prompt stringlengths 319 491 | completion stringclasses 10
values | smiles stringlengths 2 174 | toxicity_value float64 -0.34 10.2 | label int64 1 10 |
|---|---|---|---|---|
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: O=P(OCCCl)(OCCCl)OCCCl
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry know... | Toxicity Class: 5 | O=P(OCCCl)(OCCCl)OCCCl | 2.366 | 5 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: O=c1[nH]c(=O)n(C2CC(O)C(CO)O2)cc1Br
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or c... | Toxicity Class: 2 | O=c1[nH]c(=O)n(C2CC(O)C(CO)O2)cc1Br | 1.563 | 2 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: Cc1ccc([N+](=O)[O-])c([N+](=O)[O-])c1
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or... | Toxicity Class: 5 | Cc1ccc([N+](=O)[O-])c([N+](=O)[O-])c1 | 2.354 | 5 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CCC(=O)OC1=C(OC(=O)CC)C(=O)OC1=O
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chem... | Toxicity Class: 2 | CCC(=O)OC1=C(OC(=O)CC)C(=O)OC1=O | 1.685 | 2 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CCCCCN(N=O)C(N)=O
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge... | Toxicity Class: 6 | CCCCCN(N=O)C(N)=O | 2.454 | 6 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CCOP(=S)(Oc1cnn(-c2ccccc2)c(=O)c1OC)OC(C)C
Instructions: Analyze the molecule and estimate its toxicity level using any scientif... | Toxicity Class: 10 | CCOP(=S)(Oc1cnn(-c2ccccc2)c(=O)c1OC)OC(C)C | 4.439 | 10 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CCC(C(=O)C(C)C(O)C(C)CCc1ccc(C)c(O)c1C(=O)O)C1OC(CC)(C2CCC(O)(CC)C(C)O2)CC1C
Instructions: Analyze the molecule and estimate its... | Toxicity Class: 9 | CCC(C(=O)C(C)C(O)C(C)CCc1ccc(C)c(O)c1C(=O)O)C1OC(CC)(C2CCC(O)(CC)C(C)O2)CC1C | 3.685 | 9 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CC(C)CNC(=S)NCC(C)C
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowled... | Toxicity Class: 6 | CC(C)CNC(=S)NCC(C)C | 2.372 | 6 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: Nc1nc(=S)ss1
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you ... | Toxicity Class: 2 | Nc1nc(=S)ss1 | 1.693 | 2 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CCCCOC(=O)c1ccccc1C(=O)OCCOCCOC(=O)c1ccccc1C(=O)OCCCC
Instructions: Analyze the molecule and estimate its toxicity level using a... | Toxicity Class: 2 | CCCCOC(=O)c1ccccc1C(=O)OCCOCCOC(=O)c1ccccc1C(=O)OCCCC | 1.67 | 2 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CN1C(=O)CN=C(c2ccccc2)c2cc(Cl)ccc21
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or c... | Toxicity Class: 8 | CN1C(=O)CN=C(c2ccccc2)c2cc(Cl)ccc21 | 2.908 | 8 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: C1CNCCN1
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may ... | Toxicity Class: 2 | C1CNCCN1 | 1.656 | 2 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: Cc1c(C)c2c(c(C)c1O)CCC(C)(C(=O)O)O2
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or c... | Toxicity Class: 3 | Cc1c(C)c2c(c(C)c1O)CCC(C)(C(=O)O)O2 | 1.765 | 3 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CC(C)OC(=O)C(Cl)(Cl)Cl
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry know... | Toxicity Class: 2 | CC(C)OC(=O)C(Cl)(Cl)Cl | 1.67 | 2 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: O=c1ccc2ccccc2o1
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge ... | Toxicity Class: 7 | O=c1ccc2ccccc2o1 | 2.698 | 7 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CCCCNCCC[Si](OC)(OC)OC
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry know... | Toxicity Class: 1 | CCCCNCCC[Si](OC)(OC)OC | 1.265 | 1 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CC(=O)OCC(C(OC(C)=O)c1ccccc1)[N+](=O)[O-]
Instructions: Analyze the molecule and estimate its toxicity level using any scientifi... | Toxicity Class: 3 | CC(=O)OCC(C(OC(C)=O)c1ccccc1)[N+](=O)[O-] | 1.939 | 3 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: COCCOC(C)=O
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you m... | Toxicity Class: 2 | COCCOC(C)=O | 1.542 | 2 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: C=CCSc1nnc(CSP(=S)(OC)OC)s1
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry... | Toxicity Class: 5 | C=CCSc1nnc(CSP(=S)(OC)OC)s1 | 2.33 | 5 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CCC(C)n1c(=O)[nH]c(C)c(Br)c1=O
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemis... | Toxicity Class: 7 | CCC(C)n1c(=O)[nH]c(C)c(Br)c1=O | 2.61 | 7 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: N#Cc1ccc(Cl)c([N+](=O)[O-])c1
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemist... | Toxicity Class: 3 | N#Cc1ccc(Cl)c([N+](=O)[O-])c1 | 1.95 | 3 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CCOP(=S)(OCC)Oc1ccc([N+](=O)[O-])c(Cl)c1
Instructions: Analyze the molecule and estimate its toxicity level using any scientific... | Toxicity Class: 9 | CCOP(=S)(OCC)Oc1ccc([N+](=O)[O-])c(Cl)c1 | 3.814 | 9 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CCc1ccc(C(=O)c2ccccc2)c(C(=O)O)c1
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or che... | Toxicity Class: 3 | CCc1ccc(C(=O)c2ccccc2)c(C(=O)O)c1 | 1.757 | 3 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: C[Si](C)(C)Cl
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you... | Toxicity Class: 1 | C[Si](C)(C)Cl | 1.351 | 1 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: Cc1c(F)c(F)c2[nH]c(C(F)(F)F)nc2c1F
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or ch... | Toxicity Class: 10 | Cc1c(F)c(F)c2[nH]c(C(F)(F)F)nc2c1F | 4.81 | 10 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CCN(CC)C(=O)c1ccccc1O
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowl... | Toxicity Class: 6 | CCN(CC)C(=O)c1ccccc1O | 2.523 | 6 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: COc1ccc2c(=O)c(C)c(-c3ccccc3)oc2c1CN(C)C
Instructions: Analyze the molecule and estimate its toxicity level using any scientific... | Toxicity Class: 9 | COc1ccc2c(=O)c(C)c(-c3ccccc3)oc2c1CN(C)C | 3.908 | 9 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CCCCC[Si](OC)(OC)OC
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowled... | Toxicity Class: 2 | CCCCC[Si](OC)(OC)OC | 1.592 | 2 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CS(=O)(=O)NC(=O)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-]
Instructions: Analyze the molecule and estimate its toxicity level u... | Toxicity Class: 6 | CS(=O)(=O)NC(=O)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] | 2.545 | 6 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CCOP(=S)(Cl)OCC
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge y... | Toxicity Class: 4 | CCOP(=S)(Cl)OCC | 2.148 | 4 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CCOP(=S)(OCC)OC(Cl)C(Cl)(Cl)Cl
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemis... | Toxicity Class: 10 | CCOP(=S)(OCC)OC(Cl)C(Cl)(Cl)Cl | 5.225 | 10 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: O=C1Nc2ccc(Cl)cc2C(c2ccccc2Cl)=NC1O
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or c... | Toxicity Class: 3 | O=C1Nc2ccc(Cl)cc2C(c2ccccc2Cl)=NC1O | 1.854 | 3 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: COP(N)(=S)Oc1cc(Cl)c(Cl)cc1Cl
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemist... | Toxicity Class: 7 | COP(N)(=S)Oc1cc(Cl)c(Cl)cc1Cl | 2.641 | 7 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CN(CCC#N)CCC#N
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge yo... | Toxicity Class: 5 | CN(CCC#N)CCC#N | 2.188 | 5 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CNC(=O)ON=C1SCSC1(C)C
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowl... | Toxicity Class: 10 | CNC(=O)ON=C1SCSC1(C)C | 5.517 | 10 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CNN=Nc1ccccc1
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you... | Toxicity Class: 6 | CNN=Nc1ccccc1 | 2.508 | 6 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: C=CCOC=C
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may ... | Toxicity Class: 5 | C=CCOC=C | 2.185 | 5 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: COCCCNc1nc(NC(C)C)nc(SC)n1
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry ... | Toxicity Class: 2 | COCCCNc1nc(NC(C)C)nc(SC)n1 | 1.735 | 2 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CC(=O)Nc1cc(Cl)c([N+](=O)[O-])cc1Cl
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or c... | Toxicity Class: 3 | CC(=O)Nc1cc(Cl)c([N+](=O)[O-])cc1Cl | 1.945 | 3 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CCN(CC)CCOCc1cc(Br)cc(Br)c1OC
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemist... | Toxicity Class: 8 | CCN(CC)CCOCc1cc(Br)cc(Br)c1OC | 2.898 | 8 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: COCCN1C=CC(=C2C(=O)c3ccccc3C2=O)C=C1
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or ... | Toxicity Class: 8 | COCCN1C=CC(=C2C(=O)c3ccccc3C2=O)C=C1 | 2.905 | 8 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CCC1(CC)C(=O)C=CN(CN2CCNCC2)C1=O
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chem... | Toxicity Class: 5 | CCC1(CC)C(=O)C=CN(CN2CCNCC2)C1=O | 2.297 | 5 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CN1C(C(=O)Nc2ccccn2)=C(O)c2ccccc2S1(=O)=O
Instructions: Analyze the molecule and estimate its toxicity level using any scientifi... | Toxicity Class: 8 | CN1C(C(=O)Nc2ccccn2)=C(O)c2ccccc2S1(=O)=O | 3.186 | 8 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CCOC(=O)NNc1nncc2ccccc12
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry kn... | Toxicity Class: 7 | CCOC(=O)NNc1nncc2ccccc12 | 2.864 | 7 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: O=Cc1ccc([N+](=O)[O-])cc1
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry k... | Toxicity Class: 1 | O=Cc1ccc([N+](=O)[O-])cc1 | 1.507 | 1 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CNC(=O)Nc1ccccc1
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge ... | Toxicity Class: 2 | CNC(=O)Nc1ccccc1 | 1.64 | 2 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CN(C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1nc(C(F)(F)F)c(Cl)s1
Instructions: Analyze the molecule and estimate its toxicity level us... | Toxicity Class: 8 | CN(C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1nc(C(F)(F)F)c(Cl)s1 | 2.96 | 8 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: Brc1nc(Br)c(Br)[nH]1
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowle... | Toxicity Class: 10 | Brc1nc(Br)c(Br)[nH]1 | 3.952 | 10 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CCCSc1ccc2[nH]c(NC(=O)OC)nc2c1
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemis... | Toxicity Class: 4 | CCCSc1ccc2[nH]c(NC(=O)OC)nc2c1 | 2.044 | 4 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CCCC(c1ccc(CCCl)cc1)c1c(O)c2ccccc2oc1=O
Instructions: Analyze the molecule and estimate its toxicity level using any scientific ... | Toxicity Class: 10 | CCCC(c1ccc(CCCl)cc1)c1c(O)c2ccccc2oc1=O | 4.297 | 10 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: O=C(O)CC(NC(=O)COc1ccc(Cl)cc1Cl)C(=O)O
Instructions: Analyze the molecule and estimate its toxicity level using any scientific o... | Toxicity Class: 6 | O=C(O)CC(NC(=O)COc1ccc(Cl)cc1Cl)C(=O)O | 2.527 | 6 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CN(C)c1nc(N(C)C)nc(N(C)C)n1
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry... | Toxicity Class: 7 | CN(C)c1nc(N(C)C)nc(N(C)C)n1 | 2.779 | 7 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: COc1cc(O)c(C(=O)c2ccccc2)cc1S(=O)(=O)O
Instructions: Analyze the molecule and estimate its toxicity level using any scientific o... | Toxicity Class: 3 | COc1cc(O)c(C(=O)c2ccccc2)cc1S(=O)(=O)O | 1.941 | 3 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CCOP(=S)(CC)Oc1cc(Cl)ccc1Cl
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry... | Toxicity Class: 10 | CCOP(=S)(CC)Oc1cc(Cl)ccc1Cl | 4.197 | 10 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: O=C(O)CCC(=O)c1ccc(C2CCCCC2)c(Cl)c1
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or c... | Toxicity Class: 9 | O=C(O)CCC(=O)c1ccc(C2CCCCC2)c(Cl)c1 | 3.39 | 9 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CC1(COCCOCC2(C)CO2)CO1
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry know... | Toxicity Class: 1 | CC1(COCCOCC2(C)CO2)CO1 | 1.433 | 1 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: COP(C)(=S)SCn1c(=O)oc2cccnc21
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemist... | Toxicity Class: 5 | COP(C)(=S)SCn1c(=O)oc2cccnc21 | 2.22 | 5 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: [O-][n+]1c2ccccc2nc2ccccc21
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry... | Toxicity Class: 1 | [O-][n+]1c2ccccc2nc2ccccc21 | 1.473 | 1 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: Fc1c(Cl)c(Cl)c2nc(C(F)(F)F)[nH]c2c1Cl
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or... | Toxicity Class: 10 | Fc1c(Cl)c(Cl)c2nc(C(F)(F)F)[nH]c2c1Cl | 5.11 | 10 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CCCCC(CC)COC(CBr)c1cccc(C2CCCCC2)c1
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or c... | Toxicity Class: 8 | CCCCC(CC)COC(CBr)c1cccc(C2CCCCC2)c1 | 3.199 | 8 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: O=C(NCCO[N+](=O)[O-])c1cccnc1
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemist... | Toxicity Class: 5 | O=C(NCCO[N+](=O)[O-])c1cccnc1 | 2.238 | 5 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CCCC(C)COC(C)=O
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge y... | Toxicity Class: 1 | CCCC(C)COC(C)=O | 1.29 | 1 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CCCC(=O)C(CC)Cc1ccccc1
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry know... | Toxicity Class: 2 | CCCC(=O)C(CC)Cc1ccccc1 | 1.667 | 2 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: Clc1ccc2c(c1)C(N1CCNCC1)=Nc1ccccc1O2
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or ... | Toxicity Class: 8 | Clc1ccc2c(c1)C(N1CCNCC1)=Nc1ccccc1O2 | 3.001 | 8 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: COc1nnc(CSP(=S)(OC)OC)s1
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry kn... | Toxicity Class: 8 | COc1nnc(CSP(=S)(OC)OC)s1 | 2.93 | 8 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: COCC1CO1
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may ... | Toxicity Class: 5 | COCC1CO1 | 2.284 | 5 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: Nc1cc([N+](=O)[O-])ccc1O
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry kn... | Toxicity Class: 3 | Nc1cc([N+](=O)[O-])ccc1O | 1.808 | 3 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: C=CC(=O)OCCO
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you ... | Toxicity Class: 5 | C=CC(=O)OCCO | 2.252 | 5 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CC(O)C1CC=CCC1
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge yo... | Toxicity Class: 3 | CC(O)C1CC=CCC1 | 1.952 | 3 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CCCNc1nnc(-c2ccccc2)c2ccccc12
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemist... | Toxicity Class: 7 | CCCNc1nnc(-c2ccccc2)c2ccccc12 | 2.703 | 7 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: C=COCCOCC1CO1
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you... | Toxicity Class: 3 | C=COCCOCC1CO1 | 1.771 | 3 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CCOC(=O)CC(SP(=O)(OC)SC)C(=O)OCC
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chem... | Toxicity Class: 9 | CCOC(=O)CC(SP(=O)(OC)SC)C(=O)OCC | 3.466 | 9 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CC(C)NC(=O)OCC(O)C1COc2ccccc2O1
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemi... | Toxicity Class: 5 | CC(C)NC(=O)OCC(O)C1COc2ccccc2O1 | 2.273 | 5 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CC(C)CC=O
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may... | Toxicity Class: 1 | CC(C)CC=O | 1.187 | 1 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CC(C)(C)OOC(=O)c1ccccc1
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry kno... | Toxicity Class: 5 | CC(C)(C)OOC(=O)c1ccccc1 | 2.283 | 5 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: O=[N+]([O-])c1ccc(CCl)cc1
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry k... | Toxicity Class: 4 | O=[N+]([O-])c1ccc(CCl)cc1 | 1.977 | 4 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: C#CCN(CC)CC
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you m... | Toxicity Class: 3 | C#CCN(CC)CC | 1.859 | 3 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: C1COCO1
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may h... | Toxicity Class: 1 | C1COCO1 | 1.393 | 1 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CCOP(=S)(CC)Sc1ccccc1C
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry know... | Toxicity Class: 9 | CCOP(=S)(CC)Sc1ccccc1C | 3.782 | 9 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: Cc1ncc(CO)c(CO)c1O
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledg... | Toxicity Class: 2 | Cc1ncc(CO)c(CO)c1O | 1.626 | 2 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CCSC(=S)N(C)C
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you... | Toxicity Class: 6 | CCSC(=S)N(C)C | 2.434 | 6 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: COCCSCCO
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may ... | Toxicity Class: 1 | COCCSCCO | 1.02 | 1 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CCOC(C1=NCC(C)(CC)CN1)c1ccccc1
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemis... | Toxicity Class: 8 | CCOC(C1=NCC(C)(CC)CN1)c1ccccc1 | 3.073 | 8 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CCOP(=S)(Oc1cnn(CC)c(=O)c1OC)OC(C)C
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or c... | Toxicity Class: 10 | CCOP(=S)(Oc1cnn(CC)c(=O)c1OC)OC(C)C | 4.97 | 10 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CC(=N)NP(=S)(Oc1ccc(Cl)cc1)Oc1ccc(Cl)cc1
Instructions: Analyze the molecule and estimate its toxicity level using any scientific... | Toxicity Class: 10 | CC(=N)NP(=S)(Oc1ccc(Cl)cc1)Oc1ccc(Cl)cc1 | 5.006 | 10 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: O=Cc1ccccc1
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you m... | Toxicity Class: 3 | O=Cc1ccccc1 | 1.912 | 3 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CCS(=O)(=O)CCO
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge yo... | Toxicity Class: 1 | CCS(=O)(=O)CCO | 0.885 | 1 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CCC(C)OC(CBr)c1ccccc1
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowl... | Toxicity Class: 8 | CCC(C)OC(CBr)c1ccccc1 | 3.012 | 8 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemist... | Toxicity Class: 3 | CC(C)(c1ccc(O)cc1)c1ccc(O)cc1 | 1.847 | 3 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: NC(=O)Cc1c([O-])on[n+]1Cc1ccccc1
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chem... | Toxicity Class: 2 | NC(=O)Cc1c([O-])on[n+]1Cc1ccccc1 | 1.719 | 2 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or ch... | Toxicity Class: 3 | CN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O | 1.867 | 3 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: COc1ccc(C(=O)NCc2cccnc2)cc1C(=O)NCc1cccnc1
Instructions: Analyze the molecule and estimate its toxicity level using any scientif... | Toxicity Class: 4 | COc1ccc(C(=O)NCc2cccnc2)cc1C(=O)NCc1cccnc1 | 2.099 | 4 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CC(=Cc1ccccc1)CC(=O)NC1CCCCC1
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemist... | Toxicity Class: 3 | CC(=Cc1ccccc1)CC(=O)NC1CCCCC1 | 1.933 | 3 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: ClCCC(Cl)(Cl)Cl
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge y... | Toxicity Class: 6 | ClCCC(Cl)(Cl)Cl | 2.57 | 6 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CCC(CO)(CO)CO
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you... | Toxicity Class: 1 | CCC(CO)(CO)CO | 0.978 | 1 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: O=[N+]([O-])c1cnc(Cl)c([N+](=O)[O-])c1
Instructions: Analyze the molecule and estimate its toxicity level using any scientific o... | Toxicity Class: 9 | O=[N+]([O-])c1cnc(Cl)c([N+](=O)[O-])c1 | 3.61 | 9 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: NC(=O)c1c(F)cccc1F
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledg... | Toxicity Class: 2 | NC(=O)c1c(F)cccc1F | 1.678 | 2 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: Cc1cc(Cl)ccc1OCC(=O)Nc1ccccc1
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemist... | Toxicity Class: 3 | Cc1cc(Cl)ccc1OCC(=O)Nc1ccccc1 | 1.787 | 3 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: CC[Si](N(C)C)(N(C)C)N(C)C
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry k... | Toxicity Class: 5 | CC[Si](N(C)C)(N(C)C)N(C)C | 2.245 | 5 |
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10.
Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%).
Molecule: COc1ccc(C(=O)CCC(=O)O)c2ccccc12
Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemi... | Toxicity Class: 4 | COc1ccc(C(=O)CCC(=O)O)c2ccccc12 | 2.157 | 4 |
End of preview. Expand in Data Studio
README.md exists but content is empty.
- Downloads last month
- 24