule <SMILES> O=C(CNS(=O)(=O)C1=CC=CS1)NC1=CC=C(OC(F)(F)F)C=C1 </SMILES> into IUPAC name."
},
{
"role": "assistant",
"content": "<IUPAC> 2-(thiophen-2-ylsulfonylamino)-N-[4-(trifluoromethoxy)phenyl]acetamide </IUPAC>"
}
] | {
"source": "SMolInstruct",
"split": "train",
"task": "name_conversion-s2i",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"probl... |
[
{
"role": "user",
"content": "Predict a possible product from the listed reactants and reagents. <SMILES> CC1=CC(C2CC2)=CN=C1N1CCNCC1.COC(=O)C1=CC=C(CN2CCCS2(=O)=O)N=C1 </SMILES>"
},
{
"role": "assistant",
"content": "<SMILES> CC1=CC(C2CC2)=CN=C1N1CCN(C(=O)C2=CC=C(CN3CCCS3(=O)=O)N=C2)CC1 </SMILE... | {
"source": "SMolInstruct",
"split": "train",
"task": "forward_synthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem... |
[
{
"role": "user",
"content": "Can you tell me the SMILES representation for the molecule <IUPAC> (1Z)-N-(dibenzofuran-3-ylamino)-2,2-dimethylpropanimidoyl cyanide </IUPAC> ?"
},
{
"role": "assistant",
"content": "Sure. <SMILES> CC(C)(C)C(C#N)=NNC1=CC=C2C(=C1)OC1=CC=CC=C12 </SMILES> ."
}
] | {
"source": "SMolInstruct",
"split": "train",
"task": "name_conversion-i2s",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"probl... |
[
{
"role": "user",
"content": "Suggest possible substances that may have been involved in the synthesis of the presented compound. <SMILES> CC(Cl)OC(=O)N1CCS(=O)(=O)CC1 </SMILES>"
},
{
"role": "assistant",
"content": "<SMILES> CC(Cl)OC(=O)Cl.O=S1(=O)CCNCC1 </SMILES>"
}
] | {
"source": "SMolInstruct",
"split": "train",
"task": "retrosynthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem": ... |
[
{
"role": "user",
"content": "Can you list the reactants that might result in the chemical product <SMILES> O=[N+]([O-])C1=CC([N+](=O)[O-])=C(NC2=NC(Cl)=CC=C2C(F)(F)F)C(C(F)(F)F)=C1 </SMILES> ?"
},
{
"role": "assistant",
"content": "<SMILES> NC1=NC(Cl)=CC=C1C(F)(F)F.O=[N+]([O-])C1=CC([N+](=O)[O-... | {
"source": "SMolInstruct",
"split": "train",
"task": "retrosynthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem": ... |
[
{
"role": "user",
"content": "Please provide a feasible product that could be formed using these reactants and reagents: <SMILES> C1CCOC1.CC(=O)O.CC(=O)O[BH-](OC(C)=O)OC(C)=O.CC(Cl)Cl.COCCOC1=CC=C2C(=C1)NC1=C(C(N)=O)N=CC(C3=CC=CC(N)=C3C)=C12.O=CC1=CC=C(F)C=C1C(=O)O.[Na+] </SMILES> ."
},
{
"role": "a... | {
"source": "SMolInstruct",
"split": "train",
"task": "forward_synthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem... |
[
{
"role": "user",
"content": "<SMILES> C1=CC=C([PH](C2=CC=CC=C2)(C2=CC=CC=C2)[Pd]([PH](C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)([PH](C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)[PH](C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)C=C1.CC#N.CCCS(=O)(=O)NC1=CC=C(F)C(C(=O)NC2=CN=C3C(=C2)C(I)=CN3S(=O)(=O)C2=CC=CC=C2)=C1F.O.O=C([O-]... | {
"source": "SMolInstruct",
"split": "train",
"task": "forward_synthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem... |
[
{
"role": "user",
"content": "What is the SMILES representation for <IUPAC> N-[3-(8-azabicyclo[3.2.1]oct-2-en-8-yl)-3-oxopropyl]-2-fluorobenzenesulfonamide </IUPAC> ?"
},
{
"role": "assistant",
"content": "<SMILES> O=C(CCNS(=O)(=O)C1=CC=CC=C1F)N1C2C=CCC1CC2 </SMILES>"
}
] | {
"source": "SMolInstruct",
"split": "train",
"task": "name_conversion-i2s",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"probl... |
[
{
"role": "user",
"content": "<SMILES> C1=CC=C([PH](C2=CC=CC=C2)(C2=CC=CC=C2)[Pd]([PH](C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)([PH](C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)[PH](C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)C=C1.C1COCCO1.CC(C)(C)OC(=O)N1CCC(CCOC2=NC=C(B3OC(C)(C)C(C)(C)O3)C=C2C(F)(F)F)CC1.CN1C=NC2=C(Cl)N=C... | {
"source": "SMolInstruct",
"split": "train",
"task": "forward_synthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem... |
[
{
"role": "user",
"content": "<SMILES> CCCCC(C)(CC)C(=O)C1CCN2CCN(C)C(=O)N12 </SMILES> is the SMILES representation of a molecule. What is its IUPAC name?"
},
{
"role": "assistant",
"content": "<IUPAC> (8S)-8-(2-ethyl-2-methylhexanoyl)-2-methyl-4,6,7,8-tetrahydro-3H-pyrazolo[1,2-a][1,2,4]triazin... | {
"source": "SMolInstruct",
"split": "train",
"task": "name_conversion-s2i",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"probl... |
[
{
"role": "user",
"content": "Convert the following SMILES notation <SMILES> BrC1=CC=C(CC2(CC3=CC=C(Br)C=C3)OCCO2)C=C1 </SMILES> into its IUPAC nomenclature."
},
{
"role": "assistant",
"content": "<IUPAC> 2,2-bis[(4-bromophenyl)methyl]-1,3-dioxolane </IUPAC>"
}
] | {
"source": "SMolInstruct",
"split": "train",
"task": "name_conversion-s2i",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"probl... |
[
{
"role": "user",
"content": "Can you list the reactants that might result in the chemical product <SMILES> O=CC1=CC=C(CSC2=CC=C(O)C(Cl)=C2)C=C1 </SMILES> ?"
},
{
"role": "assistant",
"content": "<SMILES> O=CC1=CC=C(CBr)C=C1.OC1=CC=C(S)C=C1Cl </SMILES>"
}
] | {
"source": "SMolInstruct",
"split": "train",
"task": "retrosynthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem": ... |
[
{
"role": "user",
"content": "What reactants could lead to the production of the following product? <SMILES> CN1C([N+](=O)[O-])=CN=C1C1=NC(OCCNCCO)=C2C=CC=CC2=N1 </SMILES>"
},
{
"role": "assistant",
"content": "<SMILES> CN1C([N+](=O)[O-])=CN=C1C1=NC(Cl)=C2C=CC=CC2=N1.OCCNCCO </SMILES>"
}
] | {
"source": "SMolInstruct",
"split": "train",
"task": "retrosynthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem": ... |
[
{
"role": "user",
"content": "Please identify the SMILES representation of the molecule named <IUPAC> N-[(1S,2S)-1-amino-1-hydroxy-3-(hydroxyamino)-3-oxopropan-2-yl]-4-[2-[4-[[(2S)-2,3-diaminopropanoyl]amino]phenyl]ethynyl]benzamide </IUPAC> ."
},
{
"role": "assistant",
"content": "The molecule'... | {
"source": "SMolInstruct",
"split": "train",
"task": "name_conversion-i2s",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"probl... |
[
{
"role": "user",
"content": "What is the IUPAC name of the molecule <SMILES> CC=C(O)C(=CC)C1=C(F)C=CC(N)=C1O </SMILES> ?"
},
{
"role": "assistant",
"content": "<IUPAC> 6-amino-3-fluoro-2-[(2Z,4E)-4-hydroxyhexa-2,4-dien-3-yl]phenol </IUPAC>"
}
] | {
"source": "SMolInstruct",
"split": "train",
"task": "name_conversion-s2i",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"probl... |
[
{
"role": "user",
"content": "Consider that for a chemical reaction, if <SMILES> Br[Mg]C1=CC=CC=C1.CC(=O)C1=CC=CC=C1.CC(=O)O.CC(=O)OC(C)=O </SMILES> is/are the reactants and reagents, what can be the product?"
},
{
"role": "assistant",
"content": "<SMILES> C=C(C1=CC=CC=C1)C1=CC=CC=C1 </SMILES>"
... | {
"source": "SMolInstruct",
"split": "train",
"task": "forward_synthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem... |
[
{
"role": "user",
"content": "What reactants could lead to the production of the following product? <SMILES> CCCC1=C(CC2=CC=C(C3=CC=CC=C3C3=NOC(=O)N3)C=C2)C(=O)N([C@H]2CC[C@H](C3=NN=C(C)O3)CC2)C2=NC=NN12 </SMILES>"
},
{
"role": "assistant",
"content": "<SMILES> CCCC1=C(CC2=CC=C(C3=CC=CC=C3C#N)C=... | {
"source": "SMolInstruct",
"split": "train",
"task": "retrosynthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem": ... |
[
{
"role": "user",
"content": "Based on the given reactants and reagents: <SMILES> CC1=CC=C(S(=O)(=O)O)C=C1.CC1=CC=CC=C1.O=S(=O)(O)O </SMILES>, what product could potentially be produced?"
},
{
"role": "assistant",
"content": "The product can be <SMILES> O=S1C=C2C=CCOC2=C1 </SMILES> ."
}
] | {
"source": "SMolInstruct",
"split": "train",
"task": "forward_synthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem... |
[
{
"role": "user",
"content": "I'd like to know the molecular formula of <SMILES> COCC1=CC(C(=O)NC(CN)C2CC2)=NO1 </SMILES> . Can you tell me?"
},
{
"role": "assistant",
"content": "Sure. It's <MOLFORMULA> C11H17N3O3 </MOLFORMULA> ."
}
] | {
"source": "SMolInstruct",
"split": "train",
"task": "name_conversion-s2f",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"probl... |
[
{
"role": "user",
"content": "Determine the IUPAC name for the molecule represented by the following SMILES representation: <SMILES> CN(C)CC(=O)NCCC1CCNCC1;Cl;Cl </SMILES> ."
},
{
"role": "assistant",
"content": "<IUPAC> 2-(dimethylamino)-N-(2-piperidin-4-ylethyl)acetamide;dihydrochloride </IUPA... | {
"source": "SMolInstruct",
"split": "train",
"task": "name_conversion-s2i",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"probl... |
[
{
"role": "user",
"content": "Can you identify the reactant(s) that might result in the given product <SMILES> CCOC(=O)C1=COC(N)=N1 </SMILES> ?"
},
{
"role": "assistant",
"content": "<SMILES> CCOC(=O)C(=O)CBr.NC(N)=O </SMILES>"
}
] | {
"source": "SMolInstruct",
"split": "train",
"task": "retrosynthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem": ... |
[
{
"role": "user",
"content": "Can you list the reactants that might result in the chemical product <SMILES> O=C1NC2=CC=C(F)C=C2C1=CC1=C2CCOC(=O)C2=CN1 </SMILES> ?"
},
{
"role": "assistant",
"content": "<SMILES> O=C1CC2=CC(F)=CC=C2N1.O=CC1=C2CCOC(=O)C2=CN1 </SMILES>"
}
] | {
"source": "SMolInstruct",
"split": "train",
"task": "retrosynthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem": ... |
[
{
"role": "user",
"content": "Do retrosynthesis with the product <SMILES> CC1=NC2=NC=C(C3=CC=C(F)C(C4=CC=CC=C4C#N)=C3)N2C=C1 </SMILES> ."
},
{
"role": "assistant",
"content": "OK. The reactants may be <SMILES> CC1(C)OB(C2=CC=C(F)C(C3=CC=CC=C3C#N)=C2)OC1(C)C.CC1=NC2=NC=C(Br)N2C=C1 </SMILES> ."
... | {
"source": "SMolInstruct",
"split": "train",
"task": "retrosynthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem": ... |
[
{
"role": "user",
"content": "Can you tell me the potential product of a chemical reaction that uses <SMILES> C1COCCN1.COC(=O)C1=CC=CC(I)=C1.O=C1NC2=CC=CC=C2[C@@]12C[C@@H]2C1=CC=C(Cl)C=C1 </SMILES> as the reactants and reagents?"
},
{
"role": "assistant",
"content": "Sure. A potential product: <... | {
"source": "SMolInstruct",
"split": "train",
"task": "forward_synthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem... |
[
{
"role": "user",
"content": "<IUPAC> methyl 4-[[(3-hydroxyoxolan-3-yl)methylamino]methyl]benzoate </IUPAC> is the IUPAC name of a molecule. Please give its molecular formula."
},
{
"role": "assistant",
"content": "<MOLFORMULA> C14H19NO4 </MOLFORMULA>"
}
] | {
"source": "SMolInstruct",
"split": "train",
"task": "name_conversion-i2f",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"probl... |
[
{
"role": "user",
"content": "Convert the following SMILES notation <SMILES> NC1CCC(NC(=S)C23CC4CC(C5=CC=CC=C5)(CC2C4OC2=CC=CC=C2)C3)CC1 </SMILES> into its IUPAC nomenclature."
},
{
"role": "assistant",
"content": "<IUPAC> N-(4-aminocyclohexyl)-6-phenoxy-1-phenyltricyclo[3.3.1.03,7]nonane-3-carb... | {
"source": "SMolInstruct",
"split": "train",
"task": "name_conversion-s2i",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"probl... |
[
{
"role": "user",
"content": "<SMILES> CCOCC.ClCCl.O=C(C1=CC=CC=C1)C1=NOC(CSC2=CC=CC=C2)=N1.O=C(OO)C1=CC=CC(Cl)=C1.O=S([O-])([O-])=S.[Na+] </SMILES> Considering the given starting materials, what might be the resulting product in a chemical reaction?"
},
{
"role": "assistant",
"content": "<SMILE... | {
"source": "SMolInstruct",
"split": "train",
"task": "forward_synthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem... |
[
{
"role": "user",
"content": "Predict the product of a chemical reaction with <SMILES> BrC1=CN=C2C=CC=CC2=C1.CCOCC.COC1=CC(C=O)=CC=C1OCC1=CC=CC=C1.[Li]CCCC </SMILES> as the reactants and reagents."
},
{
"role": "assistant",
"content": "<SMILES> COC1=CC(C(O)C2=CN=C3C=CC=CC3=C2)=CC=C1OCC1=CC=CC=C1... | {
"source": "SMolInstruct",
"split": "train",
"task": "forward_synthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem... |
[
{
"role": "user",
"content": "With the given product <SMILES> CCCC1=CC(OC2=CC=CC=C2)=CC=C1OCCCOC1=CC=C(S(N)(=O)=O)C=C1 </SMILES>, suggest some likely reactants that were used in its synthesis."
},
{
"role": "assistant",
"content": "<SMILES> CCCC1=CC(OC2=CC=CC=C2)=CC=C1OCCCBr.NS(=O)(=O)C1=CC=C(O)... | {
"source": "SMolInstruct",
"split": "train",
"task": "retrosynthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem": ... |
[
{
"role": "user",
"content": "<SMILES> BrC1=CC=CC2=C1N[C@H]1CCNC[C@@H]21.C1CCOC1.CCOC(=O)Cl.O=C([O-])[C@@H](O)C1=CC=CC=C1.O=C([O-])[O-].[Na+] </SMILES> Considering the given starting materials, what might be the resulting product in a chemical reaction?"
},
{
"role": "assistant",
"content": "<SM... | {
"source": "SMolInstruct",
"split": "train",
"task": "forward_synthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem... |
[
{
"role": "user",
"content": "Convert the IUPAC name of a molecule <IUPAC> 8-hydrazinyl-3-methyl-7-(2-phenylethyl)purine-2,6-dione </IUPAC> into SMILES representation."
},
{
"role": "assistant",
"content": "<SMILES> CN1C(=O)NC(=O)C2=C1N=C(NN)N2CCC1=CC=CC=C1 </SMILES>"
}
] | {
"source": "SMolInstruct",
"split": "train",
"task": "name_conversion-i2s",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"probl... |
[
{
"role": "user",
"content": "Given the following reactants and reagents, please provide a possible product. <SMILES> CCCCC1=NN2C=CC=CC2=C1CC1=CC=C(C2=CC=CC=C2C(=O)OC(C)(C)C)C=C1.CCOCC.ClCCl.O=C(O)C(F)(F)F.[Na+].[OH-] </SMILES>"
},
{
"role": "assistant",
"content": "<SMILES> CCCCC1=NN2C=CC=CC2=C... | {
"source": "SMolInstruct",
"split": "train",
"task": "forward_synthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem... |
[
{
"role": "user",
"content": "Predict the product of a chemical reaction with <SMILES> C1=CC=C([PH](C2=CC=CC=C2)(C2=CC=CC=C2)[Pd]([PH](C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)([PH](C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)[PH](C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)C=C1.COC1=CC=C(Br)C=C1C1=NC(C2=CC=CC=N2)=NO1.COCCOC... | {
"source": "SMolInstruct",
"split": "train",
"task": "forward_synthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem... |
[
{
"role": "user",
"content": "<SMILES> CC(C)(C)OC(=O)COC1=CC=CC2=C1C1=C(C(N)=O)C=CC=C1N2CC1=CC=CC=C1Cl </SMILES> Given the product provided, propose some possible reactants that could have been employed in its formation."
},
{
"role": "assistant",
"content": "Here are possible reactants: <SMILES... | {
"source": "SMolInstruct",
"split": "train",
"task": "retrosynthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem": ... |
[
{
"role": "user",
"content": "Name the molecular formula for the molecule established as <IUPAC> amino-oxo-[(E)-2-(3,4,5-trimethylphenyl)ethenyl]azanium </IUPAC> using the IUPAC nomenclature."
},
{
"role": "assistant",
"content": "<MOLFORMULA> C11H15N2O+ </MOLFORMULA>"
}
] | {
"source": "SMolInstruct",
"split": "train",
"task": "name_conversion-i2f",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"probl... |
[
{
"role": "user",
"content": "For the molecule with <IUPAC> 2,5-diphenyldiazaphospholidine </IUPAC> as the IUPAC name, what is the corresponding SMILES representation?"
},
{
"role": "assistant",
"content": "The corresponding SMILES representation is <SMILES> C1=CC=C(C2CPN(C3=CC=CC=C3)N2)C=C1 </S... | {
"source": "SMolInstruct",
"split": "train",
"task": "name_conversion-i2s",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"probl... |
[
{
"role": "user",
"content": "<SMILES> CC(=O)C1=CC(C)=NC(C)=C1.CCOC(=O)C(O)(CC(=O)C1=CC(C)=NC(C)=C1)C(=O)OCC </SMILES> Given the above reactants and reagents, what could be a probable product of their reaction?"
},
{
"role": "assistant",
"content": "A probable product could be <SMILES> CCOC(=O)C... | {
"source": "SMolInstruct",
"split": "train",
"task": "forward_synthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem... |
[
{
"role": "user",
"content": "<SMILES> CC1(C)CC2=CC=CC(N)=C2O1.ClC1=CC=C2C(I)=CC=CC2=N1.NCC1=CC=CN=C1 </SMILES> Given the above reactants and reagents, what could be a probable product of their reaction?"
},
{
"role": "assistant",
"content": "A probable product could be <SMILES> CC1(C)CC2=CC=CC(... | {
"source": "SMolInstruct",
"split": "train",
"task": "forward_synthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem... |
[
{
"role": "user",
"content": "Consider that for a chemical reaction, if <SMILES> ClC(Cl)Cl.NC(=O)/C=C(\\C(=O)O)C1=CC=C(N)C=C1.O=C1C=CC(=O)O1 </SMILES> is/are the reactants and reagents, what can be the product?"
},
{
"role": "assistant",
"content": "<SMILES> NC(=O)/C=C(\\C(=O)O)C1=CC=C(C(=O)O)C=... | {
"source": "SMolInstruct",
"split": "train",
"task": "forward_synthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem... |
[
{
"role": "user",
"content": "Predict the product of a chemical reaction with <SMILES> CC(C)COC1=CC=CC2=C1C(OCC1CCNCC1)=NO2.COC(=O)C(C)(C)C=O.COC(=O)C1(C=O)CCC1 </SMILES> as the reactants and reagents."
},
{
"role": "assistant",
"content": "<SMILES> COC(=O)C(C)(C)CN1CCC(COC2=NOC3=CC=CC(OCC(C)C)=... | {
"source": "SMolInstruct",
"split": "train",
"task": "forward_synthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem... |
[
{
"role": "user",
"content": "Provide the potential reactants that may be used to produce the product <SMILES> CC(=O)OCC1=C(C2=CN(C)C(=O)C(NC3=NN4CCN(C)CC4=C3)=C2)C=C(F)C=C1N1CCN2C(=CC3=C2CC(C)(C)C3)C1=O </SMILES> ."
},
{
"role": "assistant",
"content": "The potential reactants: <SMILES> CC(=O)O... | {
"source": "SMolInstruct",
"split": "train",
"task": "retrosynthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem": ... |
[
{
"role": "user",
"content": "Provide the molecular formula for the IUPAC named substance <IUPAC> 2-[(3S)-1-(3-chloro-4-methylphenyl)sulfonylpyrrolidin-3-yl]-3-methylimidazo[4,5-b]pyridine </IUPAC> ."
},
{
"role": "assistant",
"content": "<MOLFORMULA> C18H19ClN4O2S </MOLFORMULA>"
}
] | {
"source": "SMolInstruct",
"split": "train",
"task": "name_conversion-i2f",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"probl... |
[
{
"role": "user",
"content": "Consider that for a chemical reaction, if <SMILES> C1CCOC1.CCN(C(C)C)C(C)C.CN1N=NC2=C(C#N)C=C(C3=CC=C(OCCCOS(C)(=O)=O)C(C(F)(F)F)=C3)C=C21.CNC </SMILES> is/are the reactants and reagents, what can be the product?"
},
{
"role": "assistant",
"content": "<SMILES> CN(C)... | {
"source": "SMolInstruct",
"split": "train",
"task": "forward_synthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem... |
[
{
"role": "user",
"content": "Consider that for a chemical reaction, if <SMILES> CC1=CC=CC=C1C1=CC(N2CCOCC2)=NC=C1C(N)=O.C[O-].Cl.ClCCl.O=C1CCC(=O)N1Br.[Na+] </SMILES> is/are the reactants and reagents, what can be the product?"
},
{
"role": "assistant",
"content": "<SMILES> COC(=O)NC1=CN=C(N2CC... | {
"source": "SMolInstruct",
"split": "train",
"task": "forward_synthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem... |
[
{
"role": "user",
"content": "Consider that for a chemical reaction, if <SMILES> C1CCOC1.CO.COC(=O)C1=CC=C(C2=CN=CN2C)C=C1.O.[Li+].[OH-] </SMILES> is/are the reactants and reagents, what can be the product?"
},
{
"role": "assistant",
"content": "<SMILES> CN1C=NC=C1C1=CC=C(C(=O)O)C=C1 </SMILES>"
... | {
"source": "SMolInstruct",
"split": "train",
"task": "forward_synthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem... |
[
{
"role": "user",
"content": "What reactants could lead to the production of the following product? <SMILES> CS(=O)C1=CC=CC2=C(C3=CC=NC=N3)C(C3=CC=C(F)C=C3)=NN12 </SMILES>"
},
{
"role": "assistant",
"content": "<SMILES> CSC1=CC=CC2=C(C3=CC=NC=N3)C(C3=CC=C(F)C=C3)=NN12.O=C(OO)C1=CC=CC(Cl)=C1 </SM... | {
"source": "SMolInstruct",
"split": "train",
"task": "retrosynthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem": ... |
[
{
"role": "user",
"content": "<SMILES> COC1=CC(C)=CC=C1C1=NC(C)=C(C2=CC=CN=C2)N1 </SMILES> Given the product provided, propose some possible reactants that could have been employed in its formation."
},
{
"role": "assistant",
"content": "Here are possible reactants: <SMILES> COC1=CC(C)=CC=C1C1=N... | {
"source": "SMolInstruct",
"split": "train",
"task": "retrosynthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem": ... |
[
{
"role": "user",
"content": "Could you tell which reactants might have been used to generate the following product? <SMILES> N#CC1=CC(Cl)=CC(OC2=C(Cl)C=CC(CNC(=O)C3=NNC=C3)=C2F)=C1 </SMILES>"
},
{
"role": "assistant",
"content": "<SMILES> N#CC1=CC(Cl)=CC(OC2=C(Cl)C=CC(CN)=C2F)=C1.O=C(O)C1=NNC=C... | {
"source": "SMolInstruct",
"split": "train",
"task": "retrosynthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem": ... |
[
{
"role": "user",
"content": "What is the molecular formula for the molecule denoted by <SMILES> O=C(C=CC1=CC=C(C2=CC=C(F)C=C2)S1)NCC(=O)NC1=CC=C(N2C=NC=N2)C=C1 </SMILES> ?"
},
{
"role": "assistant",
"content": "<MOLFORMULA> C23H18FN5O2S </MOLFORMULA>"
}
] | {
"source": "SMolInstruct",
"split": "train",
"task": "name_conversion-s2f",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"probl... |
[
{
"role": "user",
"content": "Translate the chemical IUPAC name <IUPAC> N-(7-bicyclo[4.1.0]heptanyl)-2-fluoro-2-methylpropanamide </IUPAC> into its molecular formula."
},
{
"role": "assistant",
"content": "<MOLFORMULA> C11H18FNO </MOLFORMULA>"
}
] | {
"source": "SMolInstruct",
"split": "train",
"task": "name_conversion-i2f",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"probl... |
[
{
"role": "user",
"content": "What is the IUPAC name of the molecule <SMILES> N#CC1=CC=C(C2=NC3=C(C4=CC=CC=C4)C=C4C(C5=CC=CC(C6=C(F)C(F)=C(F)C(F)=C6F)=C5)=NC5=CC=CC=C5C4=C3N=C2C2=CC=C(C#N)C=C2)C=C1 </SMILES> ?"
},
{
"role": "assistant",
"content": "<IUPAC> 4-[2-(4-cyanophenyl)-7-[3-(2,3,4,5,6-pe... | {
"source": "SMolInstruct",
"split": "train",
"task": "name_conversion-s2i",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"probl... |
[
{
"role": "user",
"content": "Predict a possible product from the listed reactants and reagents. <SMILES> CCCCC[C@H]1CC[C@H]([C@H]2CC[C@H](C(O)CC3=CC=C(F)C(F)=C3)CC2)CC1.CCN(CC)CC.CS(C)=O.ClCCl.O.O=C(Cl)C(=O)Cl </SMILES>"
},
{
"role": "assistant",
"content": "<SMILES> CCCCC[C@H]1CC[C@H]([C@H]2CC... | {
"source": "SMolInstruct",
"split": "train",
"task": "forward_synthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem... |
[
{
"role": "user",
"content": "Convert the following SMILES notation <SMILES> CCCC(N)(CCC)C(N)(CCC)CCC </SMILES> into its IUPAC nomenclature."
},
{
"role": "assistant",
"content": "<IUPAC> 4,5-dipropyloctane-4,5-diamine </IUPAC>"
}
] | {
"source": "SMolInstruct",
"split": "train",
"task": "name_conversion-s2i",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"probl... |
[
{
"role": "user",
"content": "Do retrosynthesis with the product <SMILES> CC1=CC=C(NC(=O)C2=CC(N3CCN(C)CC3)=CC(S(F)(F)(F)(F)F)=C2)C=C1N1C=CN2N=C(C3=CC=CN=C3)C=C12 </SMILES> ."
},
{
"role": "assistant",
"content": "OK. The reactants may be <SMILES> CC1=CC=C(N)C=C1N1C=CN2N=C(C3=CC=CN=C3)C=C12.CN1C... | {
"source": "SMolInstruct",
"split": "train",
"task": "retrosynthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem": ... |
[
{
"role": "user",
"content": "Based on the given reactants and reagents: <SMILES> NCC1=CC=C(Cl)N=C1.O=C(O)C1=CC([N+](=O)[O-])=C(SC2=C(Cl)C=NC=C2Cl)S1 </SMILES>, what product could potentially be produced?"
},
{
"role": "assistant",
"content": "The product can be <SMILES> O=C(NCC1=CC=C(Cl)N=C1)C1... | {
"source": "SMolInstruct",
"split": "train",
"task": "forward_synthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem... |
[
{
"role": "user",
"content": "What is the molecular formula of the compound with this IUPAC name <IUPAC> 10-naphthalen-2-yl-2-phenylnaphtho[2,1-g][1,3]benzothiazole </IUPAC> ?"
},
{
"role": "assistant",
"content": "<MOLFORMULA> C31H19NS </MOLFORMULA>"
}
] | {
"source": "SMolInstruct",
"split": "train",
"task": "name_conversion-i2f",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"probl... |
[
{
"role": "user",
"content": "To synthesis <SMILES> O=C(O)C1=CC2=CC=C(Br)C=C2C2=CC=CC=C12 </SMILES>, what are the possible reactants? Write in the SMILES representation."
},
{
"role": "assistant",
"content": "<SMILES> NC1=CC=CC=C1C(=CC1=CC=C(Br)C=C1)C(=O)[O-] </SMILES>"
}
] | {
"source": "SMolInstruct",
"split": "train",
"task": "retrosynthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem": ... |
[
{
"role": "user",
"content": "Can you identify the reactant(s) that might result in the given product <SMILES> COC1=C(Cl)C(=O)N(C)N=C1 </SMILES> ?"
},
{
"role": "assistant",
"content": "<SMILES> CN1N=CC(Cl)=C(Cl)C1=O.C[O-] </SMILES>"
}
] | {
"source": "SMolInstruct",
"split": "train",
"task": "retrosynthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem": ... |
[
{
"role": "user",
"content": "Given the following reactants and reagents, please provide a possible product. <SMILES> CN(C)C=O.O=C([O-])[O-].O=CC1=CC([N+](=O)[O-])=CC=C1F.OC1=CC=CC=C1.[K+] </SMILES>"
},
{
"role": "assistant",
"content": "<SMILES> O=CC1=CC([N+](=O)[O-])=CC=C1OC1=CC=CC=C1 </SMILES... | {
"source": "SMolInstruct",
"split": "train",
"task": "forward_synthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem... |
[
{
"role": "user",
"content": "Please provide a feasible product that could be formed using these reactants and reagents: <SMILES> C1=CC=C(P(C2=CC=CC=C2)[C-]2C=CC=C2)C=C1.C1CCOC1.CC#N.CC1(C)OBOC1(C)C.CCN(CC)CC.CCOC(C)=O.COC(=O)C1=NC(N2CCC3=CC=CC(C(=O)NC4=NC5=CC=CC=C5S4)=C3C2)=CC=C1Br.ClCCl.Cl[Pd]Cl.[Fe+2] </... | {
"source": "SMolInstruct",
"split": "train",
"task": "forward_synthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem... |
[
{
"role": "user",
"content": "The IUPAC name of a certain molecule is <IUPAC> N-(3-chloro-4-fluorophenyl)-2-[(5R)-2-(3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide </IUPAC> . Can you provide its SMILES representation?"
},
{
"role": "assistant",
"content": "The SMILES representatio... | {
"source": "SMolInstruct",
"split": "train",
"task": "name_conversion-i2s",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"probl... |
[
{
"role": "user",
"content": "Translate the given SMILES formula of a molecule <SMILES> C1=CC=C(C2=NN=C(NCCC3=CN4CCCCC4=N3)S2)C=C1 </SMILES> into its IUPAC name."
},
{
"role": "assistant",
"content": "<IUPAC> 5-phenyl-N-[2-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)ethyl]-1,3,4-thiadiazol-2-a... | {
"source": "SMolInstruct",
"split": "train",
"task": "name_conversion-s2i",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"probl... |
[
{
"role": "user",
"content": "Based on the given reactants and reagents: <SMILES> C1CCOC1.C=CCOC1=CC=C(C(=O)OC)C=C1.CO.[Na+].[OH-] </SMILES>, what product could potentially be produced?"
},
{
"role": "assistant",
"content": "The product can be <SMILES> C=CCOC1=CC=C(C(=O)O)C=C1 </SMILES> ."
}
] | {
"source": "SMolInstruct",
"split": "train",
"task": "forward_synthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem... |
[
{
"role": "user",
"content": "Convert the following SMILES notation <SMILES> COC(=O)C1=C(C)OC(CN(C)C(=O)C2=CC=C(N3C=CN=C3)C=C2)=C1 </SMILES> into its IUPAC nomenclature."
},
{
"role": "assistant",
"content": "<IUPAC> methyl 5-[[(4-imidazol-1-ylbenzoyl)-methylamino]methyl]-2-methylfuran-3-carboxy... | {
"source": "SMolInstruct",
"split": "train",
"task": "name_conversion-s2i",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"probl... |
[
{
"role": "user",
"content": "Can you tell me the potential product of a chemical reaction that uses <SMILES> C=CC=CC(=O)OC.O=C1NNC(=O)C1(CCOC1CCCCO1)CC1=CC=CC=C1 </SMILES> as the reactants and reagents?"
},
{
"role": "assistant",
"content": "Sure. A potential product: <SMILES> COC(=O)C1C=CCN2C(... | {
"source": "SMolInstruct",
"split": "train",
"task": "forward_synthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem... |
[
{
"role": "user",
"content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <SMILES> C[C@H](NC(=O)OC(C)(C)C)C(=O)NC1=CC=CC=C1NC1CCCOC1 </SMILES>"
},
{
"role": "assistant",
"content": "<SMILES> C[C@H](NC(=O)OC(C)(C)C)C(=O)O.NC1=CC=CC=C1N... | {
"source": "SMolInstruct",
"split": "train",
"task": "retrosynthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem": ... |
[
{
"role": "user",
"content": "Predict a possible product from the listed reactants and reagents. <SMILES> CC(C)(C)OC(=O)N1CCC(C(=O)O)CC1.CCN=C=NCCCN(C)C.CCO.CCOC(C)=O.CN(C)C=O.CNC.Cl.ClCCl.ON1N=NC2=CC=CN=C21 </SMILES>"
},
{
"role": "assistant",
"content": "<SMILES> CN(C)C(=O)C1CCN(C(=O)OC(C)(C)C... | {
"source": "SMolInstruct",
"split": "train",
"task": "forward_synthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem... |
[
{
"role": "user",
"content": "Propose a potential product given these reactants and reagents. <SMILES> CCOCC.CC[Si](CC)(CC)OC(C1=CC=C2C(=C1)C=CN2CC1=CC=CC=C1)(C(F)(F)F)C(F)(F)F.CN(C)C=O.O=C1CCC(=O)N1I.[Cl-].[NH4+] </SMILES>"
},
{
"role": "assistant",
"content": "<SMILES> CC[Si](CC)(CC)OC(C1=CC=C... | {
"source": "SMolInstruct",
"split": "train",
"task": "forward_synthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem... |
[
{
"role": "user",
"content": "<IUPAC> [(2S)-but-3-en-2-yl] 5-(difluoromethoxy)-1-methylpyrazole-3-carboxylate </IUPAC> The above is the IUPAC name of a molecule. Write its molecular formula."
},
{
"role": "assistant",
"content": "<MOLFORMULA> C10H12F2N2O3 </MOLFORMULA>"
}
] | {
"source": "SMolInstruct",
"split": "train",
"task": "name_conversion-i2f",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"probl... |
[
{
"role": "user",
"content": "Given the following reactants and reagents, please provide a possible product. <SMILES> C1COCCO1.CCOP(=O)(CCOCCOCCOC[C@H](C)NC(=O)OC(C)(C)C)OCC </SMILES>"
},
{
"role": "assistant",
"content": "<SMILES> CCOP(=O)(CCOCCOCCOC[C@H](C)N)OCC </SMILES>"
}
] | {
"source": "SMolInstruct",
"split": "train",
"task": "forward_synthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem... |
[
{
"role": "user",
"content": "Turn the given SMILES symbol of a molecule <SMILES> CC(CN1C(=O)CCC1CCNCC1=CC=CN=C1)C1=CC=CC=C1 </SMILES> into its respective IUPAC name."
},
{
"role": "assistant",
"content": "<IUPAC> (5R)-1-[(2S)-2-phenylpropyl]-5-[2-(pyridin-3-ylmethylamino)ethyl]pyrrolidin-2-one ... | {
"source": "SMolInstruct",
"split": "train",
"task": "name_conversion-s2i",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"probl... |
[
{
"role": "user",
"content": "<SMILES> C1CCOC1.CC(C)(O)C1=NN=C2[C@H](N)CC[C@@H](C3=CC=CC(F)=C3F)CN21.CCN(CC)CC.ClCCl.O=C(N1C=CN=C1)N1C=CN=C1.O=C1NCCC12CCNCC2 </SMILES> Considering the given starting materials, what might be the resulting product in a chemical reaction?"
},
{
"role": "assistant",
... | {
"source": "SMolInstruct",
"split": "train",
"task": "forward_synthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem... |
[
{
"role": "user",
"content": "Identify possible reactants that could have been used to create the specified product. <SMILES> C=CCOC1=CC=C(C)C2=C1C(=O)C1CCCCC21 </SMILES>"
},
{
"role": "assistant",
"content": "<SMILES> C=CCBr.CC1=CC=C(O)C2=C1C1CCCCC1C2=O </SMILES>"
}
] | {
"source": "SMolInstruct",
"split": "train",
"task": "retrosynthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem": ... |
[
{
"role": "user",
"content": "What is the molecular formula for the molecule denoted by <SMILES> CNC1CCOCC1S(=O)C1=CC=CC(C(F)(F)F)=C1 </SMILES> ?"
},
{
"role": "assistant",
"content": "<MOLFORMULA> C13H16F3NO2S </MOLFORMULA>"
}
] | {
"source": "SMolInstruct",
"split": "train",
"task": "name_conversion-s2f",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"probl... |
[
{
"role": "user",
"content": "Based on the given reactants and reagents: <SMILES> C1CCOC1.O=C([O-])[C@H](O)[C@@H](O)C(=O)[O-].O=C1OC(=O)C2CC=CCC12.[Al+3].[H-].[K+].[Li+].[Na+] </SMILES>, what product could potentially be produced?"
},
{
"role": "assistant",
"content": "The product can be <SMILES... | {
"source": "SMolInstruct",
"split": "train",
"task": "forward_synthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem... |
[
{
"role": "user",
"content": "Provide the potential reactants that may be used to produce the product <SMILES> CC1=CC(Cl)=CC2=C1N1C(=NN=C1N1CCN(C)CC1)CN=C2C1=CC=CC=N1 </SMILES> ."
},
{
"role": "assistant",
"content": "The potential reactants: <SMILES> CC1=CC(Cl)=CC2=C1N1C(Br)=NN=C1CN=C2C1=CC=CC=... | {
"source": "SMolInstruct",
"split": "train",
"task": "retrosynthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem": ... |
[
{
"role": "user",
"content": "Can you identify the reactant(s) that might result in the given product <SMILES> CCOC(=O)CNC(=O)C1=C(O)C2=CC(Cl)=CC(C)=C2SC1=O </SMILES> ?"
},
{
"role": "assistant",
"content": "<SMILES> CCOC(=O)CNC(=O)C1=C(O)C2=CC(Cl)=CC(Br)=C2SC1=O.C[Sn](C)(C)C </SMILES>"
}
] | {
"source": "SMolInstruct",
"split": "train",
"task": "retrosynthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem": ... |
[
{
"role": "user",
"content": "<SMILES> COC(=O)[C@@H]1C[C@H](N(CC(C)C)C(=O)C2=CN=C(C(C)(C)C)N=C2NCCCS(C)=O)CN(C(=O)OC(C)(C)C)C1 </SMILES> Given the product provided, propose some possible reactants that could have been employed in its formation."
},
{
"role": "assistant",
"content": "Here are pos... | {
"source": "SMolInstruct",
"split": "train",
"task": "retrosynthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem": ... |
[
{
"role": "user",
"content": "Can you give the SMILES notation of the molecule <IUPAC> N-(5-chloro-2-cyanophenyl)-2-(2-cyanophenoxy)acetamide </IUPAC> ?"
},
{
"role": "assistant",
"content": "Sure. <SMILES> N#CC1=CC=C(Cl)C=C1NC(=O)COC1=CC=CC=C1C#N </SMILES>"
}
] | {
"source": "SMolInstruct",
"split": "train",
"task": "name_conversion-i2s",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"probl... |
[
{
"role": "user",
"content": "What reactants could lead to the production of the following product? <SMILES> CC(C)(C)C(=O)NCC1=CC=C(Cl)C(C(=O)NC2=CC(F)=C(F)C(C(=O)NC3=CC=C(Br)C=C3)=C2)=C1 </SMILES>"
},
{
"role": "assistant",
"content": "<SMILES> CC(C)(C)C(=O)NCC1=CC=C(Cl)C(C(=O)NC2=CC(F)=C(F)C(C... | {
"source": "SMolInstruct",
"split": "train",
"task": "retrosynthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem": ... |
[
{
"role": "user",
"content": "Convert the SMILES representation of a molecule <SMILES> CC1COCCN1C1=NC=CC2=C1N=CN2 </SMILES> into molecular formula."
},
{
"role": "assistant",
"content": "<MOLFORMULA> C11H14N4O </MOLFORMULA>"
}
] | {
"source": "SMolInstruct",
"split": "train",
"task": "name_conversion-s2f",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"probl... |
[
{
"role": "user",
"content": "Can you tell me the potential product of a chemical reaction that uses <SMILES> CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)C1=NC=CC2=CC(N)=CC=C12.CC1=CC(B(O)O)=CC=C1CCOC(=O)NC1=CC=CC(C#N)=C1.O.O=CC(=O)O </SMILES> as the reactants and reagents?"
},
{
"role": "assistant",
"conten... | {
"source": "SMolInstruct",
"split": "train",
"task": "forward_synthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem... |
[
{
"role": "user",
"content": "Suggest possible substances that may have been involved in the synthesis of the presented compound. <SMILES> CC1=C(C)C2=C(C3=CC(Br)=C(O[C@@H](CCC4=CC=CC=C4)C(=O)O)C(Br)=C3)C3=CC=CC=C3C(Br)=C2S1 </SMILES>"
},
{
"role": "assistant",
"content": "<SMILES> CC1=C(C)C2=C(C... | {
"source": "SMolInstruct",
"split": "train",
"task": "retrosynthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem": ... |
[
{
"role": "user",
"content": "Provide the potential reactants that may be used to produce the product <SMILES> COC1=CC=CC=C1CN1C=CN=C1C(C)C1=CC=CC(C)=C1C </SMILES> ."
},
{
"role": "assistant",
"content": "The potential reactants: <SMILES> CC1=CC=CC(C(C)C2=NC=CN2)=C1C.COC1=CC=CC=C1CBr </SMILES> .... | {
"source": "SMolInstruct",
"split": "train",
"task": "retrosynthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem": ... |
[
{
"role": "user",
"content": "A chemical reaction has started with the substance(s) <SMILES> CCC1=CC=C(CCOC2=CC=C(CC3SC(=O)NC3=O)C=C2)N=C1.CCN(CC)CC.ClCCl.O.O=C(NCCO[N+](=O)[O-])OCCl </SMILES> as the reactants and reagents, what could be a probable product?"
},
{
"role": "assistant",
"content": ... | {
"source": "SMolInstruct",
"split": "train",
"task": "forward_synthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem... |
[
{
"role": "user",
"content": "Build a molecule that meets the requirement: The molecule is a C-glycosyl compound that is isovitexin in which the hydroxyl hydrogen at position 7 is replaced by a beta-D-glucosyl residue. It has a role as a metabolite. It is a dihydroxyflavone, a glycosyloxyflavone, a monometh... | {
"source": "SMolInstruct",
"split": "train",
"task": "molecule_generation",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"probl... |
[
{
"role": "user",
"content": "Using <SMILES> CC(C)C[AlH]CC(C)C.CC1=CC=CC=C1.O=C1C[C@@H]2[C@@H](CC[C@H](CCC3=CC=CC=C3)OC3CCCCO3)[C@H](OC3CCCCO3)C[C@@H]2O1 </SMILES> as the reactants and reagents, tell me the potential product."
},
{
"role": "assistant",
"content": "<SMILES> OC1C[C@@H]2[C@@H](CC[C... | {
"source": "SMolInstruct",
"split": "train",
"task": "forward_synthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem... |
[
{
"role": "user",
"content": "<IUPAC> 1-(furan-2-ylmethyl)-3-[3-(1-methylpiperidin-4-yl)-[1,2,4]triazolo[4,3-a]pyridin-8-yl]urea </IUPAC> is the IUPAC name of a molecule. Please give its SMILES representation."
},
{
"role": "assistant",
"content": "<SMILES> CN1CCC(C2=NN=C3C(NC(=O)NCC4=CC=CO4)=CC... | {
"source": "SMolInstruct",
"split": "train",
"task": "name_conversion-i2s",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"probl... |
[
{
"role": "user",
"content": "I need a molecule that meets the following conditions: The molecule is often attached to a R aglycon. Please represent the molecule in SMILES."
},
{
"role": "assistant",
"content": "<SMILES> CC(=O)N[C@@H]1[C@@H](O)[C@H](O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O[C@]3(C(=O)O)... | {
"source": "SMolInstruct",
"split": "train",
"task": "molecule_generation",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"probl... |
[
{
"role": "user",
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a tripeptide composed of L-tryptophan, L-alanine, and glycine joined by peptide linkages. It has a role as a metabolite. It derives... | {
"source": "SMolInstruct",
"split": "train",
"task": "molecule_generation",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"probl... |
[
{
"role": "user",
"content": "For the molecule named <IUPAC> tert-butyl N-[4-[[4-(trifluoromethoxy)phenyl]carbamoyl]phenyl]carbamate </IUPAC> by IUPAC nomenclature, provide its molecular formula."
},
{
"role": "assistant",
"content": "<MOLFORMULA> C19H19F3N2O4 </MOLFORMULA>"
}
] | {
"source": "SMolInstruct",
"split": "train",
"task": "name_conversion-i2f",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"probl... |
[
{
"role": "user",
"content": "What reactants could lead to the production of the following product? <SMILES> CN1C=CC2=CC=CC(CNC3=CC=CC(C4=C5C=CC=C(Cl)C5=NN=C4C4=CC=CC=C4)=C3)=C21 </SMILES>"
},
{
"role": "assistant",
"content": "<SMILES> CN1C=CC2=CC=CC(C=O)=C21.NC1=CC=CC(C2=C3C=CC=C(Cl)C3=NN=C2C2... | {
"source": "SMolInstruct",
"split": "train",
"task": "retrosynthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem": ... |
[
{
"role": "user",
"content": "Please give me some details about this molecule. <SMILES> C=C(C)[C@H]1CC[C@H](C)[C@@H](O)C1 </SMILES>"
},
{
"role": "assistant",
"content": "The molecule is a dihydrocarveol with (1S,2S,4S)-stereochemistry. It has a role as a plant metabolite. It is an enantiomer of... | {
"source": "SMolInstruct",
"split": "train",
"task": "molecule_captioning",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"probl... |
[
{
"role": "user",
"content": "Propose a potential product given these reactants and reagents. <SMILES> CC1=CC=C2NC3=CC=CC=C3C(=S)NC2=C1.CCCCO.COC(CN)OC </SMILES>"
},
{
"role": "assistant",
"content": "<SMILES> COC(CNC1=NC2=CC(C)=CC=C2NC2=CC=CC=C12)OC </SMILES>"
}
] | {
"source": "SMolInstruct",
"split": "train",
"task": "forward_synthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem... |
[
{
"role": "user",
"content": "Using <SMILES> CC(C)=O.CCO.COC(=O)C1CC(=O)N(CC2=CC=C(OC)C=C2)C1.[BH4-].[Cl-].[NH4+].[Na+] </SMILES> as the reactants and reagents, tell me the potential product."
},
{
"role": "assistant",
"content": "<SMILES> COC1=CC=C(CN2CC(CO)CC2=O)C=C1 </SMILES>"
}
] | {
"source": "SMolInstruct",
"split": "train",
"task": "forward_synthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem... |
[
{
"role": "user",
"content": "Can you tell me the potential product of a chemical reaction that uses <SMILES> CC1=NC=CC=C1C#N.CN(C)C=O </SMILES> as the reactants and reagents?"
},
{
"role": "assistant",
"content": "Sure. A potential product: <SMILES> CN(C)C=CC1=NC=CC=C1C#N </SMILES> ."
}
] | {
"source": "SMolInstruct",
"split": "train",
"task": "forward_synthesis",
"language": "en",
"licence": "cc-by-4.0",
"chemistry": true,
"cid": null,
"question_id": null,
"answer_letter": null,
"category": null,
"seq_type": null,
"smiles": null,
"original_source": null,
"id": null,
"problem... |
Chemistry SFT Ultra
Modern chemistry fine-tuning data built from multiple curated upstream datasets, merged into a single English corpus with reproducible processing and analysis.
Dataset Summary
This repository merges several instruction/QA-style sources into a single, cleaned, deduplicated, English-only training corpus in chat format.
The final corpus contains 1,370,322 rows. Each row is:
messages: a list of{role, content}message dicts (chat/SFT format)metadata: a structured dict containing provenance + task fields (and, when available, chemistry fields like SMILES)
Source Datasets
This dataset is assembled from multiple upstream sources (see metadata.source / metadata.original_source per row). The high-level intended sources include:
- SMolInstruct
- OmniChem
- MoleculeQA
- ChemRxiv-Train
- Tulu-3 SFT Mixture
- NuminaMath-CoT
- TextbookReasoning
Note: Because the dataset is merged, the most reliable “source of truth” for provenance is the per-row
metadatafields.
Dataset Structure
Top-level columns (verified)
Your structure analyzer notebook confirms the dataset has exactly two top-level columns:
messagesmetadata
messages schema (verified)
messages is a list of dicts with:
role(string): one ofsystem,user,assistant,tool(most rows areuser+assistant)content(string): the message text
In the sampled rows from the notebook run, conversations are typically 2 turns (p50=2, p90=2).
metadata schema (verified)
metadata is a struct with the following fields:
source(string)split(string)task(string)language(string)licence(string)chemistry(bool)cid(string)question_id(string)answer_letter(string)category(string)seq_type(string)smiles(string)original_source(string)id(string)problem(string)subject(string)reference_answer(string)
Some fields may be empty depending on which upstream source produced the row.
Example record
{
"messages": [
{"role": "user", "content": "What is the SMILES for aspirin?"},
{"role": "assistant", "content": "CC(=O)OC1=CC=CC=C1C(=O)O"}
],
"metadata": {
"source": "SMolInstruct",
"split": "train",
"task": "smiles_conversion",
"language": "en",
"licence": "MIT",
"chemistry": True,
"cid": "",
"question_id": "",
"answer_letter": "",
"category": "conversion",
"seq_type": "qa",
"smiles": "CC(=O)OC1=CC=CC=C1C(=O)O",
"original_source": "smolininstruct",
"id": "",
"problem": "",
"subject": "",
"reference_answer": ""
}
}
Dataset Analysis (from your notebook runs)
From your sanity-check and schema analyzer outputs:
- Schema normalization:
messageswere normalizable in sampled rows (no schema errors observed) - Assistant supervision present: sampled rows include assistant responses
- Sequence length profile (audit sample): median in the hundreds of tokens with a small tail beyond 2048, indicating some long examples
- LoRA smoke test: successful 4-bit load + LoRA injection + a few training steps using sampled real rows
Usage
from datasets import load_dataset
ds = load_dataset("summykai/chemistry-sft-ultra", split="train")
ex = ds[0]
messages = ex["messages"]
meta = ex["metadata"]
# Example: filter for rows that provide a SMILES in metadata
smiles_rows = ds.filter(lambda x: (x["metadata"]["smiles"] is not None) and (x["metadata"]["smiles"] != ""))
# Example: filter by task
retrosynth = ds.filter(lambda x: x["metadata"]["task"] == "retrosynthesis")
Considerations for Use
- This is a merged dataset; licensing is per-source. Use
metadata.licenceandmetadata.original_sourceto audit before redistribution. - Most examples are short 2-turn chat pairs, but there is a long-context tail.
- The dataset is English-focused (
language: en), but you should still validate per-row language if you require strict guarantees.
License
Because this dataset aggregates multiple upstream datasets, it does not have a single uniform license. See:
metadata.licencefor the row-level license string (when provided)metadata.original_source/metadata.sourcefor provenance
If you need a stricter story (e.g., “MIT-only”), you should filter the dataset by licence/source and publish a derived subset.
Citation
If you use this dataset in your research, cite the dataset repo:
@dataset{chemistry_sft_ultra,
title = {Chemistry SFT Ultra: A Curated Chemistry Instruction Tuning Dataset},
author = {summykai},
year = {2025},
publisher = {Hugging Face},
howpublished = {Hugging Face Datasets},
}
- Downloads last month
- 62