Dataset Viewer
Auto-converted to Parquet Duplicate
id
stringlengths
9
24
image
imagewidth (px)
266
1.83k
mol
stringlengths
724
10.7k
smiles
stringlengths
12
273
selfies
stringlengths
36
1k
inchi
stringlengths
40
713
14756366.2020.1837124_1
RDKit 2D 36 39 0 0 0 0 0 0 0 0999 V2000 4.4444 -3.0805 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.4698 -2.6511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8508 -2.4457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8508 -2.0163 0.0000 C 0 0 0 0...
Nc1ccccc1NC(=O)c1ccc(CNC(=O)c2n[nH]cc2NC(=O)c2c(Cl)cccc2Cl)cc1
[N][C][=C][C][=C][C][=C][Ring1][=Branch1][N][C][=Branch1][C][=O][C][=C][C][=C][Branch2][Ring1][#C][C][N][C][=Branch1][C][=O][C][=N][NH1][C][=C][Ring1][Branch1][N][C][=Branch1][C][=O][C][=C][Branch1][C][Cl][C][=C][C][=C][Ring1][#Branch1][Cl][C][=C][Ring2][Ring1][#Branch2]
InChI=1S/C25H20Cl2N6O3/c26-16-4-3-5-17(27)21(16)24(35)32-20-13-30-33-22(20)25(36)29-12-14-8-10-15(11-9-14)23(34)31-19-7-2-1-6-18(19)28/h1-11,13H,12,28H2,(H,29,36)(H,30,33)(H,31,34)(H,32,35)
14756366.2020.1837124_2
14756366.2020.1837124_2.mol ChemDraw10172222052D 28 31 0 0 0 0 0 0 0 0999 V2000 -0.5384 0.8888 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5982 0.0762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1196 -0.3302 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.8374 0.07...
O=C(Nc1cccc(OCC2CCCN2)n1)Nc1csc(-c2ccncc2)n1
[O][=C][Branch2][Ring1][Branch1][N][C][=C][C][=C][C][Branch1][#Branch2][O][C][C][C][C][C][N][Ring1][Branch1][=N][Ring1][=N][N][C][=C][S][C][Branch1][=Branch2][C][=C][C][=N][C][=C][Ring1][=Branch1][=N][Ring1][O]
InChI=1S/C19H20N6O2S/c26-19(25-16-12-28-18(23-16)13-6-9-20-10-7-13)24-15-4-1-5-17(22-15)27-11-14-3-2-8-21-14/h1,4-7,9-10,12,14,21H,2-3,8,11H2,(H2,22,24,25,26)
14756366.2020.1837124_3
RDKit 2D 26 28 0 0 0 0 0 0 0 0999 V2000 2.7933 -3.0234 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2793 -3.3177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2793 -3.9064 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.7933 -4.2007 0.0000 C 0 0 0 0...
O=C(Nc1ccc(F)cc1)c1n[nH]cc1NC(=O)c1c(F)cccc1F
[O][=C][Branch1][=N][N][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][C][=N][NH1][C][=C][Ring1][Branch1][N][C][=Branch1][C][=O][C][=C][Branch1][C][F][C][=C][C][=C][Ring1][#Branch1][F]
InChI=1S/C17H11F3N4O2/c18-9-4-6-10(7-5-9)22-17(26)15-13(8-21-24-15)23-16(25)14-11(19)2-1-3-12(14)20/h1-8H,(H,21,24)(H,22,26)(H,23,25)
14756366.2020.1837124_4
14756366.2020.1837124_4.mol ChemDraw10252222032D 30 32 0 0 0 0 0 0 0 0999 V2000 -1.6704 1.1774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9021 0.9242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2004 1.3581 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.1670 2.15...
CCCCCCNC(=O)Nc1c(C#N)c2n(c1C(=O)Nc1ccccc1)CCC2
[C][C][C][C][C][C][N][C][=Branch1][C][=O][N][C][C][Branch1][Ring1][C][#N][=C][N][Branch1][P][C][=Ring1][#Branch1][C][=Branch1][C][=O][N][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][C][Ring1][#C]
InChI=1S/C22H27N5O2/c1-2-3-4-8-13-24-22(29)26-19-17(15-23)18-12-9-14-27(18)20(19)21(28)25-16-10-6-5-7-11-16/h5-7,10-11H,2-4,8-9,12-14H2,1H3,(H,25,28)(H2,24,26,29)
acs.accounts.7b00050_1
acs.accounts.7b00050_1.mol ChemDraw10252219382D 13 14 0 0 0 0 0 0 0 0999 V2000 -0.7851 1.9382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1255 -0.9277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7851 -1.4233 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 -1.4683 -0.927...
Cc1cc2[c]([Sn]([CH3])([CH3])[CH3])scc2s1
[C][C][=C][C][=CH0][Branch1][=Branch2][Sn][Branch1][C][CH3][Branch1][C][CH3][CH3][S][C][=C][Ring1][=Branch2][S][Ring1][N]
InChI=1S/C7H5S2.3CH3.Sn/c1-5-2-6-3-8-4-7(6)9-5;;;;/h2,4H,1H3;3*1H3;
acs.accounts.7b00050_2
acs.accounts.7b00050_2.mol ChemDraw10252220102D 49 54 0 0 0 0 0 0 0 0999 V2000 0.0026 -4.4377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0026 -3.6163 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.6432 -3.1032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4384 -3.377...
CCCCCCc1cc2c(=C(C#N)C#N)s/c(=c3/s/c(=c4/sc(=C(C#N)C#N)c5cc(CCCCCC)sc45)c4c3C(=O)N(C)C4=O)c2s1
[C][C][C][C][C][C][C][=C][C][C][=Branch1][Branch2][=C][Branch1][Ring1][C][#N][C][#N][S][/C][=Branch2][Branch1][=Branch1][=C][/S][/C][=Branch2][Ring1][#C][=C][/S][C][=Branch1][Branch2][=C][Branch1][Ring1][C][#N][C][#N][C][C][=C][Branch1][#Branch1][C][C][C][C][C][C][S][C][Ring2][Ring1][Ring1][=Ring1][O][C][=C][Ring2][Rin...
InChI=1S/C37H31N5O2S5/c1-4-6-8-10-12-22-14-24-28(20(16-38)17-39)47-34(30(24)45-22)32-26-27(37(44)42(3)36(26)43)33(49-32)35-31-25(29(48-35)21(18-40)19-41)15-23(46-31)13-11-9-7-5-2/h14-15H,4-13H2,1-3H3/b34-32+,35-33+
acs.accounts.7b00050_3
acs.accounts.7b00050_3.mol ChemDraw10172222072D 68 75 0 0 0 0 0 0 0 0999 V2000 -1.0548 2.1603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3918 1.6878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6825 0.8620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3301 0.795...
CCCCCCCCc1cc2/c(=c3\s/c(=C4/C(=O)N(CCCCCCCC)c5ccccc54)c4sc(CCCCCCCC)cc34)s/c(=C3/C(=O)N(CCCCCCCC)c4ccccc43)c2s1
[C][C][C][C][C][C][C][C][C][=C][C][/C][=Branch2][Branch1][=Branch1][=C][\S][/C][=Branch2][Ring1][N][=C][/C][=Branch1][C][=O][N][Branch1][=Branch2][C][C][C][C][C][C][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][Ring2][Ring1][C][C][S][C][Branch1][=Branch2][C][C][C][C][C][C][C][C][=C][C][Ring2][Ring2][C][=Ring1][=N][S][/C]...
InChI=1S/C60H78N2O2S4/c1-5-9-13-17-21-25-33-43-41-47-53(67-57(55(47)65-43)51-45-35-27-29-37-49(45)61(59(51)63)39-31-23-19-15-11-7-3)54-48-42-44(34-26-22-18-14-10-6-2)66-56(48)58(68-54)52-46-36-28-30-38-50(46)62(60(52)64)40-32-24-20-16-12-8-4/h27-30,35-38,41-42H,5-26,31-34,39-40H2,1-4H3/b54-53+,57-51+,58-52+
acs.analchem.0c01918_1
RDKit 2D 14 15 0 0 0 0 0 0 0 0999 V2000 3.1378 -0.7020 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.0194 -1.2285 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.0454 -2.2815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9530 -2.8080 0.0000 C 0 0 0 0...
NNc1cc[n+]([O-])c2cc(Cl)ccc12
[N][N][C][=C][C][=N+1][Branch1][C][O-1][C][=C][C][Branch1][C][Cl][=C][C][=C][Ring1][N][Ring1][#Branch1]
InChI=1S/C9H8ClN3O/c10-6-1-2-7-8(12-11)3-4-13(14)9(7)5-6/h1-5,12H,11H2
acs.analchem.0c01918_2
acs.analchem.0c01918_2.mol ChemDraw10252219412D 15 16 0 0 0 0 0 0 0 0999 V2000 0.9363 0.4529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6645 0.0404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6645 -0.7846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9363 -1.197...
[N-]=[N+]=Nc1cc[n+]([O-])c2cc(Cl)ccc12
[N-1][=N+1][=N][C][=C][C][=N+1][Branch1][C][O-1][C][=C][C][Branch1][C][Cl][=C][C][=C][Ring1][N][Ring1][#Branch1]
InChI=1S/C9H5ClN4O/c10-6-1-2-7-8(12-13-11)3-4-14(15)9(7)5-6/h1-5H
acs.analchem.0c01918_3
RDKit 2D 13 14 0 0 0 0 0 0 0 0999 V2000 5.4138 -5.7260 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4138 -4.4826 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 6.4828 -3.8609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4828 -2.6503 0.0000 C 0 0 0 0...
[O-][n+]1ccc(Cl)c2ccc(Cl)cc21
[O-1][N+1][=C][C][=C][Branch1][C][Cl][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][Ring1][N]
InChI=1S/C9H5Cl2NO/c10-6-1-2-7-8(11)3-4-12(13)9(7)5-6/h1-5H
acs.analchem.8b01879_1
acs.analchem.8b01879_1.mol ChemDraw10172222072D 36 40 0 0 0 0 0 0 0 0999 V2000 -2.1428 -2.7232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5800 -2.1255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8398 -1.3287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3203 -0.731...
CC1(C)C(/C=C/C2=C3Oc4cc(O)ccc4C=C3CCC2)=[N+](CCCCS(=O)(=O)O)c2ccccc21
[C][C][Branch1][C][C][C][Branch2][Ring1][#Branch2][/C][=C][/C][=C][O][C][=C][C][Branch1][C][O][=C][C][=C][Ring1][#Branch1][C][=C][Ring1][O][C][C][C][Ring1][#C][=N+1][Branch1][=N][C][C][C][C][S][=Branch1][C][=O][=Branch1][C][=O][O][C][=C][C][=C][C][=C][Ring1][=Branch1][Ring2][Ring2][Ring1]
InChI=1S/C29H31NO5S/c1-29(2)24-10-3-4-11-25(24)30(16-5-6-17-36(32,33)34)27(29)15-13-20-8-7-9-22-18-21-12-14-23(31)19-26(21)35-28(20)22/h3-4,10-15,18-19H,5-9,16-17H2,1-2H3,(H,32,33,34)/p+1
acs.analchem.8b01879_2
acs.analchem.8b01879_2.mol ChemDraw10172222082D 53 58 0 0 0 0 0 0 0 0999 V2000 -5.2805 -4.1217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7319 -3.4735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0453 -2.6482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4967 -2.117...
CC1(C)C(/C=C/C2=C3Oc4cc(OC(=O)Oc5ccc(CCC(=O)C(F)(F)F)cc5)ccc4C=C3CCC2)=[N+](CCCCS(=O)(=O)O)c2ccccc21
[C][C][Branch1][C][C][C][Branch2][Branch1][O][/C][=C][/C][=C][O][C][=C][C][Branch2][Ring1][#C][O][C][=Branch1][C][=O][O][C][=C][C][=C][Branch1][#C][C][C][C][=Branch1][C][=O][C][Branch1][C][F][Branch1][C][F][F][C][=C][Ring1][=C][=C][C][=C][Ring2][Ring1][Branch2][C][=C][Ring2][Ring1][N][C][C][C][Ring2][Ring1][S][=N+1][Br...
InChI=1S/C40H38F3NO8S/c1-39(2)32-10-3-4-11-33(32)44(22-5-6-23-53(47,48)49)35(39)20-16-27-8-7-9-29-24-28-15-19-31(25-34(28)52-37(27)29)51-38(46)50-30-17-12-26(13-18-30)14-21-36(45)40(41,42)43/h3-4,10-13,15-20,24-25H,5-9,14,21-23H2,1-2H3/p+1/b20-16+
acs.analchem.8b01879_3
acs.analchem.8b01879_3.mol ChemDraw10172222092D 54 60 0 0 0 0 0 0 0 0999 V2000 -5.3051 -3.9563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7919 -3.3084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0117 -2.5524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4988 -1.958...
CC1(C)C(/C=C/C2=C3Oc4cc(OC(=O)Oc5ccc(CCC6(C(F)(F)F)OO6)cc5)ccc4C=C3CCC2)=[N+](CCCCS(=O)(=O)O)c2ccccc21
[C][C][Branch1][C][C][C][Branch2][Branch1][#C][/C][=C][/C][=C][O][C][=C][C][Branch2][Ring2][Ring1][O][C][=Branch1][C][=O][O][C][=C][C][=C][Branch2][Ring1][C][C][C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][O][O][Ring1][#Branch1][C][=C][Ring1][#C][=C][C][=C][Ring2][Ring1][=Branch2][C][=C][Ring2][Ring1][=...
InChI=1S/C40H38F3NO9S/c1-38(2)32-10-3-4-11-33(32)44(22-5-6-23-54(46,47)48)35(38)19-15-27-8-7-9-29-24-28-14-18-31(25-34(28)51-36(27)29)50-37(45)49-30-16-12-26(13-17-30)20-21-39(52-53-39)40(41,42)43/h3-4,10-19,24-25H,5-9,20-23H2,1-2H3/p+1/b19-15+
acs.chemrev.9b00145_1
RDKit 2D 21 23 0 0 0 0 0 0 0 0999 V2000 7.4203 -3.8846 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4203 -2.6350 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 6.3188 -2.0102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3188 -0.7878 0.0000 O 0 0 0 0...
O=C(Nc1ccccc1)c1cc2ccccc2oc1=O
[O][=C][Branch1][#Branch2][N][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][C][=C][Ring1][=Branch1][O][C][Ring1][#Branch2][=O]
InChI=1S/C16H11NO3/c18-15(17-12-7-2-1-3-8-12)13-10-11-6-4-5-9-14(11)20-16(13)19/h1-10H,(H,17,18)
acs.chemrev.9b00145_2
acs.chemrev.9b00145_2.mol ChemDraw10172222092D 31 33 0 0 0 0 0 0 0 0999 V2000 1.7607 0.5796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0780 0.1808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3465 0.5796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3363 0.1808...
CCN(CC)c1ccc2cc(/C=C/C(C#N)C3C(=O)OC(C)(C)OC3=O)c(=O)oc2c1
[C][C][N][Branch1][Ring1][C][C][C][=C][C][=C][C][=C][Branch2][Ring1][#Branch2][/C][=C][/C][Branch1][Ring1][C][#N][C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][O][C][Ring1][=Branch2][=O][C][=Branch1][C][=O][O][C][Ring2][Ring1][=Branch1][=C][Ring2][Ring1][#Branch2]
InChI=1S/C23H24N2O6/c1-5-25(6-2)17-10-9-14-11-15(20(26)29-18(14)12-17)7-8-16(13-24)19-21(27)30-23(3,4)31-22(19)28/h7-12,16,19H,5-6H2,1-4H3/b8-7+
acs.chemrev.9b00145_3
RDKit 2D 31 34 0 0 0 0 0 0 0 0999 V2000 0.2003 -2.5654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2003 -2.2008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4757 -2.0253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5008 -1.6608 0.0000 C 0 0 0 0...
COc1ccc(C#Cc2ccc3cc(C(=O)NCc4ccccn4)c(=O)oc3c2)cc1
[C][O][C][=C][C][=C][Branch2][Ring2][Branch1][C][#C][C][=C][C][=C][C][=C][Branch1][#C][C][=Branch1][C][=O][N][C][C][=C][C][=C][C][=N][Ring1][=Branch1][C][=Branch1][C][=O][O][C][Ring1][P][=C][Ring2][Ring1][Branch1][C][=C][Ring2][Ring1][=N]
InChI=1S/C25H18N2O4/c1-30-21-11-8-17(9-12-21)5-6-18-7-10-19-15-22(25(29)31-23(19)14-18)24(28)27-16-20-4-2-3-13-26-20/h2-4,7-15H,16H2,1H3,(H,27,28)
acs.chemrev.9b00145_4
acs.chemrev.9b00145_4.mol ChemDraw10172222092D 40 44 0 0 0 0 0 0 0 0999 V2000 -5.4986 -0.3949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4986 0.4201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7757 0.8175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0527 0.4201...
CCN(CC)c1ccc2cc(/C=C/c3cc[n+](Cc4ccc(B5OC(C)(C)C(C)(C)O5)cc4)cc3)c(=O)oc2c1
[C][C][N][Branch1][Ring1][C][C][C][=C][C][=C][C][=C][Branch2][Ring2][=C][/C][=C][/C][=C][C][=N+1][Branch2][Ring1][S][C][C][=C][C][=C][Branch2][Ring1][Ring2][B][O][C][Branch1][C][C][Branch1][C][C][C][Branch1][C][C][Branch1][C][C][O][Ring1][=Branch2][C][=C][Ring1][#C][C][=C][Ring2][Ring1][=Branch1][C][=Branch1][C][=O][O]...
InChI=1S/C33H38BN2O4/c1-7-36(8-2)29-16-13-26-21-27(31(37)38-30(26)22-29)12-9-24-17-19-35(20-18-24)23-25-10-14-28(15-11-25)34-39-32(3,4)33(5,6)40-34/h9-22H,7-8,23H2,1-6H3/q+1
acs.chemrev.9b00145_5
acs.chemrev.9b00145_5.mol ChemDraw10252219412D 66 74 0 0 0 0 0 0 0 0999 V2000 -5.8477 -3.1385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8477 -2.3234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1374 -1.9160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4271 -2.3234...
CCN(CC)c1ccc2c(c1)Oc1cc(N(CC)CC)ccc1C21c2cc(C#Cc3ccc(-c4cc5ccc(N(CC)CC)cc5oc4=O)cc3)ccc2C(=O)N1NC(=O)c1ccccc1
[C][C][N][Branch1][Ring1][C][C][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][O][C][=C][C][Branch1][Branch2][N][Branch1][Ring1][C][C][C][C][=C][C][=C][Ring1][O][C][Ring1][S][C][=C][C][Branch2][Ring2][#Branch1][C][#C][C][=C][C][=C][Branch2][Ring1][=Branch2][C][=C][C][=C][C][=C][Branch1][Branch2][N][Branch1][Rin...
InChI=1S/C56H53N5O5/c1-7-58(8-2)42-26-25-41-33-46(55(64)66-50(41)34-42)39-23-20-37(21-24-39)18-19-38-22-29-45-49(32-38)56(61(54(45)63)57-53(62)40-16-14-13-15-17-40)47-30-27-43(59(9-3)10-4)35-51(47)65-52-36-44(28-31-48(52)56)60(11-5)12-6/h13-17,20-36H,7-12H2,1-6H3,(H,57,62)
acs.chemrev.9b00145_6
RDKit 2D 28 32 0 0 0 0 0 0 0 0999 V2000 2.9342 -0.2080 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.9342 -0.6728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3354 -0.9052 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 3.7367 -0.6728 0.0000 C 0 0 0 0...
O=C(NCc1ccccn1)c1cc2cc3c4c(c2oc1=O)CCCN4CCC3
[O][=C][Branch1][O][N][C][C][=C][C][=C][C][=N][Ring1][=Branch1][C][=C][C][=C][C][=C][C][=Branch1][=Branch2][=C][Ring1][=Branch1][O][C][Ring1][#Branch2][=O][C][C][C][N][Ring1][#Branch2][C][C][C][Ring1][=C]
InChI=1S/C22H21N3O3/c26-21(24-13-16-6-1-2-8-23-16)18-12-15-11-14-5-3-9-25-10-4-7-17(19(14)25)20(15)28-22(18)27/h1-2,6,8,11-12H,3-5,7,9-10,13H2,(H,24,26)
acs.chemrev.9b00145_7
RDKit 2D 38 43 0 0 0 0 0 0 0 0999 V2000 0.4879 -0.0791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8132 -0.2532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8335 -0.6172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5083 -0.8071 0.0000 O 0 0 0 0...
C=CC(=O)Oc1ccc2c(c1)Oc1c(ccc3oc(=O)c(C(=O)OCC)cc13)C21OC(=O)c2ccccc21
[C][=C][C][=Branch1][C][=O][O][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][O][C][=C][Branch2][Ring1][=Branch2][C][=C][C][O][C][=Branch1][C][=O][C][Branch1][Branch2][C][=Branch1][C][=O][O][C][C][=C][C][Ring1][S][=Ring1][N][C][Ring2][Ring1][Branch1][O][C][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][...
InChI=1S/C29H18O9/c1-3-24(30)35-15-9-10-20-23(13-15)36-25-17-14-18(26(31)34-4-2)27(32)37-22(17)12-11-21(25)29(20)19-8-6-5-7-16(19)28(33)38-29/h3,5-14H,1,4H2,2H3
acs.chemrev.9b00145_8
acs.chemrev.9b00145_8.mol ChemDraw10252219422D 32 35 0 0 0 0 0 0 0 0999 V2000 0.4746 0.6152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2008 0.2122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8786 0.6152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1208 1.4211...
CCN(CC)c1ccc2cc(C(Cc3sc4ccccc4[n+]3C)S(=O)(=O)[O-])c(=O)oc2c1
[C][C][N][Branch1][Ring1][C][C][C][=C][C][=C][C][=C][Branch2][Ring1][O][C][Branch1][S][C][C][S][C][=C][C][=C][C][=C][Ring1][=Branch1][N+1][=Ring1][=Branch2][C][S][=Branch1][C][=O][=Branch1][C][=O][O-1][C][=Branch1][C][=O][O][C][Ring2][Ring1][#Branch1][=C][Ring2][Ring1][O]
InChI=1S/C23H24N2O5S2/c1-4-25(5-2)16-11-10-15-12-17(23(26)30-19(15)13-16)21(32(27,28)29)14-22-24(3)18-8-6-7-9-20(18)31-22/h6-13,21H,4-5,14H2,1-3H3
acs.chemrev.9b00145_9
acs.chemrev.9b00145_9.mol ChemDraw10252219422D 17 18 0 0 0 0 0 0 0 0999 V2000 -1.0676 0.2129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0676 1.0221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3742 1.4345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3853 1.0221...
CCN(CC)c1ccc2cc(N)c(=O)oc2c1
[C][C][N][Branch1][Ring1][C][C][C][=C][C][=C][C][=C][Branch1][C][N][C][=Branch1][C][=O][O][C][Ring1][Branch2][=C][Ring1][N]
InChI=1S/C13H16N2O2/c1-3-15(4-2)10-6-5-9-7-11(14)13(16)17-12(9)8-10/h5-8H,3-4,14H2,1-2H3
acs.jafc.9b04085_1
RDKit 2D 15 16 0 0 0 0 0 0 0 0999 V2000 4.0199 -1.3622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4229 -1.7337 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.7861 -1.3870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7065 -0.6811 0.0000 N 0 0 0 0...
Sc1nnc(NCNc2nnc(S)s2)s1
[S][C][=N][N][=C][Branch1][=C][N][C][N][C][=N][N][=C][Branch1][C][S][S][Ring1][=Branch1][S][Ring1][=C]
InChI=1S/C5H6N6S4/c12-4-10-8-2(14-4)6-1-7-3-9-11-5(13)15-3/h1H2,(H,6,8)(H,7,9)(H,10,12)(H,11,13)
acs.jafc.9b04085_2
RDKit 2D 15 16 0 0 0 0 0 0 0 0999 V2000 3.2812 -1.4241 0.0000 Cu 0 0 0 0 0 2 0 0 0 0 0 0 2.7738 -1.7352 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 2.2326 -1.4480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1649 -0.8616 0.0000 N 0 0 0 0...
Nc1nnc([S][Cu][S]c2nnc(N)s2)s1
[N][C][=N][N][=C][Branch1][=C][SH0][Cu][SH0][C][=N][N][=C][Branch1][C][N][S][Ring1][=Branch1][S][Ring1][=C]
InChI=1S/2C2H3N3S2.Cu/c2*3-1-4-5-2(6)7-1;/h2*(H2,3,4)(H,5,6);/q;;+2/p-2
acs.jmedchem.0c01021_1
acs.jmedchem.0c01021_1.mol ChemDraw10252219422D 56 62 0 0 0 0 0 0 0 0999 V2000 6.5099 -2.1124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1676 -2.8715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3119 -2.9374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8840 -2.277...
COc1ccc2[nH]cc(CCNC(=O)C(CCC3(CCc4cn(CCCNc5ccc([N+](=O)[O-])c6nonc56)nn4)N=N3)C(=O)CCc3ccc(O)cc3)c2c1
[C][O][C][=C][C][=C][NH1][C][=C][Branch2][=Branch1][=N][C][C][N][C][=Branch1][C][=O][C][Branch2][Ring2][P][C][C][C][Branch2][Ring2][=Branch1][C][C][C][=C][N][Branch2][Ring1][=Branch2][C][C][C][N][C][=C][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][=N][O][N][=C][Ring1][N][Ring1][Branch1][N][=N][Ring2][Ring1][...
InChI=1S/C38H41N11O7/c1-55-28-8-9-31-30(21-28)25(22-41-31)15-19-40-37(52)29(34(51)12-5-24-3-6-27(50)7-4-24)14-17-38(45-46-38)16-13-26-23-48(47-42-26)20-2-18-39-32-10-11-33(49(53)54)36-35(32)43-56-44-36/h3-4,6-11,21-23,29,39,41,50H,2,5,12-20H2,1H3,(H,40,52)
acs.jmedchem.0c01507_1
acs.jmedchem.0c01507_1.mol ChemDraw10252220112D 8 7 0 0 0 0 0 0 0 0999 V2000 -1.4397 0.1949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6896 -0.2099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7138 -1.0345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0121 0.210...
CC(C)C(=O)C(C)C
[C][C][Branch1][C][C][C][=Branch1][C][=O][C][Branch1][C][C][C]
InChI=1S/C7H14O/c1-5(2)7(8)6(3)4/h5-6H,1-4H3
acs.jmedchem.0c01507_2
acs.jmedchem.0c01507_2.mol ChemDraw10252220122D 19 21 0 0 0 0 0 0 0 0999 V2000 2.9740 -0.5925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2848 -0.1743 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.5958 -0.5925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5958 -1.405...
CNC(=O)NCC12CC3(C)CC(C)(CC(C)(C3)C1)C2
[C][N][C][=Branch1][C][=O][N][C][C][C][C][Branch1][C][C][C][C][Branch1][C][C][Branch1][=C][C][C][Branch1][C][C][Branch1][Ring2][C][Ring1][=Branch2][C][Ring1][N][C][Ring1][=N]
InChI=1S/C16H28N2O/c1-13-5-14(2)7-15(3,6-13)10-16(8-13,9-14)11-18-12(19)17-4/h5-11H2,1-4H3,(H2,17,18,19)
acs.jmedchem.0c01507_3
acs.jmedchem.0c01507_3.mol ChemDraw10252219432D 29 30 0 0 0 0 0 0 0 0999 V2000 -2.7950 0.3949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5145 -0.0088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5145 -0.8161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1788 -1.219...
CCC(Cc1ccc(C(=O)NCc2ccc(OC)cc2C(F)(F)F)cc1)C(=O)O
[C][C][C][Branch2][Ring2][Branch2][C][C][=C][C][=C][Branch2][Ring1][O][C][=Branch1][C][=O][N][C][C][=C][C][=C][Branch1][Ring1][O][C][C][=C][Ring1][Branch2][C][Branch1][C][F][Branch1][C][F][F][C][=C][Ring2][Ring1][=Branch1][C][=Branch1][C][=O][O]
InChI=1S/C21H22F3NO4/c1-3-14(20(27)28)10-13-4-6-15(7-5-13)19(26)25-12-16-8-9-17(29-2)11-18(16)21(22,23)24/h4-9,11,14H,3,10,12H2,1-2H3,(H,25,26)(H,27,28)
acs.jmedchem.0c01507_4
RDKit 2D 27 29 0 0 0 0 0 0 0 0999 V2000 5.5406 -1.2727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1166 -1.4909 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.7208 -1.2727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7491 -0.8364 0.0000 N 0 0 0 0...
CNc1nc(C)nc(N2CCC(C(=O)Nc3cc(Br)cc(OC)c3)CC2)n1
[C][N][C][=N][C][Branch1][C][C][=N][C][Branch2][Ring1][P][N][C][C][C][Branch2][Ring1][Branch1][C][=Branch1][C][=O][N][C][=C][C][Branch1][C][Br][=C][C][Branch1][Ring1][O][C][=C][Ring1][=Branch2][C][C][Ring2][Ring1][C][=N][Ring2][Ring1][=Branch2]
InChI=1S/C18H23BrN6O2/c1-11-21-17(20-2)24-18(22-11)25-6-4-12(5-7-25)16(26)23-14-8-13(19)9-15(10-14)27-3/h8-10,12H,4-7H2,1-3H3,(H,23,26)(H,20,21,22,24)
acs.jmedchem.0c01507_5
acs.jmedchem.0c01507_5.mol ChemDraw10252219432D 32 34 0 0 0 0 0 0 0 0999 V2000 -4.6041 -0.4594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8805 -0.8706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1567 -0.4594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4988 -0.850...
CNC(=O)c1cc(Oc2ccc(NC(=O)Nc3ccc(Cl)c(C(F)(F)F)c3)cc2)ccn1
[C][N][C][=Branch1][C][=O][C][=C][C][Branch2][Ring2][=Branch2][O][C][=C][C][=C][Branch2][Ring1][N][N][C][=Branch1][C][=O][N][C][=C][C][=C][Branch1][C][Cl][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][O][C][=C][Ring2][Ring1][Branch1][=C][C][=N][Ring2][Ring1][N]
InChI=1S/C21H16ClF3N4O3/c1-26-19(30)18-11-15(8-9-27-18)32-14-5-2-12(3-6-14)28-20(31)29-13-4-7-17(22)16(10-13)21(23,24)25/h2-11H,1H3,(H,26,30)(H2,28,29,31)
acs.jmedchem.0c01507_6
acs.jmedchem.0c01507_6.mol ChemDraw10252220122D 28 30 0 0 0 0 0 0 0 0999 V2000 -5.4230 1.4595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6574 1.0259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6574 0.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9557 -0.216...
CNC(=O)NCCCOc1ccc(-c2nc3ccc(C)cn3c2NC)cc1C
[C][N][C][=Branch1][C][=O][N][C][C][C][O][C][=C][C][=C][Branch2][Ring1][Ring1][C][N][=C][C][=C][C][Branch1][C][C][=C][N][Ring1][#Branch1][C][=Ring1][#Branch2][N][C][C][=C][Ring2][Ring1][C][C]
InChI=1S/C21H27N5O2/c1-14-6-9-18-25-19(20(22-3)26(18)13-14)16-7-8-17(15(2)12-16)28-11-5-10-24-21(27)23-4/h6-9,12-13,22H,5,10-11H2,1-4H3,(H2,23,24,27)
acs.jmedchem.0c01507_7
acs.jmedchem.0c01507_7.mol ChemDraw10252219432D 25 26 0 0 0 0 0 0 0 0999 V2000 -2.9154 -0.0132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9154 -0.8339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2076 -1.2574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4352 -0.833...
CCC(=O)N1CCC(NC(=O)Nc2ccc(OC(F)(F)F)cc2)CC1
[C][C][C][=Branch1][C][=O][N][C][C][C][Branch2][Ring1][#Branch2][N][C][=Branch1][C][=O][N][C][=C][C][=C][Branch1][#Branch2][O][C][Branch1][C][F][Branch1][C][F][F][C][=C][Ring1][O][C][C][Ring2][Ring1][Branch1]
InChI=1S/C16H20F3N3O3/c1-2-14(23)22-9-7-12(8-10-22)21-15(24)20-11-3-5-13(6-4-11)25-16(17,18)19/h3-6,12H,2,7-10H2,1H3,(H2,20,21,24)
acs.jmedchem.0c01897_1
RDKit 2D 51 57 0 0 0 0 0 0 0 0999 V2000 7.3784 -0.3328 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.2180 -0.5944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3784 -0.8678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2180 -1.1412 0.0000 C 0 0 0 0...
O=C1CCC(N2C(=O)c3cccc(NCCCCCC4CCN(CCNC(=O)c5cc6c(o5)C(=O)c5ccccc5C6=O)CC4)c3C2=O)C(=O)N1
[O][=C][C][C][C][Branch2][=Branch1][=Branch2][N][C][=Branch1][C][=O][C][=C][C][=C][C][Branch2][Branch1][Ring1][N][C][C][C][C][C][C][C][C][N][Branch2][Ring1][P][C][C][N][C][=Branch1][C][=O][C][=C][C][=C][Branch1][Ring2][O][Ring1][Branch1][C][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Ring1][N][=O][C][C][R...
InChI=1S/C38H39N5O8/c44-30-13-12-28(35(47)41-30)43-37(49)25-10-6-11-27(31(25)38(43)50)39-16-5-1-2-7-22-14-18-42(19-15-22)20-17-40-36(48)29-21-26-32(45)23-8-3-4-9-24(23)33(46)34(26)51-29/h3-4,6,8-11,21-22,28,39H,1-2,5,7,12-20H2,(H,40,48)(H,41,44,47)
acs.jmedchem.0c02239_1
RDKit 2D 38 43 0 0 1 0 0 0 0 0999 V2000 1.4286 -2.0509 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6327 -1.6857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7959 -2.1071 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2653 -2.0931 0.0000 C 0 0 0 0...
COC(=O)C[C@H]1[C@]2(C)C3=C(C)[C@H](c4ccoc4)C[C@H]3O[C@@H]2[C@@H]2OC(=O)[C@]3(C)CCC(=O)[C@@]1(C)[C@@H]23
[C][O][C][=Branch1][C][=O][C][C@H1][C@][Branch1][C][C][C][=C][Branch1][C][C][C@H1][Branch1][Branch2][C][C][=C][O][C][=Ring1][Branch1][C][C@H1][Ring1][O][O][C@@H1][Ring1][#C][C@@H1][O][C][=Branch1][C][=O][C@][Branch1][C][C][C][C][C][=Branch1][C][=O][C@@][Ring2][Ring1][O][Branch1][C][C][C@@H1][Ring1][=N][Ring1][=Branch2]
InChI=1S/C27H32O7/c1-13-15(14-7-9-32-12-14)10-16-20(13)27(4)17(11-19(29)31-5)26(3)18(28)6-8-25(2)22(26)21(23(27)33-16)34-24(25)30/h7,9,12,15-17,21-23H,6,8,10-11H2,1-5H3/t15-,16-,17-,21-,22+,23-,25-,26+,27-/m1/s1
acs.jmedchem.0c02261_1
RDKit 2D 34 38 0 0 0 0 0 0 0 0999 V2000 5.0066 -4.8685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5033 -4.8685 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2914 -4.4628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8146 -4.4628 0.0000 C 0 0 0 0...
COc1ccc(CCN2CCC(Nc3nc4ccccc4n3Cc3ccc(F)cc3)CC2)cc1
[C][O][C][=C][C][=C][Branch2][Ring2][=Branch2][C][C][N][C][C][C][Branch2][Ring1][O][N][C][=N][C][=C][C][=C][C][=C][Ring1][=Branch1][N][Ring1][=Branch2][C][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][C][C][Ring2][Ring1][Branch2][C][=C][Ring2][Ring1][S]
InChI=1S/C28H31FN4O/c1-34-25-12-8-21(9-13-25)14-17-32-18-15-24(16-19-32)30-28-31-26-4-2-3-5-27(26)33(28)20-22-6-10-23(29)11-7-22/h2-13,24H,14-20H2,1H3,(H,30,31)
acs.jmedchem.1c00242_1
RDKit 2D 31 35 0 0 1 0 0 0 0 0999 V2000 0.5114 -3.1863 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.7306 -2.8266 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 1.0959 -3.0321 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4612 -2.8266 0.0000 C 0 0 0 0...
NS(=O)(=O)OCC1CC(n2ccc3c(N[C@H]4CCc5ccccc54)ncnc32)C[C@H]1O
[N][S][=Branch1][C][=O][=Branch1][C][=O][O][C][C][C][C][Branch2][Ring1][#C][N][C][=C][C][=C][Branch1][#C][N][C@H1][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][Ring1][=Branch2][N][=C][N][=C][Ring1][S][Ring2][Ring1][Ring1][C][C@H1][Ring2][Ring1][Branch2][O]
InChI=1S/C21H25N5O4S/c22-31(28,29)30-11-14-9-15(10-19(14)27)26-8-7-17-20(23-12-24-21(17)26)25-18-6-5-13-3-1-2-4-16(13)18/h1-4,7-8,12,14-15,18-19,27H,5-6,9-11H2,(H2,22,28,29)(H,23,24,25)/t14?,15?,18-,19+/m0/s1
acs.jmedchem.1c00270_1
acs.jmedchem.1c00270_1.mol ChemDraw10172222122D 53 60 0 0 0 0 0 0 0 0999 V2000 1.7736 -0.4419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0780 -0.9721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3128 -0.6186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3128 -1.148...
CCc1cc2c(cc1N1CCN(C(=O)CNc3cccc4c3C(=O)N(C3CCC(=O)NC3=O)C4=O)CC1)C(C)(C)c1[nH]c3cc(C#N)ccc3c1C2=O
[C][C][C][=C][C][=C][Branch2][Branch1][=Branch1][C][=C][Ring1][=Branch1][N][C][C][N][Branch2][Ring2][=Branch1][C][=Branch1][C][=O][C][N][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=Branch1][C][=O][N][Branch1][=N][C][C][C][C][=Branch1][C][=O][N][C][Ring1][#Branch1][=O][C][Ring1][=C][=O][C][C][Ring2][Ring1][=N][C][Branch1]...
InChI=1S/C40H37N7O6/c1-4-22-17-25-26(40(2,3)36-34(35(25)50)23-9-8-21(19-41)16-28(23)43-36)18-30(22)45-12-14-46(15-13-45)32(49)20-42-27-7-5-6-24-33(27)39(53)47(38(24)52)29-10-11-31(48)44-37(29)51/h5-9,16-18,29,42-43H,4,10-15,20H2,1-3H3,(H,44,48,51)
acs.jmedchem.1c01119_1
RDKit 2D 29 30 0 0 0 0 0 0 0 0999 V2000 1.6387 -1.9880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7297 -1.6145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4339 -1.3614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4794 -1.0000 0.0000 C 0 0 0 0...
CCc1c(C(=O)Nc2cc(S(=O)(=O)N(CC)CC)ccc2O)[nH]c(C)c1C(C)=O
[C][C][C][=C][Branch2][Ring1][#C][C][=Branch1][C][=O][N][C][=C][C][Branch1][#C][S][=Branch1][C][=O][=Branch1][C][=O][N][Branch1][Ring1][C][C][C][C][=C][C][=C][Ring1][=C][O][NH1][C][Branch1][C][C][=C][Ring2][Ring1][Branch2][C][Branch1][C][C][=O]
InChI=1S/C20H27N3O5S/c1-6-15-18(13(5)24)12(4)21-19(15)20(26)22-16-11-14(9-10-17(16)25)29(27,28)23(7-2)8-3/h9-11,21,25H,6-8H2,1-5H3,(H,22,26)
acs.jmedchem.1c01206_1
RDKit 2D 55 62 0 0 0 0 0 0 0 0999 V2000 0.3042 -0.2689 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.3853 -0.4226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5678 -0.4226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6692 -0.5762 0.0000 C 0 0 0 0...
O=C1CCC(N2C(=O)c3cccc(N4CCN(C(=O)C5CCN(c6ccc(NC(=O)c7cnc(Oc8ccccc8)nc7)cc6)CC5)CC4)c3C2=O)C(=O)N1
[O][=C][C][C][C][Branch2][#Branch1][#Branch1][N][C][=Branch1][C][=O][C][=C][C][=C][C][Branch2][Branch1][P][N][C][C][N][Branch2][Branch1][Branch1][C][=Branch1][C][=O][C][C][C][N][Branch2][Ring2][Branch1][C][=C][C][=C][Branch2][Ring1][=Branch2][N][C][=Branch1][C][=O][C][=C][N][=C][Branch1][#Branch2][O][C][=C][C][=C][C][=...
InChI=1S/C40H38N8O7/c49-33-14-13-32(36(51)44-33)48-38(53)30-7-4-8-31(34(30)39(48)54)46-19-21-47(22-20-46)37(52)25-15-17-45(18-16-25)28-11-9-27(10-12-28)43-35(50)26-23-41-40(42-24-26)55-29-5-2-1-3-6-29/h1-12,23-25,32H,13-22H2,(H,43,50)(H,44,49,51)
acs.jmedchem.1c01682_1
RDKit 2D 27 30 0 0 0 0 0 0 0 0999 V2000 8.1028 -2.0069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5270 -1.6571 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.9512 -1.9885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3753 -1.6571 0.0000 C 0 0 0 0...
COc1ccc(Nc2nnc(-c3cccc(-c4ccccc4)c3C)o2)cc1
[C][O][C][=C][C][=C][Branch2][Ring1][S][N][C][=N][N][=C][Branch2][Ring1][Ring2][C][=C][C][=C][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][Ring1][N][C][O][Ring2][Ring1][C][C][=C][Ring2][Ring1][=Branch2]
InChI=1S/C22H19N3O2/c1-15-19(16-7-4-3-5-8-16)9-6-10-20(15)21-24-25-22(27-21)23-17-11-13-18(26-2)14-12-17/h3-14H,1-2H3,(H,23,25)
acs.jmedchem.1c01682_2
RDKit 2D 27 30 0 0 0 0 0 0 0 0999 V2000 10.9474 -1.1731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2175 -0.7495 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.5439 -1.1568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8140 -0.7495 0.0000 C 0 0 0 0...
COc1ccc(Nc2nnc(-c3ccc(-c4ccccc4)c(C)c3)o2)cc1
[C][O][C][=C][C][=C][Branch2][Ring2][C][N][C][=N][N][=C][Branch2][Ring1][=Branch1][C][=C][C][=C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Branch1][C][C][=C][Ring1][=N][O][Ring2][Ring1][C][C][=C][Ring2][Ring1][=Branch2]
InChI=1S/C22H19N3O2/c1-15-14-17(8-13-20(15)16-6-4-3-5-7-16)21-24-25-22(27-21)23-18-9-11-19(26-2)12-10-18/h3-14H,1-2H3,(H,23,25)
acs.jmedchem.1c01714_1
acs.jmedchem.1c01714_1.mol ChemDraw10252220132D 24 26 0 0 0 0 0 0 0 0999 V2000 3.5452 2.0823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8403 1.6536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1354 2.0823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4305 1.653...
CCCc1cc2ncnc(Nc3ccc(C)cc3)c2cc1CCC
[C][C][C][C][=C][C][=N][C][=N][C][Branch1][=N][N][C][=C][C][=C][Branch1][C][C][C][=C][Ring1][#Branch1][=C][Ring1][=C][C][=C][Ring2][Ring1][C][C][C][C]
InChI=1S/C21H25N3/c1-4-6-16-12-19-20(13-17(16)7-5-2)22-14-23-21(19)24-18-10-8-15(3)9-11-18/h8-14H,4-7H2,1-3H3,(H,22,23,24)
acs.jmedchem.1c01714_2
acs.jmedchem.1c01714_2.mol ChemDraw10252219452D 39 44 0 0 1 0 0 0 0 0999 V2000 -1.0592 -1.0655 0.0000 C 0 0 0 0 0 4 0 0 0 0 0 0 -0.8605 -1.8504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3239 -2.5231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1183 -2.523...
Cc1c(NC(=O)OC[C@@H]2COCCN2)cn2ncnc(Nc3ccc4c(cnn4Cc4cccc(F)c4)c3)c12
[C][C][C][Branch1][S][N][C][=Branch1][C][=O][O][C][C@@H1][C][O][C][C][N][Ring1][=Branch1][=C][N][N][=C][N][=C][Branch2][Ring1][=C][N][C][=C][C][=C][C][Branch2][Ring1][C][C][=N][N][Ring1][Branch1][C][C][=C][C][=C][C][Branch1][C][F][=C][Ring1][#Branch1][=C][Ring1][P][C][=Ring2][Ring2][=Branch1][Ring2][Ring1][Branch2]
InChI=1S/C27H27FN8O3/c1-17-23(34-27(37)39-15-22-14-38-8-7-29-22)13-36-25(17)26(30-16-32-36)33-21-5-6-24-19(10-21)11-31-35(24)12-18-3-2-4-20(28)9-18/h2-6,9-11,13,16,22,29H,7-8,12,14-15H2,1H3,(H,34,37)(H,30,32,33)/t22-/m0/s1
acs.jmedchem.1c01714_3
RDKit 2D 34 38 0 0 0 0 0 0 0 0999 V2000 2.3732 -1.5683 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2201 -1.9790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7608 -2.0537 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.4545 -1.6989 0.0000 C 0 0 0 0...
O=C(NCCO)C1=Cc2c(ncnc2Nc2ccc(Oc3cccc4sccc34)cc2)NCC1
[O][=C][Branch1][Branch1][N][C][C][O][C][=C][C][=C][Branch2][Ring1][S][N][=C][N][=C][Ring1][=Branch1][N][C][=C][C][=C][Branch1][#C][O][C][=C][C][=C][C][S][C][=C][C][Ring1][=Branch2][=Ring1][Branch1][C][=C][Ring1][S][N][C][C][Ring2][Ring1][N]
InChI=1S/C25H23N5O3S/c31-12-11-27-25(32)16-8-10-26-23-20(14-16)24(29-15-28-23)30-17-4-6-18(7-5-17)33-21-2-1-3-22-19(21)9-13-34-22/h1-7,9,13-15,31H,8,10-12H2,(H,27,32)(H2,26,28,29,30)
acs.jmedchem.1c01714_4
RDKit 2D 29 31 0 0 0 0 0 0 0 0999 V2000 3.7500 -2.6246 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4000 -2.8265 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0250 -2.6246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6750 -2.8265 0.0000 C 0 0 0 0...
O=C(Nc1ccc(F)c(Cl)c1)c1cc(NCc2cc(O)ccc2O)ccc1O
[O][=C][Branch1][S][N][C][=C][C][=C][Branch1][C][F][C][Branch1][C][Cl][=C][Ring1][Branch2][C][=C][C][Branch1][#C][N][C][C][=C][C][Branch1][C][O][=C][C][=C][Ring1][#Branch1][O][=C][C][=C][Ring1][S][O]
InChI=1S/C20H16ClFN2O4/c21-16-9-13(1-4-17(16)22)24-20(28)15-8-12(2-5-19(15)27)23-10-11-7-14(25)3-6-18(11)26/h1-9,23,25-27H,10H2,(H,24,28)
acs.jmedchem.1c01714_5
RDKit 2D 38 41 0 0 0 0 0 0 0 0999 V2000 2.8947 -2.9045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4211 -2.6291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4211 -2.1283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0000 -1.8779 0.0000 C 0 0 0 0...
Cc1cc(Nc2ncc(Cl)c(Nc3ccccc3S(=O)(=O)C(C)C)n2)c(OC(C)C)cc1C1CCNCC1
[C][C][=C][C][Branch2][Ring2][=Branch1][N][C][=N][C][=C][Branch1][C][Cl][C][Branch2][Ring1][=Branch1][N][C][=C][C][=C][C][=C][Ring1][=Branch1][S][=Branch1][C][=O][=Branch1][C][=O][C][Branch1][C][C][C][=N][Ring2][Ring1][Ring2][=C][Branch1][#Branch1][O][C][Branch1][C][C][C][C][=C][Ring2][Ring1][#C][C][C][C][N][C][C][Ring...
InChI=1S/C28H36ClN5O3S/c1-17(2)37-25-15-21(20-10-12-30-13-11-20)19(5)14-24(25)33-28-31-16-22(29)27(34-28)32-23-8-6-7-9-26(23)38(35,36)18(3)4/h6-9,14-18,20,30H,10-13H2,1-5H3,(H2,31,32,33,34)
acs.jmedchem.1c01714_6
acs.jmedchem.1c01714_6.mol ChemDraw10252219452D 40 44 0 0 0 0 0 0 0 0999 V2000 -3.2013 0.2069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4188 -0.2069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7074 0.2069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9959 -0.206...
Cc1ccc(C(=O)Nc2ccc(CN3CCN(C)CC3)c(C(F)(F)F)c2)cc1NC(=O)c1cnc2[nH]ccc2c1
[C][C][=C][C][=C][Branch2][Ring2][#Branch1][C][=Branch1][C][=O][N][C][=C][C][=C][Branch1][=N][C][N][C][C][N][Branch1][C][C][C][C][Ring1][#Branch1][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][Ring2][Ring1][C][C][=C][Ring2][Ring1][O][N][C][=Branch1][C][=O][C][=C][N][=C][NH1][C][=C][C][Ring1][Branch1][=C...
InChI=1S/C29H29F3N6O2/c1-18-3-4-20(14-25(18)36-28(40)22-13-19-7-8-33-26(19)34-16-22)27(39)35-23-6-5-21(24(15-23)29(30,31)32)17-38-11-9-37(2)10-12-38/h3-8,13-16H,9-12,17H2,1-2H3,(H,33,34)(H,35,39)(H,36,40)
acs.jmedchem.1c01714_7
acs.jmedchem.1c01714_7.mol ChemDraw10252219452D 29 31 0 0 0 0 0 0 0 0999 V2000 1.4139 -0.8622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6236 -0.8622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2284 -0.1380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6236 0.586...
COc1cc(C(=O)n2nc(Nc3ccc(C)cc3)nc2N)cc(OC)c1OC
[C][O][C][=C][C][Branch2][Ring1][O][C][=Branch1][C][=O][N][N][=C][Branch1][=N][N][C][=C][C][=C][Branch1][C][C][C][=C][Ring1][#Branch1][N][=C][Ring1][=N][N][=C][C][Branch1][Ring1][O][C][=C][Ring2][Ring1][Branch2][O][C]
InChI=1S/C19H21N5O4/c1-11-5-7-13(8-6-11)21-19-22-18(20)24(23-19)17(25)12-9-14(26-2)16(28-4)15(10-12)27-3/h5-10H,1-4H3,(H3,20,21,22,23)
acs.jmedchem.1c01714_8
RDKit 2D 29 31 0 0 0 0 0 0 0 0999 V2000 5.5928 -1.4083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1892 -1.1615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7856 -0.9147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7856 -0.4211 0.0000 C 0 0 0 0...
C#Cc1cccc(Nc2ncnc3cc(OCCOC)c(OCCOC)cc23)c1
[C][#C][C][=C][C][=C][C][Branch2][Ring1][#C][N][C][=N][C][=N][C][=C][C][Branch1][=Branch1][O][C][C][O][C][=C][Branch1][=Branch1][O][C][C][O][C][C][=C][Ring2][Ring1][Ring2][Ring1][S][=C][Ring2][Ring1][O]
InChI=1S/C22H23N3O4/c1-4-16-6-5-7-17(12-16)25-22-18-13-20(28-10-8-26-2)21(29-11-9-27-3)14-19(18)23-15-24-22/h1,5-7,12-15H,8-11H2,2-3H3,(H,23,24,25)
acs.jmedchem.1c01714_9
acs.jmedchem.1c01714_9.mol ChemDraw10172222142D 28 30 0 0 0 0 0 0 0 0999 V2000 -0.7173 2.6488 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0194 2.2145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0194 1.3461 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.7173 0.911...
O=C(Nc1ccccc1C(=O)N/N=C/c1ccc(O)cc1O)c1ccco1
[O][=C][Branch2][Ring1][=N][N][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=Branch1][C][=O][N][/N][=C][/C][=C][C][=C][Branch1][C][O][C][=C][Ring1][#Branch1][O][C][=C][C][=C][O][Ring1][Branch1]
InChI=1S/C19H15N3O5/c23-13-8-7-12(16(24)10-13)11-20-22-18(25)14-4-1-2-5-15(14)21-19(26)17-6-3-9-27-17/h1-11,23-24H,(H,21,26)(H,22,25)/b20-11+
End of preview. Expand in Data Studio

Dataset Card for Alpha-Extractor OCSR Benchmark

This dataset is a small, challenging benchmark for Optical Chemical Structure Recognition (OCSR), featuring 200 images. The data is a subset of the test data created for the "αExtractor" system, a tool specifically designed to perform well on difficult images, including those with backgrounds, low quality, and even hand-drawn structures. It serves as an excellent test of model robustness.

Dataset Details

Dataset Description

The Alpha-Extractor OCSR Benchmark is derived from the test data of the αExtractor system, a project by AlphaMa and the Shanghai Institute of Materia Medica (SIMM). The αExtractor recognition model is an enhanced version of a winning entry in the Bristol-Myers Squibb Molecular Translation Kaggle competition, designed for high accuracy on challenging, real-world chemical images.

The original test data collection was created to showcase the system's ability to handle images that conventional OCSR tools often struggle with. This Hugging Face dataset, prepared by Hunter Heidenreich, consists of a 200-image subset from that collection. It has been processed to include not only the source images and MOL files but also derived canonical SMILES, InChI, and SELFIES strings, making it ready for machine learning applications.

  • Curated by: Original data curated by the alpha-Extractor team. This Hugging Face version was prepared by Hunter Heidenreich.
  • License: MIT License.

Dataset Sources

Uses

Direct Use

Given its small size and challenging nature, this dataset is best suited for evaluating the robustness of pre-trained OCSR models. It is ideal for:

  • Testing model performance on non-standard images (e.g., low-quality, hand-drawn).
  • Error analysis to identify weaknesses in an OCSR pipeline.
  • Benchmarking against a set of known difficult cases.

Out-of-Scope Use

This dataset is not suitable for training deep learning models from scratch due to its very small size (200 examples). Using it as a primary training set would lead to severe overfitting. Its specific and challenging composition may not be representative of any single, large-scale document source like patents or journals.

Dataset Structure

The dataset contains a single train split with 200 examples. Each example has the following fields:

  • id (string): A unique identifier for the example.
  • image (image): A PIL-encoded image of the chemical structure.
  • mol (string): The ground truth structure in MOL file format.
  • smiles (string): The canonical SMILES string for the molecule, generated from the mol data using RDKit.
  • selfies (string): The SELFIES representation of the molecule, generated from the smiles string.
  • inchi (string): The standard InChI string for the molecule, generated from the mol data using RDKit.

Dataset Creation

Curation Rationale

The original test data was curated to validate the performance of the αExtractor system, specifically its ability to generalize to diverse and low-quality chemical structure images where other systems might fail. This subset provides a standardized benchmark for these challenging cases.

Source Data

Data Collection and Processing

The source data was collected by the alpha-Extractor team and is available in their public GitHub repository. The repository contains a variety of image types, including standard benchmarks, images from the Bristol-Myers Squibb Kaggle competition, and specially collected examples of low-quality and hand-drawn structures.

This Hugging Face dataset is a 200-image subset of that larger collection. It was prepared by Hunter Heidenreich, who processed the ground truth MOL files using RDKit to generate the corresponding SMILES, InChI, and SELFIES strings.

Who are the source data producers?

The dataset was collected and curated by the research team behind the alpha-Extractor project.

Bias, Risks, and Limitations

  • Extremely Small Size: With only 200 examples, any performance metrics calculated on this dataset should be interpreted with caution, as they may not be statistically significant.
  • Purpose-Built Bias: The dataset was likely curated to contain a high proportion of "hard" examples to highlight the strengths of a particular model. It is therefore not a random or representative sample of chemical images.
  • Unknown Composition: The exact breakdown of image types (e.g., how many are hand-drawn vs. low-quality) within this 200-image subset is not specified.

Recommendations

Use this dataset strictly for evaluation and robustness testing. It is a valuable tool for identifying failure modes in OCSR models but should not be used to draw broad conclusions about a model's overall performance without considering results from larger, more balanced benchmarks.

Citation

If you use this dataset, please cite the original αExtractor paper and this Hugging Face dataset to ensure reproducibility.

BibTeX:

@article{zhang2022extractor,
  title={αExtractor: a system for automatic extraction of chemical information from biomedical literature},
  author={Zhang, Rui and Chen, Zerun and Liu, Zaiyi and Zhang, Yanli and Wang, Xiaohong and Ai, Haitao and Liu, Jing and Du, Yong and Li, Youyong and Zhu, Weiliang},
  journal={Journal of Cheminformatics},
  volume={14},
  number={1},
  pages={64},
  year={2022},
  publisher={Springer}
}

@misc{huggingface_dataset_alphaextractor,
  author = {Heidenreich, Hunter},
  title = {Alpha-Extractor OCSR Benchmark},
  year = {2025},
  publisher = {Hugging Face},
  journal = {Hugging Face repository},
  howpublished = {\url{[https://huggingface.co/datasets/hheiden/alpha-extractor_OCSR_benchmark](https://huggingface.co/datasets/hheiden/alpha-extractor_OCSR_benchmark)}}
}
Downloads last month
11

Collection including hheiden/Colored_Background_OCSR_benchmark