id stringlengths 12 17 | smiles stringlengths 1 100 | property stringclasses 11
values | prompt stringlengths 48 169 | completion stringlengths 1 7 |
|---|---|---|---|---|
rdkit_prop_0 | C[C@@H](C(=O)O)N(C)C1=CCCCC1 | Molecular Weight | What is the Molecular Weight of <SMILES>C[C@@H](C(=O)O)N(C)C1=CCCCC1</SMILES>? Answer: | 183.25 |
rdkit_prop_1 | C[C@@H](C(=O)O)N(C)C1=CCCCC1 | LogP | What is the LogP of <SMILES>C[C@@H](C(=O)O)N(C)C1=CCCCC1</SMILES>? Answer: | 1.85 |
rdkit_prop_2 | C[C@@H](C(=O)O)N(C)C1=CCCCC1 | Number of Atoms | What is the Number of Atoms in <SMILES>C[C@@H](C(=O)O)N(C)C1=CCCCC1</SMILES>? Answer: | 13 |
rdkit_prop_3 | C[C@@H](C(=O)O)N(C)C1=CCCCC1 | Number of Heavy Atoms | What is the Number of Heavy Atoms in <SMILES>C[C@@H](C(=O)O)N(C)C1=CCCCC1</SMILES>? Answer: | 13 |
rdkit_prop_4 | C[C@@H](C(=O)O)N(C)C1=CCCCC1 | Number of Rings | What is the Number of Rings in <SMILES>C[C@@H](C(=O)O)N(C)C1=CCCCC1</SMILES>? Answer: | 1 |
rdkit_prop_5 | C[C@@H](C(=O)O)N(C)C1=CCCCC1 | Number of Aromatic Rings | What is the Number of Aromatic Rings in <SMILES>C[C@@H](C(=O)O)N(C)C1=CCCCC1</SMILES>? Answer: | 0 |
rdkit_prop_6 | C[C@@H](C(=O)O)N(C)C1=CCCCC1 | Number of Rotatable Bonds | What is the Number of Rotatable Bonds in <SMILES>C[C@@H](C(=O)O)N(C)C1=CCCCC1</SMILES>? Answer: | 3 |
rdkit_prop_7 | C[C@@H](C(=O)O)N(C)C1=CCCCC1 | Number of H-Bond Donors | What is the Number of H-Bond Donors in <SMILES>C[C@@H](C(=O)O)N(C)C1=CCCCC1</SMILES>? Answer: | 1 |
rdkit_prop_8 | C[C@@H](C(=O)O)N(C)C1=CCCCC1 | Number of H-Bond Acceptors | What is the Number of H-Bond Acceptors in <SMILES>C[C@@H](C(=O)O)N(C)C1=CCCCC1</SMILES>? Answer: | 2 |
rdkit_prop_9 | C[C@@H](C(=O)O)N(C)C1=CCCCC1 | TPSA | What is the TPSA of <SMILES>C[C@@H](C(=O)O)N(C)C1=CCCCC1</SMILES>? Answer: | 40.54 |
rdkit_prop_10 | C[C@@H](C(=O)O)N(C)C1=CCCCC1 | Formal Charge | What is the Formal Charge of <SMILES>C[C@@H](C(=O)O)N(C)C1=CCCCC1</SMILES>? Answer: | 0 |
rdkit_prop_11 | CCCCCCCC/C=C\CCCCCCCC(=O)OP(=O)([O-])OC(C[N+](C)(C)C)C(=O)CCCCCCCCCCCCCCC | Molecular Weight | What is the Molecular Weight of <SMILES>CCCCCCCC/C=C\CCCCCCCC(=O)OP(=O)([O-])OC(C[N+](C)(C)C)C(=O)CCCCCCCCCCCCCCC</SMILES>? Answer: | 686.01 |
rdkit_prop_12 | CCCCCCCC/C=C\CCCCCCCC(=O)OP(=O)([O-])OC(C[N+](C)(C)C)C(=O)CCCCCCCCCCCCCCC | LogP | What is the LogP of <SMILES>CCCCCCCC/C=C\CCCCCCCC(=O)OP(=O)([O-])OC(C[N+](C)(C)C)C(=O)CCCCCCCCCCCCCCC</SMILES>? Answer: | 11.18 |
rdkit_prop_13 | CCCCCCCC/C=C\CCCCCCCC(=O)OP(=O)([O-])OC(C[N+](C)(C)C)C(=O)CCCCCCCCCCCCCCC | Number of Atoms | What is the Number of Atoms in <SMILES>CCCCCCCC/C=C\CCCCCCCC(=O)OP(=O)([O-])OC(C[N+](C)(C)C)C(=O)CCCCCCCCCCCCCCC</SMILES>? Answer: | 47 |
rdkit_prop_14 | CCCCCCCC/C=C\CCCCCCCC(=O)OP(=O)([O-])OC(C[N+](C)(C)C)C(=O)CCCCCCCCCCCCCCC | Number of Heavy Atoms | What is the Number of Heavy Atoms in <SMILES>CCCCCCCC/C=C\CCCCCCCC(=O)OP(=O)([O-])OC(C[N+](C)(C)C)C(=O)CCCCCCCCCCCCCCC</SMILES>? Answer: | 47 |
rdkit_prop_15 | CCCCCCCC/C=C\CCCCCCCC(=O)OP(=O)([O-])OC(C[N+](C)(C)C)C(=O)CCCCCCCCCCCCCCC | Number of Rings | What is the Number of Rings in <SMILES>CCCCCCCC/C=C\CCCCCCCC(=O)OP(=O)([O-])OC(C[N+](C)(C)C)C(=O)CCCCCCCCCCCCCCC</SMILES>? Answer: | 0 |
rdkit_prop_16 | CCCCCCCC/C=C\CCCCCCCC(=O)OP(=O)([O-])OC(C[N+](C)(C)C)C(=O)CCCCCCCCCCCCCCC | Number of Aromatic Rings | What is the Number of Aromatic Rings in <SMILES>CCCCCCCC/C=C\CCCCCCCC(=O)OP(=O)([O-])OC(C[N+](C)(C)C)C(=O)CCCCCCCCCCCCCCC</SMILES>? Answer: | 0 |
rdkit_prop_17 | CCCCCCCC/C=C\CCCCCCCC(=O)OP(=O)([O-])OC(C[N+](C)(C)C)C(=O)CCCCCCCCCCCCCCC | Number of Rotatable Bonds | What is the Number of Rotatable Bonds in <SMILES>CCCCCCCC/C=C\CCCCCCCC(=O)OP(=O)([O-])OC(C[N+](C)(C)C)C(=O)CCCCCCCCCCCCCCC</SMILES>? Answer: | 35 |
rdkit_prop_18 | CCCCCCCC/C=C\CCCCCCCC(=O)OP(=O)([O-])OC(C[N+](C)(C)C)C(=O)CCCCCCCCCCCCCCC | Number of H-Bond Donors | What is the Number of H-Bond Donors in <SMILES>CCCCCCCC/C=C\CCCCCCCC(=O)OP(=O)([O-])OC(C[N+](C)(C)C)C(=O)CCCCCCCCCCCCCCC</SMILES>? Answer: | 0 |
rdkit_prop_19 | CCCCCCCC/C=C\CCCCCCCC(=O)OP(=O)([O-])OC(C[N+](C)(C)C)C(=O)CCCCCCCCCCCCCCC | Number of H-Bond Acceptors | What is the Number of H-Bond Acceptors in <SMILES>CCCCCCCC/C=C\CCCCCCCC(=O)OP(=O)([O-])OC(C[N+](C)(C)C)C(=O)CCCCCCCCCCCCCCC</SMILES>? Answer: | 6 |
rdkit_prop_20 | CCCCCCCC/C=C\CCCCCCCC(=O)OP(=O)([O-])OC(C[N+](C)(C)C)C(=O)CCCCCCCCCCCCCCC | TPSA | What is the TPSA of <SMILES>CCCCCCCC/C=C\CCCCCCCC(=O)OP(=O)([O-])OC(C[N+](C)(C)C)C(=O)CCCCCCCCCCCCCCC</SMILES>? Answer: | 92.73 |
rdkit_prop_21 | CCCCCCCC/C=C\CCCCCCCC(=O)OP(=O)([O-])OC(C[N+](C)(C)C)C(=O)CCCCCCCCCCCCCCC | Formal Charge | What is the Formal Charge of <SMILES>CCCCCCCC/C=C\CCCCCCCC(=O)OP(=O)([O-])OC(C[N+](C)(C)C)C(=O)CCCCCCCCCCCCCCC</SMILES>? Answer: | 0 |
rdkit_prop_22 | CSCC[C@H](N)CC(=O)O | Molecular Weight | What is the Molecular Weight of <SMILES>CSCC[C@H](N)CC(=O)O</SMILES>? Answer: | 163.24 |
rdkit_prop_23 | CSCC[C@H](N)CC(=O)O | LogP | What is the LogP of <SMILES>CSCC[C@H](N)CC(=O)O</SMILES>? Answer: | 0.54 |
rdkit_prop_24 | CSCC[C@H](N)CC(=O)O | Number of Atoms | What is the Number of Atoms in <SMILES>CSCC[C@H](N)CC(=O)O</SMILES>? Answer: | 10 |
rdkit_prop_25 | CSCC[C@H](N)CC(=O)O | Number of Heavy Atoms | What is the Number of Heavy Atoms in <SMILES>CSCC[C@H](N)CC(=O)O</SMILES>? Answer: | 10 |
rdkit_prop_26 | CSCC[C@H](N)CC(=O)O | Number of Rings | What is the Number of Rings in <SMILES>CSCC[C@H](N)CC(=O)O</SMILES>? Answer: | 0 |
rdkit_prop_27 | CSCC[C@H](N)CC(=O)O | Number of Aromatic Rings | What is the Number of Aromatic Rings in <SMILES>CSCC[C@H](N)CC(=O)O</SMILES>? Answer: | 0 |
rdkit_prop_28 | CSCC[C@H](N)CC(=O)O | Number of Rotatable Bonds | What is the Number of Rotatable Bonds in <SMILES>CSCC[C@H](N)CC(=O)O</SMILES>? Answer: | 5 |
rdkit_prop_29 | CSCC[C@H](N)CC(=O)O | Number of H-Bond Donors | What is the Number of H-Bond Donors in <SMILES>CSCC[C@H](N)CC(=O)O</SMILES>? Answer: | 2 |
rdkit_prop_30 | CSCC[C@H](N)CC(=O)O | Number of H-Bond Acceptors | What is the Number of H-Bond Acceptors in <SMILES>CSCC[C@H](N)CC(=O)O</SMILES>? Answer: | 3 |
rdkit_prop_31 | CSCC[C@H](N)CC(=O)O | TPSA | What is the TPSA of <SMILES>CSCC[C@H](N)CC(=O)O</SMILES>? Answer: | 63.32 |
rdkit_prop_32 | CSCC[C@H](N)CC(=O)O | Formal Charge | What is the Formal Charge of <SMILES>CSCC[C@H](N)CC(=O)O</SMILES>? Answer: | 0 |
rdkit_prop_33 | O=C(CCCCCCC(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O)ON1C(=O)CC(S(=O)(=O)O)C1=O.[Na] | Molecular Weight | What is the Molecular Weight of <SMILES>O=C(CCCCCCC(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O)ON1C(=O)CC(S(=O)(=O)O)C1=O.[Na]</SMILES>? Answer: | 551.46 |
rdkit_prop_34 | O=C(CCCCCCC(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O)ON1C(=O)CC(S(=O)(=O)O)C1=O.[Na] | LogP | What is the LogP of <SMILES>O=C(CCCCCCC(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O)ON1C(=O)CC(S(=O)(=O)O)C1=O.[Na]</SMILES>? Answer: | -2.11 |
rdkit_prop_35 | O=C(CCCCCCC(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O)ON1C(=O)CC(S(=O)(=O)O)C1=O.[Na] | Number of Atoms | What is the Number of Atoms in <SMILES>O=C(CCCCCCC(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O)ON1C(=O)CC(S(=O)(=O)O)C1=O.[Na]</SMILES>? Answer: | 35 |
rdkit_prop_36 | O=C(CCCCCCC(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O)ON1C(=O)CC(S(=O)(=O)O)C1=O.[Na] | Number of Heavy Atoms | What is the Number of Heavy Atoms in <SMILES>O=C(CCCCCCC(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O)ON1C(=O)CC(S(=O)(=O)O)C1=O.[Na]</SMILES>? Answer: | 35 |
rdkit_prop_37 | O=C(CCCCCCC(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O)ON1C(=O)CC(S(=O)(=O)O)C1=O.[Na] | Number of Rings | What is the Number of Rings in <SMILES>O=C(CCCCCCC(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O)ON1C(=O)CC(S(=O)(=O)O)C1=O.[Na]</SMILES>? Answer: | 2 |
rdkit_prop_38 | O=C(CCCCCCC(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O)ON1C(=O)CC(S(=O)(=O)O)C1=O.[Na] | Number of Aromatic Rings | What is the Number of Aromatic Rings in <SMILES>O=C(CCCCCCC(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O)ON1C(=O)CC(S(=O)(=O)O)C1=O.[Na]</SMILES>? Answer: | 0 |
rdkit_prop_39 | O=C(CCCCCCC(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O)ON1C(=O)CC(S(=O)(=O)O)C1=O.[Na] | Number of Rotatable Bonds | What is the Number of Rotatable Bonds in <SMILES>O=C(CCCCCCC(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O)ON1C(=O)CC(S(=O)(=O)O)C1=O.[Na]</SMILES>? Answer: | 11 |
rdkit_prop_40 | O=C(CCCCCCC(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O)ON1C(=O)CC(S(=O)(=O)O)C1=O.[Na] | Number of H-Bond Donors | What is the Number of H-Bond Donors in <SMILES>O=C(CCCCCCC(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O)ON1C(=O)CC(S(=O)(=O)O)C1=O.[Na]</SMILES>? Answer: | 2 |
rdkit_prop_41 | O=C(CCCCCCC(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O)ON1C(=O)CC(S(=O)(=O)O)C1=O.[Na] | Number of H-Bond Acceptors | What is the Number of H-Bond Acceptors in <SMILES>O=C(CCCCCCC(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O)ON1C(=O)CC(S(=O)(=O)O)C1=O.[Na]</SMILES>? Answer: | 12 |
rdkit_prop_42 | O=C(CCCCCCC(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O)ON1C(=O)CC(S(=O)(=O)O)C1=O.[Na] | TPSA | What is the TPSA of <SMILES>O=C(CCCCCCC(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O)ON1C(=O)CC(S(=O)(=O)O)C1=O.[Na]</SMILES>? Answer: | 236.1 |
rdkit_prop_43 | O=C(CCCCCCC(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O)ON1C(=O)CC(S(=O)(=O)O)C1=O.[Na] | Formal Charge | What is the Formal Charge of <SMILES>O=C(CCCCCCC(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O)ON1C(=O)CC(S(=O)(=O)O)C1=O.[Na]</SMILES>? Answer: | 0 |
rdkit_prop_44 | O=C(CCc1ccc(Br)cc1)OCc1ccccc1 | Molecular Weight | What is the Molecular Weight of <SMILES>O=C(CCc1ccc(Br)cc1)OCc1ccccc1</SMILES>? Answer: | 319.2 |
rdkit_prop_45 | O=C(CCc1ccc(Br)cc1)OCc1ccccc1 | LogP | What is the LogP of <SMILES>O=C(CCc1ccc(Br)cc1)OCc1ccccc1</SMILES>? Answer: | 4.13 |
rdkit_prop_46 | O=C(CCc1ccc(Br)cc1)OCc1ccccc1 | Number of Atoms | What is the Number of Atoms in <SMILES>O=C(CCc1ccc(Br)cc1)OCc1ccccc1</SMILES>? Answer: | 19 |
rdkit_prop_47 | O=C(CCc1ccc(Br)cc1)OCc1ccccc1 | Number of Heavy Atoms | What is the Number of Heavy Atoms in <SMILES>O=C(CCc1ccc(Br)cc1)OCc1ccccc1</SMILES>? Answer: | 19 |
rdkit_prop_48 | O=C(CCc1ccc(Br)cc1)OCc1ccccc1 | Number of Rings | What is the Number of Rings in <SMILES>O=C(CCc1ccc(Br)cc1)OCc1ccccc1</SMILES>? Answer: | 2 |
rdkit_prop_49 | O=C(CCc1ccc(Br)cc1)OCc1ccccc1 | Number of Aromatic Rings | What is the Number of Aromatic Rings in <SMILES>O=C(CCc1ccc(Br)cc1)OCc1ccccc1</SMILES>? Answer: | 2 |
rdkit_prop_50 | O=C(CCc1ccc(Br)cc1)OCc1ccccc1 | Number of Rotatable Bonds | What is the Number of Rotatable Bonds in <SMILES>O=C(CCc1ccc(Br)cc1)OCc1ccccc1</SMILES>? Answer: | 5 |
rdkit_prop_51 | O=C(CCc1ccc(Br)cc1)OCc1ccccc1 | Number of H-Bond Donors | What is the Number of H-Bond Donors in <SMILES>O=C(CCc1ccc(Br)cc1)OCc1ccccc1</SMILES>? Answer: | 0 |
rdkit_prop_52 | O=C(CCc1ccc(Br)cc1)OCc1ccccc1 | Number of H-Bond Acceptors | What is the Number of H-Bond Acceptors in <SMILES>O=C(CCc1ccc(Br)cc1)OCc1ccccc1</SMILES>? Answer: | 2 |
rdkit_prop_53 | O=C(CCc1ccc(Br)cc1)OCc1ccccc1 | TPSA | What is the TPSA of <SMILES>O=C(CCc1ccc(Br)cc1)OCc1ccccc1</SMILES>? Answer: | 26.3 |
rdkit_prop_54 | O=C(CCc1ccc(Br)cc1)OCc1ccccc1 | Formal Charge | What is the Formal Charge of <SMILES>O=C(CCc1ccc(Br)cc1)OCc1ccccc1</SMILES>? Answer: | 0 |
rdkit_prop_55 | CCCCCCCCCCCCCCCC[Si](C)(OC)O[Si](C)(C)C | Molecular Weight | What is the Molecular Weight of <SMILES>CCCCCCCCCCCCCCCC[Si](C)(OC)O[Si](C)(C)C</SMILES>? Answer: | 388.79 |
rdkit_prop_56 | CCCCCCCCCCCCCCCC[Si](C)(OC)O[Si](C)(C)C | LogP | What is the LogP of <SMILES>CCCCCCCCCCCCCCCC[Si](C)(OC)O[Si](C)(C)C</SMILES>? Answer: | 8.04 |
rdkit_prop_57 | CCCCCCCCCCCCCCCC[Si](C)(OC)O[Si](C)(C)C | Number of Atoms | What is the Number of Atoms in <SMILES>CCCCCCCCCCCCCCCC[Si](C)(OC)O[Si](C)(C)C</SMILES>? Answer: | 25 |
rdkit_prop_58 | CCCCCCCCCCCCCCCC[Si](C)(OC)O[Si](C)(C)C | Number of Heavy Atoms | What is the Number of Heavy Atoms in <SMILES>CCCCCCCCCCCCCCCC[Si](C)(OC)O[Si](C)(C)C</SMILES>? Answer: | 25 |
rdkit_prop_59 | CCCCCCCCCCCCCCCC[Si](C)(OC)O[Si](C)(C)C | Number of Rings | What is the Number of Rings in <SMILES>CCCCCCCCCCCCCCCC[Si](C)(OC)O[Si](C)(C)C</SMILES>? Answer: | 0 |
rdkit_prop_60 | CCCCCCCCCCCCCCCC[Si](C)(OC)O[Si](C)(C)C | Number of Aromatic Rings | What is the Number of Aromatic Rings in <SMILES>CCCCCCCCCCCCCCCC[Si](C)(OC)O[Si](C)(C)C</SMILES>? Answer: | 0 |
rdkit_prop_61 | CCCCCCCCCCCCCCCC[Si](C)(OC)O[Si](C)(C)C | Number of Rotatable Bonds | What is the Number of Rotatable Bonds in <SMILES>CCCCCCCCCCCCCCCC[Si](C)(OC)O[Si](C)(C)C</SMILES>? Answer: | 18 |
rdkit_prop_62 | CCCCCCCCCCCCCCCC[Si](C)(OC)O[Si](C)(C)C | Number of H-Bond Donors | What is the Number of H-Bond Donors in <SMILES>CCCCCCCCCCCCCCCC[Si](C)(OC)O[Si](C)(C)C</SMILES>? Answer: | 0 |
rdkit_prop_63 | CCCCCCCCCCCCCCCC[Si](C)(OC)O[Si](C)(C)C | Number of H-Bond Acceptors | What is the Number of H-Bond Acceptors in <SMILES>CCCCCCCCCCCCCCCC[Si](C)(OC)O[Si](C)(C)C</SMILES>? Answer: | 2 |
rdkit_prop_64 | CCCCCCCCCCCCCCCC[Si](C)(OC)O[Si](C)(C)C | TPSA | What is the TPSA of <SMILES>CCCCCCCCCCCCCCCC[Si](C)(OC)O[Si](C)(C)C</SMILES>? Answer: | 18.46 |
rdkit_prop_65 | CCCCCCCCCCCCCCCC[Si](C)(OC)O[Si](C)(C)C | Formal Charge | What is the Formal Charge of <SMILES>CCCCCCCCCCCCCCCC[Si](C)(OC)O[Si](C)(C)C</SMILES>? Answer: | 0 |
rdkit_prop_66 | CC(C)(C)c1c2nc(c(C(C)(C)C)c3ccc([nH]3)c(C(C)(C)C)c3nc(c(C(C)(C)C)c4ccc1[nH]4)C=C3)C=C2.[Cu+2] | Molecular Weight | What is the Molecular Weight of <SMILES>CC(C)(C)c1c2nc(c(C(C)(C)C)c3ccc([nH]3)c(C(C)(C)C)c3nc(c(C(C)(C)C)c4ccc1[nH]4)C=C3)C=C2.[Cu+2]</SMILES>? Answer: | 598.34 |
rdkit_prop_67 | CC(C)(C)c1c2nc(c(C(C)(C)C)c3ccc([nH]3)c(C(C)(C)C)c3nc(c(C(C)(C)C)c4ccc1[nH]4)C=C3)C=C2.[Cu+2] | LogP | What is the LogP of <SMILES>CC(C)(C)c1c2nc(c(C(C)(C)C)c3ccc([nH]3)c(C(C)(C)C)c3nc(c(C(C)(C)C)c4ccc1[nH]4)C=C3)C=C2.[Cu+2]</SMILES>? Answer: | 9.84 |
rdkit_prop_68 | CC(C)(C)c1c2nc(c(C(C)(C)C)c3ccc([nH]3)c(C(C)(C)C)c3nc(c(C(C)(C)C)c4ccc1[nH]4)C=C3)C=C2.[Cu+2] | Number of Atoms | What is the Number of Atoms in <SMILES>CC(C)(C)c1c2nc(c(C(C)(C)C)c3ccc([nH]3)c(C(C)(C)C)c3nc(c(C(C)(C)C)c4ccc1[nH]4)C=C3)C=C2.[Cu+2]</SMILES>? Answer: | 41 |
rdkit_prop_69 | CC(C)(C)c1c2nc(c(C(C)(C)C)c3ccc([nH]3)c(C(C)(C)C)c3nc(c(C(C)(C)C)c4ccc1[nH]4)C=C3)C=C2.[Cu+2] | Number of Heavy Atoms | What is the Number of Heavy Atoms in <SMILES>CC(C)(C)c1c2nc(c(C(C)(C)C)c3ccc([nH]3)c(C(C)(C)C)c3nc(c(C(C)(C)C)c4ccc1[nH]4)C=C3)C=C2.[Cu+2]</SMILES>? Answer: | 41 |
rdkit_prop_70 | CC(C)(C)c1c2nc(c(C(C)(C)C)c3ccc([nH]3)c(C(C)(C)C)c3nc(c(C(C)(C)C)c4ccc1[nH]4)C=C3)C=C2.[Cu+2] | Number of Rings | What is the Number of Rings in <SMILES>CC(C)(C)c1c2nc(c(C(C)(C)C)c3ccc([nH]3)c(C(C)(C)C)c3nc(c(C(C)(C)C)c4ccc1[nH]4)C=C3)C=C2.[Cu+2]</SMILES>? Answer: | 5 |
rdkit_prop_71 | CC(C)(C)c1c2nc(c(C(C)(C)C)c3ccc([nH]3)c(C(C)(C)C)c3nc(c(C(C)(C)C)c4ccc1[nH]4)C=C3)C=C2.[Cu+2] | Number of Aromatic Rings | What is the Number of Aromatic Rings in <SMILES>CC(C)(C)c1c2nc(c(C(C)(C)C)c3ccc([nH]3)c(C(C)(C)C)c3nc(c(C(C)(C)C)c4ccc1[nH]4)C=C3)C=C2.[Cu+2]</SMILES>? Answer: | 3 |
rdkit_prop_72 | CC(C)(C)c1c2nc(c(C(C)(C)C)c3ccc([nH]3)c(C(C)(C)C)c3nc(c(C(C)(C)C)c4ccc1[nH]4)C=C3)C=C2.[Cu+2] | Number of Rotatable Bonds | What is the Number of Rotatable Bonds in <SMILES>CC(C)(C)c1c2nc(c(C(C)(C)C)c3ccc([nH]3)c(C(C)(C)C)c3nc(c(C(C)(C)C)c4ccc1[nH]4)C=C3)C=C2.[Cu+2]</SMILES>? Answer: | 0 |
rdkit_prop_73 | CC(C)(C)c1c2nc(c(C(C)(C)C)c3ccc([nH]3)c(C(C)(C)C)c3nc(c(C(C)(C)C)c4ccc1[nH]4)C=C3)C=C2.[Cu+2] | Number of H-Bond Donors | What is the Number of H-Bond Donors in <SMILES>CC(C)(C)c1c2nc(c(C(C)(C)C)c3ccc([nH]3)c(C(C)(C)C)c3nc(c(C(C)(C)C)c4ccc1[nH]4)C=C3)C=C2.[Cu+2]</SMILES>? Answer: | 2 |
rdkit_prop_74 | CC(C)(C)c1c2nc(c(C(C)(C)C)c3ccc([nH]3)c(C(C)(C)C)c3nc(c(C(C)(C)C)c4ccc1[nH]4)C=C3)C=C2.[Cu+2] | Number of H-Bond Acceptors | What is the Number of H-Bond Acceptors in <SMILES>CC(C)(C)c1c2nc(c(C(C)(C)C)c3ccc([nH]3)c(C(C)(C)C)c3nc(c(C(C)(C)C)c4ccc1[nH]4)C=C3)C=C2.[Cu+2]</SMILES>? Answer: | 2 |
rdkit_prop_75 | CC(C)(C)c1c2nc(c(C(C)(C)C)c3ccc([nH]3)c(C(C)(C)C)c3nc(c(C(C)(C)C)c4ccc1[nH]4)C=C3)C=C2.[Cu+2] | TPSA | What is the TPSA of <SMILES>CC(C)(C)c1c2nc(c(C(C)(C)C)c3ccc([nH]3)c(C(C)(C)C)c3nc(c(C(C)(C)C)c4ccc1[nH]4)C=C3)C=C2.[Cu+2]</SMILES>? Answer: | 57.36 |
rdkit_prop_76 | CC(C)(C)c1c2nc(c(C(C)(C)C)c3ccc([nH]3)c(C(C)(C)C)c3nc(c(C(C)(C)C)c4ccc1[nH]4)C=C3)C=C2.[Cu+2] | Formal Charge | What is the Formal Charge of <SMILES>CC(C)(C)c1c2nc(c(C(C)(C)C)c3ccc([nH]3)c(C(C)(C)C)c3nc(c(C(C)(C)C)c4ccc1[nH]4)C=C3)C=C2.[Cu+2]</SMILES>? Answer: | 2 |
rdkit_prop_77 | C[C@H]1C(=O)c2cc3c(cc2CCN(C)Cc2c1ccc1c2OCO1)OCO3 | Molecular Weight | What is the Molecular Weight of <SMILES>C[C@H]1C(=O)c2cc3c(cc2CCN(C)Cc2c1ccc1c2OCO1)OCO3</SMILES>? Answer: | 367.4 |
rdkit_prop_78 | C[C@H]1C(=O)c2cc3c(cc2CCN(C)Cc2c1ccc1c2OCO1)OCO3 | LogP | What is the LogP of <SMILES>C[C@H]1C(=O)c2cc3c(cc2CCN(C)Cc2c1ccc1c2OCO1)OCO3</SMILES>? Answer: | 3.12 |
rdkit_prop_79 | C[C@H]1C(=O)c2cc3c(cc2CCN(C)Cc2c1ccc1c2OCO1)OCO3 | Number of Atoms | What is the Number of Atoms in <SMILES>C[C@H]1C(=O)c2cc3c(cc2CCN(C)Cc2c1ccc1c2OCO1)OCO3</SMILES>? Answer: | 27 |
rdkit_prop_80 | C[C@H]1C(=O)c2cc3c(cc2CCN(C)Cc2c1ccc1c2OCO1)OCO3 | Number of Heavy Atoms | What is the Number of Heavy Atoms in <SMILES>C[C@H]1C(=O)c2cc3c(cc2CCN(C)Cc2c1ccc1c2OCO1)OCO3</SMILES>? Answer: | 27 |
rdkit_prop_81 | C[C@H]1C(=O)c2cc3c(cc2CCN(C)Cc2c1ccc1c2OCO1)OCO3 | Number of Rings | What is the Number of Rings in <SMILES>C[C@H]1C(=O)c2cc3c(cc2CCN(C)Cc2c1ccc1c2OCO1)OCO3</SMILES>? Answer: | 5 |
rdkit_prop_82 | C[C@H]1C(=O)c2cc3c(cc2CCN(C)Cc2c1ccc1c2OCO1)OCO3 | Number of Aromatic Rings | What is the Number of Aromatic Rings in <SMILES>C[C@H]1C(=O)c2cc3c(cc2CCN(C)Cc2c1ccc1c2OCO1)OCO3</SMILES>? Answer: | 2 |
rdkit_prop_83 | C[C@H]1C(=O)c2cc3c(cc2CCN(C)Cc2c1ccc1c2OCO1)OCO3 | Number of Rotatable Bonds | What is the Number of Rotatable Bonds in <SMILES>C[C@H]1C(=O)c2cc3c(cc2CCN(C)Cc2c1ccc1c2OCO1)OCO3</SMILES>? Answer: | 0 |
rdkit_prop_84 | C[C@H]1C(=O)c2cc3c(cc2CCN(C)Cc2c1ccc1c2OCO1)OCO3 | Number of H-Bond Donors | What is the Number of H-Bond Donors in <SMILES>C[C@H]1C(=O)c2cc3c(cc2CCN(C)Cc2c1ccc1c2OCO1)OCO3</SMILES>? Answer: | 0 |
rdkit_prop_85 | C[C@H]1C(=O)c2cc3c(cc2CCN(C)Cc2c1ccc1c2OCO1)OCO3 | Number of H-Bond Acceptors | What is the Number of H-Bond Acceptors in <SMILES>C[C@H]1C(=O)c2cc3c(cc2CCN(C)Cc2c1ccc1c2OCO1)OCO3</SMILES>? Answer: | 6 |
rdkit_prop_86 | C[C@H]1C(=O)c2cc3c(cc2CCN(C)Cc2c1ccc1c2OCO1)OCO3 | TPSA | What is the TPSA of <SMILES>C[C@H]1C(=O)c2cc3c(cc2CCN(C)Cc2c1ccc1c2OCO1)OCO3</SMILES>? Answer: | 57.23 |
rdkit_prop_87 | C[C@H]1C(=O)c2cc3c(cc2CCN(C)Cc2c1ccc1c2OCO1)OCO3 | Formal Charge | What is the Formal Charge of <SMILES>C[C@H]1C(=O)c2cc3c(cc2CCN(C)Cc2c1ccc1c2OCO1)OCO3</SMILES>? Answer: | 0 |
rdkit_prop_88 | O=C1CN(c2ccccc2)C(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1 | Molecular Weight | What is the Molecular Weight of <SMILES>O=C1CN(c2ccccc2)C(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1</SMILES>? Answer: | 772.97 |
rdkit_prop_89 | O=C1CN(c2ccccc2)C(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1 | LogP | What is the LogP of <SMILES>O=C1CN(c2ccccc2)C(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1</SMILES>? Answer: | -4.14 |
rdkit_prop_90 | O=C1CN(c2ccccc2)C(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1 | Number of Atoms | What is the Number of Atoms in <SMILES>O=C1CN(c2ccccc2)C(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1</SMILES>? Answer: | 48 |
rdkit_prop_91 | O=C1CN(c2ccccc2)C(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1 | Number of Heavy Atoms | What is the Number of Heavy Atoms in <SMILES>O=C1CN(c2ccccc2)C(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1</SMILES>? Answer: | 48 |
rdkit_prop_92 | O=C1CN(c2ccccc2)C(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1 | Number of Rings | What is the Number of Rings in <SMILES>O=C1CN(c2ccccc2)C(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1</SMILES>? Answer: | 7 |
rdkit_prop_93 | O=C1CN(c2ccccc2)C(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1 | Number of Aromatic Rings | What is the Number of Aromatic Rings in <SMILES>O=C1CN(c2ccccc2)C(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1</SMILES>? Answer: | 1 |
rdkit_prop_94 | O=C1CN(c2ccccc2)C(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1 | Number of Rotatable Bonds | What is the Number of Rotatable Bonds in <SMILES>O=C1CN(c2ccccc2)C(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1</SMILES>? Answer: | 1 |
rdkit_prop_95 | O=C1CN(c2ccccc2)C(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1 | Number of H-Bond Donors | What is the Number of H-Bond Donors in <SMILES>O=C1CN(c2ccccc2)C(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1</SMILES>? Answer: | 11 |
rdkit_prop_96 | O=C1CN(c2ccccc2)C(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1 | Number of H-Bond Acceptors | What is the Number of H-Bond Acceptors in <SMILES>O=C1CN(c2ccccc2)C(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1</SMILES>? Answer: | 12 |
rdkit_prop_97 | O=C1CN(c2ccccc2)C(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1 | TPSA | What is the TPSA of <SMILES>O=C1CN(c2ccccc2)C(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1</SMILES>? Answer: | 237.99 |
rdkit_prop_98 | O=C1CN(c2ccccc2)C(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1 | Formal Charge | What is the Formal Charge of <SMILES>O=C1CN(c2ccccc2)C(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1.O=C1CNC(=S)N1</SMILES>? Answer: | 0 |
rdkit_prop_99 | C[N+](C)(C)CCO.O=P([O-])([O-])OP(=O)([O-])O.[Mg+2] | Molecular Weight | What is the Molecular Weight of <SMILES>C[N+](C)(C)CCO.O=P([O-])([O-])OP(=O)([O-])O.[Mg+2]</SMILES>? Answer: | 303.43 |
End of preview. Expand in Data Studio
README.md exists but content is empty.
- Downloads last month
- 16