text
stringlengths
1
383k
input_ids
list
token_type_ids
list
attention_mask
list
Blésois (or Blaisois in older maps) is a natural region of France located around the city of Blois (Loir-et-Cher). This term also refers to the locals living there. Historically, Blésois was part of the County of Blois, and from 1498 part of the Orléanais province. Situation This natural region is located in the cent...
[ 101, 139, 18076, 7301, 1548, 113, 1137, 139, 20737, 7301, 1548, 1107, 2214, 7415, 114, 1110, 170, 2379, 1805, 1104, 1699, 1388, 1213, 1103, 1331, 1104, 139, 2858, 1548, 113, 10605, 3161, 118, 3084, 118, 20394, 1200, 114, 119, 1188, 1858...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Abderrahim Berrada (; 1938 – 20 February 2022) was a Moroccan lawyer and human rights activist. Biography Berrada became a lawyer in 1962, specializing in political processing. He defended activists within the National Union of Popular Forces and other political activists during the 1970s. He also represented Abraham ...
[ 101, 22358, 1200, 10659, 4060, 4108, 10582, 1810, 113, 132, 3412, 782, 1406, 1428, 17881, 1477, 114, 1108, 170, 18754, 4545, 1105, 1769, 2266, 7041, 119, 20599, 4108, 10582, 1810, 1245, 170, 4545, 1107, 2832, 117, 14774, 1107, 1741, 6165,...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Nancy McCord (died July 8, 1974, Arcadia, California) was an American soprano and actress who had an active career in opera, musical theatre, and vaudeville during the 1920s, 1930s and early 1940s. She appeared in operettas and musicals on Broadway and in operas with several American companies, including the St. Louis ...
[ 101, 7444, 150, 1665, 1658, 6944, 113, 1452, 1351, 129, 117, 2424, 117, 18647, 21403, 117, 1756, 114, 1108, 1126, 1237, 11264, 1105, 3647, 1150, 1125, 1126, 2327, 1578, 1107, 4677, 117, 2696, 4041, 117, 1105, 25535, 1219, 1103, 6033, 11...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
The 2021–22 season is A.C. Perugia Calcio's first season back in second division of the Italian football league, the Serie B, and the 117th as a football club. Players First-team quad Out on loan Pre-season and friendlies Competitions Overall record Serie A League table Results summary Results by round Match...
[ 101, 1109, 17881, 1475, 782, 1659, 1265, 1110, 138, 119, 140, 119, 7022, 9037, 11917, 8174, 112, 188, 1148, 1265, 1171, 1107, 1248, 2417, 1104, 1103, 2169, 1709, 2074, 117, 1103, 9689, 139, 117, 1105, 1103, 12737, 1582, 1112, 170, 1709,...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
The 1935 Southwest Texas State Bobcats football team was an American football team that represented Southwest Texas State Teachers College (now known as Texas State University) during the 1935 college football season as a member of the Lone Star Conference (LSC). In their first year under head coach Joe Bailey Cheaney,...
[ 101, 1109, 3588, 10859, 2245, 1426, 3162, 21393, 1709, 1264, 1108, 1126, 1237, 1709, 1264, 1115, 2533, 10859, 2245, 1426, 14290, 1531, 113, 1208, 1227, 1112, 2245, 1426, 1239, 114, 1219, 1103, 3588, 2134, 1709, 1265, 1112, 170, 1420, 1104...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
The Justus Bissing Jr. Historic District, in Hays, Kansas in Ellis County, Kansas, was listed on the National Register of Historic Places in 2004. The district includes two contributing buildings: the 1920 Justus Bissing Jr. house, Craftsman in style with Prairie School influences, and the c. 1932 Tower Service statio...
[ 101, 1109, 2066, 1361, 139, 14788, 1158, 3108, 119, 3700, 1574, 117, 1107, 16164, 1116, 117, 4312, 1107, 8161, 1391, 117, 4312, 117, 1108, 2345, 1113, 1103, 1305, 4273, 1104, 3700, 5068, 1107, 1516, 119, 1109, 1629, 2075, 1160, 7773, 22...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
The Antico Stabilimento Balneare (Ancient Bathing Establishment) located in Mondello, a seaside borough north of Palermo, Sicily, is a art noveau or Liberty-style building atop piers of the beach in the town. The term balneare is related to the Spanish and Portuguese Balneario which is either a swimming or beach establ...
[ 101, 1109, 8329, 2528, 1457, 23156, 24891, 3452, 1186, 18757, 21615, 19386, 1162, 113, 7622, 10567, 1158, 24813, 114, 1388, 1107, 22401, 12065, 1186, 117, 170, 17043, 3269, 7833, 1564, 1104, 20250, 117, 12180, 117, 1110, 170, 1893, 1185, ...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Judy Berkstresser is a former American Republican politician who served in the Missouri House of Representatives. She graduated from Crane High School and attended the College of the Ozarks. She has worked as a cosmetologist, the owner of a beef cattle operation, the owner and operator of a dairy farm, and as a real ...
[ 101, 12248, 4108, 18416, 20357, 6906, 1110, 170, 1393, 1237, 3215, 2931, 1150, 1462, 1107, 1103, 4499, 1585, 1104, 5423, 119, 1153, 3024, 1121, 15972, 1693, 1323, 1105, 2323, 1103, 1531, 1104, 1103, 16075, 23822, 1116, 119, 1153, 1144, 15...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Vovkove () may refer to the following places in Ukraine: Vovkove, Donetsk Oblast, village in Pokrovsk Raion Vovkove, Odessa Oblast, village in Berezivka Raion Vovkove, Sumy Oblast, village in Romny Raion Vovkove, Zakarpattia Oblast, village in Uzhhorod Raion Vovkove, former name of Tanivka, village in Berezivka Raion,...
[ 101, 159, 3292, 7498, 1162, 113, 114, 1336, 5991, 1106, 1103, 1378, 2844, 1107, 5231, 131, 159, 3292, 7498, 1162, 117, 24243, 23450, 11705, 117, 1491, 1107, 18959, 1377, 12316, 5276, 20089, 1320, 159, 3292, 7498, 1162, 117, 21613, 11705, ...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Chris Ryder was a journalist and author originally from Northern Ireland. Chris Ryder was born in Newry in 1947. He attended St. Mary's Christian Brothers' Grammar School, Belfast. He worked as a journalist for several newspapers including the Belfast Telegraph, the Sunday Times and the Daily Telegraph. He was targ...
[ 101, 2929, 11779, 1108, 170, 4391, 1105, 2351, 2034, 1121, 2579, 2270, 119, 2929, 11779, 1108, 1255, 1107, 1203, 1616, 1107, 3138, 119, 1124, 2323, 1457, 119, 2090, 112, 188, 2131, 5216, 112, 11803, 1323, 117, 10189, 119, 1124, 1589, 11...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Fruman is a surname. Notable people with the surname include: Igor Fruman (born 1966), Soviet-born American businessman Orly Fruman (born 1955), Israeli politician
[ 101, 13359, 19147, 1110, 170, 12239, 119, 11017, 1234, 1114, 1103, 12239, 1511, 131, 15293, 13359, 19147, 113, 1255, 2678, 114, 117, 2461, 118, 1255, 1237, 6414, 2926, 1193, 13359, 19147, 113, 1255, 3115, 114, 117, 4878, 2931, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
The Ghost of Kyiv () is the nickname given to a disputed and unconfirmed MiG-29 Fulcrum flying ace credited with shooting down six Russian planes in the Kyiv offensive on 24 February 2022. According to the Security Service of Ukraine, he has shot down 10 Russian jets as of 27 February. Although not confirmed to be real...
[ 101, 1109, 9040, 1104, 148, 10279, 1964, 113, 114, 1110, 1103, 8002, 1549, 1106, 170, 11807, 1105, 8362, 7235, 22750, 25107, 118, 1853, 14763, 1233, 1665, 5697, 3754, 20839, 5175, 1114, 4598, 1205, 1565, 1938, 10025, 1107, 1103, 148, 1027...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
This list includes cavalry regiments assigned to Corps of the British Army in the period 1916–19. On the outbreak of World War I the establishment of a British infantry division included a cavalry squadron for reconnaissance and escort duties. From 1915 these were primarily provided by mounted units of the Special Rese...
[ 101, 1188, 2190, 2075, 7915, 11988, 3346, 1106, 3158, 1104, 1103, 1418, 1740, 1107, 1103, 1669, 4145, 782, 1627, 119, 1212, 1103, 8010, 1104, 1291, 1414, 146, 1103, 4544, 1104, 170, 1418, 6404, 2417, 1529, 170, 7915, 5780, 1111, 11469, ...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
The National Security Council of Antigua and Barbuda was established in 2006 by The National Security Council Act of 2006. Role The role of the National Security Council as defined by the National Security Council Act is to; create policies for government ministries relating to national security. Make recommendations...
[ 101, 1109, 1305, 4354, 1761, 1104, 8329, 13855, 1105, 6523, 7925, 1810, 1108, 1628, 1107, 1386, 1118, 1109, 1305, 4354, 1761, 2173, 1104, 1386, 119, 17094, 1109, 1648, 1104, 1103, 1305, 4354, 1761, 1112, 3393, 1118, 1103, 1305, 4354, 1761...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Rosa 'Black Baccara' (aka 'MEIdebenne') is a dark burgundy Hybrid tea rose cultivar, bred by French rose hybridizer, Jacques Mouchotte, before 2000. Meilland International introduced the rose in France in 2000. The rose was also introduced in America by Star Roses and Plants/Conard-Pyle in 2002. Description 'Black Ba...
[ 101, 9449, 112, 2117, 18757, 19495, 1611, 112, 113, 10908, 112, 22157, 2240, 2007, 9672, 1673, 112, 114, 1110, 170, 1843, 171, 15243, 27478, 27602, 5679, 3152, 9528, 12416, 1197, 117, 14698, 1118, 1497, 3152, 9890, 17260, 117, 6909, 12556...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
The 1937 Southwest Texas State Bobcats football team was an American football team that represented Southwest Texas State Teachers College (now known as Texas State University) during the 1937 college football season as a member of the Lone Star Conference (LSC). In their third year under head coach Joe Bailey Cheaney,...
[ 101, 1109, 3493, 10859, 2245, 1426, 3162, 21393, 1709, 1264, 1108, 1126, 1237, 1709, 1264, 1115, 2533, 10859, 2245, 1426, 14290, 1531, 113, 1208, 1227, 1112, 2245, 1426, 1239, 114, 1219, 1103, 3493, 2134, 1709, 1265, 1112, 170, 1420, 1104...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
The American Association of Veterinary Parasitologists is a professional association for veterinary parasitology. Despite the name it primarily serves both the United States and Canada and to a lesser degree the entire world. The AAVP connects veterinary parasitologists to each other and provides recommendations as to ...
[ 101, 1109, 1237, 1791, 1104, 27495, 23994, 5053, 2430, 17246, 1110, 170, 1848, 3852, 1111, 27431, 18311, 5053, 25333, 119, 2711, 1103, 1271, 1122, 3120, 3411, 1241, 1103, 1244, 1311, 1105, 1803, 1105, 1106, 170, 9774, 2178, 1103, 2072, 13...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Mard-i Imruz (Persian: The Man of Today) was a Persian language weekly newspaper which was in circulation between 1942 and 1948. It was based in Tehran, Iran. The paper was among the opposition publications of the period. History and period Mard-i Imruz was established by Mohammad Masud who was the license holder, and...
[ 101, 9751, 1181, 118, 178, 146, 1306, 5082, 1584, 113, 3886, 131, 1109, 2268, 1104, 3570, 114, 1108, 170, 3886, 1846, 5392, 3054, 1134, 1108, 1107, 9097, 1206, 2889, 1105, 3027, 119, 1135, 1108, 1359, 1107, 13857, 117, 3398, 119, 1109, ...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
A typewriter is a mechanical or electromechanical machine for typing characters. Typewriter or Typewriters may also refer to: The Typewriter, a short composition of light music by Leroy Anderson Typewriter (TV series), an Indian web television series Ilion Typewriters, an American minor league baseball team
[ 101, 138, 2076, 13814, 1110, 170, 6676, 1137, 24266, 3263, 18546, 4571, 3395, 1111, 26716, 2650, 119, 6902, 13814, 1137, 6902, 13814, 1116, 1336, 1145, 5991, 1106, 131, 1109, 6902, 13814, 117, 170, 1603, 5239, 1104, 1609, 1390, 1118, 2533...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Ocellularia upretii is a species of corticolous (bark-dwelling) lichen in the family Graphidaceae. It is found in India. Taxonomy The lichen was formally described as a new species in 2018 by Santosh Joshi, Pradeep Divakar, H. Thorsten Lumbsch, and Robert Lücking. The type was collected in the Shimoga District of cent...
[ 101, 152, 18091, 1465, 1146, 8127, 6904, 1110, 170, 1530, 1104, 1884, 3740, 10658, 12769, 113, 12001, 118, 13835, 114, 181, 26312, 1179, 1107, 1103, 1266, 144, 14543, 3031, 1810, 8814, 119, 1135, 1110, 1276, 1107, 1726, 119, 13429, 19608,...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Ronald Whitefoord Smith (1855 – 8 August 1909) was an Australian politician. Smith was born in Sandy Bay in Tasmania in 1855. In 1897 he was elected to the Tasmanian House of Assembly, representing the seat of Launceston. He served until his defeat in 1900. He died in 1909 in Hobart. References 1855 births 1909 deat...
[ 101, 8565, 2061, 14467, 6944, 2159, 113, 8082, 782, 129, 1360, 4818, 114, 1108, 1126, 1925, 2931, 119, 2159, 1108, 1255, 1107, 9908, 2410, 1107, 12484, 1107, 8082, 119, 1130, 5678, 1119, 1108, 1809, 1106, 1103, 23584, 1585, 1104, 2970, ...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
The 1966 Dayton race riot (also known as the Dayton uprising) was a period of civil unrest in Dayton, Ohio, United States. The riot occurred on September 1 and lasted about 24 hours, ending after the Ohio National Guard had been mobilized. It was the largest race riot in Dayton's history and one of several to occur dur...
[ 101, 1109, 2678, 15321, 1886, 14807, 113, 1145, 1227, 1112, 1103, 15321, 13034, 114, 1108, 170, 1669, 1104, 2987, 18366, 1107, 15321, 117, 3197, 117, 1244, 1311, 119, 1109, 14807, 3296, 1113, 1347, 122, 1105, 5695, 1164, 1572, 2005, 117, ...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Oberammergau station () is a railway station in the municipality of Oberammergau, in Bavaria, Germany. It is the southern terminus of the Ammergau Railway of Deutsche Bahn. Services the following services stop at Oberammergau: RB: hourly service to References External links Oberammergau layout Railway stat...
[ 101, 152, 3169, 2312, 4027, 20130, 1466, 113, 114, 1110, 170, 2529, 1466, 1107, 1103, 2667, 1104, 152, 3169, 2312, 4027, 20130, 117, 1107, 11632, 117, 1860, 119, 1135, 1110, 1103, 2359, 7132, 1104, 1103, 7277, 4027, 20130, 2847, 1104, 1...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
My Lady Friends is a 1921 American silent comedy film directed by Lloyd Ingraham and starring Carter DeHaven, Flora Parker DeHaven and Thomas G. Lingham. It was based on the 1919 Broadway play of the same title by Frank Mandel and Emil Nyitray. Cast Carter DeHaven as James Smith Flora Parker DeHaven as Catherine ...
[ 101, 1422, 2876, 7025, 1110, 170, 4085, 1237, 3826, 3789, 1273, 2002, 1118, 6151, 1130, 14867, 2522, 1105, 3937, 5007, 3177, 3048, 24134, 117, 15527, 5597, 3177, 3048, 24134, 1105, 1819, 144, 119, 20815, 2522, 119, 1135, 1108, 1359, 1113,...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Sun Won't Shine may refer to: "Sun Won't Shine", a song by Sentenced from the album Down "Sun Won't Shine", a song by Skyy from the album Skyyport "The Sun Won't Shine", a song by Angelfish from their self-titled album "The Sun Won't Shine", a song by Katrina and the Waves from their self-titled album
[ 101, 3477, 9083, 112, 189, 22931, 1336, 5991, 1106, 131, 107, 3477, 9083, 112, 189, 22931, 107, 117, 170, 1461, 1118, 14895, 5208, 9650, 1121, 1103, 1312, 5245, 107, 3477, 9083, 112, 189, 22931, 107, 117, 170, 1461, 1118, 5751, 1183, ...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
The 2022 Swiss Open (officially known as Yonex Swiss Open 2022, for sponsorship reasons) is a badminton tournament that will take place in St. Jakobshalle at Basel, Switzerland. It will take place from 22 to 27 March, with a total prize pool of $180,000. Tournament The 2022 Swiss Open will be the sixth tournament of t...
[ 101, 1109, 17881, 1477, 4614, 3353, 113, 3184, 1227, 1112, 14941, 24321, 4614, 3353, 17881, 1477, 117, 1111, 12387, 3672, 114, 1110, 170, 22438, 2348, 1115, 1209, 1321, 1282, 1107, 1457, 119, 20791, 5480, 4838, 1120, 14562, 117, 4507, 119...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
"Mazeppa, der Volksheld der Ukraine" (Mazeppa, the Folk Hero of Ukraine) is a historical film by German director Martin Berger, that was filmed in 1918 and released in July 1919. Plot An historic drama about the Cossack Mazeppa, who at the end of the seventeenth century was a highly placed soldier under the Polish ki...
[ 101, 107, 7085, 3171, 13059, 117, 4167, 5713, 4616, 17674, 4167, 5231, 107, 113, 7085, 3171, 13059, 117, 1103, 12539, 9390, 1104, 5231, 114, 1110, 170, 3009, 1273, 1118, 1528, 1900, 2405, 17911, 117, 1115, 1108, 5819, 1107, 3428, 1105, ...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Khmer inscriptions are a corpus of post-5th century historical texts engraved on materials such as stone and metal ware found in a wide range of mainland Southeast Asia (Cambodia, Vietnam, Thailand and Laos) and relating to the Khmer civilization. The study of Khmer inscriptions is known as Khmer epigraphy. Khmer insc...
[ 101, 21259, 14212, 1132, 170, 26661, 1104, 2112, 118, 4025, 1432, 3009, 6685, 17788, 1113, 3881, 1216, 1112, 2576, 1105, 2720, 1594, 1162, 1276, 1107, 170, 2043, 2079, 1104, 8684, 8348, 3165, 113, 13101, 117, 4357, 117, 5872, 1105, 16765,...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
In the 1300s Robert the Bruce granted Royal Burgh of Aberdeen unusually strong rights over the burgh itself and the open lands outside the city. The land was valuable and so the boundary was marked out by the March Stones of Aberdeen, "march" being the word used to describe a border area. In their first incarnation the...
[ 101, 1130, 1103, 21251, 1116, 1823, 1103, 4767, 3609, 1787, 139, 15243, 1324, 1104, 12184, 14624, 2012, 2266, 1166, 1103, 171, 15243, 1324, 2111, 1105, 1103, 1501, 4508, 1796, 1103, 1331, 119, 1109, 1657, 1108, 7468, 1105, 1177, 1103, 590...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Voicemeeter is a virtual mixing console and sound card running on the Windows operating system. It allows the processing of any audio signal - whether its source is physical (microphone) or virtual (application) - and its transmission to physical audio devices and/or applications. Voicemeeter offers many useful featur...
[ 101, 7900, 21563, 2083, 1110, 170, 8496, 7021, 10662, 1105, 1839, 3621, 1919, 1113, 1103, 5647, 3389, 1449, 119, 1135, 3643, 1103, 6165, 1104, 1251, 6056, 4344, 118, 2480, 1157, 2674, 1110, 2952, 113, 16976, 114, 1137, 8496, 113, 4048, ...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Panfilov (, Panfilov, , Panfilovo) is a selo in Ertis District in Pavlodar Region of northern Kazakhstan. Population: . Notable people Herman Gref (born 1964), politician and businessman References Populated places in Pavlodar Region
[ 101, 6991, 8702, 14185, 113, 117, 6991, 8702, 14185, 117, 117, 6991, 8702, 14185, 1186, 114, 1110, 170, 14516, 2858, 1107, 142, 3740, 1548, 1574, 1107, 19585, 1964, 2858, 7858, 4171, 1104, 2350, 11816, 119, 10858, 131, 119, 11017, 1234, ...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
David Jones (April 13, 1841 - June 18, 1911) was an American soldier and recipient of the Medal of Honor who received the award for his actions in the American Civil War. Biography Jones was born in Fayette County, Ohio on April 13, 1841. He served as a private with Company F of the 22nd Ohio Volunteer Infantry and t...
[ 101, 1681, 2690, 113, 1364, 1492, 117, 9599, 118, 1340, 1407, 117, 4383, 114, 1108, 1126, 1237, 5176, 1105, 7668, 1104, 1103, 3803, 1104, 7337, 1150, 1460, 1103, 2574, 1111, 1117, 3721, 1107, 1103, 1237, 3145, 1414, 119, 20599, 2690, 11...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Animal Locomotion: An Electro-photographic Investigation of Consecutive Phases of Animal Movements (1872–1885) is a series of scientific photographs by Eadweard Muybridge to study motion in animals including humans. In all, over 100,000 images were made, resulting in a portfolio of 781 composite collotype prints publis...
[ 101, 10854, 10605, 8178, 24035, 131, 1760, 2896, 10294, 8005, 118, 15368, 15701, 1104, 16752, 2217, 12734, 2109, 12278, 1116, 1104, 10854, 6257, 1116, 113, 7052, 782, 5951, 114, 1110, 170, 1326, 1104, 3812, 6810, 1118, 142, 3556, 14719, 1...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Over the Wire is a 1921 American silent drama film directed by Wesley Ruggles and starring Alice Lake, Alan Roscoe and Alan Hale. Cast Alice Lake as Kathleen Dexter Alan Roscoe as John Grannan George Stewart as Terry Dexter Alan Hale as James Twyford References Bibliography Connelly, Robert B. The Silents: ...
[ 101, 3278, 1103, 24781, 1110, 170, 4085, 1237, 3826, 3362, 1273, 2002, 1118, 11496, 155, 9610, 15657, 1105, 3937, 4953, 2161, 117, 4258, 155, 2155, 16123, 1105, 4258, 13684, 119, 21452, 4953, 2161, 1112, 15182, 15815, 4258, 155, 2155, 161...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Vladimir Kuspish (born 1942) was a Soviet Union judoka. He was the champion in judo U70kg at the1965 European Judo Championships. References 1942 births Soviet male judoka
[ 101, 8591, 23209, 20080, 2944, 113, 1255, 2889, 114, 1108, 170, 2461, 1913, 179, 18109, 1968, 119, 1124, 1108, 1103, 3628, 1107, 179, 18109, 158, 20829, 1377, 1403, 1120, 1103, 16382, 27677, 1735, 23915, 2572, 2708, 119, 19714, 1116, 2889...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
N-Acetyldopamine is the organic compound with the formula CH3C(O)NHCH2CH2C6H3(OH)2. It is the N-acetylated derivative of dopamine. This compound is a reactive intermediate in sclerotization, the process by which insect cuticles are formed by hardening molecular precursors. The catechol substituent is susceptible to ...
[ 101, 151, 118, 12860, 2340, 25791, 4163, 9685, 1110, 1103, 7878, 7090, 1114, 1103, 7893, 24890, 1495, 1658, 113, 152, 114, 20576, 23258, 1477, 23258, 1477, 1658, 1545, 3048, 1495, 113, 18719, 114, 123, 119, 1135, 1110, 1103, 151, 118, 2...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Artem Volodymyrovych Kachanovskyi (ukr. Арте́м Володи́мирович Качано́вський, born 12.12.1992) is a 2-dan professional go player from Ukraine. He was the fifth player to be awarded professional status by the European Go Federation, in 2016. He has won the European Grand Slam tournament twice, in 2017 and 2021, and was r...
[ 101, 20654, 1306, 5713, 22320, 4527, 12316, 21155, 14812, 18546, 22933, 1182, 113, 26006, 1197, 119, 448, 20442, 28404, 19692, 28310, 28401, 450, 16948, 28400, 16948, 28396, 17424, 28310, 28401, 17424, 20442, 17892, 457, 10286, 28409, 10286, ...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
The Battle of Mykolaiv is a military engagement which started on the night of 26 February 2022, as part of the Kherson offensive during the 2022 Russian invasion of Ukraine. Battle During the afternoon hours of 26 February 2022, 12 Russian tanks managed to break through in Kakhovka on the Dnieper and began heading to...
[ 101, 1109, 2651, 1104, 1422, 2718, 20737, 1964, 1110, 170, 1764, 8164, 1134, 1408, 1113, 1103, 1480, 1104, 1744, 1428, 17881, 1477, 117, 1112, 1226, 1104, 1103, 148, 20765, 1320, 5810, 1219, 1103, 17881, 1477, 1938, 4923, 1104, 5231, 119,...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Frederick Baldwin may refer to: Frederick Walker Baldwin, hydrofoil and aviation pioneer and partner of the inventor Alexander Graham Bell Frederick W. Baldwin (Vermont politician), Vermont attorney, businessman, historian, author and politician Frederick C. Baldwin, American photographer
[ 101, 4682, 10944, 1336, 5991, 1106, 131, 4682, 4575, 10944, 117, 177, 19694, 14467, 2723, 1105, 8747, 8578, 1105, 3547, 1104, 1103, 12989, 2792, 5159, 4720, 4682, 160, 119, 10944, 113, 8472, 2931, 114, 117, 8472, 6507, 117, 6414, 117, 4...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Humber College is a below-grade light rail transit (LRT) station under construction on Line 6 Finch West, a new line that is part of the Toronto subway system. The station will be located at the southwest corner of Highway 27 and Humber College Boulevard on the Humber College North Campus in Etobicoke, Toronto. The sta...
[ 101, 20164, 10615, 1531, 1110, 170, 2071, 118, 3654, 1609, 4356, 9575, 113, 149, 10460, 114, 1466, 1223, 2058, 1113, 2800, 127, 19143, 1537, 117, 170, 1207, 1413, 1115, 1110, 1226, 1104, 1103, 3506, 14790, 1449, 119, 1109, 1466, 1209, 1...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
"School Spirit" is the eleventh episode of the first season of Hulu's horror anthology streaming television series Into the Dark. The feature-length episode was directed by Mike Gan, who co-wrote the episode's teleplay. It was released on Hulu on August 2, 2019. The holiday for this episode is the first day of school...
[ 101, 107, 1323, 7258, 107, 1110, 1103, 14079, 2004, 1104, 1103, 1148, 1265, 1104, 20164, 7535, 112, 188, 5367, 12315, 11403, 1778, 1326, 14000, 1103, 4753, 119, 1109, 2672, 118, 2251, 2004, 1108, 2002, 1118, 2639, 144, 1389, 117, 1150, ...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Joseph A. Zombek (December 24, 1932 – January 13, 1996) was an American football defensive end and punter who played two seasons in the National Football League (NFL) for the Pittsburgh Steelers. He played college football at Pittsburgh, and was drafted by the Steelers in the 9th round of the 1954 NFL Draft. Early lif...
[ 101, 2419, 138, 119, 163, 20972, 4820, 113, 1382, 1572, 117, 3833, 782, 1356, 1492, 117, 1820, 114, 1108, 1126, 1237, 1709, 5341, 1322, 1105, 22498, 1200, 1150, 1307, 1160, 2955, 1107, 1103, 1305, 2289, 1453, 113, 4279, 114, 1111, 1103,...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Pomaderris halmaturina, commonly known as Kangaroo Island pomaderris, is a species of flowering plant in the family Rhamnaceae and is endemic to southern continental Australia. It is a shrub with narrowly elliptic to egg-shaped leaves with toothed or wavy edges, and sparse panicles of hairy, yellowish-green flowers. D...
[ 101, 18959, 12540, 14791, 1116, 5871, 16882, 20362, 2983, 117, 3337, 1227, 1112, 17614, 25956, 2054, 185, 7903, 2692, 4889, 117, 1110, 170, 1530, 1104, 11853, 2582, 1107, 1103, 1266, 155, 2522, 22636, 19460, 1105, 1110, 6850, 1106, 2359, ...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
In the Sultanate of Morocco, a Khalifa (, "deputy" or "steward"; sometimes translated as "viceroy") was a high-level official who reported directly to the Sultan. Specifically, in the Spanish protectorate in Morocco from 1912 to 1956, the Khalifa () represented the authority of the Sultan and was directly in charge of ...
[ 101, 1130, 1103, 26607, 1104, 9614, 117, 170, 148, 24486, 8057, 113, 117, 107, 5874, 107, 1137, 107, 26036, 2881, 107, 132, 2121, 4957, 1112, 107, 4711, 9166, 107, 114, 1108, 170, 1344, 118, 1634, 2078, 1150, 2103, 2626, 1106, 1103, 7...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Shevchenko is a crater on Mercury. Its name was adopted by the International Astronomical Union (IAU) in 1976, for Ukrainian poet Taras Hryhorovych Shevchenko. On the west rim of Shevchenko is an unnamed smaller crater that has sharp features and contains hollows. References
[ 101, 1153, 1964, 18599, 1110, 170, 12742, 1113, 10080, 119, 2098, 1271, 1108, 3399, 1118, 1103, 1570, 26545, 1913, 113, 146, 1592, 2591, 114, 1107, 2402, 117, 1111, 5284, 4225, 10235, 1116, 145, 1616, 13252, 3292, 21155, 1153, 1964, 18599...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
is the upcoming ninth live video album by Japanese band Wagakki Band, to be released by Universal Music Japan. The video covers the band's annual New Year concert at the Nippon Budokan on January 9, 2022. The concert aired on Wowow Plus on February 27, 2022. Track listing All tracks are arranged by Wagakki Band. Pers...
[ 101, 1110, 1103, 8851, 6948, 1686, 1888, 1312, 1118, 1983, 1467, 160, 15446, 1377, 2293, 4230, 117, 1106, 1129, 1308, 1118, 6896, 1953, 1999, 119, 1109, 1888, 3662, 1103, 1467, 112, 188, 2683, 1203, 2381, 3838, 1120, 1103, 21206, 17084, ...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Piedmont Healthcare is an American non-profit private operator of health care facilities that was founded in 1905. It is based in Atlanta, Georgia, and, as of February 2022, owns and operates 16 hospitals and more than 3,000 sites of care, including urgent care centers and physician clinics in the United States. In 202...
[ 101, 20970, 22993, 1110, 1126, 1237, 1664, 118, 5022, 2029, 6650, 1104, 2332, 1920, 3380, 1115, 1108, 1771, 1107, 4761, 119, 1135, 1110, 1359, 1107, 5161, 117, 3260, 117, 1105, 117, 1112, 1104, 1428, 17881, 1477, 117, 8300, 1105, 5049, ...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Robert Sibley (born 10 July 1966) is an Australian former professional basketball player. He played in the National Basketball League (NBL) with the Brisbane Bullets and Melbourne Tigers. Sibley won three NBL championships: two with the Bullets in 1985 and 1987, and one with the Tigers in 1993. He was nicknamed "The Ba...
[ 101, 1823, 14159, 26672, 113, 1255, 1275, 1351, 2678, 114, 1110, 1126, 1925, 1393, 1848, 3163, 1591, 119, 1124, 1307, 1107, 1103, 1305, 6035, 1453, 113, 151, 13360, 114, 1114, 1103, 7217, 9255, 6248, 1105, 4141, 7811, 119, 14159, 26672, ...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Tenri Dam is a concrete gravity dam located in Nara prefecture in Japan. The dam is used for flood control and water supply. The catchment area of the dam is 10.7 km2. The dam impounds about 18 ha of land when full and can store 2500 thousand cubic meters of water. The construction of the dam was started on 1970 and co...
[ 101, 5157, 2047, 8732, 1110, 170, 5019, 9926, 6961, 1388, 1107, 11896, 1611, 22041, 1107, 1999, 119, 1109, 6961, 1110, 1215, 1111, 7870, 1654, 1105, 1447, 3880, 119, 1109, 27011, 1298, 1104, 1103, 6961, 1110, 1275, 119, 128, 1557, 1477, ...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
The Plaza Theater in Burlington, Kansas, at 404 Neosho St., was built in 1942. It was listed on the National Register of Historic Places in 2005. It replaced a 1941-built Plaza Theater which was destroyed in a flood. It was designed by architect Al Hauetter in Moderne style. In 1990 the facility began to be operated...
[ 101, 1109, 9761, 5978, 1107, 16402, 117, 4312, 117, 1120, 27993, 14521, 2737, 1186, 1457, 119, 117, 1108, 1434, 1107, 2889, 119, 1135, 1108, 2345, 1113, 1103, 1305, 4273, 1104, 3700, 5068, 1107, 1478, 119, 1135, 2125, 170, 3018, 118, 14...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Devon Koswal (born 21 August 2003) is a Dutch professional footballer who currently plays as a defender for FC Dordrecht in the Dutch Eerste Divisie. Club career Koswal came through the ranks at VV Alexandria, Spartaan '20, SBV Excelsior and FC Dordrecht, and made his debut for the senior team, coming on as a substitu...
[ 101, 7122, 19892, 1116, 11487, 113, 1255, 1626, 1360, 1581, 114, 1110, 170, 2954, 1848, 3585, 1150, 1971, 2399, 1112, 170, 8919, 1111, 3604, 2091, 2956, 20690, 1107, 1103, 2954, 142, 1468, 1566, 12120, 9356, 1663, 119, 1998, 1578, 19892, ...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
The 2022 Racing Louisville FC season is the club's second season of play. Racing Louisville competes in the National Women's Soccer League, the top flight of professional women's soccer in the United States. Background In its inaugural season, Racing Louisville built a squad from the 2020 NWSL Expansion Draft, the 2...
[ 101, 1109, 17881, 1477, 6770, 11595, 3604, 1265, 1110, 1103, 1526, 112, 188, 1248, 1265, 1104, 1505, 119, 6770, 11595, 14786, 1107, 1103, 1305, 2453, 112, 188, 6863, 1453, 117, 1103, 1499, 3043, 1104, 1848, 1535, 112, 188, 5862, 1107, 1...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Malek Baayou (born 29 April 1999 in Sousse; ) is a Tunisian professional footballer who plays as a midfielder for Étoile Sportive du Sahel and the Tunisia national team. Club career Baayou is trained at the Étoile Sportive du Sahel (ESS), where he goes through all categories of young people. In 2019, Malek Baayou h...
[ 101, 10882, 1377, 18757, 4164, 6094, 113, 1255, 1853, 1364, 1729, 1107, 1573, 13356, 1162, 132, 114, 1110, 170, 25594, 1848, 3585, 1150, 2399, 1112, 170, 8852, 1111, 234, 2430, 4759, 7331, 2109, 3840, 17784, 18809, 1105, 1103, 13772, 1569...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
The 2022 Araucanías wildfires are a series of wildfires in the Chilean region of Araucanía. By February 26 57,000 ha had been burnt by fires. The commune of Traiguén and China Muerta National Reserve were on February 26 the places were most resources being used to fight fires. By February 25 180 haa had been consumed i...
[ 101, 1109, 17881, 1477, 25692, 23315, 1179, 22418, 4098, 20259, 1132, 170, 1326, 1104, 4098, 20259, 1107, 1103, 12208, 1805, 1104, 25692, 23315, 1179, 7171, 119, 1650, 1428, 1744, 4667, 117, 1288, 5871, 1125, 1151, 11946, 1118, 8966, 119, ...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
The Old Town Hall is a former events venue in Prince of Wales Road, Cromer, Norfolk, England. The structure, which is currently used for retail purposes, is a grade II listed building. History In the mid-19th century, a group of local businessmen decided to form a company to raise funds for the erection of an events v...
[ 101, 1109, 2476, 2779, 1944, 1110, 170, 1393, 1958, 6590, 1107, 2558, 1104, 2717, 1914, 117, 140, 11457, 1197, 117, 7240, 117, 1652, 119, 1109, 2401, 117, 1134, 1110, 1971, 1215, 1111, 6989, 4998, 117, 1110, 170, 3654, 1563, 2345, 1459,...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Ramany vs Ramany 3.0 (ரமணி விஸ் ரமணி) is an Indian Tamil-language sitcom Comedy web series, produced as an Original for Aha Tamil, directed by Naga. Produced by Kavithalayaa Productions the series stars Vasuki Anand and Ram G in the lead role along with Poovilangu Mohan, Ponni Suresh, Param Guhanesh and Vaidyanathan Pa...
[ 101, 15078, 3382, 5016, 15078, 3382, 124, 119, 121, 113, 100, 100, 100, 114, 1110, 1126, 1890, 5344, 118, 1846, 13664, 8909, 5127, 1326, 117, 1666, 1112, 1126, 7267, 1111, 7066, 1161, 5344, 117, 2002, 1118, 11896, 2571, 119, 13662, 1118...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Batillipes lusitanus is a species of tardigrade in the genus Batillipes. Description B. lusitanus has middle toes on each four feet which are all equal in length. It exhibits a dorsal cuticular ornamentation which is constituted by large pillars, which makes the cuticle itself appear similar to that of B. adriaticus ...
[ 101, 21928, 7956, 9717, 1279, 181, 1361, 5168, 9299, 1110, 170, 1530, 1104, 27629, 16936, 24633, 1107, 1103, 2804, 21928, 7956, 9717, 1279, 119, 14177, 27530, 139, 119, 181, 1361, 5168, 9299, 1144, 2243, 10497, 1113, 1296, 1300, 1623, 113...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
The Walls Are Way Too Thin is the second extended play (EP) by British singer-songwriter Holly Humberstone. It was released on 5 November 2021, by Interscope Records. Release On 5 August 2021, Holly Humberstone announced the release of her second EP The Walls Are Way Too Thin alongside co-writer Matty Healy (The 1975)...
[ 101, 1109, 22211, 2372, 4714, 6466, 27626, 1110, 1103, 1248, 2925, 1505, 113, 4493, 114, 1118, 1418, 2483, 118, 5523, 9030, 20164, 10615, 6078, 119, 1135, 1108, 1308, 1113, 126, 1379, 17881, 1475, 117, 1118, 11300, 15300, 2151, 119, 17443...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Spiranthes perexilis, the languid ladies’-tresses is a species of orchid native to California and Oregon. Description Spiranthes perexilis plants are closely related to Spiranthes romanzoffiana and similar in appearance, but "gracile and open-spiralled, with narrow subpandurate labella". Spiranthes porrifolia plants ...
[ 101, 156, 8508, 6922, 16090, 1679, 11708, 22279, 117, 1103, 2495, 2118, 16423, 8564, 787, 118, 189, 26628, 1110, 170, 1530, 1104, 20468, 2900, 1106, 1756, 1105, 4660, 119, 14177, 27530, 156, 8508, 6922, 16090, 1679, 11708, 22279, 3546, 11...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Air Balloon was launched in 1784 at Yarmouth as a coaster. She was captured in 1797. She then disappeared from United Kingdom records until 1824. She was almost rebuilt in 1825, only to suffer a major maritime incident in 1826. She was refloated and resumed sailing, but was wrecked in 1829. Career Air Balloon first ap...
[ 101, 1806, 7708, 6931, 1108, 2536, 1107, 17521, 1120, 14680, 9019, 16397, 1112, 170, 20814, 119, 1153, 1108, 3297, 1107, 14643, 119, 1153, 1173, 4712, 1121, 1244, 2325, 3002, 1235, 11638, 119, 1153, 1108, 1593, 6669, 1107, 11377, 117, 117...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
The 1953 Southwest Texas State Bobcats football team was an American football team that represented Southwest Texas State Teachers College (now known as Texas State University) during the 1953 college football season as a member of the Lone Star Conference (LSC). In their third year under head coach Milton Jowers, the ...
[ 101, 1109, 3185, 10859, 2245, 1426, 3162, 21393, 1709, 1264, 1108, 1126, 1237, 1709, 1264, 1115, 2533, 10859, 2245, 1426, 14290, 1531, 113, 1208, 1227, 1112, 2245, 1426, 1239, 114, 1219, 1103, 3185, 2134, 1709, 1265, 1112, 170, 1420, 1104...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Pau Cunill Clapés (born 4 January 2000) is a field hockey player from Spain, who plays as a Defender. Personal life Pau Cunill has a younger brother, Pepe, who also plays field hockey for Spain. Career Club level In the Spanish División de Honor, Cunill plays for Atlètic Terrassa. Spain Under–21 Cunill made his de...
[ 101, 19585, 1358, 140, 19782, 2339, 140, 16046, 10051, 113, 1255, 125, 1356, 1539, 114, 1110, 170, 1768, 4700, 1591, 1121, 2722, 117, 1150, 2399, 1112, 170, 3177, 27896, 119, 13907, 1297, 19585, 1358, 140, 19782, 2339, 1144, 170, 3247, ...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
The 2022 African Women's Youth Handball Championship will be held in Conakry, Guinea from 27 February to 4 March 2022. It will also act as the qualification tournament for the 2022 Women's Youth World Handball Championship to be held in Georgia. Results All times are local (UTC±0). References 2022 in African handbal...
[ 101, 1109, 17881, 1477, 2170, 2453, 112, 188, 4866, 25283, 1935, 1209, 1129, 1316, 1107, 16752, 3715, 1616, 117, 6793, 1121, 1765, 1428, 1106, 125, 1345, 17881, 1477, 119, 1135, 1209, 1145, 2496, 1112, 1103, 8969, 2348, 1111, 1103, 17881,...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
The Voice Kids is a Polish reality music talent show for aspiring singers aged 8 to 14, airing on TVP 2. The fifth season premiered on February 26, 2022. Tomson & Baron, Dawid Kwiatkowski and Cleo will return as the coaches. Tomasz Kammel returned as host, alongside Ida Nowakowska-Herndon. Coaches Teams Colour key...
[ 101, 1109, 7900, 9904, 1110, 170, 3129, 3958, 1390, 5939, 1437, 1111, 25850, 9500, 4079, 129, 1106, 1489, 117, 10477, 1113, 1794, 2101, 123, 119, 1109, 3049, 1265, 5281, 1113, 1428, 1744, 117, 17881, 1477, 119, 2545, 2142, 111, 5483, 11...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Ultsch is a German language surname. It stems from a reduced form of the male given name Ulrich – and may refer to: Bernhard Ultsch (1898), German World War I flying ace Detlef Ultsch (1955), former East German judoka References German-language surnames Surnames from given names
[ 101, 158, 24735, 1732, 1110, 170, 1528, 1846, 12239, 119, 1135, 12878, 1121, 170, 3549, 1532, 1104, 1103, 2581, 1549, 1271, 21351, 782, 1105, 1336, 5991, 1106, 131, 23627, 158, 24735, 1732, 113, 5381, 114, 117, 1528, 1291, 1414, 146, 37...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Shalash (Šalaš) was a Syrian goddess best known as the wife of Dagan, the head of the pantheon of the middle Euphrates area. She was already worshiped in Ebla and Tuttul in the third millennium BCE, and later her cult is attested in Mari as well. She was also introduced to the Mesopotamian and Hurrian pantheons. Both ...
[ 101, 156, 19456, 2737, 113, 322, 5971, 10222, 114, 1108, 170, 8697, 9659, 1436, 1227, 1112, 1103, 1676, 1104, 10136, 3820, 117, 1103, 1246, 1104, 1103, 13316, 24471, 1104, 1103, 2243, 142, 4455, 20955, 3052, 1298, 119, 1153, 1108, 1640, ...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
The 2022 RFL 1895 Cup, known as the 2022 AB Sundecks 1895 Cup for sponsorship reasons, is the third playing of the RFL 1895 Cup, a rugby league football competition for clubs in the United Kingdom. The competition for clubs who play below the top-tier Super League, with amateur clubs joining lower-tier professional clu...
[ 101, 1109, 17881, 1477, 24695, 2162, 5639, 1635, 117, 1227, 1112, 1103, 17881, 1477, 16151, 3477, 2007, 8770, 5639, 1635, 1111, 12387, 3672, 117, 1110, 1103, 1503, 1773, 1104, 1103, 24695, 2162, 5639, 1635, 117, 170, 4896, 2074, 1709, 220...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Lloyd John O'Neil AM (17 July 1928 - 27 February 1992) was an Australian publisher. He was involved with a number of different publishing firms and imprints during his career. He served as president of the Australian Book Publishers Association from 1969 to 1971. Early life O'Neil was born in Melbourne on 17 July 1928...
[ 101, 6151, 1287, 152, 112, 6003, 6586, 113, 1542, 1351, 3825, 118, 1765, 1428, 1924, 114, 1108, 1126, 1925, 6654, 119, 1124, 1108, 2017, 1114, 170, 1295, 1104, 1472, 5550, 9780, 1105, 17322, 1116, 1219, 1117, 1578, 119, 1124, 1462, 1112...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
The American Innovation and Choice Online (AICO) is a proposed antitrust bill in the United States Congress. The legislation was introduced by David Cicilline (D-RI) as H.R. 3816 in the House of Representatives on June 11, 2021. On October 14, 2021, companion legislation in the Senate was introduced by Amy Klobuchar (D...
[ 101, 1109, 1237, 13886, 1105, 10373, 10523, 113, 19016, 15678, 114, 1110, 170, 3000, 2848, 18062, 8954, 4550, 1107, 1103, 1244, 1311, 2757, 119, 1109, 5626, 1108, 2234, 1118, 1681, 140, 27989, 23824, 1162, 113, 141, 118, 155, 2240, 114, ...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Sheikha Latifa bint Mohammed bin Rashid Al Maktoum (born 16 June 1983) is the daughter of Mohammed bin Rashid Al Maktoum and Chairperson of Dubai Culture & Arts Authority and member of the Dubai Council and Chairperson of Art Dubai. Her Highness was born on 16 June 1983 and is married to Hamdan Bin Faisal AlQassimi wh...
[ 101, 13609, 1161, 2001, 3121, 8057, 9055, 1204, 12811, 9055, 24736, 2586, 7085, 21270, 6094, 1306, 113, 1255, 1479, 1340, 2278, 114, 1110, 1103, 1797, 1104, 12811, 9055, 24736, 2586, 7085, 21270, 6094, 1306, 1105, 7507, 14359, 1104, 11593, ...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Kackerterhaff is a small Hamlet and farm, near the E29 main road and Moutfort in the Commune of Contern in Luxembourg. It is only located on a small trail and no vehicles besides ones using the farm and used by residents are permitted to use it. Kackerterhaff consists of 2 small trails, one links Kackerterhaff with the...
[ 101, 14812, 8638, 2083, 2328, 3101, 1110, 170, 1353, 20332, 1105, 3922, 117, 1485, 1103, 142, 26752, 1514, 1812, 1105, 12556, 3818, 11088, 1107, 1103, 3291, 6262, 10038, 1104, 16752, 16748, 1107, 10665, 119, 1135, 1110, 1178, 1388, 1113, ...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Torgovaya square is the central square of the of Russian town Ustyuzhna in Vologda Oblast. The square had appeared in the XVI-th century and since then was the center of the social and economic life of the city. In 1778 it was redeveloped according to the architectural plans of the Catherine II's commission and receive...
[ 101, 19928, 2758, 2497, 2315, 1961, 1110, 1103, 2129, 1961, 1104, 1103, 1104, 1938, 1411, 11155, 2340, 14875, 7272, 1161, 1107, 5713, 8032, 1810, 11705, 119, 1109, 1961, 1125, 1691, 1107, 1103, 18406, 118, 24438, 1432, 1105, 1290, 1173, 1...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Papa Haydn is a restaurant with two locations in Portland, Oregon. Description Papa Hayden is a restaurant with locations in northwest Portland's Northwest District and southeast Portland's Sellwood-Moreland neighborhood. History Spouses Michael and Evelyn Gibbons have owned the business since 1978. During the COVID-...
[ 101, 14885, 16164, 22834, 1110, 170, 4382, 1114, 1160, 4541, 1107, 6141, 117, 4660, 119, 14177, 27530, 14885, 14344, 1110, 170, 4382, 1114, 4541, 1107, 4794, 6141, 112, 188, 8358, 1574, 1105, 5038, 6141, 112, 188, 22087, 2339, 2615, 118, ...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
The Prosecution of Offences Act 1884 was an act of the United Kingdom Parliament. Its main purpose was to modify the original Prosecution of Offences Act 1879, merging the roles of Director of Public Prosecutions and Treasury Solicitor (Section 2), though it also put in place a requirement for Commissioners and Assista...
[ 101, 1109, 5096, 2217, 12734, 1988, 1104, 8060, 7008, 1116, 2173, 6394, 1108, 1126, 2496, 1104, 1103, 1244, 2325, 2901, 119, 2098, 1514, 3007, 1108, 1106, 22015, 1103, 1560, 5096, 2217, 12734, 1988, 1104, 8060, 7008, 1116, 2173, 6917, 117...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Wairangi was a Maori rangatira (chieftain) of the Ngāti Raukawa iwi in the Tainui tribal confederation from the Waikato region, New Zealand and the ancestor of the Ngāti Wairangi hapu. He probably lived in the mid-seventeenth century. Life Wairangi was a son of Takihiku and brother of Tama-te-hura, Upoko-iti, and Pip...
[ 101, 160, 8341, 4993, 1182, 1108, 170, 16922, 2047, 8293, 11745, 1611, 113, 2705, 11379, 114, 1104, 1103, 26057, 9663, 3121, 16890, 12658, 3624, 178, 10073, 1107, 1103, 16191, 14787, 1182, 10059, 14255, 8124, 2692, 1891, 1121, 1103, 160, ...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Kingdom is an anime adaptation of a manga series of the same title written and illustrated by Yasuhisa Hara. At the end of the third season's final episode, a fourth season was announced, and will premiere on April 10, 2022. The cast will return to reprise their roles. The opening theme is "Rei -ray-" performed by Suir...
[ 101, 2325, 1110, 1126, 9499, 6350, 1104, 170, 9675, 1326, 1104, 1103, 1269, 1641, 1637, 1105, 8292, 1118, 14680, 6385, 27516, 1161, 21046, 119, 1335, 1103, 1322, 1104, 1103, 1503, 1265, 112, 188, 1509, 2004, 117, 170, 2223, 1265, 1108, ...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Cystofilobasidium is a genus of fungi in the family Cystofilobasidiaceae. Species occur as yeasts, but produce filamentous sexual states that form dikaryote teliospores, from which the unicellular basidia (if present) are formed. The hyphae usually have dolipore septa without a parenthesome, and their cell walls contai...
[ 101, 27688, 12223, 8702, 2858, 16531, 2386, 3656, 1110, 170, 2804, 1104, 17005, 1107, 1103, 1266, 27688, 12223, 8702, 2858, 16531, 2386, 12571, 19460, 119, 11763, 4467, 1112, 25693, 1116, 117, 1133, 3133, 20497, 7609, 3452, 2285, 3785, 2231...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
An election for the leadership of the Saskatchewan New Democratic Party will be held in June 2020 as a result of the resignation of Ryan Meili. Rules All Saskatchewan New Democratic Party members in good standing will be eligible to vote online or by mail-in ballot. Timeline October 26, 2020: the NDP loses the 2020 g...
[ 101, 1760, 1728, 1111, 1103, 3645, 1104, 1103, 9861, 1203, 2978, 1786, 1209, 1129, 1316, 1107, 1340, 12795, 1112, 170, 1871, 1104, 1103, 7809, 1104, 3730, 24563, 2646, 119, 8385, 1398, 9861, 1203, 2978, 1786, 1484, 1107, 1363, 2288, 1209,...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Haryana State Consumer Disputes Redressal Commission is an autonomous, statutory and constitutional institution formed as a quasi judicial body in Delhi under Section 24-B of the Consumer Protection Act, 1986 to protect the rights of consumers. It is a system of alternate dispute resolution between conflicting parties ...
[ 101, 26022, 1426, 17122, 12120, 20080, 20311, 2156, 7370, 1348, 2827, 1110, 1126, 10661, 117, 17302, 1105, 7950, 5375, 1824, 1112, 170, 21711, 9799, 1404, 1107, 6175, 1223, 6177, 1572, 118, 139, 1104, 1103, 17122, 8063, 2173, 117, 2177, 1...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Flavihalobacter is a Gram-negative, aerobic, rod-shaped and non-motile genus of bacteria from the family of Flavobacteriaceae with one known species (Flavihalobacter algicola). Flavihalobacter algicola has been isolated from the alga Saccharina japonica from Weihai. References Bacteria Bacteria genera Monotypic bacte...
[ 101, 143, 9516, 21656, 20717, 2822, 25857, 1110, 170, 19891, 118, 4366, 117, 170, 10771, 15421, 117, 14628, 118, 4283, 1105, 1664, 118, 182, 3329, 4759, 2804, 1104, 10548, 1121, 1103, 1266, 1104, 143, 9516, 12809, 11179, 16386, 8814, 1114...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Vijai Pal Singh (February 23, 1923 - ?) was an indian politician and leader of Communist Party of India. He represented Muzaffarnagar lok sabha constituency from 1971 to 1977. He was a Member at U.P. Vidhan Sabha from 1962 to 67. References Communist Party of India politicians from Uttar Pradesh 1923 births
[ 101, 159, 18158, 1182, 19585, 1233, 5329, 113, 1428, 1695, 117, 4123, 118, 136, 114, 1108, 1126, 1107, 10359, 2931, 1105, 2301, 1104, 5248, 1786, 1104, 1726, 119, 1124, 2533, 19569, 3293, 3101, 1813, 14734, 25338, 1377, 21718, 24167, 5269...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
The NJPW 50th Anniversary Show was an professional wrestling event promoted by New Japan Pro-Wrestling (NJPW). The event took place on March 1, 2022, in Tokyo, Japan at the Nippon Budokan. The event was to commemorate the fiftieth anniversary of the promotion, which was founded in 1972 by Antonio Inoki. Production Ba...
[ 101, 1109, 21166, 2101, 2924, 13163, 12656, 3237, 1108, 1126, 1848, 7325, 1856, 3082, 1118, 1203, 1999, 5096, 118, 5995, 113, 21166, 2101, 2924, 114, 119, 1109, 1856, 1261, 1282, 1113, 1345, 122, 117, 17881, 1477, 117, 1107, 4839, 117, ...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
The Algerian National rugby sevens Championship is a rugby sevens club competition that is played in Algeria and created in 2018. The national championship of rugby began in 2018, it was learned by the president of the Algerian Rugby Federation (FAR), Sofiane Benhacen. History The first edition was held in the 2018–19...
[ 101, 1109, 18068, 1305, 4896, 1978, 1116, 1935, 1110, 170, 4896, 1978, 1116, 1526, 2208, 1115, 1110, 1307, 1107, 11347, 1105, 1687, 1107, 1857, 119, 1109, 1569, 2899, 1104, 4896, 1310, 1107, 1857, 117, 1122, 1108, 3560, 1118, 1103, 2084, ...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
APIB may refer to: Military АПИБ (авиацио́нный полк истребителей-бомбардировщиков), Russian for a fighter-bomber aviation regiment, particularly in the Soviet Air Forces Advanced primer ignition blowback, a design feature of some firearms Political MÉS-APIB, a name under which the Spanish political party Més per M...
[ 101, 20480, 2064, 1336, 5991, 1106, 131, 4012, 448, 28380, 28374, 28367, 113, 475, 28394, 17424, 10286, 28408, 17424, 16948, 28310, 17127, 17127, 28413, 17106, 490, 16948, 28400, 28399, 483, 28403, 28404, 20442, 19692, 28393, 17424, 28404, 19...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Sunny Prajapati (born 25 December 1995) is an Indian filmmaker, Director, Screenwriter, Lyricist(songwriter), Composer, actor known for his works in Hindi cinema. Early life Sunny Prajapati born (25 December 1995). He is from Bijouli Village at Etawah District in UP, India. He was born into a Hindu family of Delhi, C...
[ 101, 17321, 153, 18663, 26519, 3121, 113, 1255, 1512, 1382, 1876, 114, 1110, 1126, 1890, 13140, 117, 2524, 117, 15652, 13814, 117, 149, 23710, 1776, 113, 5523, 114, 117, 19208, 117, 2811, 1227, 1111, 1117, 1759, 1107, 9001, 7678, 119, 4...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
The 2022 British Indoor Athletics Championships were the national indoor track and field competition for British athletes, held on 26 and 27 February 2022 at Arena Birmingham. Background The 2022 British Indoor Athletics Championships were held on 26 and 27 February 2022 at Arena Birmingham. The event was used as a qu...
[ 101, 1109, 17881, 1477, 1418, 12617, 8058, 2708, 1127, 1103, 1569, 9287, 1854, 1105, 1768, 2208, 1111, 1418, 7653, 117, 1316, 1113, 1744, 1105, 1765, 1428, 17881, 1477, 1120, 6492, 5836, 119, 24570, 1109, 17881, 1477, 1418, 12617, 8058, 2...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Geertruida H. Springer (1895 – 1988) was a Dutch still life painter, best known for her paintings Stilleven met fles en boek, Stilleven met schedeldak en glazen potjes, and Stilleven met potje en Javaans beeldje among others. Her work is part of the permanent collections of Teyler Museum. References 1895 births 1988...
[ 101, 23880, 3740, 5082, 6859, 145, 119, 18919, 113, 5639, 782, 2115, 114, 1108, 170, 2954, 1253, 1297, 5125, 117, 1436, 1227, 1111, 1123, 4694, 4209, 19907, 1179, 1899, 22593, 1279, 4035, 171, 7745, 1377, 117, 4209, 19907, 1179, 1899, 1...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
Sceloporus cozumelae, the Cozumel spiny lizard, is a species of lizard in the family Phrynosomatidae. It is endemic to Mexico. References Sceloporus Reptiles of Mexico Endemic fauna of Mexico Reptiles described in 1927
[ 101, 20452, 19773, 18876, 1361, 1884, 10337, 10212, 5024, 117, 1103, 3291, 10337, 10212, 6898, 1183, 20730, 117, 1110, 170, 1530, 1104, 20730, 1107, 1103, 1266, 7642, 15023, 22354, 21943, 5106, 119, 1135, 1110, 6850, 1106, 2470, 119, 19714,...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Illuminators is a live album by drummer Sunny Murray. It was recorded at the The Knitting Factory in New York City and was released in 1996 by Audible Hiss. On the album, Murray is joined by saxophonist and pianist Charles Gayle. Reception In a review for AllMusic, Rob Ferrier wrote: "Sunny Murray and Charles Gayle.....
[ 101, 9190, 7776, 24682, 1116, 1110, 170, 1686, 1312, 1118, 6924, 17321, 5593, 119, 1135, 1108, 1802, 1120, 1103, 1109, 148, 2605, 19162, 9977, 1107, 1203, 1365, 1392, 1105, 1108, 1308, 1107, 1820, 1118, 22139, 2165, 1230, 1116, 119, 1212,...
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...