Datasets:
image imagewidth (px) 300 300 | question stringclasses 2
values | choices stringlengths 100 3.13k | label int64 0 3 | description stringlengths 25 1.57k | id stringlengths 14 24 |
|---|---|---|---|---|---|
What is the most relevant description of the following organic molecule? | ['The molecule is an aromatic ketone that is phenyl 1H-pyrazol-4-yl ketone in which the pyrazolyl group is substituted at positions 1 and 5 by methyl and hydroxy groups, respectively, and in which the phenyl group is substituted at positions 2, 3, and 4 by methyl, 4,5-dihydro-1,2-oxazol-3-yl, and methylsulfonyl groups,... | 2 | Its SMILES notation is CCCCC[C@H]1[C@H](O1)/C=C/C(C/C=C\\C/C=C\\CCCC(=O)[O-])O. | ChemQA/mol_caption_0 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a member of the class of carbazoles that is 1-(carbazol-9-yl)-3-(dimethylamino)propan-2-ol bearing two additional bromo substituents at positions 3 and 6 on the carbazole ring system. It is a member of carbazoles, an organobromine compound, a secondary alcohol and a tertiary amino compound.', 'The mol... | 1 | Its SMILES notation is [125Te]. | ChemQA/mol_caption_1 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a tetracyclic triterpenoid that is 4,4,8-trimethylandrosta-1,14-diene substituted by an oxo group at position 3, an acetoxy group at position 7 and a furan-3-yl group at position 17. Isolated from Azadirachta indica, it exhibits antiplasmodial and antineoplastic activities. It has a role as an antineo... | 0 | Its SMILES notation is CC(=O)O[C@@H]1C[C@@H]2[C@](C=CC(=O)C2(C)C)([C@@H]3[C@@]1(C4=CC[C@H]([C@@]4(CC3)C)C5=COC=C5)C)C. | ChemQA/mol_caption_2 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a docosanoid that is (4Z,8E,10Z,13Z,15E,19Z)-docosahexaenoic acid carrying two hydroperoxy substituents at the 7S- and 17S-positions. It has a role as a human xenobiotic metabolite. It is a docosanoid, a hydroperoxy fatty acid, a lipid hydroperoxide and a long-chain fatty acid. It derives from an all-... | 3 | Its SMILES notation is CN(C(=O)N)N=O. | ChemQA/mol_caption_3 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a medium-chain fatty acid that is non-2-enoic acid substituted at position 4 by a hydroxy group. It is an olefinic fatty acid, a hydroxy fatty acid, a medium-chain fatty acid and a straight-chain fatty acid.', 'The molecule is a vibsane diterpenoid that is (2Z,6E,10E)-cycloundeca-2,6,10-trien-1-one wh... | 2 | Its SMILES notation is C1=CC=C2C(=C1)C(=CN2)C3=NC=CS3. | ChemQA/mol_caption_4 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a L-histidine derivative that is N,N-dimethyl-L-histidine substituted at positions N3 and C5 on the imidazole ring by methyl and mercapto groups respectively. It has a role as a marine metabolite, an antioxidant and a radical scavenger. It is an aryl thiol and a L-histidine derivative. It is a tautome... | 1 | Its SMILES notation is C([C@@H]1[C@H]([C@H](C(O1)NC(=O)C[NH3+])O)O)OP(=O)([O-])[O-]. | ChemQA/mol_caption_5 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a dialkyl phosphate in which the alkyl group specified is perfluorooctyl. It has a role as a xenobiotic and an environmental contaminant. It is a dialkyl phosphate and an organofluorine compound.', 'The molecule is the pyranose form of D-mannose 6-phosphate. It is a D-mannose 6-phosphate and a D-hexop... | 1 | Its SMILES notation is C([C@@H]1[C@H]([C@@H]([C@@H](C(O1)O)O)O)O)OP(=O)(O)O. | ChemQA/mol_caption_6 | |
What is the most relevant description of the following organic molecule? | ['The molecule is an organic heterotricyclic compound found in Pterocarpus santalinus. It has a role as a metabolite and a plant metabolite. It is an organic heterotricyclic compound, an aromatic ether, a cyclic ketone, a member of phenols, a tertiary alcohol and a tertiary alpha-hydroxy ketone.', 'The molecule is a sp... | 0 | Its SMILES notation is COC1=CC(=O)[C@@]2(C[C@]1([C@H](C3=CC(=C(C=C32)OC)O)C=C)OC)O. | ChemQA/mol_caption_7 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a member of the class of isoquinolines that is 1-benzylisoquinoline carrying an additional butyl substituent at position 4 on the phenyl ring.', 'The molecule is a long-chain primary fatty alcohol that is docosane substituted by a hydroxy group at position 1. It has a role as an antiviral agent. It is... | 1 | Its SMILES notation is CCCCCCCCCCCCCCCCCCCCCCO. | ChemQA/mol_caption_8 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a dipeptide formed from L-alanyl and L-aspartic acid residues. It has a role as a metabolite. It is a conjugate acid of an Ala-Asp(1-).', 'The molecule is a 1,3-diglyceride in which the acyl groups at positions 1 and 3 are specified as oleoyl and linoleoyl respectively. It is a diacylglycerol 36:3 and... | 2 | Its SMILES notation is C([C@@H]1[C@H]([C@@H](C(O1)(CO)OP(=O)(O)O)O)O)OP(=O)(O)O. | ChemQA/mol_caption_9 | |
What is the most relevant description of the following organic molecule? | ["The molecule is a purine ribonucleoside 5'-diphosphate that is GDP substituted at the 3' position by an N-methylanthraniloyl group. It has a role as a fluorescent probe. It derives from a GDP and a N-methylanthranilic acid.", 'The molecule is an ADP-glycero-D-manno-heptose. It has a role as an Escherichia coli metabo... | 1 | Its SMILES notation is C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)OP(=O)(O)OC4[C@H]([C@H]([C@@H]([C@H](O4)[C@@H](CO)O)O)O)O)O)O)N. | ChemQA/mol_caption_10 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a deoxyketohexose comprising the open-chain form of D-glucose lacking the -OH group at the 3-position and having the keto group at the 2-position. It is a deoxyketohexose and a deoxyglucose.', 'The molecule is a member of the class of dibenzofurans that is dibenzo[b,d]furan substituted by a hydroxy gr... | 1 | Its SMILES notation is C1=CC(=C2C3=C(C(=C(C=C3)Cl)Cl)OC2=C1)O. | ChemQA/mol_caption_11 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a nitrile that is acetonitrile where one of the methyl hydrogens is substituted by a 2-methylphenyl group. It derives from an acetonitrile.', 'The molecule is a fluoroalkane that is hexane in which all of the hydrogens have been replaced by fluorines. It has a role as a radioopaque medium and a non-po... | 0 | Its SMILES notation is CC1=CC=CC=C1CC#N. | ChemQA/mol_caption_12 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a NAD(P)(+) and a NADP. It has a role as a fundamental metabolite and a cofactor. It is a conjugate acid of a NADP zwitterion and a NADP(3-).', 'The molecule is that isomer of butenoic acid having the double bond at position C-3. It is a conjugate acid of a but-3-enoate.', 'The molecule is dianion of ... | 3 | Its SMILES notation is CCN(C)C(=O)OC1=CC=CC(=C1)[C@H](C)N(C)C.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O. | ChemQA/mol_caption_13 | |
What is the most relevant description of the following organic molecule? | ["The molecule is a flavonoid oxoanion obtained by deprotonation of the 5-hydroxy group of 3',4',5,6-tetrahydroxy-3,7-dimethoxyflavone. It is the major microspecies at pH 7.3 (according to Marvin v 6.2.0.). It is a conjugate base of a 3',4',5,6-tetrahydroxy-3,7-dimethoxyflavone.", 'The molecule is a polyprenyl phospho ... | 0 | Its SMILES notation is COC1=C(C(=C2C(=C1)OC(=C(C2=O)OC)C3=CC(=C(C=C3)O)O)[O-])O. | ChemQA/mol_caption_14 | |
What is the most relevant description of the following organic molecule? | ['The molecule is an acyl-CoA that results from the formal condensation of the thiol group of coenzyme A with the carboxy group of oscr#32. It derives from an oscr#32. It is a conjugate acid of an oscr#32-CoA(4-).', 'The molecule is a 3-hydroxyicosanoyl-CoA(4-) obtained by deprotonation of the phosphate and diphosphate... | 3 | Its SMILES notation is CC1=CN(C(=O)NC1=O)[C@H]2C[C@@H]([C@H](O2)CO)OP(=O)(O)OC[C@@H]3[C@H](C[C@@H](O3)N4C=CC(=NC4=O)N)OP(=O)(O)OC[C@@H]5[C@H](C[C@@H](O5)N6C=NC7=C(N=CN=C76)N)OP(=O)(O)OC[C@@H]8[C@H](C[C@@H](O8)N9C=NC1=C(N=CN=C19)N)OP(=O)(O)OC[C@@H]1[C@H](C[C@@H](O1)N1C=CC(=NC1=O)N)OP(=O)(O)OC[C@@H]1[C@H](C[C@@H](O1)N1C=... | ChemQA/mol_caption_15 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a 1D-myo-inositol bis(diphosphate) tetrakisphosphate having the two diphospho groups located at positions 1 and 5. It derives from a myo-inositol. It is a conjugate acid of a 1,5-bis(diphospho)-1D-myo-inositol 2,3,4,6-tetrakisphosphate(13-).', 'The molecule is a glutamic semialdehyde arising from form... | 3 | Its SMILES notation is C[C@@H](CCCC(=C)C)CCOC(=O)CC1=CC=CC=C1. | ChemQA/mol_caption_16 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a hydrate of nickel chloride containing nickel (in the +2 oxidation state), chloride and water moeities in the ratio 1:2:6. It has a role as a sensitiser. It contains a nickel dichloride.', 'The molecule is a methoxybenzoic acid substituted with a methoxy group at position C-4. It has a role as a plan... | 0 | Its SMILES notation is O.O.O.O.O.O.[Cl-].[Cl-].[Ni+2]. | ChemQA/mol_caption_17 | |
What is the most relevant description of the following organic molecule? | ["The molecule is a diphenylethane that is 1,2-dihydrostilbene substituted by hydroxy groups at positions 3, 3' and 5. It has a role as a plant metabolite. It is a member of resorcinols, a polyphenol and a diphenylethane. It derives from a hydride of a 1,2-dihydrostilbene.", 'The molecule is a fatty alcohol consisting ... | 1 | Its SMILES notation is CCCCCCCCCO. | ChemQA/mol_caption_18 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a carbohydrate sulfate that is 2-acetamido-6-O-sulfo-D-galactopyranose in which the hydroxy group at position 3 has been converted into the corresponding beta-D-glucopyranuronoside. It is an amino disaccharide, a carbohydrate acid derivative, a member of acetamides and an oligosaccharide sulfate.', 'T... | 1 | Its SMILES notation is CCOC1C(C2=C(O1)C=CC(=C2)OS(=O)(=O)C)(C)C. | ChemQA/mol_caption_19 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a ginsenoside found in Panax ginseng that is dammarane which is substituted by hydroxy groups at the 3beta, 12beta and 20 pro-S positions and in which the hydroxy group at position 20 has been converted to the corresponding beta-D-xylopyranosyl-beta-D-glucopyranoside. It has a role as an antineoplasti... | 3 | Its SMILES notation is CCN(CC)C(=O)N1C=NC(=N1)S(=O)(=O)C2=C(C=C(C=C2C)C)C. | ChemQA/mol_caption_20 | |
What is the most relevant description of the following organic molecule? | ['The molecule is the cis-isomer of caffeic acid. It has a role as a plant metabolite and a human xenobiotic metabolite. It is a conjugate acid of a cis-caffeate.', 'The molecule is a naphthoic acid that is CD437 in which the phenolic hydroxy group has been converted to its methyl ether. It has a role as a dermatologic... | 3 | Its SMILES notation is CC/C=C\\C/C=C\\C/C=C\\C=C\\C(C/C=C\\C/C=C\\CCC(=O)O)OO. | ChemQA/mol_caption_21 | |
What is the most relevant description of the following organic molecule? | ['The molecule is the monocarboxylic acid amide resulting from the formal condensation of the aryl amino group of 1-methyl-N-phenylpiperidin-4-amine with propanoic acid. It is a member of piperidines and a monocarboxylic acid amide.', 'The molecule is a 13-hydroxy-14,15-epoxy-(5Z,8Z,11Z)-icosatrienoate that is the conj... | 0 | Its SMILES notation is CCC(=O)N(C1CCN(CC1)C)C2=CC=CC=C2. | ChemQA/mol_caption_22 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a branched-chain saturated fatty acid consisting of tridecanoic acid carrying a 12-methyl group. It is a long-chain fatty acid and a branched-chain saturated fatty acid. It is a conjugate acid of an isomyristate.', 'The molecule is a 2-hydroxydicarboxylic acid that is succinic acid in which one of the... | 1 | Its SMILES notation is C(C(C(=O)O)O)C(=O)O. | ChemQA/mol_caption_23 | |
What is the most relevant description of the following organic molecule? | ['The molecule is the iodide salt of ecothiopate. An irreversible acetylcholinesterase inhibitor, it is used an ocular antihypertensive in the treatment of open-angle glaucoma, particularly when other drugs have proved inadequate. It has a role as an antiglaucoma drug, an EC 3.1.1.8 (cholinesterase) inhibitor and a mio... | 2 | Its SMILES notation is CC(=O)N[C@@H]1[C@H]([C@@H]([C@H](O[C@H]1NC(=O)C[C@@H](C(=O)O)N)CO)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O[C@H]3[C@H]([C@H]([C@@H]([C@H](O3)CO[C@@H]4[C@H]([C@H]([C@@H]([C@H](O4)CO[C@@H]5[C@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)O)O[C@@H]6[C@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)O)O)O[C@@H]7[C@H]([C@H]([C@... | ChemQA/mol_caption_24 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a hydrate that is the trihydrate form of scopolamine hydrobromide. It has a role as a mydriatic agent, a muscarinic antagonist, an anaesthesia adjuvant, an antispasmodic drug and an antiemetic. It contains a scopolamine hydrobromide (anhydrous).', 'The molecule is a mannooligosaccharide derivative con... | 0 | Its SMILES notation is CN1[C@@H]2CC(C[C@H]1[C@H]3[C@@H]2O3)OC(=O)[C@H](CO)C4=CC=CC=C4.O.O.O.Br. | ChemQA/mol_caption_25 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a D-tagatose 6-phosphate that is in the open-chain keto-form. It derives from a keto-D-tagatose. It is a conjugate acid of a keto-D-tagatose 6-phosphate(2-). It is an enantiomer of a keto-L-tagatose 6-phosphate.', "The molecule is an amidoalkyl phosphate that is the 4-phosphate derivative of (R)-panto... | 2 | Its SMILES notation is C(=O)([O-])P(=O)(O)[O-]. | ChemQA/mol_caption_26 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a member of the class of piperidines that is the 4-acetyl-2-methoxyphenyl ether of 3-(piperidin-1-yl)propan-1-ol which is substituted at position 4 of the piperidine ring by a 6-fluoro-1,2-benzoxazol-3-yl group. A member of the group of second generation antipsychotics (also known as an atypical antip... | 3 | Its SMILES notation is C1=CC=C(C=C1)NC2=CC=CC=C2. | ChemQA/mol_caption_27 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a tetrol that is cyclohexene in which a hydrogen attached to each of the carbons at positions 3, 4, 5, and 6 is replaced by a hydroxy group. The group consists of six possible diastereoisomers, known as conduritols A to F, some of which can exist as two distinct enantiomers. It is a tetrol, a secondar... | 1 | Its SMILES notation is CCN(CC1=CC(=CC=C1)S(=O)(=O)[O-])C2=CC=C(C=C2)C(=C3C=CC(=[N+](CC)CC4=CC(=CC=C4)S(=O)(=O)[O-])C=C3)C5=CC=CC=C5.[Na+]. | ChemQA/mol_caption_28 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a phthalic acid monoester obtained by formal condensation of one of the carboxy groups of phthalic acid with the hydroxy group of octanol. It has a role as a human xenobiotic metabolite. It derives from an octan-1-ol.', 'The molecule is an (omega-1)-hydroxy fatty acid that is (2E)-oct-2-enoic acid in ... | 2 | Its SMILES notation is C[C@H](CCC=C(C)C)[C@H]1CC[C@@]2([C@@]1(C[C@H]([C@@]3([C@H]2CC=C4[C@H]3CC[C@@H](C4(C)C)O)C)O)C)C. | ChemQA/mol_caption_29 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a delta-lactam that is piperidine-2-carboxylic acid substituted at position 6 by an oxo group. It has a role as a bacterial metabolite. It is a delta-lactam and a monocarboxylic acid. It is a conjugate acid of a 6-ketopiperidine-2-carboxylate.', "The molecule is an acyclic carotene that is lycopene in... | 2 | Its SMILES notation is C1=NC2=C(N1[C@H]3[C@H]4[C@@H]([C@H](O3)COP(=O)(O)O)OP(=O)(O4)O)N=C(NC2=O)N. | ChemQA/mol_caption_30 | |
What is the most relevant description of the following organic molecule? | ['The molecule is an amino trisaccharide that consists of a galactose residue attached by a beta-(1->3)-linkage to an N-acetylglucosamine residue, that is in turn attached to a second galactose by a beta-(1->6)-linkage. It is an amino trisaccharide and a glucosamine oligosaccharide.', 'The molecule is the pteridine tha... | 2 | Its SMILES notation is C[C@H]1[C@H]([C@H]([C@@H]([C@@H](O1)O[C@H]2[C@@H]([C@@H]([C@@H](O[C@H]2O[C@H]3[C@@H]([C@H](OC([C@@H]3NC(=O)C)O)CO)O[C@H]4[C@@H]([C@H]([C@H]([C@H](O4)CO)O)O)NC(=O)C)C)O)O)O)O)O. | ChemQA/mol_caption_31 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a member of the class of pyrazoles that is 1H-pyrazole which is substituted at positions 1, 3 and 5 by 4-sulfamoylphenyl, trifluoromethyl and p-tolyl groups, respectively. A cyclooxygenase-2 inhibitor, it is used in the treatment of arthritis. It has a role as a cyclooxygenase 2 inhibitor and a non-na... | 2 | Its SMILES notation is CC1=CCC(CC1=O)C(=C)C. | ChemQA/mol_caption_32 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a member of the class of tetracenes that is tetracenomycin C in which the methoxy group at position 3 is replaced by a phenolic OH. It has a role as a bacterial metabolite. It is an enol ether, an enone, a triol, a polyphenol, a methyl ester, a tetracenomycin and a tertiary alpha-hydroxy ketone.', "Th... | 0 | Its SMILES notation is CC1=C(C(=CC2=CC3=C(C(=C12)O)C(=O)[C@@]4(C(=O)C=C([C@H]([C@@]4(C3=O)O)O)OC)O)O)C(=O)OC. | ChemQA/mol_caption_33 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a member of the class of pyrrolidine-2-ones that is pyrrolidin-2-one in which the hydrogen attached to the nitrogen is replaced by a methyl group. It has a role as a polar aprotic solvent. It is a N-alkylpyrrolidine, a lactam and a member of pyrrolidin-2-ones.', 'The molecule is a 1-alkylglycero-3-pho... | 1 | Its SMILES notation is CCCCCCCCCCCCCCCCCCOCC(COP(=O)([O-])OCC[N+](C)(C)C)O. | ChemQA/mol_caption_34 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a monomethoxyflavone that is myricetin in which the hydroxy group at position 7 is substituted by a methoxy group. It has a role as a plant metabolite. It is a pentahydroxyflavone and a monomethoxyflavone. It derives from a myricetin.', 'The molecule is an O-acylcarnitine having 15-carboxypentadecanoy... | 0 | Its SMILES notation is COC1=CC(=C2C(=C1)OC(=C(C2=O)O)C3=CC(=C(C(=C3)O)O)O)O. | ChemQA/mol_caption_35 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a beta-D-galactosyl-N-acylsphingosine in which the acyl group is specified as eicosanoyl. It has a role as a mouse metabolite. It derives from an icosanoic acid.', 'The molecule is a ribulose 5-phosphate. It has a role as an Escherichia coli metabolite. It derives from a L-ribulose. It is a conjugate ... | 1 | Its SMILES notation is C([C@@H]([C@@H](C(=O)CO)O)O)OP(=O)(O)O. | ChemQA/mol_caption_36 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a polar amino acid zwitterion restulting from the transfer of a proton from the carboxy group to the alpha-amino group of D-histidine. The major species at pH 7.3. It is a tautomer of a D-histidine.', 'The molecule is a glycosylgalactose consisting of beta-D-galactose substituted on O-6 with a beta-D-... | 1 | Its SMILES notation is C([C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)O)O)O)O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)C(=O)O)O)O)O. | ChemQA/mol_caption_37 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a monounsaturated fatty acyl-CoA(4-) arising from deprotonation of the phosphate and diphosphate functions of trans-2-pentadecenoyl-CoA; major species at pH 7.3. It is a conjugate base of a trans-2-pentadecenoyl-CoA.', 'The molecule is a pteroate and a member of pteroates. It is a conjugate base of a ... | 3 | Its SMILES notation is C[C@H]1[C@@H](C[C@H]([C@@H](O1)OCCCCC(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)COP(=O)([O-])OP(=O)([O-])OC[C@@H]2[C@H]([C@H]([C@@H](O2)N3C=NC4=C(N=CN=C43)N)O)OP(=O)([O-])[O-])O)O)O. | ChemQA/mol_caption_38 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a monocarboxylic acid anion that is the conjugate base of 13-(beta-D-glucosyloxy)docosanoic acid, arising from deprotonation of the carboxy group. It derives from a behenate. It is a conjugate base of a 13-(beta-D-glucosyloxy)docosanoic acid.', 'The molecule is a ten-membered synthetic oligopeptide co... | 2 | Its SMILES notation is C[C@]12CC=C3[C@]([C@@H]1C[C@@]4(C(=C)[C@]2(C(=O)[C@@](C4=O)(C)O)C(=O)OC)C)([C@@H](CC(=O)C3(C)C)O)C. | ChemQA/mol_caption_39 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a beta-D-glucoside resulting from the formal condensation of the carboxy group of ferulic acid with the anomeric hydroxy group of beta-D-glucose. It has a role as an antioxidant and a plant metabolite. It is a beta-D-glucoside, a cinnamate ester, a member of phenols and an aromatic ether. It derives f... | 0 | Its SMILES notation is COC1=C(C=CC(=C1)/C=C/C(=O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)O. | ChemQA/mol_caption_40 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a medium-chain fatty acyl-CoA that results from the formal condensation of the thiol group of coenzyme A with the carboxy group of 2,6-dimethylheptanoic acid. It is a multi-methyl-branched fatty acyl-CoA and a medium-chain fatty acyl-CoA. It is a conjugate acid of a 2,6-dimethylheptanoyl-CoA(4-).', 'T... | 2 | Its SMILES notation is C[C@]1(CCC[C@@]2([C@@H]1[C@@H]([C@]34[C@H]2CC[C@](C3)(C(=C)C4)O)C(=O)O)C=O)C(=O)O. | ChemQA/mol_caption_41 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a ceramide obtained by formal condensation of the carboxy group of icosanoic acid with the amino group of (4E,14Z)-sphinga-4,14-dienine. It has a role as a Papio hamadryas metabolite. It derives from an icosanoic acid.', 'The molecule is a methyl-L-methionine having the methyl group attached to the al... | 0 | Its SMILES notation is CCCCCCCCCCCCCCCCCCCC(=O)N[C@@H](CO)[C@@H](/C=C/CCCCCCCC/C=C\\CCC)O. | ChemQA/mol_caption_42 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a polyunsaturated fatty acid anion that is the conjugate base of juvenile hormone I carboxylic acid, obtained by deprotonation of the carboxy group; major species at pH 7.3. It is a polyunsaturated fatty acid anion and a branched-chain fatty acid anion. It is a conjugate base of a juvenile hormone I a... | 0 | Its SMILES notation is CC/C(=C\\CC/C(=C/C(=O)[O-])/C)/CC[C@@H]1[C@](O1)(C)CC. | ChemQA/mol_caption_43 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a member of the class of hopanoids that is bacteriohopane-31,32,33,34-tetrol carrying additional methyl and amino substituents at positions 3 and 35 respectively. Isolated from Methylococcus capsulatus. It has a role as a bacterial metabolite. It is a hopanoid, a tetrol and a primary amino compound.',... | 0 | Its SMILES notation is C[C@H]1CC[C@@]2([C@H]3CC[C@@H]4[C@]5(CC[C@@H]([C@@H]5CC[C@]4([C@@]3(CC[C@H]2C1(C)C)C)C)[C@H](C)C[C@H]([C@H]([C@H]([C@H](CN)O)O)O)O)C)C. | ChemQA/mol_caption_44 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a pyrimidine nucleotide-sugar having thymine as the nucleobase and 4-amino-2,3,4,6-tetradeoxy-alpha-D-glucose as the sugar component. It has a role as a bacterial metabolite. It is a conjugate acid of a dTDP-4-ammonio-2,3,4,6-tetradeoxy-alpha-D-glucose(1-).', 'The molecule is an organosulfonate oxoani... | 0 | Its SMILES notation is C[C@@H]1[C@H](CC[C@H](O1)OP(=O)(O)OP(=O)(O)OC[C@@H]2[C@H](C[C@@H](O2)N3C=C(C(=O)NC3=O)C)O)N. | ChemQA/mol_caption_45 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a gallate ester obtained by condensation of the carboxy group of gallic acid with the hydroxy group of octanol. It has a role as a food antioxidant, a plant metabolite and a hypoglycemic agent.', "The molecule is a member of the class of phenoxazines that is 1,9-dimethyl-3H-phenoxazin-3-one carrying a... | 1 | Its SMILES notation is CC1=CC(=CC(=C1C2=C(C3=C(C=C2O)OC4=CC(=O)C(=C(C4=N3)C)C5=C(C=C(C=C5C)O)O)C)O)O. | ChemQA/mol_caption_46 | |
What is the most relevant description of the following organic molecule? | ['The molecule is an organosulfur heterocyclic compound that is 1,2,3-trithiane in which one of the hydrogens at position 5 has been replaced by a dimethylamino group. A nicotinic acetylcholine receptor agonist, it was used (particularly as its hydrogen oxalate salt, known as thyocyclam oxalate) as a broad-spectrum ins... | 0 | Its SMILES notation is CN(C)C1CSSSC1. | ChemQA/mol_caption_47 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a 1-alkylglycerone 3-phosphate in which the alkyl group is specified as pentadecyl It is a conjugate acid of a 1-pentadecylglycerone 3-phosphate(2-).', 'The molecule is an oligosaccharide sulfate consisting of 2-O-sulfo-beta-D-glucopyranuronic acid and 2-deoxy-6-O-sulfo-2-(sulfoamino)-alpha-D-glucopyr... | 1 | Its SMILES notation is C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O)NS(=O)(=O)O)O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)C(=O)O)O)O)OS(=O)(=O)O)OS(=O)(=O)O. | ChemQA/mol_caption_48 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a piperidinium ion that is benzamide substituted on nitrogen by a 2-hydroxyethyl group and at the 4-position by a [3-(4-carboxybutanamido)-N-methylpiperidinio]methyl group. It has a role as a hapten. It is a piperidinium ion and a quaternary ammonium ion.', "The molecule is a biflavonoid isolated from... | 3 | Its SMILES notation is CC(=O)OCCCC1=CC=CC=C1. | ChemQA/mol_caption_49 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a tetrasaccharide consisting of alpha-D-abequose, alpha-D-mannose, alpha-L-rhamnose and alpha-D-galactose residues linked sequentially (1->3), (1->4) and (1->3); epitope of the O-antigen polysaccharide in Salmonella. It has a role as an epitope.', 'The molecule is a monocarboxylic acid anion that is t... | 2 | Its SMILES notation is C(C(=O)[C@H](C(=O)[O-])O)OP(=O)([O-])[O-]. | ChemQA/mol_caption_50 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a monocarboxylic acid anion resulting from the deprotonation of the carboxy group of O-formylcefamandole. It is a conjugate base of an O-formylcefamandole.', 'The molecule is an oxylipin that is the 15-hydoxy derivative of (6Z,9Z,12Z,16E,18Z)-tetracosa-6,9,12,16,18-pentaenoic acid. Isolated from soft ... | 1 | Its SMILES notation is CCCCC/C=C\\C=C\\C(C/C=C\\C/C=C\\C/C=C\\CCCCC(=O)O)O. | ChemQA/mol_caption_51 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a dipeptide composed of L-asparagine and L-proline joined by a peptide linkage. It has a role as a metabolite. It derives from a L-asparagine and a L-proline.', 'The molecule is an indanone with an oxo substituent at position 2. It is a metabolite of indane. It has a role as a xenobiotic metabolite.',... | 3 | Its SMILES notation is CCCCC/C=C\\C/C=C\\CCCCCCCC(=O)OC[C@H](COP(=O)(O)O)O. | ChemQA/mol_caption_52 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a carboxylic ester obtained by the formal condensation of the benzylic hydroxy group of 4-hydroxy-6-[hydroxy(phenyl)methyl]-2-oxo-1,2-dihydropyridine-3-carboxylic acid with 3-methylbutanoic acid. It is isolated from the culture broth of Penicillium sp. SPF-32629 and acts as an inhibitor of the enzyme ... | 2 | Its SMILES notation is CCCCCCCC(=O)CC. | ChemQA/mol_caption_53 | |
What is the most relevant description of the following organic molecule? | ['The molecule is an ammonium ion resulting from the protonation of the nitrogen atom of iminodiacetate. The major species at pH 7.3. It is an ammonium ion derivative and a dicarboxylic acid dianion. It is a conjugate acid of an iminodiacetate.', 'The molecule is a monocarboxylic acid that is butyric acid in which one ... | 3 | Its SMILES notation is C1=CC(=C(C(=C1Cl)C(=O)O)Cl)Cl. | ChemQA/mol_caption_54 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a kaempferol O-glucoside that is kaempferol attached to a rutinosyl [6-deoxy-alpha-L-mannosyl-(1->6)-beta-D-glucosyl] residue at position 3 via a glycosidic linkage. It has been isolated from the leaves of Solanum campaniforme. It has a role as a metabolite, a radical scavenger and a plant metabolite.... | 1 | Its SMILES notation is C[C@H]([C@@H](C(=O)N1CCC[C@H]1C(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](C)N)O. | ChemQA/mol_caption_55 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a cembrane diterpenoid that is cembra-2E,7E,11Z-trien-20,10-olide substituted by a hydroxy group at position 1 and a methoxy group at position 4. It has been isolated from the leaves of natural product found in Croton gratissimus. It has a role as a metabolite. It is a cembrane diterpenoid, a diterpen... | 2 | Its SMILES notation is C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(C[C@H]([C@@H](C5(CO)CO)O)O)C)C)[C@@H]2[C@]1(C)O)C)C(=O)O. | ChemQA/mol_caption_56 | |
What is the most relevant description of the following organic molecule? | ['The molecule is an N-acyl-4-hydroxy-15-methylhexadecasphinganine-1-phosphocholine in which the acyl group has 18 carbons and 0 double bonds and is 2-hydroxylated. It is a N-acyl-4-hydroxy-15-methylhexadecasphinganine-1-phosphocholine and a 15-methylhexadecaphytosphingosine.', 'The molecule is a dicarboxylic acid that... | 2 | Its SMILES notation is C([C@@H]([C@@H](CS(=O)(=O)O)O)O)C(=O)C(=O)O. | ChemQA/mol_caption_57 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a malonate ester that is diisopropyl malonate in which the two methylene hydrogens at position 2 are replaced by a 1,3-dithiolan-2-ylidene group. An insecticide and fungicide used to control a range of diseases including Pyricularia oryzae, Helminthosporium sigmoideum and Fusarium nivale. It has a rol... | 2 | Its SMILES notation is C([C@H]([C@H]([C@@H](C=O)O)O)O)OP(=O)(O)O. | ChemQA/mol_caption_58 | |
What is the most relevant description of the following organic molecule? | ['The molecule is an (omega-1)-hydroxy fatty acid that is trans-2-tetradecenoic acid in which the 13-pro-R hydrogen is replaced by a hydroxy group. It is a long-chain fatty acid, an (omega-1)-hydroxy fatty acid, an alpha,beta-unsaturated monocarboxylic acid and a hydroxy monounsaturated fatty acid. It derives from a tr... | 1 | Its SMILES notation is CCC/C=C/C=C/C=C/CCC1=CC=C(O1)OC(=O)O. | ChemQA/mol_caption_59 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a primary arylamine that is p-xylene substituted at the 2 and 5 positions by amino groups. It is formally a reduction product of 2,5-dimethyl-1,4-benzoquinonediimine. It has a role as an allergen. It derives from a hydride of a p-xylene.', 'The molecule is an amino disaccharide comprised of 2-acetamid... | 1 | Its SMILES notation is CC(=O)N[C@@H]1[C@H]([C@@H]([C@H](O[C@H]1O[C@@H]2[C@H](O[C@H]([C@H]([C@H]2O)O)O)CO)CO)O)O. | ChemQA/mol_caption_60 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a linear amino tetrasaccharide consisting of two sialyl, one galactose and one glucose residue (at the reducing end) connected by sequential alpha-(2->8)-, alpha-(2->3)- and beta-(1->4)-linkages.', 'The molecule is a natural product found in Leucosceptrum canum. It has a role as a metabolite, an angio... | 1 | Its SMILES notation is C[C@@H]1CC[C@H]2[C@H]1[C@](C3=CC(O[C@@]3([C@@H]2C)O)(C)C)(C(=O)[C@@H](C)CC[C@@H]4C(=CC(=O)O4)C)O. | ChemQA/mol_caption_61 | |
What is the most relevant description of the following organic molecule? | ['The molecule is the S-enantiomer of 2-hydroxypalmitate. It is a conjugate base of a (S)-2-hydroxyhexadecanoic acid. It is an enantiomer of a (R)-2-hydroxyhexadecanoate.', "The molecule is an organic heterotetracyclic compound that is 7-phenyl-5-imino-5,7-dihydrobenzo[a]phenazine-3-sulfonic acid in which the imino hyd... | 0 | Its SMILES notation is CCCCCCCCCCCCCC[C@@H](C(=O)[O-])O. | ChemQA/mol_caption_62 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a very long-chain primary fatty alcohol that is tetracosane in which a hydrogen attached to one of the terminal carbons is replaced by a hydroxy group. It has been isolated from a variety of plants, including grape seeds, evening primrose (Oenothera biennis), pitaya fruits (Hylocereus polyrhizus and H... | 3 | Its SMILES notation is CCCCCCCC/C=C/CCCCCCCC(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC3=C(N=CN=C32)N)O)OP(=O)(O)O)O. | ChemQA/mol_caption_63 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a hydrochloride resulting from the reaction of equimolar amounts of sertraline and hydrogen chloride. A selective serotonin-reuptake inhibitor (SSRI), it is administered orally as an antidepressant for the treatment of depression, obsessive-compulsive disorder, panic disorder and post-traumatic stress... | 1 | Its SMILES notation is CN1C(=NN=N1)SCC2=C(N3[C@@H]([C@@](C3=O)(NC(=O)CSC[C@H](C(=O)O)N)OC)SC2)C(=O)O. | ChemQA/mol_caption_64 | |
What is the most relevant description of the following organic molecule? | ['The molecule is an organophosphate oxoanion obtained by deprotonation of the diphosphate OH groups of N-acetyl-alpha-D-glucosaminyl-1-diphospho-trans,polycis-decaprenol; major species at pH 7.3. It is a conjugate base of a N-acetyl-alpha-D-glucosaminyl-1-diphospho-trans,polycis-decaprenol.', 'The molecule is a cytoto... | 2 | Its SMILES notation is C/C(=C\\C=C\\C=C(\\C=C\\C=C(\\C=C\\C=C(\\C(=O)O)/C)/C)/C)/C=C/C=C(/C=C/C=C(/C(=O)O)\\C)\\C. | ChemQA/mol_caption_65 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a scalarane sesterterpenoid with formula C26H40O3, originally isolated from the marine sponge Hyrtios erecta. It has a role as a marine metabolite. It is a scalarane sesterterpenoid, an enal and an acetate ester.', 'The molecule is an organophosphate oxoanion arising from deprotonation of the phosphat... | 3 | Its SMILES notation is CCO.C[C@@H]1[C@H]2[C@@H]([C@H]3[C@@H](C(=O)C(=C([C@]3(C(=O)C2=C(C4=C1C=CC=C4O)O)O)O)C(=O)N)[NH+](C)C)O.C[C@@H]1[C@H]2[C@@H]([C@H]3[C@@H](C(=O)C(=C([C@]3(C(=O)C2=C(C4=C1C=CC=C4O)O)O)O)C(=O)N)[NH+](C)C)O.O.[Cl-].[Cl-]. | ChemQA/mol_caption_66 | |
What is the most relevant description of the following organic molecule? | ['The molecule is an L-alpha-amino acid zwitterion obtained by transfer of a proton from the carboxy to the amino group of gamma-glutamyltyramine It is a tautomer of a gamma-glutamyltyramine.', 'The molecule is a CDP-diacylglycerol in which both phosphatidyl acyl groups are specified as oleoyl. It derives from an oleic... | 2 | Its SMILES notation is COC1=C(C=CC(=C1)C2=CC(=O)C3=C(O2)C=C(C(=C3O)OC)O)O. | ChemQA/mol_caption_67 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a 1-hexadecanoyl-2-acyl-sn-glycero-3-phospho-1D-myo-inositol in which the 2-acyl group is specified as 9Z,12Z-octadecadienoyl (linoleoyl). It is a 1-hexadecanoyl-2-acyl-sn-glycero-3-phospho-1D-myo-inositol and a phosphatidylinositol (16:0/18:2). It is a conjugate acid of a 1-hexadecanoyl-2-(9Z,12Z-oct... | 3 | Its SMILES notation is CCCCC[C@@H](/C=C/[C@H]1[C@H]2C[C@@H]([C@@H]1C/C=C\\CCCC(=O)O)OO2)OO. | ChemQA/mol_caption_68 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a 1,3-diglyceride in which the acyl groups at positions 1 and 3 are specified as oleoyl and palmitoyl respectively (the S-stereoisomer). It is a 1-oleoyl-3-palmitoylglycerol and a 1,3-diacyl-sn-glycerol.', 'The molecule is a tetronic acid derivative that is furan-2(5H)-one which is substituted at posi... | 2 | Its SMILES notation is CCCCCCCCCCCCCC(=O)O[C@@H]1[C@H]([C@]2([C@@H](C=C(C[C@]3([C@H]2C=C(C3=O)C)O)CO)[C@H]4[C@@]1(C4(C)C)OC(=O)C)O)C. | ChemQA/mol_caption_69 | |
What is the most relevant description of the following organic molecule? | ['The molecule is an omega-hydroxy fatty acid ascaroside obtained by formal condensation of the alcoholic hydroxy group of (2E)-8-oct-2-enoic acid with ascarylopyranose (the alpha anomer). It is a metabolite of the nematode Caenorhabditis elegans. It has a role as a Caenorhabditis elegans metabolite. It is an omega-hyd... | 2 | Its SMILES notation is C[C@H](CCC[C@H](C)C(=O)[O-])[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O)C)C. | ChemQA/mol_caption_70 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a dimeric branched amino tetrasaccharide consisting of 6-O-sulfo-beta-D-glucosyl-(1->3)-N-acetyl-beta-D-galactosamine, having a further 6-O-sulfo-beta-D-glucosyl-(1->3)-N-acetyl-beta-D-galactosaminyl moiety attached at the 6-position of the galactosamine. It is an oligosaccharide sulfate and an amino ... | 3 | Its SMILES notation is CC(C(=O)N[C@H]1[C@@H]2N(C1=O)[C@H](C(S2)(C)C)C(=O)O)OC3=CC=CC=C3. | ChemQA/mol_caption_71 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a butenolide that is furan-2(5H)-one substituted by a 4-hydroxybenzyl group at position 4 and a 4-hydroxyphenyl group at position 3. It has been isolated from Penicillium species. It has a role as a Penicillium metabolite. It is a polyphenol and a butenolide.', 'The molecule is a L-arginine derivative... | 1 | Its SMILES notation is CN=C(N)NCCC[C@@H](C(=O)O)N. | ChemQA/mol_caption_72 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a gallate ester obtained by formal condensation of the carboxy group of gallic acid with the (3S)-hydroxy group of (+)-epicatechin. It has a role as a metabolite. It is a catechin, a gallate ester and a polyphenol. It derives from a gallic acid and a (+)-epicatechin.', 'The molecule is a N-acylpyrroli... | 3 | Its SMILES notation is COC(=O)N(C1=CC=CC=C1COC2=NN(C=C2)C3=CC=C(C=C3)Cl)OC. | ChemQA/mol_caption_73 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a nucleoside analogue that is adenosine in which the nitrogen at position 7 is replaced by a carbamoyl-substituted carbon. It is a potent inhibitor of protein kinase C. It has a role as a protein kinase inhibitor. It derives from an adenosine.', 'The molecule is a carbamate ester obtained by the forma... | 3 | Its SMILES notation is C[C@H](CCC(=O)NCCS(=O)(=O)O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC[C@H]4[C@@]3(CC[C@H](C4)OS(=O)(=O)O)C)C. | ChemQA/mol_caption_74 | |
What is the most relevant description of the following organic molecule? | ['The molecule is an organic sodium salt which is the monosodium salt of callysponginol sulfonic acid A. It is isolated from the marine sponge Callyspongia truncata as a membrane type 1 matrix metalloproteinase (MT1-MMP) inhibitor. It has a role as a metabolite and a matrix metalloproteinase inhibitor. It contains a ca... | 0 | Its SMILES notation is CCCCCC/C=C\\CCCCCCCCCCCCC#C[C@H](C(=O)O)OS(=O)(=O)[O-].[Na+]. | ChemQA/mol_caption_75 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a member of the class of cyclohexadienes that is cyclohexa-1,3-diene substituted by a 3-oxobutyl group at position 1 and by methyl groups at positions 2 and 6. It has a role as a human urinary metabolite and a flavouring agent. It is a cyclohexadiene and a methyl ketone.', 'The molecule is an enone th... | 1 | Its SMILES notation is CCC(=O)/C=C/C=C/C(=C/C=C/C=C/C1=CC=CC=C1)/C. | ChemQA/mol_caption_76 | |
What is the most relevant description of the following organic molecule? | ['The molecule is an anthracycline antibiotic that is 13-deoxydaunorubicin substituted at position 10 by a carboxy group. It is an aminoglycoside, an anthracycline antibiotic, a deoxy hexoside, a monosaccharide derivative, a hydroxy monocarboxylic acid and a member of p-quinones. It derives from a daunorubicin. It is a... | 2 | Its SMILES notation is CCCCCC(C(C/C=C\\CCCCCCCC(=O)[O-])O)O. | ChemQA/mol_caption_77 | |
What is the most relevant description of the following organic molecule? | ['The molecule is an optically active form of prolinate having D-configuration. It has a role as a human metabolite. It is a conjugate base of a D-proline. It is an enantiomer of a L-prolinate.', 'The molecule is a 1-O-acyl-sn-glycero-3-phosphocholine in which the acyl group is specified as icosanoyl. It is a 1-O-acyl-... | 1 | Its SMILES notation is CCCCCCCCCCCCCCCCCCCC(=O)OC[C@H](COP(=O)([O-])OCC[N+](C)(C)C)O. | ChemQA/mol_caption_78 | |
What is the most relevant description of the following organic molecule? | ['The molecule is an O-acylcarnitine having palmitoyl (hexadecanoyl) as the acyl substituent. It has a role as a metabolite. It derives from a hexadecanoic acid.', 'The molecule is an alpha-amino acid that is butanoic acid substituted by an amino group at position 2 and a hydroxy group at position 3. It has a role as a... | 2 | Its SMILES notation is CCCCC/C=C\\C/C=C\\CCCCCCCCCCCC(=O)[O-]. | ChemQA/mol_caption_79 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a hydroxy fatty acid anion obtained by deprotonation of the carboxy group of 9(S)-HODE; major species at pH 7.3. It is a hydroxy fatty acid anion, a polyunsaturated fatty acid anion, an octadecanoid anion and a HODE(1-). It is a conjugate base of a 9(S)-HODE. It is an enantiomer of a 9(R)-HODE(1-).', ... | 3 | Its SMILES notation is CC[NH3+].[N+](=O)([O-])[O-]. | ChemQA/mol_caption_80 | |
What is the most relevant description of the following organic molecule? | ['The molecule is an amino tetrasaccharide consisting of 2-acetamido-beta-D-galactopyranosyl, alpha-D-galactopyranosyl, beta-D-galactopyranosyl and beta-D-glucopyranosyl residues joined in sequence by (1->3) glycosidic bonds. It is an amino tetrasaccharide and a member of acetamides.', 'The molecule is a quassinoid tha... | 3 | Its SMILES notation is C[C@@H](C(=O)O)NC(=O)CC1=CNC2=CC=CC=C21. | ChemQA/mol_caption_81 | |
What is the most relevant description of the following organic molecule? | ['The molecule is an unsaturated fatty acyl-CoA that results from the formal condensation of the thiol group of coenzyme A with the carboxy group of trans-oct-2-enoic acid. It has a role as a human metabolite, an Escherichia coli metabolite and a mouse metabolite. It is a medium-chain fatty acyl-CoA, a trans-2-enoyl-Co... | 0 | Its SMILES notation is CCCCC/C=C/C(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC3=C(N=CN=C32)N)O)OP(=O)(O)O)O. | ChemQA/mol_caption_82 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a dibenzoazepine that is 5H-dibenzo[b,f]azepine carrying a carbamoyl substituent at the azepine nitrogen, used as an anticonvulsant. It has a role as an anticonvulsant, an EC 3.5.1.98 (histone deacetylase) inhibitor, a mitogen, a glutamate transporter activator, an antimanic drug, an analgesic, a non-... | 1 | Its SMILES notation is CCCCCCCCCCCCCCCCCC(=O)N[C@@H](CO)[C@@H](/C=C/CCCCCCCCCC(C)C)O. | ChemQA/mol_caption_83 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a carotenol having the structure of rhodopin with two hydrogen atoms abstracted from the C(3)-C(4) bond to form an extra trans double bond. It has a role as a bacterial metabolite. It is a carotenol and a tertiary alcohol. It derives from a rhodopin.', 'The molecule is a 3beta-hydroxy-4beta-formyl-4al... | 3 | Its SMILES notation is C1=CC=C(C(=C1)C2=C3C=C(C(=O)C=C3OC4=C(C(=C(C=C24)Br)[O-])[Hg])Br)C(=O)[O-].O.[Na+].[Na+]. | ChemQA/mol_caption_84 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a pyrrolopyrazine that is hexahydropyrrolo[1,2-a]pyrazine-1,4-dione substituted by a hydroxy group at position 6 and a 2-methylpropyl group at position 3. It has been isolated from the mycelia of Cordyceps sinensis. It has a role as a fungal metabolite. It is a pyrrolopyrazine and a dipeptide.', 'The ... | 2 | Its SMILES notation is CCCCC/C=C\\C/C=C\\C/C=C\\C/C=C\\CCCC(=O)O. | ChemQA/mol_caption_85 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a pentacyclic triterpenoid that is olean-18-ene substituted at position 3 by an oxo group and position 28 by a carboxy group. It has a role as a metabolite, an anti-HSV-1 agent and an anti-HIV agent. It derives from a hydride of an oleanane.', 'The molecule is an organophosphate oxoanion obtained by d... | 0 | Its SMILES notation is C[C@@]12CC[C@]3(CCC(C=C3[C@H]1CC[C@H]4[C@]2(CC[C@@H]5[C@@]4(CCC(=O)C5(C)C)C)C)(C)C)C(=O)O. | ChemQA/mol_caption_86 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a quercetin O-glucoside that is quercetin attached to a beta-D-glucopyranosyl-(1->6)-beta-D-glucopyranosyl-(1->6)-beta-D-glucopyranosyl-(1->6)-beta-D-glucopyranoside residue at position 3 via a glycosidic linkage. It has a role as a plant metabolite. It is a quercetin O-glucoside, a tetrahydroxyflavon... | 3 | Its SMILES notation is C1=CC(=C(C=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O)CO)O)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O. | ChemQA/mol_caption_87 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a quinoline having a chloro group at the 7-position and an aryl amino group at the 4-position. It has a role as an antimalarial, a non-steroidal anti-inflammatory drug, a drug allergen, a prodrug, an EC 2.1.1.8 (histamine N-methyltransferase) inhibitor and an anticoronaviral agent. It is a member of p... | 1 | Its SMILES notation is CCCCC[C@@H](/C=C/C=C\\C/C=C\\C/C=C\\CCCC(=O)O[C@H](CO)COP(=O)([O-])OCC[N+](C)(C)C)O. | ChemQA/mol_caption_88 | |
What is the most relevant description of the following organic molecule? | ["The molecule is the doubly positive charged ammonium ion obtained from protonation of the four amino groups and deprotonation of the phosphate OH groups of kanamycin A 3'-phosphate; major species at pH 7.3. It is a conjugate acid of a kanamycin A 3'-phosphate.", 'The molecule is a dicarboxylic acid dianion and a hydr... | 3 | Its SMILES notation is C([C@@H]1[C@H]([C@@H]([C@H](C(O1)O)NC(=O)CO)O)O)OP(=O)(O)O. | ChemQA/mol_caption_89 | |
What is the most relevant description of the following organic molecule? | ['The molecule is an O-acylcarnitine having (7Z,10Z,13Z,16Z)-docosatetraenoyl as the acyl substituent. It has a role as a metabolite. It derives from a carnitine.', 'The molecule is tetraanion of methacrylyl-CoA arising from deprotonation of the phosphate and diphosphate functions; principal microspecies at pH 7.3. It ... | 0 | Its SMILES notation is CCCCC/C=C\\C/C=C\\C/C=C\\C/C=C\\CCCCCC(=O)OC(CC(=O)[O-])C[N+](C)(C)C. | ChemQA/mol_caption_90 | |
What is the most relevant description of the following organic molecule? | ['The molecule is an O-acylcarnitine having 3-hydroxyeicosanoyl as the acyl substituent. It has a role as a metabolite. It is an O-acylcarnitine, an ammonium betaine and a carboxylic ester. It derives from a carnitine.', 'The molecule is an unsaturated fatty acid, a carbocyclic fatty acid and an oxo carboxylic acid. It... | 3 | Its SMILES notation is C12=C(C(=C(C(=C1Cl)Cl)Cl)Cl)C(=O)OC2=O. | ChemQA/mol_caption_91 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a fatty acid ester that is the ethyl ester of 3-hydroxyhexanoic acid. It derives from a 3-hydroxyhexanoic acid.', "The molecule is a cyclic purine dinucleotide that consists of AMP and GMP units cyclised via 3',5'-linkages. It is an adenyl ribonucleotide, a cyclic purine dinucleotide and a guanyl ribo... | 3 | Its SMILES notation is CN1C=[N+](C2=C1C(=O)NC(=N2)N(C)C)[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)([O-])[O-])O)O. | ChemQA/mol_caption_92 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a fifteen-membered glycopeptide comprising glycyl, cyclohexylglycyl, alanyl, glycyl, 3-methylphenylalanyl, (5R)-5-(beta-D-galactopyranosyloxy)lysyl, glycyl. alpha-glutamyl, glutaminyl, glycyl, prolyl, lysyl, glycyl, alpha-glutamyl and threonine residues coupled in sequence.', 'The molecule is the trih... | 2 | Its SMILES notation is C1=CC(=CC=C1C(=N)N)OCCCOC2=CC=C(C=C2)C(=N)N.C(CS(=O)(=O)O)O.C(CS(=O)(=O)O)O. | ChemQA/mol_caption_93 | |
What is the most relevant description of the following organic molecule? | ['The molecule is dianion of (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate arising from deprotonation of both phosphate OH groups. It is a conjugate base of a (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate.', 'The molecule is the aromatic diazonium ion that is diazotised 2-aminobenzenesulfonic acid. It has a role as a hap... | 3 | Its SMILES notation is C1CC1NC2=C3C(=NC(=N2)N)N(C=N3)[C@@H]4C[C@@H](C=C4)CO.C1CC1NC2=C3C(=NC(=N2)N)N(C=N3)[C@@H]4C[C@@H](C=C4)CO.OS(=O)(=O)O. | ChemQA/mol_caption_94 | |
What is the most relevant description of the following organic molecule? | ['The molecule is an aromatic amino-acid anion that is the conjugate base of phenylalanine, arising from deprotonation of the carboxy group. It is an alpha-amino-acid anion and an aromatic amino-acid anion. It is a conjugate base of a phenylalanine.', 'The molecule is a phosphatidylcholine 40:1 in which the acyl groups... | 1 | Its SMILES notation is CCCCCCCCCCCCCCCCCCCC(=O)OC[C@H](COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCCC/C=C\\CCCCCCCC. | ChemQA/mol_caption_95 | |
What is the most relevant description of the following organic molecule? | ['The molecule is an organic heterotetracyclic compound and 19-membered macrocyclic lactam antibiotic originally isolated from the Ethiopian shrub Maytenus serrata but also found in other Maytenus species. It exhibits cytotoxicity against many tumour cell lines. It has a role as a plant metabolite, an antimicrobial age... | 2 | Its SMILES notation is CCCOC(=O)C. | ChemQA/mol_caption_96 | |
What is the most relevant description of the following organic molecule? | ['The molecule is an aldehyde that is thiphene substituted by a formyl group at position 2. It has a role as a metabolite. It is a member of thiophenes and an aldehyde.', 'The molecule is a phosphate salt obtained by reacting 3,4-dimethyl-1H-pyrazole with one equivalent of phosphoric acid. It is a nitrification inhibit... | 2 | Its SMILES notation is CCC(C)C(C(=O)[O-])O. | ChemQA/mol_caption_97 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a cyclic hydroxamic acid that consists of 1,4-benzoxazine bearing three hydroxy substituents at positions 2, 4 and 7 as well as an oxo group at position 3. It is a benzoxazine, a cyclic hydroxamic acid and a lactol.', 'The molecule is an N-acetyl-beta-D-glucosaminide in which the anomeric hydroxy hydr... | 3 | Its SMILES notation is CC(=O)N1CCN(CC1)C2=CC=C(C=C2)OC[C@@H]3CO[C@](O3)(CN4C=CN=C4)C5=C(C=C(C=C5)Cl)Cl. | ChemQA/mol_caption_98 | |
What is the most relevant description of the following organic molecule? | ['The molecule is a sialotriaosylceramide that is ganglioside GM2 (18:0) in which the carboxy function of the sialic acid residue has been converted into a carboxamide. It is a sialotriaosylceramide and a dicarboxylic acid diamide. It derives from a ganglioside GM2 (18:0).', 'The molecule is a polyprenol triphosphate w... | 0 | Its SMILES notation is CCCCCCCCCCCCCCCCCC(=O)N[C@@H](CO[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O[C@H]2[C@@H]([C@H]([C@H]([C@H](O2)CO)O[C@H]3[C@@H]([C@H]([C@H]([C@H](O3)CO)O)O)NC(=O)C)O[C@@]4(C[C@@H]([C@H]([C@@H](O4)[C@@H]([C@@H](CO)O)O)NC(=O)C)O)C(=O)N)O)O)O)[C@@H](/C=C/CCCCCCCCCCCCC)O. | ChemQA/mol_caption_99 |
Dataset Card for ChemQA
Introducing ChemQA: a Multimodal Question-and-Answering Dataset on Chemistry Reasoning. This work is inspired by IsoBench[1] and ChemLLMBench[2].
Content
There are 5 QA Tasks in total:
- Counting Numbers of Carbons and Hydrogens in Organic Molecules: adapted from the 600 PubChem molecules created from [2], evenly divided into validation and evaluation datasets.
- Calculating Molecular Weights in Organic Molecules: adapted from the 600 PubChem molecules created from [2], evenly divided into validation and evaluation datasets.
- Name Conversion: From SMILES to IUPAC: adapted from the 600 PubChem molecules created from [2], evenly divided into validation and evaluation datasets.
- Molecule Captioning and Editing: inspired by [2], adapted from dataset provided in [3], following the same training, validation and evaluation splits.
- Retro-synthesis Planning: inspired by [2], adapted from dataset provided in [4], following the same training, validation and evaluation splits.
Load the Dataset
from datasets import load_dataset
dataset_train = load_dataset('shangzhu/ChemQA', split='train')
dataset_valid = load_dataset('shangzhu/ChemQA', split='valid')
dataset_test = load_dataset('shangzhu/ChemQA', split='test')
Reference
[1] Fu, D., Khalighinejad, G., Liu, O., Dhingra, B., Yogatama, D., Jia, R., & Neiswanger, W. (2024). IsoBench: Benchmarking Multimodal Foundation Models on Isomorphic Representations.
[2] Guo, T., Guo, kehan, Nan, B., Liang, Z., Guo, Z., Chawla, N., Wiest, O., & Zhang, X. (2023). What can Large Language Models do in chemistry? A comprehensive benchmark on eight tasks. Advances in Neural Information Processing Systems (Vol. 36, pp. 59662–59688).
[3] Edwards, C., Lai, T., Ros, K., Honke, G., Cho, K., & Ji, H. (2022). Translation between Molecules and Natural Language. Proceedings of the 2022 Conference on Empirical Methods in Natural Language Processing, 375–413.
[4] Irwin, R., Dimitriadis, S., He, J., & Bjerrum, E. J. (2022). Chemformer: a pre-trained transformer for computational chemistry. Machine Learning: Science and Technology, 3(1), 15022.
Citation
@misc{chemQA2024,
title={ChemQA: a Multimodal Question-and-Answering Dataset on Chemistry Reasoning},
author={Shang Zhu and Xuefeng Liu and Ghazal Khalighinejad},
year={2024},
publisher={Hugging Face},
howpublished={\url{https://huggingface.co/datasets/shangzhu/ChemQA}},
}
@misc{zimmermann2024reflections2024largelanguage,
title={Reflections from the 2024 Large Language Model (LLM) Hackathon for Applications in Materials Science and Chemistry},
author={Yoel Zimmermann and Adib Bazgir and Zartashia Afzal and Fariha Agbere and Qianxiang Ai and Nawaf Alampara and Alexander Al-Feghali and Mehrad Ansari and Dmytro Antypov and Amro Aswad and Jiaru Bai and Viktoriia Baibakova and Devi Dutta Biswajeet and Erik Bitzek and Joshua D. Bocarsly and Anna Borisova and Andres M Bran and L. Catherine Brinson and Marcel Moran Calderon and Alessandro Canalicchio and Victor Chen and Yuan Chiang and Defne Circi and Benjamin Charmes and Vikrant Chaudhary and Zizhang Chen and Min-Hsueh Chiu and Judith Clymo and Kedar Dabhadkar and Nathan Daelman and Archit Datar and Matthew L. Evans and Maryam Ghazizade Fard and Giuseppe Fisicaro and Abhijeet Sadashiv Gangan and Janine George and Jose D. Cojal Gonzalez and Michael Götte and Ankur K. Gupta and Hassan Harb and Pengyu Hong and Abdelrahman Ibrahim and Ahmed Ilyas and Alishba Imran and Kevin Ishimwe and Ramsey Issa and Kevin Maik Jablonka and Colin Jones and Tyler R. Josephson and Greg Juhasz and Sarthak Kapoor and Rongda Kang and Ghazal Khalighinejad and Sartaaj Khan and Sascha Klawohn and Suneel Kuman and Alvin Noe Ladines and Sarom Leang and Magdalena Lederbauer and Sheng-Lun Mark Liao and Hao Liu and Xuefeng Liu and Stanley Lo and Sandeep Madireddy and Piyush Ranjan Maharana and Shagun Maheshwari and Soroush Mahjoubi and José A. Márquez and Rob Mills and Trupti Mohanty and Bernadette Mohr and Seyed Mohamad Moosavi and Alexander Moßhammer and Amirhossein D. Naghdi and Aakash Naik and Oleksandr Narykov and Hampus Näsström and Xuan Vu Nguyen and Xinyi Ni and Dana O'Connor and Teslim Olayiwola and Federico Ottomano and Aleyna Beste Ozhan and Sebastian Pagel and Chiku Parida and Jaehee Park and Vraj Patel and Elena Patyukova and Martin Hoffmann Petersen and Luis Pinto and José M. Pizarro and Dieter Plessers and Tapashree Pradhan and Utkarsh Pratiush and Charishma Puli and Andrew Qin and Mahyar Rajabi and Francesco Ricci and Elliot Risch and Martiño Ríos-García and Aritra Roy and Tehseen Rug and Hasan M Sayeed and Markus Scheidgen and Mara Schilling-Wilhelmi and Marcel Schloz and Fabian Schöppach and Julia Schumann and Philippe Schwaller and Marcus Schwarting and Samiha Sharlin and Kevin Shen and Jiale Shi and Pradip Si and Jennifer D'Souza and Taylor Sparks and Suraj Sudhakar and Leopold Talirz and Dandan Tang and Olga Taran and Carla Terboven and Mark Tropin and Anastasiia Tsymbal and Katharina Ueltzen and Pablo Andres Unzueta and Archit Vasan and Tirtha Vinchurkar and Trung Vo and Gabriel Vogel and Christoph Völker and Jan Weinreich and Faradawn Yang and Mohd Zaki and Chi Zhang and Sylvester Zhang and Weijie Zhang and Ruijie Zhu and Shang Zhu and Jan Janssen and Ian Foster and Ben Blaiszik},
year={2024},
eprint={2411.15221},
archivePrefix={arXiv},
primaryClass={cs.LG},
url={https://arxiv.org/abs/2411.15221},
}
Contact
- Downloads last month
- 42