Datasets:
id stringlengths 26 26 | image imagewidth (px) 118 1.88k | mol stringlengths 951 16k | smiles stringlengths 12 280 ⌀ | selfies stringlengths 42 1.15k ⌀ | inchi stringlengths 45 896 ⌀ |
|---|---|---|---|---|---|
US07314511-20080101-C00002 | 0020.cdx
ChemDraw12120507302D
40 48 0 0 0 0 0 0 0 0999 V2000
-1.7944 0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6987 0.7145 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6951 1.6925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3819 1.9840 0.0000 C 0 ... | c1ccc2c(c1)C1=N/C2=N\C2=N/C(=N\C3=N/C(=N\C4=N/C(=N\1)c1ccccc14)c1ccccc13)c1ccccc12 | [C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][C][=N][/C][Ring1][=Branch1][=N][\C][=N][/C][=Branch2][Ring2][=Branch1][=N][\C][=N][/C][=Branch2][Ring1][Ring2][=N][\C][=N][/C][=Branch1][Ring2][=N][-\Ring1][S][C][=C][C][=C][C][=C][Ring1][=Branch1][Ring1][#Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][Ring2][Ring... | InChI=1S/C32H16N8/c1-2-10-18-17(9-1)25-33-26(18)38-28-21-13-5-6-14-22(21)30(35-28)40-32-24-16-8-7-15-23(24)31(36-32)39-29-20-12-4-3-11-19(20)27(34-29)37-25/h1-16H/b37-25-,37-27-,38-26-,38-28-,39-29-,39-31-,40-30-,40-32- | |
US07314511-20080101-C00004 | 0040.cdx
ChemDraw12120507342D
10 10 0 0 0 0 0 0 0 0999 V2000
-0.0553 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0553 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7697 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4842 0.4125 0.0000 C 0 ... | N#Cc1ccccc1C#N | [N][#C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][#N] | InChI=1S/C8H4N2/c9-5-7-3-1-2-4-8(7)6-10/h1-4H | |
US07314511-20080101-C00006 | 0260.cdx
ChemDraw12120507402D
32 34 0 0 0 0 0 0 0 0999 V2000
-2.1859 1.4437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1859 0.6187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4714 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7569 0.6187 0.0000 C 0 ... | Cc1ccc(S(=O)(=O)Oc2ccc(OS(=O)(=O)c3ccc(C)cc3)c(C#N)c2C#N)cc1 | [C][C][=C][C][=C][Branch2][Ring2][=C][S][=Branch1][C][=O][=Branch1][C][=O][O][C][=C][C][=C][Branch2][Ring1][Ring2][O][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][Branch1][C][C][C][=C][Ring1][#Branch1][C][Branch1][Ring1][C][#N][=C][Ring2][Ring1][Ring1][C][#N][C][=C][Ring2][Ring1][#C] | InChI=1S/C22H16N2O6S2/c1-15-3-7-17(8-4-15)31(25,26)29-21-11-12-22(20(14-24)19(21)13-23)30-32(27,28)18-9-5-16(2)6-10-18/h3-12H,1-2H3 | |
US07314511-20080101-C00007 | 0270.cdx
ChemDraw12120507412D
26 28 0 0 0 0 0 0 0 0999 V2000
-0.4125 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4125 2.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1270 3.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8414 2.8875 0.0000 C 0 ... | Cc1ccc(Sc2ccc(Sc3ccc(C)cc3)c(C#N)c2C#N)cc1 | [C][C][=C][C][=C][Branch2][Ring1][=C][S][C][=C][C][=C][Branch1][=N][S][C][=C][C][=C][Branch1][C][C][C][=C][Ring1][#Branch1][C][Branch1][Ring1][C][#N][=C][Ring1][S][C][#N][C][=C][Ring2][Ring1][=Branch2] | InChI=1S/C22H16N2S2/c1-15-3-7-17(8-4-15)25-21-11-12-22(20(14-24)19(21)13-23)26-18-9-5-16(2)6-10-18/h3-12H,1-2H3 | |
US07314511-20080101-C00008 | 0271.cdx
ChemDraw12120507432D
30 32 0 0 0 0 0 0 0 0999 V2000
-0.0553 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0553 2.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7697 3.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4842 2.8875 0.0000 C 0 ... | CC(C)c1ccc(Sc2ccc(Sc3ccc(C(C)C)cc3)c(C#N)c2C#N)cc1 | [C][C][Branch1][C][C][C][=C][C][=C][Branch2][Ring2][Ring1][S][C][=C][C][=C][Branch1][P][S][C][=C][C][=C][Branch1][=Branch1][C][Branch1][C][C][C][C][=C][Ring1][=Branch2][C][Branch1][Ring1][C][#N][=C][Ring2][Ring1][C][C][#N][C][=C][Ring2][Ring1][O] | InChI=1S/C26H24N2S2/c1-17(2)19-5-9-21(10-6-19)29-25-13-14-26(24(16-28)23(25)15-27)30-22-11-7-20(8-12-22)18(3)4/h5-14,17-18H,1-4H3 | |
US07314511-20080101-C00009 | 0280.cdx
ChemDraw12120507442D
32 36 0 0 0 0 0 0 0 0999 V2000
-0.0553 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0553 2.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7697 3.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4842 2.8875 0.0000 C 0 ... | N#Cc1c(Sc2ccc3ccccc3c2)ccc(Sc2ccc3ccccc3c2)c1C#N | [N][#C][C][=C][Branch1][S][S][C][=C][C][=C][C][=C][C][=C][C][Ring1][=Branch1][=C][Ring1][#Branch2][C][=C][C][Branch1][S][S][C][=C][C][=C][C][=C][C][=C][C][Ring1][=Branch1][=C][Ring1][#Branch2][=C][Ring2][Ring1][N][C][#N] | InChI=1S/C28H16N2S2/c29-17-25-26(18-30)28(32-24-12-10-20-6-2-4-8-22(20)16-24)14-13-27(25)31-23-11-9-19-5-1-3-7-21(19)15-23/h1-16H | |
US07314511-20080101-C00010 | 0282.cdx
ChemDraw12120507472D
24 26 0 0 0 0 0 0 0 0999 V2000
-0.7697 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7697 2.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4842 3.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1987 2.8875 0.0000 C 0 ... | N#Cc1c(Sc2ccccc2)ccc(Sc2ccccc2)c1C#N | [N][#C][C][=C][Branch1][#Branch2][S][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][Branch1][#Branch2][S][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][Ring2][Ring1][Ring2][C][#N] | InChI=1S/C20H12N2S2/c21-13-17-18(14-22)20(24-16-9-5-2-6-10-16)12-11-19(17)23-15-7-3-1-4-8-15/h1-12H | |
US07314511-20080101-C00011 | 0290.cdx
ChemDraw12120508012D
26 28 0 0 0 0 0 0 0 0999 V2000
-0.7697 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7697 2.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4842 3.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1987 2.8875 0.0000 C 0 ... | Cc1ccccc1Sc1ccc(Sc2ccccc2C)c(C#N)c1C#N | [C][C][=C][C][=C][C][=C][Ring1][=Branch1][S][C][=C][C][=C][Branch1][O][S][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][Branch1][Ring1][C][#N][=C][Ring1][S][C][#N] | InChI=1S/C22H16N2S2/c1-15-7-3-5-9-19(15)25-21-11-12-22(18(14-24)17(21)13-23)26-20-10-6-4-8-16(20)2/h3-12H,1-2H3 | |
US07314511-20080101-C00012 | 0291.cdx
ChemDraw12120508022D
26 28 0 0 0 0 0 0 0 0999 V2000
-0.7697 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7697 2.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4842 3.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1987 2.8875 0.0000 C 0 ... | N#Cc1c(Sc2ccccc2Cl)ccc(Sc2ccccc2Cl)c1C#N | [N][#C][C][=C][Branch1][O][S][C][=C][C][=C][C][=C][Ring1][=Branch1][Cl][C][=C][C][Branch1][O][S][C][=C][C][=C][C][=C][Ring1][=Branch1][Cl][=C][Ring2][Ring1][=Branch1][C][#N] | InChI=1S/C20H10Cl2N2S2/c21-15-5-1-3-7-19(15)25-17-9-10-18(14(12-24)13(17)11-23)26-20-8-4-2-6-16(20)22/h1-10H | |
US07314543-20080101-C00003 | 0090.cdx
ChemDraw03230509262D
11 11 0 0 0 0 0 0 0 0999 V2000
-2.5607 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5607 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8463 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1318 -0.8250 0.0000 C 0 ... | CC(=O)C=Cc1ccccc1 | [C][C][=Branch1][C][=O][C][=C][C][=C][C][=C][C][=C][Ring1][=Branch1] | InChI=1S/C10H10O/c1-9(11)7-8-10-5-3-2-4-6-10/h2-8H,1H3 | |
US07314576-20080101-C00010 | 0009.cdx
ChemDraw08070616162D
17 17 0 0 0 0 0 0 0 0999 V2000
-3.5001 -0.4285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6751 -0.4285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4202 0.3561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0876 0.8410 0.0000 O 0 ... | CCCCCCCCCC=C1CC(C)OC1=O | [C][C][C][C][C][C][C][C][C][C][=C][C][C][Branch1][C][C][O][C][Ring1][=Branch1][=O] | InChI=1S/C15H26O2/c1-3-4-5-6-7-8-9-10-11-14-12-13(2)17-15(14)16/h11,13H,3-10,12H2,1-2H3 | |
US07314576-20080101-C00011 | 0010.cdx
ChemDraw08070616182D
16 16 0 0 0 0 0 0 0 0999 V2000
-1.1299 -0.2985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1299 0.5265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9145 0.7815 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3994 0.1140 0.0000 C 0 ... | CC(CC=C1C[C@@H](C)OC1=O)CC(C)(C)C | [C][C][Branch1][=C][C][C][=C][C][C@@H1][Branch1][C][C][O][C][Ring1][=Branch1][=O][C][C][Branch1][C][C][Branch1][C][C][C] | InChI=1S/C14H24O2/c1-10(9-14(3,4)5)6-7-12-8-11(2)16-13(12)15/h7,10-11H,6,8-9H2,1-5H3/t10?,11-/m1/s1 | |
US07314576-20080101-C00012 | 0011.cdx
ChemDraw08070616182D
14 15 0 0 0 0 0 0 0 0999 V2000
-1.4148 -0.1582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5898 -0.1582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3349 0.6264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0023 1.1114 0.0000 O 0 ... | CC1C/C(=C/C2CCCCC2)C(=O)O1 | [C][C][C][/C][=Branch1][#Branch2][=C][/C][C][C][C][C][C][Ring1][=Branch1][C][=Branch1][C][=O][O][Ring1][=N] | InChI=1S/C12H18O2/c1-9-7-11(12(13)14-9)8-10-5-3-2-4-6-10/h8-10H,2-7H2,1H3/b11-8- | |
US07314576-20080101-C00013 | 0012.cdx
ChemDraw08070616192D
10 10 0 0 0 0 0 0 0 0999 V2000
0.6592 -0.6348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4842 -0.6348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7391 0.1498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0717 0.6348 0.0000 O 0 ... | CCCCC1CCC(=O)O1 | [C][C][C][C][C][C][C][C][=Branch1][C][=O][O][Ring1][=Branch1] | InChI=1S/C8H14O2/c1-2-3-4-7-5-6-8(9)10-7/h7H,2-6H2,1H3 | |
US07314576-20080101-C00014 | 0013.cdx
ChemDraw08070616192D
11 11 0 0 0 0 0 0 0 0999 V2000
1.0164 -0.6348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8414 -0.6348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0964 0.1498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4289 0.6348 0.0000 O 0 ... | CCCCCC1CCC(=O)O1 | [C][C][C][C][C][C][C][C][C][=Branch1][C][=O][O][Ring1][=Branch1] | InChI=1S/C9H16O2/c1-2-3-4-5-8-6-7-9(10)11-8/h8H,2-7H2,1H3 | |
US07314576-20080101-C00015 | 0014.cdx
ChemDraw08070616202D
12 12 0 0 0 0 0 0 0 0999 V2000
1.3737 -0.6348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1987 -0.6348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4536 0.1498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7862 0.6348 0.0000 O 0 ... | CCCCCCC1CCC(=O)O1 | [C][C][C][C][C][C][C][C][C][C][=Branch1][C][=O][O][Ring1][=Branch1] | InChI=1S/C10H18O2/c1-2-3-4-5-6-9-7-8-10(11)12-9/h9H,2-8H2,1H3 | |
US07314576-20080101-C00016 | 0015.cdx
ChemDraw08070616202D
13 13 0 0 0 0 0 0 0 0999 V2000
1.7309 -0.6348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5559 -0.6348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8109 0.1498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1434 0.6348 0.0000 O 0 ... | CCCCCCCC1CCC(=O)O1 | [C][C][C][C][C][C][C][C][C][C][C][=Branch1][C][=O][O][Ring1][=Branch1] | InChI=1S/C11H20O2/c1-2-3-4-5-6-7-10-8-9-11(12)13-10/h10H,2-9H2,1H3 | |
US07314576-20080101-C00017 | 0016.cdx
ChemDraw08070616212D
14 14 0 0 0 0 0 0 0 0999 V2000
2.0881 -0.6348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9131 -0.6348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1681 0.1498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5006 0.6348 0.0000 O 0 ... | CCCCCCCCC1CCC(=O)O1 | [C][C][C][C][C][C][C][C][C][C][C][C][=Branch1][C][=O][O][Ring1][=Branch1] | InChI=1S/C12H22O2/c1-2-3-4-5-6-7-8-11-9-10-12(13)14-11/h11H,2-10H2,1H3 | |
US07314576-20080101-C00019 | 0018.cdx
ChemDraw08070616222D
13 13 0 0 0 0 0 0 0 0999 V2000
2.0881 -1.0473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9131 -1.0473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1681 -0.2627 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5006 0.2223 0.0000 C 0 ... | CCCCCCCC1CCOC1=O | [C][C][C][C][C][C][C][C][C][C][O][C][Ring1][Branch1][=O] | InChI=1S/C11H20O2/c1-2-3-4-5-6-7-10-8-9-13-11(10)12/h10H,2-9H2,1H3 | |
US07314576-20080101-C00021 | 0020.cdx
ChemDraw08070616232D
10 10 0 0 0 0 0 0 0 0999 V2000
0.4369 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4369 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2216 -0.6674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7065 -0.0000 0.0000 O 0 ... | CCC[C@@H]1C[C@H](C)OC1=O | [C][C][C][C@@H1][C][C@H1][Branch1][C][C][O][C][Ring1][=Branch1][=O] | InChI=1S/C8H14O2/c1-3-4-7-5-6(2)10-8(7)9/h6-7H,3-5H2,1-2H3/t6-,7+/m0/s1 | |
US07314576-20080101-C00022 | 0021.cdx
ChemDraw08070616242D
11 11 0 0 0 0 0 0 0 0999 V2000
0.7942 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7942 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5788 -0.6674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0637 -0.0000 0.0000 O 0 ... | CCCC[C@@H]1C[C@H](C)OC1=O | [C][C][C][C][C@@H1][C][C@H1][Branch1][C][C][O][C][Ring1][=Branch1][=O] | InChI=1S/C9H16O2/c1-3-4-5-8-6-7(2)11-9(8)10/h7-8H,3-6H2,1-2H3/t7-,8+/m0/s1 | |
US07314576-20080101-C00023 | 0022.cdx
ChemDraw08070616242D
12 12 0 0 0 0 0 0 0 0999 V2000
1.1514 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1514 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9360 -0.6674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4209 -0.0000 0.0000 O 0 ... | CCCCC[C@@H]1C[C@H](C)OC1=O | [C][C][C][C][C][C@@H1][C][C@H1][Branch1][C][C][O][C][Ring1][=Branch1][=O] | InChI=1S/C10H18O2/c1-3-4-5-6-9-7-8(2)12-10(9)11/h8-9H,3-7H2,1-2H3/t8-,9+/m0/s1 | |
US07314576-20080101-C00024 | 0023.cdx
ChemDraw08070616252D
13 13 0 0 0 0 0 0 0 0999 V2000
1.5086 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5086 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2933 -0.6674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7782 -0.0000 0.0000 O 0 ... | CCCCCC[C@@H]1C[C@H](C)OC1=O | [C][C][C][C][C][C][C@@H1][C][C@H1][Branch1][C][C][O][C][Ring1][=Branch1][=O] | InChI=1S/C11H20O2/c1-3-4-5-6-7-10-8-9(2)13-11(10)12/h9-10H,3-8H2,1-2H3/t9-,10+/m0/s1 | |
US07314576-20080101-C00025 | 0024.cdx
ChemDraw08070616252D
14 14 0 0 0 0 0 0 0 0999 V2000
1.8659 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8659 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6505 -0.6674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1354 -0.0000 0.0000 O 0 ... | CCCCCCC[C@@H]1C[C@H](C)OC1=O | [C][C][C][C][C][C][C][C@@H1][C][C@H1][Branch1][C][C][O][C][Ring1][=Branch1][=O] | InChI=1S/C12H22O2/c1-3-4-5-6-7-8-11-9-10(2)14-12(11)13/h10-11H,3-9H2,1-2H3/t10-,11+/m0/s1 | |
US07314576-20080101-C00026 | 0025.cdx
ChemDraw08070616262D
15 15 0 0 0 0 0 0 0 0999 V2000
2.2231 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2231 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0077 -0.6674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4927 -0.0000 0.0000 O 0 ... | CCCCCCCC[C@@H]1C[C@H](C)OC1=O | [C][C][C][C][C][C][C][C][C@@H1][C][C@H1][Branch1][C][C][O][C][Ring1][=Branch1][=O] | InChI=1S/C13H24O2/c1-3-4-5-6-7-8-9-12-10-11(2)15-13(12)14/h11-12H,3-10H2,1-2H3/t11-,12+/m0/s1 | |
US07314576-20080101-C00027 | 0026.cdx
ChemDraw08070616262D
16 16 0 0 0 0 0 0 0 0999 V2000
1.5086 0.2785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5086 -0.5465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2933 -0.8015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7782 -0.1340 0.0000 O 0 ... | CC(CC[C@@H]1C[C@H](C)OC1=O)CC(C)(C)C | [C][C][Branch1][=C][C][C][C@@H1][C][C@H1][Branch1][C][C][O][C][Ring1][=Branch1][=O][C][C][Branch1][C][C][Branch1][C][C][C] | InChI=1S/C14H26O2/c1-10(9-14(3,4)5)6-7-12-8-11(2)16-13(12)15/h10-12H,6-9H2,1-5H3/t10?,11-,12+/m0/s1 | |
US07314576-20080101-C00028 | 0027.cdx
ChemDraw08070616282D
14 15 0 0 0 0 0 0 0 0999 V2000
-2.1752 0.0946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1752 -0.7304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4607 -1.1429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7462 -0.7304 0.0000 C 0 ... | C[C@H]1C[C@@H](CC2CCCCC2)C(=O)O1 | [C][C@H1][C][C@@H1][Branch1][#Branch2][C][C][C][C][C][C][C][Ring1][=Branch1][C][=Branch1][C][=O][O][Ring1][=N] | InChI=1S/C12H20O2/c1-9-7-11(12(13)14-9)8-10-5-3-2-4-6-10/h9-11H,2-8H2,1H3/t9-,11-/m0/s1 | |
US07314576-20080101-C00029 | 0028.cdx
ChemDraw08070616292D
13 13 0 0 0 0 0 0 0 0999 V2000
-2.4837 -0.6900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6587 -0.6900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4038 0.0946 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.0712 0.5795 0.0000 C 0 ... | CCCCCC[C@]1(C)CCC(=O)O1 | [C][C][C][C][C][C][C@][Branch1][C][C][C][C][C][=Branch1][C][=O][O][Ring1][#Branch1] | InChI=1S/C11H20O2/c1-3-4-5-6-8-11(2)9-7-10(12)13-11/h3-9H2,1-2H3/t11-/m1/s1 | |
US07314576-20080101-C00030 | 0029.cdx
ChemDraw08070616292D
15 15 0 0 0 0 0 0 0 0999 V2000
-3.1982 -0.6900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3732 -0.6900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1182 0.0946 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.7857 0.5795 0.0000 C 0 ... | CCCCCCCC[C@]1(C)CCC(=O)O1 | [C][C][C][C][C][C][C][C][C@][Branch1][C][C][C][C][C][=Branch1][C][=O][O][Ring1][#Branch1] | InChI=1S/C13H24O2/c1-3-4-5-6-7-8-10-13(2)11-9-12(14)15-13/h3-11H2,1-2H3/t13-/m1/s1 | |
US07314576-20080101-C00031 | 0030.cdx
ChemDraw08070616302D
12 13 0 0 0 0 0 0 0 0999 V2000
-1.3492 0.3403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3492 -0.4847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6348 -0.8972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0797 -0.4847 0.0000 C 0 ... | O=C1OC[C@H]2CCCC[C@@H]12 | [O][=C][O][C][C@H1][C][C][C][C][C@@H1][Ring1][=Branch2][Ring1][=Branch1] | InChI=1S/C8H12O2/c9-8-7-4-2-1-3-6(7)5-10-8/h6-7H,1-5H2/t6-,7-/m1/s1 | |
US07314576-20080101-C00032 | 0031.cdx
ChemDraw08070616302D
12 12 0 0 0 0 0 0 0 0999 V2000
-2.8579 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1434 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4289 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7145 -0.4125 0.0000 C 0 ... | CCCCCC1CCCC(=O)O1 | [C][C][C][C][C][C][C][C][C][C][=Branch1][C][=O][O][Ring1][#Branch1] | InChI=1S/C10H18O2/c1-2-3-4-6-9-7-5-8-10(11)12-9/h9H,2-8H2,1H3 | |
US07314576-20080101-C00033 | 0032.cdx
ChemDraw08070616312D
13 13 0 0 0 0 0 0 0 0999 V2000
-2.5006 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7862 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0717 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3572 -0.4125 0.0000 C 0 ... | CCCCCCC1CCCC(=O)O1 | [C][C][C][C][C][C][C][C][C][C][C][=Branch1][C][=O][O][Ring1][#Branch1] | InChI=1S/C11H20O2/c1-2-3-4-5-7-10-8-6-9-11(12)13-10/h10H,2-9H2,1H3 | |
US07314576-20080101-C00034 | 0033.cdx
ChemDraw08070616312D
14 14 0 0 0 0 0 0 0 0999 V2000
-2.1434 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4289 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7145 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.4125 0.0000 C 0 ... | CCCCCCCC1CCCC(=O)O1 | [C][C][C][C][C][C][C][C][C][C][C][C][=Branch1][C][=O][O][Ring1][#Branch1] | InChI=1S/C12H22O2/c1-2-3-4-5-6-8-11-9-7-10-12(13)14-11/h11H,2-10H2,1H3 | |
US07314576-20080101-C00035 | 0034.cdx
ChemDraw08070616362D
24 24 0 0 0 0 0 0 0 0999 V2000
1.2281 -0.1289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0531 -0.1289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3080 0.6557 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6406 1.1406 0.0000 C 0 ... | CCCCCCC1CCOC1=O.CCCCCCC1COC(=O)C1 | [C][C][C][C][C][C][C][C][C][O][C][Ring1][Branch1][=O].[C][C][C][C][C][C][C][C][O][C][=Branch1][C][=O][C][Ring1][=Branch1] | InChI=1S/2C10H18O2/c1-2-3-4-5-6-9-7-10(11)12-8-9;1-2-3-4-5-6-9-7-8-12-10(9)11/h2*9H,2-8H2,1H3 | |
US07314633-20080101-C00005 | 0440.cdx
ChemDraw03080713532D
23 23 0 0 0 0 0 0 0 0999 V2000
-3.6877 1.4437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8627 1.4437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7862 1.4437 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0717 1.0313 0.0000 C 0 ... | CCOC(=O)CC(C(=O)OCC)=C1CC(C)(C)N(O)C(C)(C)C1 | [C][C][O][C][=Branch1][C][=O][C][C][Branch1][Branch2][C][=Branch1][C][=O][O][C][C][=C][C][C][Branch1][C][C][Branch1][C][C][N][Branch1][C][O][C][Branch1][C][C][Branch1][C][C][C][Ring1][O] | InChI=1S/C17H29NO5/c1-7-22-14(19)9-13(15(20)23-8-2)12-10-16(3,4)18(21)17(5,6)11-12/h21H,7-11H2,1-6H3 | |
US07314653-20080101-C00090 | 0054.cdx
ChemDraw04090518212D
17 18 0 0 0 0 0 0 0 0999 V2000
-3.0133 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8383 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9367 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5242 -0.7145 0.0000 C 0 ... | C=CC1CCC(c2ccc(C#N)cc2)CC1 | [C][=C][C][C][C][C][Branch1][=N][C][=C][C][=C][Branch1][Ring1][C][#N][C][=C][Ring1][Branch2][C][C][Ring1][=C] | InChI=1S/C15H17N/c1-2-12-3-7-14(8-4-12)15-9-5-13(11-16)6-10-15/h2,5-6,9-10,12,14H,1,3-4,7-8H2 | |
US07314653-20080101-C00094 | 0058.cdx
ChemDraw04090518262D
24 26 0 0 0 0 0 0 0 0999 V2000
0.1253 -0.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9503 -0.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9503 1.0717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1253 1.0717 0.0000 C 0 ... | C=CC1CCC(C2CCC(c3ccc(F)c(F)c3)CC2)CC1 | [C][=C][C][C][C][C][Branch2][Ring1][=Branch2][C][C][C][C][Branch1][#C][C][=C][C][=C][Branch1][C][F][C][Branch1][C][F][=C][Ring1][Branch2][C][C][Ring1][=C][C][C][Ring2][Ring1][Ring2] | InChI=1S/C20H26F2/c1-2-14-3-5-15(6-4-14)16-7-9-17(10-8-16)18-11-12-19(21)20(22)13-18/h2,11-17H,1,3-10H2 | |
US07314653-20080101-C00109 | 0073.cdx
ChemDraw04090518592D
18 19 0 0 0 0 0 0 0 0999 V2000
-2.0551 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8801 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6426 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8176 -0.7145 0.0000 C 0 ... | C=CC1CCC(C2CCC(CC)CC2)CC1 | [C][=C][C][C][C][C][Branch1][=N][C][C][C][C][Branch1][Ring1][C][C][C][C][Ring1][Branch2][C][C][Ring1][=C] | InChI=1S/C16H28/c1-3-13-5-9-15(10-6-13)16-11-7-14(4-2)8-12-16/h3,13-16H,1,4-12H2,2H3 | |
US07314653-20080101-C00118 | 0082.cdx
ChemDraw04090521542D
25 26 0 0 0 0 0 0 0 0999 V2000
-2.6008 0.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1883 -0.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3633 -0.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9508 0.3572 0.0000 C 0 ... | Cc1cc(O)c(C(C)(C)C)cc1Cc1cc(C(C)(C)C)c(O)cc1C | [C][C][=C][C][Branch1][C][O][=C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][C][=C][Ring1][O][C][C][=C][C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][=C][Branch1][C][O][C][=C][Ring1][O][C] | InChI=1S/C23H32O2/c1-14-9-20(24)18(22(3,4)5)12-16(14)11-17-13-19(23(6,7)8)21(25)10-15(17)2/h9-10,12-13,24-25H,11H2,1-8H3 | |
US07314653-20080101-C00119 | 0083.cdx
ChemDraw04090521542D
28 29 0 0 0 0 0 0 0 0999 V2000
-2.5305 0.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1180 -0.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2930 -0.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8805 0.3572 0.0000 C 0 ... | Cc1cc(O)c(C(C)(C)C)cc1C(c1cc(C(C)(C)C)c(O)cc1C)C(C)C | [C][C][=C][C][Branch1][C][O][=C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][C][=C][Ring1][O][C][Branch2][Ring1][#Branch1][C][=C][C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][=C][Branch1][C][O][C][=C][Ring1][O][C][C][Branch1][C][C][C] | InChI=1S/C26H38O2/c1-15(2)24(18-13-20(25(5,6)7)22(27)11-16(18)3)19-14-21(26(8,9)10)23(28)12-17(19)4/h11-15,24,27-28H,1-10H3 | |
US07314653-20080101-C00122 | 0086.cdx
ChemDraw04090521572D
19 19 0 0 0 0 0 0 0 0999 V2000
-1.4156 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6469 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2344 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5906 -0.7145 0.0000 C 0 ... | CC(C)(C)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 | [C][C][Branch1][C][C][Branch1][C][C][C][=C][C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][=C][Branch1][C][O][C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][=C][Ring1][#C] | InChI=1S/C18H30O/c1-16(2,3)12-10-13(17(4,5)6)15(19)14(11-12)18(7,8)9/h10-11,19H,1-9H3 | |
US07314653-20080101-C00125 | 0089.cdx
ChemDraw04090521592D
30 31 0 0 0 0 0 0 0 0999 V2000
0.3844 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7969 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6219 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0344 0.0000 0.0000 C 0 ... | CC(C)(C)c1cc(-c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O | [C][C][Branch1][C][C][Branch1][C][C][C][=C][C][Branch2][Ring1][S][C][=C][C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][=C][Branch1][C][O][C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][=C][Ring1][#C][=C][C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][=C][Ring2][Ring1][=Branch2][O] | InChI=1S/C28H42O2/c1-25(2,3)19-13-17(14-20(23(19)29)26(4,5)6)18-15-21(27(7,8)9)24(30)22(16-18)28(10,11)12/h13-16,29-30H,1-12H3 | |
US07314653-20080101-C00126 | 0090.cdx
ChemDraw04090522012D
25 27 0 0 0 0 0 0 0 0999 V2000
-1.7042 -0.6187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7042 -1.4437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9897 -1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2752 -1.4437 0.0000 C 0 ... | CC(C)(C)CC(C)(C)c1ccc(O)c(Cn2nc3ccccc3n2)c1 | [C][C][Branch1][C][C][Branch1][C][C][C][C][Branch1][C][C][Branch1][C][C][C][=C][C][=C][Branch1][C][O][C][Branch1][#C][C][N][N][=C][C][=C][C][=C][C][Ring1][=Branch1][=N][Ring1][=Branch2][=C][Ring1][P] | InChI=1S/C21H27N3O/c1-20(2,3)14-21(4,5)16-10-11-19(25)15(12-16)13-24-22-17-8-6-7-9-18(17)23-24/h6-12,25H,13-14H2,1-5H3 | |
US07314653-20080101-C00127 | 0091.cdx
ChemDraw04090522022D
17 19 0 0 0 0 0 0 0 0999 V2000
-2.1742 0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5867 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1742 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3492 -0.7145 0.0000 C 0 ... | Cc1ccc(O)c(-n2nc3ccccc3n2)c1 | [C][C][=C][C][=C][Branch1][C][O][C][Branch1][=C][N][N][=C][C][=C][C][=C][C][Ring1][=Branch1][=N][Ring1][=Branch2][=C][Ring1][S] | InChI=1S/C13H11N3O/c1-9-6-7-13(17)12(8-9)16-14-10-4-2-3-5-11(10)15-16/h2-8,17H,1H3 | |
US07314653-20080101-C00128 | 0092.cdx
ChemDraw04090522032D
25 27 0 0 0 0 0 0 0 0999 V2000
-1.4289 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4289 1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1434 2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8579 1.8563 0.0000 C 0 ... | CC(C)(C)c1cc(-n2nc3ccc(Cl)cc3n2)c(O)c(C(C)(C)C)c1 | [C][C][Branch1][C][C][Branch1][C][C][C][=C][C][Branch1][P][N][N][=C][C][=C][C][Branch1][C][Cl][=C][C][Ring1][#Branch1][=N][Ring1][#Branch2][=C][Branch1][C][O][C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][=C][Ring2][Ring1][Branch1] | InChI=1S/C20H24ClN3O/c1-19(2,3)12-9-14(20(4,5)6)18(25)17(10-12)24-22-15-8-7-13(21)11-16(15)23-24/h7-11,25H,1-6H3 | |
US07314653-20080101-C00129 | 0093.cdx
ChemDraw04090522102D
24 26 0 0 0 0 0 0 0 0999 V2000
-1.5703 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5703 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2848 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9992 0.4125 0.0000 C 0 ... | CC(C)(C)c1cc(-n2nc3ccccc3n2)c(O)c(C(C)(C)C)c1 | [C][C][Branch1][C][C][Branch1][C][C][C][=C][C][Branch1][=C][N][N][=C][C][=C][C][=C][C][Ring1][=Branch1][=N][Ring1][=Branch2][=C][Branch1][C][O][C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][=C][Ring2][Ring1][Ring2] | InChI=1S/C20H25N3O/c1-19(2,3)13-11-14(20(4,5)6)18(24)17(12-13)23-21-15-9-7-8-10-16(15)22-23/h7-12,24H,1-6H3 | |
US07314653-20080101-C00130 | 0094.cdx
ChemDraw04090522112D
34 38 0 0 0 0 0 0 0 0999 V2000
-1.5150 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5150 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2295 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9440 0.4125 0.0000 C 0 ... | CC(C)(c1ccccc1)c1cc(-n2nc3ccccc3n2)c(O)c(C(C)(C)c2ccccc2)c1 | [C][C][Branch1][C][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][Branch1][=C][N][N][=C][C][=C][C][=C][C][Ring1][=Branch1][=N][Ring1][=Branch2][=C][Branch1][C][O][C][Branch1][S][C][Branch1][C][C][Branch1][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][Ring2][Ring1][=Branch2] | InChI=1S/C30H29N3O/c1-29(2,21-13-7-5-8-14-21)23-19-24(30(3,4)22-15-9-6-10-16-22)28(34)27(20-23)33-31-25-17-11-12-18-26(25)32-33/h5-20,34H,1-4H3 | |
US07314653-20080101-C00131 | 0095.cdx
ChemDraw04090522122D
27 29 0 0 0 0 0 0 0 0999 V2000
-2.5006 0.9760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5006 1.8010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2151 2.2135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9296 1.8010 0.0000 C 0 ... | COC(=O)CCc1cc(-n2nc3ccc(Cl)cc3n2)c(O)c(C(C)(C)C)c1 | [C][O][C][=Branch1][C][=O][C][C][C][=C][C][Branch1][P][N][N][=C][C][=C][C][Branch1][C][Cl][=C][C][Ring1][#Branch1][=N][Ring1][#Branch2][=C][Branch1][C][O][C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][=C][Ring2][Ring1][Branch1] | InChI=1S/C20H22ClN3O3/c1-20(2,3)14-9-12(5-8-18(25)27-4)10-17(19(14)26)24-22-15-7-6-13(21)11-16(15)23-24/h6-7,9-11,26H,5,8H2,1-4H3 | |
US07314653-20080101-C00132 | 0096.cdx
ChemDraw04090522142D
47 50 0 0 0 0 0 0 0 0999 V2000
-0.3572 2.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3572 3.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0717 4.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7862 3.7125 0.0000 C 0 ... | CCCCCCCCCCCCOCC(O)COc1ccc(-c2nc(-c3ccc(C)cc3C)nc(-c3ccc(C)cc3C)n2)c(O)c1 | [C][C][C][C][C][C][C][C][C][C][C][C][O][C][C][Branch1][C][O][C][O][C][=C][C][=C][Branch2][Ring2][=Branch1][C][=N][C][Branch1][=N][C][=C][C][=C][Branch1][C][C][C][=C][Ring1][#Branch1][C][=N][C][Branch1][=N][C][=C][C][=C][Branch1][C][C][C][=C][Ring1][#Branch1][C][=N][Ring2][Ring1][=Branch1][C][Branch1][C][O][=C][Ring2][R... | InChI=1S/C40H53N3O4/c1-6-7-8-9-10-11-12-13-14-15-22-46-26-32(44)27-47-33-18-21-36(37(45)25-33)40-42-38(34-19-16-28(2)23-30(34)4)41-39(43-40)35-20-17-29(3)24-31(35)5/h16-21,23-25,32,44-45H,6-15,22,26-27H2,1-5H3 | |
US07314653-20080101-C00136 | 0100.cdx
Mrv0541 08031212132D
28 30 0 0 0 0 999 V2000
-3.7696 -0.6592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9446 -0.6592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5321 0.0553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9446 0.7697 0.0... | CCCC1CCC(C2CCC(c3ccc(CC(C)CC)cc3)CC2)CC1 | [C][C][C][C][C][C][C][Branch2][Ring1][=N][C][C][C][C][Branch2][Ring1][C][C][=C][C][=C][Branch1][Branch2][C][C][Branch1][C][C][C][C][C][=C][Ring1][O][C][C][Ring1][P][C][C][Ring2][Ring1][#Branch1] | InChI=1S/C26H42/c1-4-6-21-7-11-23(12-8-21)25-15-17-26(18-16-25)24-13-9-22(10-14-24)19-20(3)5-2/h9-10,13-14,20-21,23,25-26H,4-8,11-12,15-19H2,1-3H3 | |
US07314653-20080101-C00137 | 0100.cdx
ChemDraw04090522192D
41 44 0 0 0 0 0 0 0 0999 V2000
-1.8213 -1.2140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4088 -1.9285 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4088 -0.4995 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6943 -1.5160 0.0000 C 0 ... | CCCCCCCCC(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@H]([C@H](C)CCCC(C)C)[C@@]4(C)CC[C@@H]32)C1 | [C][C][C][C][C][C][C][C][C][=Branch1][C][=O][O][C@H1][C][C][C@@][Branch1][C][C][C][=Branch2][Ring2][Branch1][=C][C][C@H1][C@@H1][C][C][C@H1][Branch1][=N][C@H1][Branch1][C][C][C][C][C][C][Branch1][C][C][C][C@@][Ring1][=N][Branch1][C][C][C][C][C@@H1][Ring2][Ring1][C][Ring2][Ring1][#Branch1][C][Ring2][Ring1][O] | InChI=1S/C36H62O2/c1-7-8-9-10-11-12-16-34(37)38-29-21-23-35(5)28(25-29)17-18-30-32-20-19-31(27(4)15-13-14-26(2)3)36(32,6)24-22-33(30)35/h17,26-27,29-33H,7-16,18-25H2,1-6H3/t27-,29+,30+,31-,32+,33+,35+,36-/m1/s1 | |
US07314653-20080101-C00138 | 0102.cdx
Mrv0541 08031212142D
36 38 0 0 0 0 999 V2000
-4.0081 -0.9140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1831 -0.9140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1831 0.5150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0081 0.5150 0.0... | CCCCCCC(C)Oc1c(F)cc(C2CCC(C3CCC(CCCCC)CC3)CC2)cc1F | [C][C][C][C][C][C][C][Branch1][C][C][O][C][=C][Branch1][C][F][C][=C][Branch2][Ring1][#Branch2][C][C][C][C][Branch1][S][C][C][C][C][Branch1][=Branch1][C][C][C][C][C][C][C][Ring1][O][C][C][Ring1][P][C][=C][Ring2][Ring1][Branch2][F] | InChI=1S/C31H50F2O/c1-4-6-8-10-11-23(3)34-31-29(32)21-28(22-30(31)33)27-19-17-26(18-20-27)25-15-13-24(14-16-25)12-9-7-5-2/h21-27H,4-20H2,1-3H3 | |
US07314653-20080101-C00141 | 0105.cdx
ChemDraw04090522282D
36 39 0 0 0 0 0 0 0 0999 V2000
-3.6341 0.7131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8091 0.7140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3958 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8075 -0.7149 0.0000 C 0 ... | CCCCCCC(C)Oc1c(F)cc(-c2ccc(C34CCC(CCCCC)(CC3)CC4)cc2)cc1F | [C][C][C][C][C][C][C][Branch1][C][C][O][C][=C][Branch1][C][F][C][=C][Branch2][Ring2][C][C][=C][C][=C][Branch2][Ring1][=Branch1][C][C][C][C][Branch1][=Branch1][C][C][C][C][C][Branch1][Branch1][C][C][Ring1][O][C][C][Ring1][=N][C][=C][Ring2][Ring1][Ring1][C][=C][Ring2][Ring1][#Branch2][F] | InChI=1S/C33H46F2O/c1-4-6-8-9-11-25(3)36-31-29(34)23-27(24-30(31)35)26-12-14-28(15-13-26)33-20-17-32(18-21-33,19-22-33)16-10-7-5-2/h12-15,23-25H,4-11,16-22H2,1-3H3 | |
US07314654-20080101-C00014 | 024008.cdx
ChemDraw06280519182D
168177 0 0 0 0 0 0 0 0999 V2000
-1.4289 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4289 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7145 -1.4437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.0313 0.0000 C ... | null | null | null | |
US07314654-20080101-C00028 | 0005.cdx
ChemDraw06230508512D
19 19 0 0 0 0 0 0 0 0999 V2000
-4.5631 -0.2063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7381 -0.2063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7381 0.6187 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.9131 -0.2063 0.0000 C 0 ... | C=CC(=O)OCCCCOc1ccc(C(C)=O)cc1 | [C][=C][C][=Branch1][C][=O][O][C][C][C][C][O][C][=C][C][=C][Branch1][=Branch1][C][Branch1][C][C][=O][C][=C][Ring1][=Branch2] | InChI=1S/C15H18O4/c1-3-15(17)19-11-5-4-10-18-14-8-6-13(7-9-14)12(2)16/h3,6-9H,1,4-5,10-11H2,2H3 | |
US07314691-20080101-C00001 | 0120.cdx
ChemDraw09020522232D
12 9 0 0 0 0 0 0 0 0999 V2000
-1.3342 0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5092 0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9217 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5092 -0.7145 0.0000 O 0 ... | C.C.C=C(O)C(C)C(C)C(=O)O | [C].[C].[C][=C][Branch1][C][O][C][Branch1][C][C][C][Branch1][C][C][C][=Branch1][C][=O][O] | InChI=1S/C7H12O3.2CH4/c1-4(6(3)8)5(2)7(9)10;;/h4-5,8H,3H2,1-2H3,(H,9,10);2*1H4 | |
US07314692-20080101-C00032 | 0320.cdx
ChemDraw05220507472D
17 17 0 0 0 0 0 0 0 0999 V2000
-1.2375 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8250 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4125 -0.0000 0.0000 C 0 ... | CC(C)(C)c1cc(C=O)cc(C(C)(C)C)c1O | [C][C][Branch1][C][C][Branch1][C][C][C][=C][C][Branch1][Ring1][C][=O][=C][C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][=C][Ring1][N][O] | InChI=1S/C15H22O2/c1-14(2,3)11-7-10(9-16)8-12(13(11)17)15(4,5)6/h7-9,17H,1-6H3 | |
US07314692-20080101-C00033 | 0330.cdx
ChemDraw05220507472D
11 11 0 0 0 0 0 0 0 0999 V2000
-0.6187 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2062 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6187 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0313 -0.0000 0.0000 C 0 ... | NNc1ccc([N+](=O)[O-])cc1 | [N][N][C][=C][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][=C][Ring1][=Branch2] | InChI=1S/C6H7N3O2/c7-8-5-1-3-6(4-2-5)9(10)11/h1-4,8H,7H2 | |
US07314692-20080101-C00034 | 0331.cdx
ChemDraw05220507502D
27 28 0 0 0 0 0 0 0 0999 V2000
-3.5062 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0938 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2687 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8563 -0.0000 0.0000 C 0 ... | CC(C)(C)c1cc(C=NNc2ccc([N+](=O)[O-])cc2)cc(C(C)(C)C)c1O | [C][C][Branch1][C][C][Branch1][C][C][C][=C][C][Branch2][Ring1][Ring1][C][=N][N][C][=C][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][=C][Ring1][=Branch2][=C][C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][=C][Ring2][Ring1][=Branch1][O] | InChI=1S/C21H27N3O3/c1-20(2,3)17-11-14(12-18(19(17)25)21(4,5)6)13-22-23-15-7-9-16(10-8-15)24(26)27/h7-13,23,25H,1-6H3 | |
US07314693-20080101-C00039 | 0001.cdx
ChemDraw05010516422D
15 15 0 0 0 0 0 0 0 0999 V2000
-0.6666 0.7623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0791 0.0479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6666 -0.6666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1584 -0.6666 0.0000 C 0 ... | CCN(CC)c1ccc(C(C)(C)C)cc1 | [C][C][N][Branch1][Ring1][C][C][C][=C][C][=C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][C][=C][Ring1][#Branch2] | InChI=1S/C14H23N/c1-6-15(7-2)13-10-8-12(9-11-13)14(3,4)5/h8-11H,6-7H2,1-5H3 | |
US07314693-20080101-C00040 | 0002.cdx
ChemDraw05010516432D
16 16 0 0 0 0 0 0 0 0999 V2000
-1.1822 0.0755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5947 -0.6390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1822 -1.3534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3572 -1.3534 0.0000 C 0 ... | CCN(CC)c1cccc(N(CC)CC)c1 | [C][C][N][Branch1][Ring1][C][C][C][=C][C][=C][C][Branch1][Branch2][N][Branch1][Ring1][C][C][C][C][=C][Ring1][O] | InChI=1S/C14H24N2/c1-5-15(6-2)13-10-9-11-14(12-13)16(7-3)8-4/h9-12H,5-8H2,1-4H3 | |
US07314693-20080101-C00041 | 0003.cdx
ChemDraw05010516432D
16 16 0 0 0 0 0 0 0 0999 V2000
-0.4125 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8250 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4125 -1.4289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4125 -1.4289 0.0000 C 0 ... | CCN(CC)c1ccccc1N(CC)CC | [C][C][N][Branch1][Ring1][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][N][Branch1][Ring1][C][C][C][C] | InChI=1S/C14H24N2/c1-5-15(6-2)13-11-9-10-12-14(13)16(7-3)8-4/h9-12H,5-8H2,1-4H3 | |
US07314693-20080101-C00042 | 0004.cdx
ChemDraw05010516452D
16 17 0 0 0 0 0 0 0 0999 V2000
-0.3572 -0.1786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3572 -1.0036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3572 -1.4161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0717 -1.0036 0.0000 C 0 ... | CCN(CC)c1c(C)ccc2ccccc12 | [C][C][N][Branch1][Ring1][C][C][C][=C][Branch1][C][C][C][=C][C][=C][C][=C][C][=C][Ring1][O][Ring1][=Branch1] | InChI=1S/C15H19N/c1-4-16(5-2)15-12(3)10-11-13-8-6-7-9-14(13)15/h6-11H,4-5H2,1-3H3 | |
US07314693-20080101-C00043 | 0005.cdx
ChemDraw05010516462D
15 16 0 0 0 0 0 0 0 0999 V2000
-2.7369 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7369 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0225 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3080 -0.8250 0.0000 C 0 ... | CC(C)N(C)c1ccc2ccccc2c1 | [C][C][Branch1][C][C][N][Branch1][C][C][C][=C][C][=C][C][=C][C][=C][C][Ring1][=Branch1][=C][Ring1][#Branch2] | InChI=1S/C14H17N/c1-11(2)15(3)14-9-8-12-6-4-5-7-13(12)10-14/h4-11H,1-3H3 | |
US07314693-20080101-C00045 | 0007.cdx
ChemDraw05010516492D
21 21 0 0 0 0 0 0 0 0999 V2000
0.7145 -0.7495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7145 0.0755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0000 0.4880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7145 0.0755 0.0000 C 0 ... | CCN(CC)c1cc(N(CC)CC)cc(N(CC)CC)c1 | [C][C][N][Branch1][Ring1][C][C][C][=C][C][Branch1][Branch2][N][Branch1][Ring1][C][C][C][C][=C][C][Branch1][Branch2][N][Branch1][Ring1][C][C][C][C][=C][Ring1][S] | InChI=1S/C18H33N3/c1-7-19(8-2)16-13-17(20(9-3)10-4)15-18(14-16)21(11-5)12-6/h13-15H,7-12H2,1-6H3 | |
US07314693-20080101-C00046 | 0008.cdx
ChemDraw05010516502D
26 28 0 0 0 0 0 0 0 0999 V2000
-0.5539 0.3296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9664 -0.3849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5539 -1.0993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2711 -1.0993 0.0000 C 0 ... | CCN(Cc1ccccc1)c1cccc(N(CC)Cc2ccccc2)c1 | [C][C][N][Branch1][#Branch2][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][Branch1][#C][N][Branch1][Ring1][C][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][Ring1][S] | InChI=1S/C24H28N2/c1-3-25(19-21-12-7-5-8-13-21)23-16-11-17-24(18-23)26(4-2)20-22-14-9-6-10-15-22/h5-18H,3-4,19-20H2,1-2H3 | |
US07314693-20080101-C00047 | 0009.cdx
ChemDraw05010516512D
27 31 0 0 0 0 0 0 0 0999 V2000
-2.1883 1.7585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6008 1.0441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1883 0.3296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3633 0.3296 0.0000 C 0 ... | CCN(Cc1ccc(C)cc1)c1ccc2ccc3cccc4ccc1c2c34 | [C][C][N][Branch1][=N][C][C][=C][C][=C][Branch1][C][C][C][=C][Ring1][#Branch1][C][=C][C][=C][C][=C][C][=C][C][=C][C][=C][C][=C][Ring1][=C][C][Ring1][N][=C][Ring1][#Branch2][Ring1][=Branch1] | InChI=1S/C26H23N/c1-3-27(17-19-9-7-18(2)8-10-19)24-16-14-22-12-11-20-5-4-6-21-13-15-23(24)26(22)25(20)21/h4-16H,3,17H2,1-2H3 | |
US07314693-20080101-C00048 | 0010.cdx
ChemDraw05010516532D
24 26 0 0 0 0 0 0 0 0999 V2000
-1.4916 -0.0276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6666 -0.0276 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.2541 0.6868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2541 -0.7421 0.0000 C 0 ... | CCN(CC)c1cccc(N(c2ccccc2)c2ccccc2)c1 | [C][C][N][Branch1][Ring1][C][C][C][=C][C][=C][C][Branch2][Ring1][Ring2][N][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][Ring2][Ring1][Ring1] | InChI=1S/C22H24N2/c1-3-23(4-2)21-16-11-17-22(18-21)24(19-12-7-5-8-13-19)20-14-9-6-10-15-20/h5-18H,3-4H2,1-2H3 |
Dataset Card for USPTO OCSR Benchmark
This dataset is a large validation and benchmark set for Optical Chemical Structure Recognition (OCSR), containing 5,719 chemical structure images. The data was sourced from US Patent Office (USPTO) documents and has been curated to provide accurate ground truth MOL files. This Hugging Face version further enriches the dataset by providing pre-computed SMILES, InChI, and SELFIES strings for each molecule.
Dataset Details
Dataset Description
The USPTO OCSR Benchmark was created to serve as a high-quality validation set for OCSR software. It consists of images derived from the US Patent Office Complex Work Units, with each image containing a single chemical structure. The dataset was made possible through a collaboration with Dr. Steve Boyer and Dr. John Kinney and was later updated by Aniko Valko and Keymodule Ltd., who corrected the ground truth MOL files and removed invalid images.
The original distribution included the images, their corresponding MOL files, and a Perl script for benchmarking performance by comparing the standard InChI of predicted structures against the ground truth. This Hugging Face version processes the curated MOL files to generate additional, widely-used chemical representations—canonical SMILES, InChI, and SELFIES—making it immediately useful for training modern deep learning models on image-to-text tasks.
- Curated by: Original set by Dr. Steve Boyer and Dr. John Kinney. Updated by Aniko Valko and Keymodule Ltd. This Hugging Face version prepared by Hunter Heidenreich.
- License: Data sourced from the US Patent Office is typically in the public domain. No explicit license was provided with the original dataset.
Dataset Sources
- Repository:
- Paper: While there is no dedicated paper for the dataset, it is closely associated with the OSRA tool. Citing the OSRA paper is recommended.
Uses
Direct Use
This dataset is ideal for benchmarking, validating, and training OCSR models, particularly those intended to work with chemical diagrams from patent literature. Common use cases include:
- Image-to-SMILES translation
- Evaluating the accuracy of OCSR tools by comparing generated InChIs
- Fine-tuning vision-language models for the chemistry domain
Out-of-Scope Use
The dataset consists of segmented, single-structure images. It is not suitable for developing or evaluating the document segmentation stage of an OCSR pipeline, which involves finding and isolating chemical diagrams from a full document page. The drawing styles are also specific to patent documents and may not represent the full diversity of diagrams found in textbooks, journals, or handwritten notes.
Dataset Structure
The dataset contains a single split ('train') with 5,719 examples. Each example includes the following fields:
id(string): A unique identifier for the example, which is the original filename without the extension.image(image): A PIL-encoded image of the chemical structure.mol(string): The corrected ground truth structure in MOL file format.smiles(string): The canonical SMILES string for the molecule, generated from themoldata using RDKit.selfies(string): The SELFIES (SELF-referencIng Embedded Strings) representation, generated from thesmilesstring.inchi(string): The standard InChI string for the molecule, generated from themoldata using RDKit.
Dataset Creation
Curation Rationale
The dataset was created to provide a robust and standardized tool for the OCSR community to benchmark and validate their software against a large set of real-world examples from a significant source (US patents).
Source Data
Data Collection and Processing
The source data consists of chemical structure images from US Patent Office Complex Work Units. The initial dataset was later refined by Aniko Valko and Keymodule Ltd. by correcting errors in the ground truth MOL files and removing invalid image-molecule pairs to improve its quality as a benchmark.
For this Hugging Face Hub version, a script was used to process the corrected MOL files. This script utilized the RDKit library to generate canonical SMILES and standard InChI strings, and the selfies library to generate SELFIES representations from the SMILES strings. This pre-processing makes the dataset more accessible for machine learning workflows.
Who are the source data producers?
The underlying chemical structure data originates from documents filed with the US Patent Office. The dataset was curated and released by academic and commercial collaborators.
Bias, Risks, and Limitations
- Domain Specificity: The data is exclusively from US patents. The conventions, resolution, and styles of chemical drawings may differ from those in patents from other regions or in other types of scientific publications.
- Pre-processed Images: The images contain only single, segmented structures. This simplifies the recognition task and means models trained on this data will not learn to handle complex pages with multiple diagrams, text, and other figures.
- Lack of Negative Examples: The dataset contains only valid chemical structure images. It does not include examples of diagrams that are malformed or non-chemical, which could be important for building a truly robust real-world system.
Recommendations
Users should consider this dataset a high-quality validation set for the core task of recognizing segmented chemical structures from patents. For creating a more general-purpose OCSR tool, it is advisable to combine this dataset with others that include different drawing styles (e.g., UOB, CLEF) and more complex, unsegmented document images.
Citation
If you use this dataset, please consider citing the original OSRA paper, as the dataset is a key part of its validation suite. Please also cite this Hugging Face dataset to ensure reproducibility.
BibTeX:
@article{filippov2009optical,
title={Optical structure recognition software to recover chemical information: OSRA, an open source solution},
author={Filippov, Igor V and Nicklaus, Marc C},
journal={Journal of chemical information and modeling},
volume={49},
number={3},
pages={740--743},
year={2009},
publisher={ACS Publications}
}
@misc{huggingface_dataset_USPTO,
author = {Heidenreich, Hunter},
title = {USPTO OCSR Benchmark},
year = {2025},
publisher = {Hugging Face},
journal = {Hugging Face repository},
howpublished = {\url{[https://huggingface.co/datasets/hheiden/USPTO_OCSR_benchmark](https://huggingface.co/datasets/hheiden/USPTO_OCSR_benchmark)}}
}
- Downloads last month
- 17