messages list | task string | label int64 | drug string |
|---|---|---|---|
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | O=C(O)C=Cc1ccc(O)c(O)c1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | COc1ccc(C(=O)/C(Br)=C\C(=O)O)cc1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CC(C)NC[C@@H](O)c1ccc(O)c(O)c1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | Nc1ccccc1S(N)(=O)=O |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | C[C@](N)(Cc1ccc(O)c(O)c1)C(=O)O |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | COc1ccc(C[C@@](C)(N)C(=O)O)cc1OC |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CC(=O)N([Na])S(=O)(=O)c1ccc(N)cc1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | Nc1c(F)c(N)c(F)c(F)c1F |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | Cc1cc(C)cc(S(=O)(=O)O)c1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | CN(C)c1ccc(/N=N/S(=O)(=O)O)cc1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | CNCCc1ccc(OC(=O)C(C)C)c(OC(=O)C(C)C)c1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | Cc1ccc(S(=O)(=O)OCC(N)CN=O)cc1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | Nc1c(O)cccc1C(=O)CC(N)C(=O)O |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | O=C(O)CNC(=O)C(CS)Cc1ccccc1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CCCCCN(CCCCC)C(=O)C(CCC(=O)O)NC(=O)c1ccc(Cl)c(Cl)c1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | N=C(N)NCc1cccc(I)c1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CNC(C)(C)Cc1ccccc1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CNCC(O)c1ccc(O)c(OC)c1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | COc1ccc(C(=O)/C(Br)=C\C(=O)O)cc1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | COCCc1ccc(OCC(O)CNC(C)C)cc1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CCCCNc1ccc(C(=O)OCCOCCOCCOCCOCCOCCOCCOCCOCCOC)cc1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | CC(CCl)OC(C)CCl |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CC(=O)N[C@@H](CC(=O)N[C@H](CCC(=O)O)C(=O)O)C(=O)O |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | N=C(N)NOCC[C@H](N)C(=O)O.O |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | O=C/C=C\O |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | C=CCNN |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CN(C)CCCSC(=N)N |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | CCCCNNCCCC |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | CCCCNN |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | CCNN |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | CCCCCNN |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | CCCNN |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | CC(O)CNC(=O)N(N=O)C(C)Cl |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | C=CCNNCC=C |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | CN(C)CCN(CCN=O)C(N)=O |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | CCCCCCCCCCCCNC(=N)N |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CC(=O)N[C@@H](CC(=O)O)C(=O)O |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CNCC(O)C(O)C(O)C(O)CO |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CS(=N)(=O)CC[C@H](N)C(=O)O |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | N=C(N)NCCCCNC(=N)N |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CC(N/C(=N/C#N)Nc1ccncc1)C(C)(C)C |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CNCCc1ccccn1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | ClCc1ccccn1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | CCC1(c2ccccc2)C(=O)N=C(O)NC1=O |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | C1CCC(C(CC2CCCCN2)C2CCCCC2)CC1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CC(Cc1ccccc1)NCCC(c1ccccc1)c1ccccc1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | O=C(O)[C@H](O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)[C@H](O)CO |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CC(=O)N[C@H]1[C@@H](O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H](C)C(=O)O |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CN(N=O)C(=O)N[C@H]1[C@@H](O)O[C@H](CO)[C@@H](O)[C@@H]1O |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | COc1ccn(C)c(=O)c1C#N |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CC1(C)[C@@H](OC(=O)CCC(=O)O)CC[C@@]2(C)[C@H]1CC[C@]1(C)[C@@H]2C(=O)C=C2[C@@H]3C[C@@](C)(C(=O)O)CC[C@]3(C)CC[C@]21C |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | C[C@H]1CC[C@@H]2[C@@H](C)[C@H]3[C@H](C[C@H]4[C@@H]5CC=C6C[C@@H](O[C@@H]7O[C@H](CO)[C@H](O)[C@H](O[C@@H]8O[C@H](CO)[C@@H](O)[C@H](O)[C@H]8O)[C@H]7O[C@@H]7O[C@@H](C)[C@H](O)[C@@H](O)[C@H]7O)CC[C@]6(C)[C@H]5CC[C@@]43C)N2C1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | Cn1cc(C(=O)O)c(=O)c2ccc(/C=C/c3ccc([N+](=O)[O-])o3)nc21 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | C=C(NC(=O)C(=C)NC(=O)c1csc(C2=N[C@H]3c4csc(n4)[C@H]4NC(=O)c5csc(n5)[C@H]([C@@](C)(O)[C@@H](C)O)NC(=O)[C@H]5CSC(=N5)/C(=C\C)NC(=O)[C@H]([C@@H](C)O)NC(=O)c5csc(n5)[C@]3(CC2)NC(=O)[C@H](C)NC(=O)C(=C)NC(=O)[C@H](C)NC(=O)[C@H](C(C)CC)N[C@@H]2C=Cc3c([C@H](C)O)cc(nc3[C@H]2O)C(=O)O[C@@H]4C)n1)C(N)=O |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | Nc1nc2c(ncn2[C@H]2CC(O)[C@@H](CO)O2)c(=S)[nH]1 |
End of preview. Expand in Data Studio
README.md exists but content is empty.
- Downloads last month
- 30