ChemX
Collection
A Collection of Chemistry Datasets for Benchmarking Automated Information Extraction. More info at https://github.com/ai-chem/ChemX • 10 items • Updated
smiles string | doi string | title string | publisher string | year int64 | access int64 | compound_id string | target_type string | target_relation string | target_value string | target_units string | bacteria string | bacteria_unified string | page_bacteria int64 | origin_bacteria string | section_bacteria string | subsection_bacteria string | page_target int64 | origin_target string | section_target string | subsection_target string | page_scaffold int64 | origin_scaffold string | page_residue float64 | origin_residue string | pdf string |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
CCOC(=O)C1=C(Cn2cnc3ccccc32)NC(=O)NC1c1ccco1 | 10.1002/cjoc.202200326 | A New Discovery towards Novel Skeleton of <scp>Benzimidazole‐Conjugated</scp> Pyrimidinones as Unique Effective Antibacterial Agents | Wiley | 2,022 | 0 | 5a | MIC | '=' | 64 | µg/mL | E. c. 25922 | Escherichia coli | 4 | table 1 | null | null | 4 | table 1 | null | null | 3 | scheme 1 | 3 | scheme 1 | cjoc.202200326 |
CCOC(=O)C1=C(Cn2cnc3ccccc32)NC(=O)NC1c1cccs1 | 10.1002/cjoc.202200326 | A New Discovery towards Novel Skeleton of <scp>Benzimidazole‐Conjugated</scp> Pyrimidinones as Unique Effective Antibacterial Agents | Wiley | 2,022 | 0 | 5b | MIC | '=' | 32 | µg/mL | E. c. 25922 | Escherichia coli | 4 | table 1 | null | null | 4 | table 1 | null | null | 3 | scheme 1 | 3 | scheme 1 | cjoc.202200326 |
CCOC(=O)C1=C(Cn2cnc3ccccc32)NC(=O)NC1c1sccc1C | 10.1002/cjoc.202200326 | A New Discovery towards Novel Skeleton of <scp>Benzimidazole‐Conjugated</scp> Pyrimidinones as Unique Effective Antibacterial Agents | Wiley | 2,022 | 0 | 5c | MIC | '=' | 32 | µg/mL | E. c. 25922 | Escherichia coli | 4 | table 1 | null | null | 4 | table 1 | null | null | 3 | scheme 1 | 3 | scheme 1 | cjoc.202200326 |
CCOC(=O)C1=C(Cn2cnc3cc(Br)ccc32)NC(=O)NC1c1cccs1 | 10.1002/cjoc.202200326 | A New Discovery towards Novel Skeleton of <scp>Benzimidazole‐Conjugated</scp> Pyrimidinones as Unique Effective Antibacterial Agents | Wiley | 2,022 | 0 | 6a | MIC | '=' | 16 | µg/mL | E. c. 25922 | Escherichia coli | 4 | table 1 | null | null | 4 | table 1 | null | null | 3 | scheme 1 | 3 | scheme 1 | cjoc.202200326 |
CCOC(=O)C1=C(Cn2cnc3ccc([N+](=O)[O-])cc32)NC(=O)NC1c1cccs1 | 10.1002/cjoc.202200326 | A New Discovery towards Novel Skeleton of <scp>Benzimidazole‐Conjugated</scp> Pyrimidinones as Unique Effective Antibacterial Agents | Wiley | 2,022 | 0 | 6b | MIC | '=' | 16 | µg/mL | E. c. 25922 | Escherichia coli | 4 | table 1 | null | null | 4 | table 1 | null | null | 3 | scheme 1 | 3 | scheme 1 | cjoc.202200326 |
CCOC(=O)C1=C(Cn2cnc3ccc(Cl)cc32)NC(=O)NC1c1cccs1 | 10.1002/cjoc.202200326 | A New Discovery towards Novel Skeleton of <scp>Benzimidazole‐Conjugated</scp> Pyrimidinones as Unique Effective Antibacterial Agents | Wiley | 2,022 | 0 | 6c | MIC | '=' | 32 | µg/mL | E. c. 25922 | Escherichia coli | 4 | table 1 | null | null | 4 | table 1 | null | null | 3 | scheme 1 | 3 | scheme 1 | cjoc.202200326 |
CCOC(=O)C1=C(Cn2cnc3cc(C)c(C)cc32)NC(=O)NC1c1cccs1 | 10.1002/cjoc.202200326 | A New Discovery towards Novel Skeleton of <scp>Benzimidazole‐Conjugated</scp> Pyrimidinones as Unique Effective Antibacterial Agents | Wiley | 2,022 | 0 | 6d | MIC | '=' | 64 | µg/mL | E. c. 25922 | Escherichia coli | 4 | table 1 | null | null | 4 | table 1 | null | null | 3 | scheme 1 | 3 | scheme 1 | cjoc.202200326 |
CCOC(=O)C1=C(Cn2cnc3cc(Br)ccc32)NC(=O)NC1c1sccc1C | 10.1002/cjoc.202200326 | A New Discovery towards Novel Skeleton of <scp>Benzimidazole‐Conjugated</scp> Pyrimidinones as Unique Effective Antibacterial Agents | Wiley | 2,022 | 0 | 6e | MIC | '=' | 4 | µg/mL | E. c. 25922 | Escherichia coli | 4 | table 1 | null | null | 4 | table 1 | null | null | 3 | scheme 1 | 3 | scheme 1 | cjoc.202200326 |
CCOC(=O)C1=C(Cn2cnc3ccc([N+](=O)[O-])cc32)NC(=O)NC1c1sccc1C | 10.1002/cjoc.202200326 | A New Discovery towards Novel Skeleton of <scp>Benzimidazole‐Conjugated</scp> Pyrimidinones as Unique Effective Antibacterial Agents | Wiley | 2,022 | 0 | 6f | MIC | '=' | 16 | µg/mL | E. c. 25922 | Escherichia coli | 4 | table 1 | null | null | 4 | table 1 | null | null | 3 | scheme 1 | 3 | scheme 1 | cjoc.202200326 |
CCOC(=O)C1=C(Cn2cnc3ccc(Cl)cc32)NC(=O)NC1c1sccc1C | 10.1002/cjoc.202200326 | A New Discovery towards Novel Skeleton of <scp>Benzimidazole‐Conjugated</scp> Pyrimidinones as Unique Effective Antibacterial Agents | Wiley | 2,022 | 0 | 6g | MIC | '=' | 64 | µg/mL | E. c. 25922 | Escherichia coli | 4 | table 1 | null | null | 4 | table 1 | null | null | 3 | scheme 1 | 3 | scheme 1 | cjoc.202200326 |
CCOC(=O)C1=C(Cn2cnc3cc(C)c(C)cc32)NC(=O)NC1c1sccc1C | 10.1002/cjoc.202200326 | A New Discovery towards Novel Skeleton of <scp>Benzimidazole‐Conjugated</scp> Pyrimidinones as Unique Effective Antibacterial Agents | Wiley | 2,022 | 0 | 6h | MIC | '=' | 16 | µg/mL | E. c. 25922 | Escherichia coli | 4 | table 1 | null | null | 4 | table 1 | null | null | 3 | scheme 1 | 3 | scheme 1 | cjoc.202200326 |
CCOC(=O)C1=C(Cn2cnc3cc(Br)ccc32)NC(=O)NC1c1cccc(F)c1 | 10.1002/cjoc.202200326 | A New Discovery towards Novel Skeleton of <scp>Benzimidazole‐Conjugated</scp> Pyrimidinones as Unique Effective Antibacterial Agents | Wiley | 2,022 | 0 | 9a | MIC | '=' | 16 | µg/mL | E. c. 25922 | Escherichia coli | 4 | table 1 | null | null | 4 | table 1 | null | null | 3 | scheme 2 | 3 | scheme 2 | cjoc.202200326 |
CCOC(=O)C1=C(Cn2cnc3cc(Br)ccc32)NC(=O)NC1c1ccc(F)cc1 | 10.1002/cjoc.202200326 | A New Discovery towards Novel Skeleton of <scp>Benzimidazole‐Conjugated</scp> Pyrimidinones as Unique Effective Antibacterial Agents | Wiley | 2,022 | 0 | 9b | MIC | '=' | 2 | µg/mL | E. c. 25922 | Escherichia coli | 4 | table 1 | null | null | 4 | table 1 | null | null | 3 | scheme 2 | 3 | scheme 2 | cjoc.202200326 |
CCOC(=O)C1=C(Cn2cnc3cc(Br)ccc32)NC(=O)NC1c1ccc(F)cc1F | 10.1002/cjoc.202200326 | A New Discovery towards Novel Skeleton of <scp>Benzimidazole‐Conjugated</scp> Pyrimidinones as Unique Effective Antibacterial Agents | Wiley | 2,022 | 0 | 9c | MIC | '=' | 4 | µg/mL | E. c. 25922 | Escherichia coli | 4 | table 1 | null | null | 4 | table 1 | null | null | 3 | scheme 2 | 3 | scheme 2 | cjoc.202200326 |
CCOC(=O)C1=C(Cn2cnc3cc(Br)ccc32)NC(=O)NC1c1ccc(C(F)(F)F)cc1 | 10.1002/cjoc.202200326 | A New Discovery towards Novel Skeleton of <scp>Benzimidazole‐Conjugated</scp> Pyrimidinones as Unique Effective Antibacterial Agents | Wiley | 2,022 | 0 | 9d | MIC | '=' | 2 | µg/mL | E. c. 25922 | Escherichia coli | 4 | table 1 | null | null | 4 | table 1 | null | null | 3 | scheme 2 | 3 | scheme 2 | cjoc.202200326 |
CCOC(=O)C1=C(Cn2cnc3cc(Br)ccc32)NC(=O)NC1c1cccc(Cl)c1 | 10.1002/cjoc.202200326 | A New Discovery towards Novel Skeleton of <scp>Benzimidazole‐Conjugated</scp> Pyrimidinones as Unique Effective Antibacterial Agents | Wiley | 2,022 | 0 | 9e | MIC | '=' | 2 | µg/mL | E. c. 25922 | Escherichia coli | 4 | table 1 | null | null | 4 | table 1 | null | null | 3 | scheme 2 | 3 | scheme 2 | cjoc.202200326 |
CCOC(=O)C1=C(Cn2cnc3cc(Br)ccc32)NC(=O)NC1c1ccc(Cl)cc1 | 10.1002/cjoc.202200326 | A New Discovery towards Novel Skeleton of <scp>Benzimidazole‐Conjugated</scp> Pyrimidinones as Unique Effective Antibacterial Agents | Wiley | 2,022 | 0 | 9f | MIC | '=' | 2 | µg/mL | E. c. 25922 | Escherichia coli | 4 | table 1 | null | null | 4 | table 1 | null | null | 3 | scheme 2 | 3 | scheme 2 | cjoc.202200326 |
CCOC(=O)C1=C(Cn2cnc3cc(Br)ccc32)NC(=O)NC1c1ccc(Cl)cc1Cl | 10.1002/cjoc.202200326 | A New Discovery towards Novel Skeleton of <scp>Benzimidazole‐Conjugated</scp> Pyrimidinones as Unique Effective Antibacterial Agents | Wiley | 2,022 | 0 | 9g | MIC | '=' | 8 | µg/mL | E. c. 25922 | Escherichia coli | 4 | table 1 | null | null | 4 | table 1 | null | null | 3 | scheme 2 | 3 | scheme 2 | cjoc.202200326 |
CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCN(c4ncccn4)CC3)cc21 | 10.1016/j.bmcl.2022.128885 | Pyrimidine-conjugated fluoroquinolones as new potential broad-spectrum antibacterial agents | Elsevier BV | 2,022 | 0 | 1a | MIC | '=' | 64 | µg/mL | E. C. 25922 | Escherichia coli | 3 | table 1 | null | null | 3 | table 1 | null | null | 3 | figure 2 | 3 | figure 2 | j.bmcl.2022.128885 |
CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCN(c4nccc(C)n4)CC3)cc21 | 10.1016/j.bmcl.2022.128885 | Pyrimidine-conjugated fluoroquinolones as new potential broad-spectrum antibacterial agents | Elsevier BV | 2,022 | 0 | 1b | MIC | '=' | 1 | µg/mL | E. C. 25922 | Escherichia coli | 3 | table 1 | null | null | 3 | table 1 | null | null | 3 | figure 2 | 3 | figure 2 | j.bmcl.2022.128885 |
CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCN(c4nccc(N)n4)CC3)cc21 | 10.1016/j.bmcl.2022.128885 | Pyrimidine-conjugated fluoroquinolones as new potential broad-spectrum antibacterial agents | Elsevier BV | 2,022 | 0 | 1c | MIC | '=' | 16 | µg/mL | E. C. 25922 | Escherichia coli | 3 | table 1 | null | null | 3 | table 1 | null | null | 3 | figure 2 | 3 | figure 2 | j.bmcl.2022.128885 |
CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCN(c4nccc(C(F)(F)F)n4)CC3)cc21 | 10.1016/j.bmcl.2022.128885 | Pyrimidine-conjugated fluoroquinolones as new potential broad-spectrum antibacterial agents | Elsevier BV | 2,022 | 0 | 1d | MIC | '=' | 256 | µg/mL | E. C. 25922 | Escherichia coli | 3 | table 1 | null | null | 3 | table 1 | null | null | 3 | figure 2 | 3 | figure 2 | j.bmcl.2022.128885 |
CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCN(c4ncc(C)cn4)CC3)cc21 | 10.1016/j.bmcl.2022.128885 | Pyrimidine-conjugated fluoroquinolones as new potential broad-spectrum antibacterial agents | Elsevier BV | 2,022 | 0 | 1e | MIC | '=' | 2 | µg/mL | E. C. 25922 | Escherichia coli | 3 | table 1 | null | null | 3 | table 1 | null | null | 3 | figure 2 | 3 | figure 2 | j.bmcl.2022.128885 |
CCc1cnc(N2CCN(c3cc4c(cc3F)c(=O)c(C(=O)O)cn4CC)CC2)nc1 | 10.1016/j.bmcl.2022.128885 | Pyrimidine-conjugated fluoroquinolones as new potential broad-spectrum antibacterial agents | Elsevier BV | 2,022 | 0 | 1f | MIC | '=' | 1 | µg/mL | E. C. 25922 | Escherichia coli | 3 | table 1 | null | null | 3 | table 1 | null | null | 3 | figure 2 | 3 | figure 2 | j.bmcl.2022.128885 |
CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCN(c4ncc(OC)cn4)CC3)cc21 | 10.1016/j.bmcl.2022.128885 | Pyrimidine-conjugated fluoroquinolones as new potential broad-spectrum antibacterial agents | Elsevier BV | 2,022 | 0 | 1g | MIC | '=' | 2 | µg/mL | E. C. 25922 | Escherichia coli | 3 | table 1 | null | null | 3 | table 1 | null | null | 3 | figure 2 | 3 | figure 2 | j.bmcl.2022.128885 |
CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCN(c4ncc(F)cn4)CC3)cc21 | 10.1016/j.bmcl.2022.128885 | Pyrimidine-conjugated fluoroquinolones as new potential broad-spectrum antibacterial agents | Elsevier BV | 2,022 | 0 | 1h | MIC | '=' | 128 | µg/mL | E. C. 25922 | Escherichia coli | 3 | table 1 | null | null | 3 | table 1 | null | null | 3 | figure 2 | 3 | figure 2 | j.bmcl.2022.128885 |
CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCN(c4ncc(Br)cn4)CC3)cc21 | 10.1016/j.bmcl.2022.128885 | Pyrimidine-conjugated fluoroquinolones as new potential broad-spectrum antibacterial agents | Elsevier BV | 2,022 | 0 | 1i | MIC | '=' | 128 | µg/mL | E. C. 25922 | Escherichia coli | 3 | table 1 | null | null | 3 | table 1 | null | null | 3 | figure 2 | 3 | figure 2 | j.bmcl.2022.128885 |
O=C(O)c1cn(C2CC2)c2cc(N3CCN(c4ncccn4)CC3)c(F)cc2c1=O | 10.1016/j.bmcl.2022.128885 | Pyrimidine-conjugated fluoroquinolones as new potential broad-spectrum antibacterial agents | Elsevier BV | 2,022 | 0 | 1j | MIC | '=' | 1 | µg/mL | E. C. 25922 | Escherichia coli | 3 | table 1 | null | null | 3 | table 1 | null | null | 3 | figure 2 | 3 | figure 2 | j.bmcl.2022.128885 |
Cc1ccnc(N2CCN(c3cc4c(cc3F)c(=O)c(C(=O)O)cn4C3CC3)CC2)n1 | 10.1016/j.bmcl.2022.128885 | Pyrimidine-conjugated fluoroquinolones as new potential broad-spectrum antibacterial agents | Elsevier BV | 2,022 | 0 | 1k | MIC | '=' | 8 | µg/mL | E. C. 25922 | Escherichia coli | 3 | table 1 | null | null | 3 | table 1 | null | null | 3 | figure 2 | 3 | figure 2 | j.bmcl.2022.128885 |
O=C(O)c1cn(C2CC2)c2cc(N3CCN(c4nccc(C(F)(F)F)n4)CC3)c(F)cc2c1=O | 10.1016/j.bmcl.2022.128885 | Pyrimidine-conjugated fluoroquinolones as new potential broad-spectrum antibacterial agents | Elsevier BV | 2,022 | 0 | 1l | MIC | '=' | 32 | µg/mL | E. C. 25922 | Escherichia coli | 3 | table 1 | null | null | 3 | table 1 | null | null | 3 | figure 2 | 3 | figure 2 | j.bmcl.2022.128885 |
Cc1cnc(N2CCN(c3cc4c(cc3F)c(=O)c(C(=O)O)cn4C3CC3)CC2)nc1 | 10.1016/j.bmcl.2022.128885 | Pyrimidine-conjugated fluoroquinolones as new potential broad-spectrum antibacterial agents | Elsevier BV | 2,022 | 0 | 1m | MIC | '=' | 8 | µg/mL | E. C. 25922 | Escherichia coli | 3 | table 1 | null | null | 3 | table 1 | null | null | 3 | figure 2 | 3 | figure 2 | j.bmcl.2022.128885 |
CCc1cnc(N2CCN(c3cc4c(cc3F)c(=O)c(C(=O)O)cn4C3CC3)CC2)nc1 | 10.1016/j.bmcl.2022.128885 | Pyrimidine-conjugated fluoroquinolones as new potential broad-spectrum antibacterial agents | Elsevier BV | 2,022 | 0 | 1n | MIC | '=' | 4 | µg/mL | E. C. 25922 | Escherichia coli | 3 | table 1 | null | null | 3 | table 1 | null | null | 3 | figure 2 | 3 | figure 2 | j.bmcl.2022.128885 |
COc1cnc(N2CCN(c3cc4c(cc3F)c(=O)c(C(=O)O)cn4C3CC3)CC2)nc1 | 10.1016/j.bmcl.2022.128885 | Pyrimidine-conjugated fluoroquinolones as new potential broad-spectrum antibacterial agents | Elsevier BV | 2,022 | 0 | 1o | MIC | '=' | 4 | µg/mL | E. C. 25922 | Escherichia coli | 3 | table 1 | null | null | 3 | table 1 | null | null | 3 | figure 2 | 3 | figure 2 | j.bmcl.2022.128885 |
O=C(O)c1cn(C2CC2)c2cc(N3CCN(c4ncc(F)cn4)CC3)c(F)cc2c1=O | 10.1016/j.bmcl.2022.128885 | Pyrimidine-conjugated fluoroquinolones as new potential broad-spectrum antibacterial agents | Elsevier BV | 2,022 | 0 | 1p | MIC | '=' | 8 | µg/mL | E. C. 25922 | Escherichia coli | 3 | table 1 | null | null | 3 | table 1 | null | null | 3 | figure 2 | 3 | figure 2 | j.bmcl.2022.128885 |
O=C(O)c1cn(C2CC2)c2cc(N3CCN(c4ncc(Br)cn4)CC3)c(F)cc2c1=O | 10.1016/j.bmcl.2022.128885 | Pyrimidine-conjugated fluoroquinolones as new potential broad-spectrum antibacterial agents | Elsevier BV | 2,022 | 0 | 1q | MIC | '=' | 128 | µg/mL | E. C. 25922 | Escherichia coli | 3 | table 1 | null | null | 3 | table 1 | null | null | 3 | figure 2 | 3 | figure 2 | j.bmcl.2022.128885 |
CCOC(=O)C1=C(Cn2cnc3ccccc32)NC(=O)NC1c1ccco1 | 10.1002/cjoc.202200326 | A New Discovery towards Novel Skeleton of <scp>Benzimidazole‐Conjugated</scp> Pyrimidinones as Unique Effective Antibacterial Agents | Wiley | 2,022 | 0 | 5a | MIC | '=' | 128 | µg/mL | E. c. | Escherichia coli | 4 | table 1 | null | null | 4 | table 1 | null | null | 3 | scheme 1 | 3 | scheme 1 | cjoc.202200326 |
CCOC(=O)C1=C(Cn2cnc3ccccc32)NC(=O)NC1c1cccs1 | 10.1002/cjoc.202200326 | A New Discovery towards Novel Skeleton of <scp>Benzimidazole‐Conjugated</scp> Pyrimidinones as Unique Effective Antibacterial Agents | Wiley | 2,022 | 0 | 5b | MIC | '=' | 64 | µg/mL | E. c. | Escherichia coli | 4 | table 1 | null | null | 4 | table 1 | null | null | 3 | scheme 1 | 3 | scheme 1 | cjoc.202200326 |
CCOC(=O)C1=C(Cn2cnc3ccccc32)NC(=O)NC1c1sccc1C | 10.1002/cjoc.202200326 | A New Discovery towards Novel Skeleton of <scp>Benzimidazole‐Conjugated</scp> Pyrimidinones as Unique Effective Antibacterial Agents | Wiley | 2,022 | 0 | 5c | MIC | '=' | 64 | µg/mL | E. c. | Escherichia coli | 4 | table 1 | null | null | 4 | table 1 | null | null | 3 | scheme 1 | 3 | scheme 1 | cjoc.202200326 |
CCOC(=O)C1=C(Cn2cnc3cc(Br)ccc32)NC(=O)NC1c1cccs1 | 10.1002/cjoc.202200326 | A New Discovery towards Novel Skeleton of <scp>Benzimidazole‐Conjugated</scp> Pyrimidinones as Unique Effective Antibacterial Agents | Wiley | 2,022 | 0 | 6a | MIC | '=' | 64 | µg/mL | E. c. | Escherichia coli | 4 | table 1 | null | null | 4 | table 1 | null | null | 3 | scheme 1 | 3 | scheme 1 | cjoc.202200326 |
CCOC(=O)C1=C(Cn2cnc3ccc([N+](=O)[O-])cc32)NC(=O)NC1c1cccs1 | 10.1002/cjoc.202200326 | A New Discovery towards Novel Skeleton of <scp>Benzimidazole‐Conjugated</scp> Pyrimidinones as Unique Effective Antibacterial Agents | Wiley | 2,022 | 0 | 6b | MIC | '=' | 32 | µg/mL | E. c. | Escherichia coli | 4 | table 1 | null | null | 4 | table 1 | null | null | 3 | scheme 1 | 3 | scheme 1 | cjoc.202200326 |
CCOC(=O)C1=C(Cn2cnc3ccc(Cl)cc32)NC(=O)NC1c1cccs1 | 10.1002/cjoc.202200326 | A New Discovery towards Novel Skeleton of <scp>Benzimidazole‐Conjugated</scp> Pyrimidinones as Unique Effective Antibacterial Agents | Wiley | 2,022 | 0 | 6c | MIC | '=' | 16 | µg/mL | E. c. | Escherichia coli | 4 | table 1 | null | null | 4 | table 1 | null | null | 3 | scheme 1 | 3 | scheme 1 | cjoc.202200326 |
CCOC(=O)C1=C(Cn2cnc3cc(C)c(C)cc32)NC(=O)NC1c1cccs1 | 10.1002/cjoc.202200326 | A New Discovery towards Novel Skeleton of <scp>Benzimidazole‐Conjugated</scp> Pyrimidinones as Unique Effective Antibacterial Agents | Wiley | 2,022 | 0 | 6d | MIC | '=' | 128 | µg/mL | E. c. | Escherichia coli | 4 | table 1 | null | null | 4 | table 1 | null | null | 3 | scheme 1 | 3 | scheme 1 | cjoc.202200326 |
CCOC(=O)C1=C(Cn2cnc3cc(Br)ccc32)NC(=O)NC1c1sccc1C | 10.1002/cjoc.202200326 | A New Discovery towards Novel Skeleton of <scp>Benzimidazole‐Conjugated</scp> Pyrimidinones as Unique Effective Antibacterial Agents | Wiley | 2,022 | 0 | 6e | MIC | '=' | 16 | µg/mL | E. c. | Escherichia coli | 4 | table 1 | null | null | 4 | table 1 | null | null | 3 | scheme 1 | 3 | scheme 1 | cjoc.202200326 |
CCOC(=O)C1=C(Cn2cnc3ccc([N+](=O)[O-])cc32)NC(=O)NC1c1sccc1C | 10.1002/cjoc.202200326 | A New Discovery towards Novel Skeleton of <scp>Benzimidazole‐Conjugated</scp> Pyrimidinones as Unique Effective Antibacterial Agents | Wiley | 2,022 | 0 | 6f | MIC | '=' | 32 | µg/mL | E. c. | Escherichia coli | 4 | table 1 | null | null | 4 | table 1 | null | null | 3 | scheme 1 | 3 | scheme 1 | cjoc.202200326 |
CCOC(=O)C1=C(Cn2cnc3ccc(Cl)cc32)NC(=O)NC1c1sccc1C | 10.1002/cjoc.202200326 | A New Discovery towards Novel Skeleton of <scp>Benzimidazole‐Conjugated</scp> Pyrimidinones as Unique Effective Antibacterial Agents | Wiley | 2,022 | 0 | 6g | MIC | '=' | 64 | µg/mL | E. c. | Escherichia coli | 4 | table 1 | null | null | 4 | table 1 | null | null | 3 | scheme 1 | 3 | scheme 1 | cjoc.202200326 |
CCOC(=O)C1=C(Cn2cnc3cc(C)c(C)cc32)NC(=O)NC1c1sccc1C | 10.1002/cjoc.202200326 | A New Discovery towards Novel Skeleton of <scp>Benzimidazole‐Conjugated</scp> Pyrimidinones as Unique Effective Antibacterial Agents | Wiley | 2,022 | 0 | 6h | MIC | '=' | 32 | µg/mL | E. c. | Escherichia coli | 4 | table 1 | null | null | 4 | table 1 | null | null | 3 | scheme 1 | 3 | scheme 1 | cjoc.202200326 |
CCOC(=O)C1=C(Cn2cnc3cc(Br)ccc32)NC(=O)NC1c1cccc(F)c1 | 10.1002/cjoc.202200326 | A New Discovery towards Novel Skeleton of <scp>Benzimidazole‐Conjugated</scp> Pyrimidinones as Unique Effective Antibacterial Agents | Wiley | 2,022 | 0 | 9a | MIC | '=' | 64 | µg/mL | E. c. | Escherichia coli | 4 | table 1 | null | null | 4 | table 1 | null | null | 3 | scheme 2 | 3 | scheme 2 | cjoc.202200326 |
CCOC(=O)C1=C(Cn2cnc3cc(Br)ccc32)NC(=O)NC1c1ccc(F)cc1 | 10.1002/cjoc.202200326 | A New Discovery towards Novel Skeleton of <scp>Benzimidazole‐Conjugated</scp> Pyrimidinones as Unique Effective Antibacterial Agents | Wiley | 2,022 | 0 | 9b | MIC | '=' | 32 | µg/mL | E. c. | Escherichia coli | 4 | table 1 | null | null | 4 | table 1 | null | null | 3 | scheme 2 | 3 | scheme 2 | cjoc.202200326 |
CCOC(=O)C1=C(Cn2cnc3cc(Br)ccc32)NC(=O)NC1c1ccc(F)cc1F | 10.1002/cjoc.202200326 | A New Discovery towards Novel Skeleton of <scp>Benzimidazole‐Conjugated</scp> Pyrimidinones as Unique Effective Antibacterial Agents | Wiley | 2,022 | 0 | 9c | MIC | '=' | 64 | µg/mL | E. c. | Escherichia coli | 4 | table 1 | null | null | 4 | table 1 | null | null | 3 | scheme 2 | 3 | scheme 2 | cjoc.202200326 |
CCOC(=O)C1=C(Cn2cnc3cc(Br)ccc32)NC(=O)NC1c1ccc(C(F)(F)F)cc1 | 10.1002/cjoc.202200326 | A New Discovery towards Novel Skeleton of <scp>Benzimidazole‐Conjugated</scp> Pyrimidinones as Unique Effective Antibacterial Agents | Wiley | 2,022 | 0 | 9d | MIC | '=' | 64 | µg/mL | E. c. | Escherichia coli | 4 | table 1 | null | null | 4 | table 1 | null | null | 3 | scheme 2 | 3 | scheme 2 | cjoc.202200326 |
CCOC(=O)C1=C(Cn2cnc3cc(Br)ccc32)NC(=O)NC1c1cccc(Cl)c1 | 10.1002/cjoc.202200326 | A New Discovery towards Novel Skeleton of <scp>Benzimidazole‐Conjugated</scp> Pyrimidinones as Unique Effective Antibacterial Agents | Wiley | 2,022 | 0 | 9e | MIC | '=' | 16 | µg/mL | E. c. | Escherichia coli | 4 | table 1 | null | null | 4 | table 1 | null | null | 3 | scheme 2 | 3 | scheme 2 | cjoc.202200326 |
CCOC(=O)C1=C(Cn2cnc3cc(Br)ccc32)NC(=O)NC1c1ccc(Cl)cc1 | 10.1002/cjoc.202200326 | A New Discovery towards Novel Skeleton of <scp>Benzimidazole‐Conjugated</scp> Pyrimidinones as Unique Effective Antibacterial Agents | Wiley | 2,022 | 0 | 9f | MIC | '=' | 128 | µg/mL | E. c. | Escherichia coli | 4 | table 1 | null | null | 4 | table 1 | null | null | 3 | scheme 2 | 3 | scheme 2 | cjoc.202200326 |
CCOC(=O)C1=C(Cn2cnc3cc(Br)ccc32)NC(=O)NC1c1ccc(Cl)cc1Cl | 10.1002/cjoc.202200326 | A New Discovery towards Novel Skeleton of <scp>Benzimidazole‐Conjugated</scp> Pyrimidinones as Unique Effective Antibacterial Agents | Wiley | 2,022 | 0 | 9g | MIC | '=' | 64 | µg/mL | E. c. | Escherichia coli | 4 | table 1 | null | null | 4 | table 1 | null | null | 3 | scheme 2 | 3 | scheme 2 | cjoc.202200326 |
CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCN(c4ncccn4)CC3)cc21 | 10.1016/j.bmcl.2022.128885 | Pyrimidine-conjugated fluoroquinolones as new potential broad-spectrum antibacterial agents | Elsevier BV | 2,022 | 0 | 1a | MIC | '=' | 16 | µg/mL | E. C. | Escherichia coli | 3 | table 1 | null | null | 3 | table 1 | null | null | 3 | figure 2 | 3 | figure 2 | j.bmcl.2022.128885 |
CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCN(c4nccc(C)n4)CC3)cc21 | 10.1016/j.bmcl.2022.128885 | Pyrimidine-conjugated fluoroquinolones as new potential broad-spectrum antibacterial agents | Elsevier BV | 2,022 | 0 | 1b | MIC | '=' | 64 | µg/mL | E. C. | Escherichia coli | 3 | table 1 | null | null | 3 | table 1 | null | null | 3 | figure 2 | 3 | figure 2 | j.bmcl.2022.128885 |
CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCN(c4nccc(N)n4)CC3)cc21 | 10.1016/j.bmcl.2022.128885 | Pyrimidine-conjugated fluoroquinolones as new potential broad-spectrum antibacterial agents | Elsevier BV | 2,022 | 0 | 1c | MIC | '=' | 4 | µg/mL | E. C. | Escherichia coli | 3 | table 1 | null | null | 3 | table 1 | null | null | 3 | figure 2 | 3 | figure 2 | j.bmcl.2022.128885 |
CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCN(c4nccc(C(F)(F)F)n4)CC3)cc21 | 10.1016/j.bmcl.2022.128885 | Pyrimidine-conjugated fluoroquinolones as new potential broad-spectrum antibacterial agents | Elsevier BV | 2,022 | 0 | 1d | MIC | > | 256 | µg/mL | E. C. | Escherichia coli | 3 | table 1 | null | null | 3 | table 1 | null | null | 3 | figure 2 | 3 | figure 2 | j.bmcl.2022.128885 |
CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCN(c4ncc(C)cn4)CC3)cc21 | 10.1016/j.bmcl.2022.128885 | Pyrimidine-conjugated fluoroquinolones as new potential broad-spectrum antibacterial agents | Elsevier BV | 2,022 | 0 | 1e | MIC | '=' | 16 | µg/mL | E. C. | Escherichia coli | 3 | table 1 | null | null | 3 | table 1 | null | null | 3 | figure 2 | 3 | figure 2 | j.bmcl.2022.128885 |
CCc1cnc(N2CCN(c3cc4c(cc3F)c(=O)c(C(=O)O)cn4CC)CC2)nc1 | 10.1016/j.bmcl.2022.128885 | Pyrimidine-conjugated fluoroquinolones as new potential broad-spectrum antibacterial agents | Elsevier BV | 2,022 | 0 | 1f | MIC | '=' | 16 | µg/mL | E. C. | Escherichia coli | 3 | table 1 | null | null | 3 | table 1 | null | null | 3 | figure 2 | 3 | figure 2 | j.bmcl.2022.128885 |
CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCN(c4ncc(OC)cn4)CC3)cc21 | 10.1016/j.bmcl.2022.128885 | Pyrimidine-conjugated fluoroquinolones as new potential broad-spectrum antibacterial agents | Elsevier BV | 2,022 | 0 | 1g | MIC | '=' | 64 | µg/mL | E. C. | Escherichia coli | 3 | table 1 | null | null | 3 | table 1 | null | null | 3 | figure 2 | 3 | figure 2 | j.bmcl.2022.128885 |
CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCN(c4ncc(F)cn4)CC3)cc21 | 10.1016/j.bmcl.2022.128885 | Pyrimidine-conjugated fluoroquinolones as new potential broad-spectrum antibacterial agents | Elsevier BV | 2,022 | 0 | 1h | MIC | '=' | 16 | µg/mL | E. C. | Escherichia coli | 3 | table 1 | null | null | 3 | table 1 | null | null | 3 | figure 2 | 3 | figure 2 | j.bmcl.2022.128885 |
CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCN(c4ncc(Br)cn4)CC3)cc21 | 10.1016/j.bmcl.2022.128885 | Pyrimidine-conjugated fluoroquinolones as new potential broad-spectrum antibacterial agents | Elsevier BV | 2,022 | 0 | 1i | MIC | '=' | 64 | µg/mL | E. C. | Escherichia coli | 3 | table 1 | null | null | 3 | table 1 | null | null | 3 | figure 2 | 3 | figure 2 | j.bmcl.2022.128885 |
O=C(O)c1cn(C2CC2)c2cc(N3CCN(c4ncccn4)CC3)c(F)cc2c1=O | 10.1016/j.bmcl.2022.128885 | Pyrimidine-conjugated fluoroquinolones as new potential broad-spectrum antibacterial agents | Elsevier BV | 2,022 | 0 | 1j | MIC | '=' | 8 | µg/mL | E. C. | Escherichia coli | 3 | table 1 | null | null | 3 | table 1 | null | null | 3 | figure 2 | 3 | figure 2 | j.bmcl.2022.128885 |
Cc1ccnc(N2CCN(c3cc4c(cc3F)c(=O)c(C(=O)O)cn4C3CC3)CC2)n1 | 10.1016/j.bmcl.2022.128885 | Pyrimidine-conjugated fluoroquinolones as new potential broad-spectrum antibacterial agents | Elsevier BV | 2,022 | 0 | 1k | MIC | '=' | 64 | µg/mL | E. C. | Escherichia coli | 3 | table 1 | null | null | 3 | table 1 | null | null | 3 | figure 2 | 3 | figure 2 | j.bmcl.2022.128885 |
O=C(O)c1cn(C2CC2)c2cc(N3CCN(c4nccc(C(F)(F)F)n4)CC3)c(F)cc2c1=O | 10.1016/j.bmcl.2022.128885 | Pyrimidine-conjugated fluoroquinolones as new potential broad-spectrum antibacterial agents | Elsevier BV | 2,022 | 0 | 1l | MIC | '=' | 128 | µg/mL | E. C. | Escherichia coli | 3 | table 1 | null | null | 3 | table 1 | null | null | 3 | figure 2 | 3 | figure 2 | j.bmcl.2022.128885 |
Cc1cnc(N2CCN(c3cc4c(cc3F)c(=O)c(C(=O)O)cn4C3CC3)CC2)nc1 | 10.1016/j.bmcl.2022.128885 | Pyrimidine-conjugated fluoroquinolones as new potential broad-spectrum antibacterial agents | Elsevier BV | 2,022 | 0 | 1m | MIC | '=' | 64 | µg/mL | E. C. | Escherichia coli | 3 | table 1 | null | null | 3 | table 1 | null | null | 3 | figure 2 | 3 | figure 2 | j.bmcl.2022.128885 |
CCc1cnc(N2CCN(c3cc4c(cc3F)c(=O)c(C(=O)O)cn4C3CC3)CC2)nc1 | 10.1016/j.bmcl.2022.128885 | Pyrimidine-conjugated fluoroquinolones as new potential broad-spectrum antibacterial agents | Elsevier BV | 2,022 | 0 | 1n | MIC | '=' | 8 | µg/mL | E. C. | Escherichia coli | 3 | table 1 | null | null | 3 | table 1 | null | null | 3 | figure 2 | 3 | figure 2 | j.bmcl.2022.128885 |
COc1cnc(N2CCN(c3cc4c(cc3F)c(=O)c(C(=O)O)cn4C3CC3)CC2)nc1 | 10.1016/j.bmcl.2022.128885 | Pyrimidine-conjugated fluoroquinolones as new potential broad-spectrum antibacterial agents | Elsevier BV | 2,022 | 0 | 1o | MIC | '=' | 64 | µg/mL | E. C. | Escherichia coli | 3 | table 1 | null | null | 3 | table 1 | null | null | 3 | figure 2 | 3 | figure 2 | j.bmcl.2022.128885 |
O=C(O)c1cn(C2CC2)c2cc(N3CCN(c4ncc(F)cn4)CC3)c(F)cc2c1=O | 10.1016/j.bmcl.2022.128885 | Pyrimidine-conjugated fluoroquinolones as new potential broad-spectrum antibacterial agents | Elsevier BV | 2,022 | 0 | 1p | MIC | '=' | 128 | µg/mL | E. C. | Escherichia coli | 3 | table 1 | null | null | 3 | table 1 | null | null | 3 | figure 2 | 3 | figure 2 | j.bmcl.2022.128885 |
O=C(O)c1cn(C2CC2)c2cc(N3CCN(c4ncc(Br)cn4)CC3)c(F)cc2c1=O | 10.1016/j.bmcl.2022.128885 | Pyrimidine-conjugated fluoroquinolones as new potential broad-spectrum antibacterial agents | Elsevier BV | 2,022 | 0 | 1q | MIC | '=' | 64 | µg/mL | E. C. | Escherichia coli | 3 | table 1 | null | null | 3 | table 1 | null | null | 3 | figure 2 | 3 | figure 2 | j.bmcl.2022.128885 |
Cc1cc(C)nc(NS(=O)(=O)c2ccc(-n3cc(CSc4nc5ccccc5[nH]4)nn3)cc2)n1 | 10.3390/antibiotics12071220 | Benzimidazole-Triazole Hybrids as Antimicrobial and Antiviral Agents: A Systematic Review | MDPI AG | 2,023 | 1 | 6a | MIC | '=' | 128 | µg mL-1 | E.c. | null | 5 | table 1 | null | null | 5 | table 1 | null | null | 5 | scheme 2 | 5 | scheme 2 | antibiotics12071220 |
O=S(=O)(Nc1ncccn1)c1ccc(-n2cc(CSc3nc4ccccc4[nH]3)nn2)cc1 | 10.3390/antibiotics12071220 | Benzimidazole-Triazole Hybrids as Antimicrobial and Antiviral Agents: A Systematic Review | MDPI AG | 2,023 | 1 | 6b | MIC | '=' | 128 | µg mL-1 | E.c. | null | 5 | table 1 | null | null | 5 | table 1 | null | null | 5 | scheme 2 | 5 | scheme 2 | antibiotics12071220 |
O=S(=O)(Nc1ccccn1)c1ccc(-n2cc(CSc3nc4ccccc4[nH]3)nn2)cc1 | 10.3390/antibiotics12071220 | Benzimidazole-Triazole Hybrids as Antimicrobial and Antiviral Agents: A Systematic Review | MDPI AG | 2,023 | 1 | 6c | MIC | '=' | 64 | µg mL-1 | E.c. | null | 5 | table 1 | null | null | 5 | table 1 | null | null | 5 | scheme 2 | 5 | scheme 2 | antibiotics12071220 |
O=S(=O)(Nc1nccs1)c1ccc(-n2cc(CSc3nc4ccccc4[nH]3)nn2)cc1 | 10.3390/antibiotics12071220 | Benzimidazole-Triazole Hybrids as Antimicrobial and Antiviral Agents: A Systematic Review | MDPI AG | 2,023 | 1 | 6d | MIC | '=' | 64 | µg mL-1 | E.c. | null | 5 | table 1 | null | null | 5 | table 1 | null | null | 5 | scheme 2 | 5 | scheme 2 | antibiotics12071220 |
Cc1noc(NS(=O)(=O)c2ccc(-n3cc(CSc4nc5ccccc5[nH]4)nn3)cc2)c1C | 10.3390/antibiotics12071220 | Benzimidazole-Triazole Hybrids as Antimicrobial and Antiviral Agents: A Systematic Review | MDPI AG | 2,023 | 1 | 6e | MIC | '=' | 64 | µg mL-1 | E.c. | null | 5 | table 1 | null | null | 5 | table 1 | null | null | 5 | scheme 2 | 5 | scheme 2 | antibiotics12071220 |
N=C(N)NS(=O)(=O)c1ccc(-n2cc(CSc3nc4ccccc4[nH]3)nn2)cc1 | 10.3390/antibiotics12071220 | Benzimidazole-Triazole Hybrids as Antimicrobial and Antiviral Agents: A Systematic Review | MDPI AG | 2,023 | 1 | 6f | MIC | '=' | 256 | µg mL-1 | E.c. | null | 5 | table 1 | null | null | 5 | table 1 | null | null | 5 | scheme 2 | 5 | scheme 2 | antibiotics12071220 |
CC1Cc2ccccc2N1C(=O)Cn1cc(Cn2c(-c3ccccn3)nc3ccccc32)nn1 | 10.3390/antibiotics12071220 | Benzimidazole-Triazole Hybrids as Antimicrobial and Antiviral Agents: A Systematic Review | MDPI AG | 2,023 | 1 | 35a | MIC | '=' | 0,056 | µmol mL-1 | E. coli | Escherichia coli | 10 | table 3 | null | null | 10 | table 3 | null | null | 10 | scheme 8 | 10 | scheme 8 | antibiotics12071220 |
O=C(Cn1cc(Cn2cnc3ccccc32)nn1)N1CCc2ccc([N+](=O)[O-])cc21 | 10.3390/antibiotics12071220 | Benzimidazole-Triazole Hybrids as Antimicrobial and Antiviral Agents: A Systematic Review | MDPI AG | 2,023 | 1 | 35b | MIC | '=' | 0,062 | µmol mL-1 | E. coli | Escherichia coli | 10 | table 3 | null | null | 10 | table 3 | null | null | 10 | scheme 8 | 10 | scheme 8 | antibiotics12071220 |
Cc1cc2ncn(Cc3cn(CC(=O)N4CCc5ccc([N+](=O)[O-])cc54)nn3)c2cc1C | 10.3390/antibiotics12071220 | Benzimidazole-Triazole Hybrids as Antimicrobial and Antiviral Agents: A Systematic Review | MDPI AG | 2,023 | 1 | 35c | MIC | '=' | 0,058 | µmol mL-1 | E. coli | Escherichia coli | 10 | table 3 | null | null | 10 | table 3 | null | null | 10 | scheme 8 | 10 | scheme 8 | antibiotics12071220 |
Cc1nc2ccccc2n1Cc1cn(CC(=O)N2CCc3ccc([N+](=O)[O-])cc32)nn1 | 10.3390/antibiotics12071220 | Benzimidazole-Triazole Hybrids as Antimicrobial and Antiviral Agents: A Systematic Review | MDPI AG | 2,023 | 1 | 35d | MIC | '=' | 0,03 | µmol mL-1 | E. coli | Escherichia coli | 10 | table 3 | null | null | 10 | table 3 | null | null | 10 | scheme 8 | 10 | scheme 8 | antibiotics12071220 |
CSc1nc2ccccc2n1Cc1cn(CC(=O)N2CCc3ccc([N+](=O)[O-])cc32)nn1 | 10.3390/antibiotics12071220 | Benzimidazole-Triazole Hybrids as Antimicrobial and Antiviral Agents: A Systematic Review | MDPI AG | 2,023 | 1 | 35e | MIC | '=' | 0,056 | µmol mL-1 | E. coli | Escherichia coli | 10 | table 3 | null | null | 10 | table 3 | null | null | 10 | scheme 8 | 10 | scheme 8 | antibiotics12071220 |
O=C(Cn1cc(Cn2c(-c3ccccc3)nc3ccccc32)nn1)N1CCc2ccc([N+](=O)[O-])cc21 | 10.3390/antibiotics12071220 | Benzimidazole-Triazole Hybrids as Antimicrobial and Antiviral Agents: A Systematic Review | MDPI AG | 2,023 | 1 | 35f | MIC | '=' | 0,052 | µmol mL-1 | E. coli | Escherichia coli | 10 | table 3 | null | null | 10 | table 3 | null | null | 10 | scheme 8 | 10 | scheme 8 | antibiotics12071220 |
O=C(Cn1cc(Cn2c(-c3ccccn3)nc3ccccc32)nn1)N1CCc2ccc([N+](=O)[O-])cc21 | 10.3390/antibiotics12071220 | Benzimidazole-Triazole Hybrids as Antimicrobial and Antiviral Agents: A Systematic Review | MDPI AG | 2,023 | 1 | 35g | MIC | '=' | 0,026 | µmol mL-1 | E. coli | Escherichia coli | 10 | table 3 | null | null | 10 | table 3 | null | null | 10 | scheme 8 | 10 | scheme 8 | antibiotics12071220 |
CSc1nnc(Cn2c(CSc3ccccc3)nc3ccccc32)n1-c1ccccc1 | 10.3390/antibiotics12071220 | Benzimidazole-Triazole Hybrids as Antimicrobial and Antiviral Agents: A Systematic Review | MDPI AG | 2,023 | 1 | 107a | MIC | '=' | 62 | µg mL-1 | E. coli | null | 24 | table 9 | null | null | 24 | table 9 | null | null | 25 | scheme 27 | 25 | scheme 27 | antibiotics12071220 |
CCSc1nnc(Cn2c(CSc3ccccc3)nc3ccccc32)n1-c1ccccc1 | 10.3390/antibiotics12071220 | Benzimidazole-Triazole Hybrids as Antimicrobial and Antiviral Agents: A Systematic Review | MDPI AG | 2,023 | 1 | 107b | MIC | '=' | 72 | µg mL-1 | E. coli | null | 24 | table 9 | null | null | 24 | table 9 | null | null | 25 | scheme 27 | 25 | scheme 27 | antibiotics12071220 |
O=C(Cn1cc(Cn2cnc3ccccc32)nn1)N1CCc2ccccc21 | 10.1007/s11696-022-02436-1 | Synthesis, antimicrobial and α-glucosidase inhibition of new benzimidazole-1,2,3-triazole-indoline derivatives: a combined experimental and computational venture | Springer Science and Business Media LLC | 2,022 | 0 | 5a | MIC | '=' | 0,07 | µmol/mL | E. coli | Escherichia coli | 11 | table 3 | null | null | 11 | table 3 | null | null | 4 | scheme 3 | 5 | table 1 | s11696-022-02436-1 |
Cc1cc2ncn(Cc3cn(CC(=O)N4CCc5ccccc54)nn3)c2cc1C | 10.1007/s11696-022-02436-1 | Synthesis, antimicrobial and α-glucosidase inhibition of new benzimidazole-1,2,3-triazole-indoline derivatives: a combined experimental and computational venture | Springer Science and Business Media LLC | 2,022 | 0 | 5b | MIC | '=' | 0,065 | µmol/mL | E. coli | Escherichia coli | 11 | table 3 | null | null | 11 | table 3 | null | null | 4 | scheme 3 | 5 | table 1 | s11696-022-02436-1 |
Cc1nc2ccccc2n1Cc1cn(CC(=O)N2CCc3ccccc32)nn1 | 10.1007/s11696-022-02436-1 | Synthesis, antimicrobial and α-glucosidase inhibition of new benzimidazole-1,2,3-triazole-indoline derivatives: a combined experimental and computational venture | Springer Science and Business Media LLC | 2,022 | 0 | 5c | MIC | '=' | 0,067 | µmol/mL | E. coli | Escherichia coli | 11 | table 3 | null | null | 11 | table 3 | null | null | 4 | scheme 3 | 5 | table 1 | s11696-022-02436-1 |
CSc1nc2ccccc2n1Cc1cn(CC(=O)N2CCc3ccccc32)nn1 | 10.1007/s11696-022-02436-1 | Synthesis, antimicrobial and α-glucosidase inhibition of new benzimidazole-1,2,3-triazole-indoline derivatives: a combined experimental and computational venture | Springer Science and Business Media LLC | 2,022 | 0 | 5d | MIC | '=' | 0,062 | µmol/mL | E. coli | Escherichia coli | 11 | table 3 | null | null | 11 | table 3 | null | null | 4 | scheme 3 | 5 | table 1 | s11696-022-02436-1 |
O=C(Cn1cc(Cn2c(-c3ccccc3)nc3ccccc32)nn1)N1CCc2ccccc21 | 10.1007/s11696-022-02436-1 | Synthesis, antimicrobial and α-glucosidase inhibition of new benzimidazole-1,2,3-triazole-indoline derivatives: a combined experimental and computational venture | Springer Science and Business Media LLC | 2,022 | 0 | 5e | MIC | '=' | 0,058 | µmol/mL | E. coli | Escherichia coli | 11 | table 3 | null | null | 11 | table 3 | null | null | 4 | scheme 3 | 5 | table 1 | s11696-022-02436-1 |
O=C(Cn1cc(Cn2c(-c3ccccn3)nc3ccccc32)nn1)N1CCc2ccccc21 | 10.1007/s11696-022-02436-1 | Synthesis, antimicrobial and α-glucosidase inhibition of new benzimidazole-1,2,3-triazole-indoline derivatives: a combined experimental and computational venture | Springer Science and Business Media LLC | 2,022 | 0 | 5f | MIC | '=' | 0,057 | µmol/mL | E. coli | Escherichia coli | 11 | table 3 | null | null | 11 | table 3 | null | null | 4 | scheme 3 | 5 | table 1 | s11696-022-02436-1 |
CC1Cc2ccccc2N1C(=O)Cn1cc(Cn2cnc3ccccc32)nn1 | 10.1007/s11696-022-02436-1 | Synthesis, antimicrobial and α-glucosidase inhibition of new benzimidazole-1,2,3-triazole-indoline derivatives: a combined experimental and computational venture | Springer Science and Business Media LLC | 2,022 | 0 | 5g | MIC | '=' | 0,067 | µmol/mL | E. coli | Escherichia coli | 11 | table 3 | null | null | 11 | table 3 | null | null | 4 | scheme 3 | 5 | table 1 | s11696-022-02436-1 |
Cc1cc2ncn(Cc3cn(CC(=O)N4c5ccccc5CC4C)nn3)c2cc1C | 10.1007/s11696-022-02436-1 | Synthesis, antimicrobial and α-glucosidase inhibition of new benzimidazole-1,2,3-triazole-indoline derivatives: a combined experimental and computational venture | Springer Science and Business Media LLC | 2,022 | 0 | 5h | MIC | '=' | 0,063 | µmol/mL | E. coli | Escherichia coli | 11 | table 3 | null | null | 11 | table 3 | null | null | 4 | scheme 3 | 5 | table 1 | s11696-022-02436-1 |
Cc1nc2ccccc2n1Cc1cn(CC(=O)N2c3ccccc3CC2C)nn1 | 10.1007/s11696-022-02436-1 | Synthesis, antimicrobial and α-glucosidase inhibition of new benzimidazole-1,2,3-triazole-indoline derivatives: a combined experimental and computational venture | Springer Science and Business Media LLC | 2,022 | 0 | 5i | MIC | '=' | 0,065 | µmol/mL | E. coli | Escherichia coli | 11 | table 3 | null | null | 11 | table 3 | null | null | 4 | scheme 3 | 5 | table 1 | s11696-022-02436-1 |
CSc1nc2ccccc2n1Cc1cn(CC(=O)N2c3ccccc3CC2C)nn1 | 10.1007/s11696-022-02436-1 | Synthesis, antimicrobial and α-glucosidase inhibition of new benzimidazole-1,2,3-triazole-indoline derivatives: a combined experimental and computational venture | Springer Science and Business Media LLC | 2,022 | 0 | 5j | MIC | '=' | 0,06 | µmol/mL | E. coli | Escherichia coli | 11 | table 3 | null | null | 11 | table 3 | null | null | 4 | scheme 3 | 5 | table 1 | s11696-022-02436-1 |
CC1Cc2ccccc2N1C(=O)Cn1cc(Cn2c(-c3ccccc3)nc3ccccc32)nn1 | 10.1007/s11696-022-02436-1 | Synthesis, antimicrobial and α-glucosidase inhibition of new benzimidazole-1,2,3-triazole-indoline derivatives: a combined experimental and computational venture | Springer Science and Business Media LLC | 2,022 | 0 | 5k | MIC | '=' | 0,056 | µmol/mL | E. coli | Escherichia coli | 11 | table 3 | null | null | 11 | table 3 | null | null | 4 | scheme 3 | 5 | table 1 | s11696-022-02436-1 |
CC1Cc2ccccc2N1C(=O)Cn1cc(Cn2c(-c3ccccn3)nc3ccccc32)nn1 | 10.1007/s11696-022-02436-1 | Synthesis, antimicrobial and α-glucosidase inhibition of new benzimidazole-1,2,3-triazole-indoline derivatives: a combined experimental and computational venture | Springer Science and Business Media LLC | 2,022 | 0 | 5l | MIC | '=' | 0,056 | µmol/mL | E. coli | Escherichia coli | 11 | table 3 | null | null | 11 | table 3 | null | null | 4 | scheme 3 | 5 | table 1 | s11696-022-02436-1 |
O=C(Cn1cc(Cn2cnc3ccccc32)nn1)N1CCc2ccc([N+](=O)[O-])cc21 | 10.1007/s11696-022-02436-1 | Synthesis, antimicrobial and α-glucosidase inhibition of new benzimidazole-1,2,3-triazole-indoline derivatives: a combined experimental and computational venture | Springer Science and Business Media LLC | 2,022 | 0 | 5m | MIC | '=' | 0,062 | µmol/mL | E. coli | Escherichia coli | 11 | table 3 | null | null | 11 | table 3 | null | null | 4 | scheme 3 | 5 | table 1 | s11696-022-02436-1 |
Cc1cc2ncn(Cc3cn(CC(=O)N4CCc5ccc([N+](=O)[O-])cc54)nn3)c2cc1C | 10.1007/s11696-022-02436-1 | Synthesis, antimicrobial and α-glucosidase inhibition of new benzimidazole-1,2,3-triazole-indoline derivatives: a combined experimental and computational venture | Springer Science and Business Media LLC | 2,022 | 0 | 5n | MIC | '=' | 0,058 | µmol/mL | E. coli | Escherichia coli | 11 | table 3 | null | null | 11 | table 3 | null | null | 4 | scheme 3 | 5 | table 1 | s11696-022-02436-1 |
Cc1nc2ccccc2n1Cc1cn(CC(=O)N2CCc3ccc([N+](=O)[O-])cc32)nn1 | 10.1007/s11696-022-02436-1 | Synthesis, antimicrobial and α-glucosidase inhibition of new benzimidazole-1,2,3-triazole-indoline derivatives: a combined experimental and computational venture | Springer Science and Business Media LLC | 2,022 | 0 | 5o | MIC | '=' | 0,03 | µmol/mL | E. coli | Escherichia coli | 11 | table 3 | null | null | 11 | table 3 | null | null | 4 | scheme 3 | 5 | table 1 | s11696-022-02436-1 |
End of preview. Expand in Data Studio
Information about the dataset is detailed in the documentation:
https://ai-chem.github.io/ChemX/overview/datasets_description.html
You can find the Croissant file in our GitHub repository:
https://github.com/ai-chem/ChemX/tree/main/datasets/croissants
- Downloads last month
- 6