image imagewidth (px) 781 2.34k | question stringlengths 24 302 | choices listlengths 4 4 | answer int32 0 3 | meta_info dict | question_type stringclasses 6
values |
|---|---|---|---|---|---|
Among the four routes shown in the figure, which route is the shortest? How many steps does it have? | [
"Route B from retrosynthetic analysis using Reaxys is the shortest, with 5 steps",
"Route D from retrosynthetic analysis using Synthia is the shortest, with 7 steps",
"Route C from retrosynthetic analysis using CAS ChemPlanner is the shortest, with 4 steps",
"Route A from retrosynthetic analysis using Reaxys ... | 0 | {
"title": "Computer-Aided Retrosynthesis for Greener and Optimal Total Synthesis of a Helicase-Primase Inhibitor Active Pharmaceutical Ingredient",
"journal": "JACS AU",
"doi": "10.1021/jacsau.4c00624",
"url": "https://pubs.acs.org/doi/10.1021/jacsau.4c00624"
} | 4 | |
In Forward Route C, intermediate C9 is treated with FeCl2 to obtain C12. What chemical transformation primarily occurs in this step? What is the role of FeCl2? | [
"Tert-butyl azidoformate (C11) in the presence of ferrous chloride forms a metal nitrene intermediate with concomitant release of N2, followed by imination of the thioether to give C12",
"Tert-butyl azidoformate (C11) undergoes single-electron reduction by FeCl2 to generate a nitrogen-centered radical with concom... | 0 | {
"title": "Computer-Aided Retrosynthesis for Greener and Optimal Total Synthesis of a Helicase-Primase Inhibitor Active Pharmaceutical Ingredient",
"journal": "JACS AU",
"doi": "10.1021/jacsau.4c00624",
"url": "https://pubs.acs.org/doi/10.1021/jacsau.4c00624"
} | 1 | |
In Route A, during the sulfide oxidation step in the synthesis of IM-204, which major oxidant is used? | [
"Sodium periodate (NaIO4)",
"Trifluoroacetic acid (TFA/ DCM)",
"PhI(OAc)2 and NH4(NH2COO)",
"Sodium methanethiolate (MeSNa)"
] | 0 | {
"title": "Computer-Aided Retrosynthesis for Greener and Optimal Total Synthesis of a Helicase-Primase Inhibitor Active Pharmaceutical Ingredient",
"journal": "JACS AU",
"doi": "10.1021/jacsau.4c00624",
"url": "https://pubs.acs.org/doi/10.1021/jacsau.4c00624"
} | 0 | |
In the synthesis of IM-204 in Figure A, what strategy is used to connect the two substituted phenyl rings? | [
"Use a Heck coupling to connect the two substituted phenyl rings",
"Use a C-N coupling to connect the two substituted phenyl rings",
"Use a Suzuki coupling to connect the two substituted phenyl rings",
"Use an Ullmann coupling to connect the two substituted phenyl rings"
] | 2 | {
"title": "Computer-Aided Retrosynthesis for Greener and Optimal Total Synthesis of a Helicase-Primase Inhibitor Active Pharmaceutical Ingredient",
"journal": "JACS AU",
"doi": "10.1021/jacsau.4c00624",
"url": "https://pubs.acs.org/doi/10.1021/jacsau.4c00624"
} | 0 | |
What is the E-SMILES of the final product? | [
"Cc1nc(N(C)C(=O)Cc2ccc(-c3cc(Br)ccc3F)cc2)sc1S(C)(=N)=O<sep>",
"Cc1nc(N(C)C(=O)Cc2ccc(-c3cc(F)ccc3F)cc2)sc1S(C)(=O)=O<sep>",
"Cc1nc(N(C)C(=O)Cc2ccc(-c3cc(F)ccc3F)cc2)sc1S(C)=O<sep>",
"Cc1nc(N(C)C(=O)Cc2ccc(-c3cc(F)ccc3F)cc2)sc1S(C)(=N)=O<sep>"
] | 3 | {
"title": "Computer-Aided Retrosynthesis for Greener and Optimal Total Synthesis of a Helicase-Primase Inhibitor Active Pharmaceutical Ingredient",
"journal": "JACS AU",
"doi": "10.1021/jacsau.4c00624",
"url": "https://pubs.acs.org/doi/10.1021/jacsau.4c00624"
} | 5 | |
How many different structures of 1 did the author use? | [
"9",
"5",
"19",
"6"
] | 3 | {
"title": "Reactivity of Stabilized Vinyldiazo Compounds toward Alkenyl- and Alkynylsilanes under Gold Catalysis: Regio- and Stereoselective Synthesis of Skipped Dienes and Enynes",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.1c01381",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.1c01381"... | 0 | |
List the three products shown in the figure that contain a CO₂Et ester group and their corresponding aryl ring substituents and yields. | [
"1) 3ac: p-methoxyphenyl substitution (p-MeO-C₆H₄), yield 45%; 2) 3ae: p-chlorophenyl substitution (p-Cl-C₆H₄), yield 61%; 3) 3aj: m-fluorophenyl substitution (m-F-C₆H₄), yield 55%.",
"1) 3ab: p-methylphenyl substitution (p-Me-C₆H₄), yield 92%; 2) 3ad: p-fluorophenyl substitution (p-F-C₆H₄), yield 70%; 3) 3af: p-... | 3 | {
"title": "Reactivity of Stabilized Vinyldiazo Compounds toward Alkenyl- and Alkynylsilanes under Gold Catalysis: Regio- and Stereoselective Synthesis of Skipped Dienes and Enynes",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.1c01381",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.1c01381"... | 0 | |
Please briefly describe the overall reaction equation of this gold-catalyzed reaction and the reaction conditions used. | [
"This reaction is carried out at room temperature, using JohnPhosAuCl (5 mol %) and NaBArF₄ (5 mol %) as catalysts, in dichloromethane solvent, coupling vinyldiazo compound 1 with vinylsilane 2 in a 1:2 molar ratio to produce product 3, effecting C–N bond formation.",
"This reaction is carried out at low temperat... | 3 | {
"title": "Reactivity of Stabilized Vinyldiazo Compounds toward Alkenyl- and Alkynylsilanes under Gold Catalysis: Regio- and Stereoselective Synthesis of Skipped Dienes and Enynes",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.1c01381",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.1c01381"... | 0 | |
The product with the highest yield was prepared from 2 substituted by which group? | [
"para-fluorophenyl",
"para-trifluoromethylphenyl",
"ortho-fluorophenyl",
"H"
] | 0 | {
"title": "Reactivity of Stabilized Vinyldiazo Compounds toward Alkenyl- and Alkynylsilanes under Gold Catalysis: Regio- and Stereoselective Synthesis of Skipped Dienes and Enynes",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.1c01381",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.1c01381"... | 0 | |
Which substituent in 2 will lead to decreased stability? | [
"methyl",
"1-furanyl",
"phenyl",
"2-furanyl"
] | 3 | {
"title": "Reactivity of Stabilized Vinyldiazo Compounds toward Alkenyl- and Alkynylsilanes under Gold Catalysis: Regio- and Stereoselective Synthesis of Skipped Dienes and Enynes",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.1c01381",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.1c01381"... | 3 | |
According to Method A, which product has the highest yield? | [
"4c has the highest yield, 99%",
"4b has the highest yield, 99%",
"4q has the highest yield, 95%",
"4o has the highest yield, 97%"
] | 1 | {
"title": "Gold-Catalyzed Regioselective Synthesis of Crowded Cyclopentadienes by Migratory Cycloisomerization of Vinylallenes",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.2c02035",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.2c02035"
} | 0 | |
Briefly describe the overall reaction process from vinyallene 3 to product 4 in Method A | [
"Under catalysis by [IPrAu(CH3CN)]SbF6 (1.0 mol%), vinyallene 3 in DCE solvent (90 °C, 2–12 h) undergoes gold activation to form a carbene intermediate, followed by five-membered ring closure to give the substituted cyclopentadiene product 4.",
"Under catalysis by [IPrAu(CH3CN)]SbF6 (10 mol%), vinyallene 3 in DCE... | 2 | {
"title": "Gold-Catalyzed Regioselective Synthesis of Crowded Cyclopentadienes by Migratory Cycloisomerization of Vinylallenes",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.2c02035",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.2c02035"
} | 2 | |
If the substrate introduces a strongly electron-withdrawing group (such as p-CF3), what effect will it have on the reaction yield? | [
"Introducing a strongly electron-withdrawing group (such as p-CF3) into the substrate increases the yield.",
"Introducing a strongly electron-withdrawing group (such as p-CF3) into the substrate will cause the yield to decrease, for example 57% for 4g.",
"Introducing a strongly electron-withdrawing group (such ... | 1 | {
"title": "Gold-Catalyzed Regioselective Synthesis of Crowded Cyclopentadienes by Migratory Cycloisomerization of Vinylallenes",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.2c02035",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.2c02035"
} | 3 | |
What are the main differences between Method A and Method B in terms of catalyst loading, substrate types, and reaction conditions? | [
"Method A uses vinyallene 3 as the substrate with a catalyst loading of 1.0 mol%, Method B uses propargyl ester 1 and alkynylsilane 2 as substrates with a catalyst loading of 2.5 mol%; both are carried out in DCE at 90 °C.",
"Method A uses vinyallene 3 as the substrate with a catalyst loading of 1.0 mol%, Method ... | 0 | {
"title": "Gold-Catalyzed Regioselective Synthesis of Crowded Cyclopentadienes by Migratory Cycloisomerization of Vinylallenes",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.2c02035",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.2c02035"
} | 3 | |
What is the structural difference between products 4c and 4d? What different aryl substituents do their corresponding substrates have? | [
"The side-chain aryl group on the carbon attached to PivO in 4c is a p-OMe substituted phenyl ring, whereas the PivO side-chain aryl group in 4d is an o-F substituted phenyl ring.",
"The side-chain aryl group on the carbon attached to PivO in 4c is a p-OMe substituted phenyl ring, whereas the PivO side-chain aryl... | 1 | {
"title": "Gold-Catalyzed Regioselective Synthesis of Crowded Cyclopentadienes by Migratory Cycloisomerization of Vinylallenes",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.2c02035",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.2c02035"
} | 3 | |
In the Scope of Alkynes section, what are the substituents R on the benzene rings of products 4b and 4c respectively? What are their yields? | [
"Product 4b: R = –OCH3, yield 58%; Product 4c: R = –CH3, yield 64%.",
"Product 4b: R = –Cl, yield 63%; Product 4c: R = –Ph, yield 53%.",
"Product 4b: R = –CF3, yield 35%; Product 4c: R = –CO2Me, yield 49%.",
"Product 4b: R = –CH3, yield 64%; Product 4c: R = –OCH3, yield 58%."
] | 3 | {
"title": "Carbosulfonylation of Alkynes: A Direct Conversion of sp-C to sp3-C through Visible Light-Mediated 3-Component Reaction",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.4c02700",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.4c02700"
} | 0 | |
In the preparation of which compound was the Boc group removed? | [
"4m",
"4s",
"4q",
"4p"
] | 1 | {
"title": "Carbosulfonylation of Alkynes: A Direct Conversion of sp-C to sp3-C through Visible Light-Mediated 3-Component Reaction",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.4c02700",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.4c02700"
} | 0 | |
Please describe the overall reaction process shown in Scheme 2 and the structural features of the generated products. | [
"This reaction is a three-component photocatalytic one-pot method: aromatic or aliphatic alkynes (1), sodium sulfonate salts (2) and carboxylic acids (3) couple in the presence of 4CzIPN photocatalyst (1 mol %), DMSO solvent, blue light (456 nm) irradiation and air, ultimately yielding sulfone products (4–7). The p... | 1 | {
"title": "Carbosulfonylation of Alkynes: A Direct Conversion of sp-C to sp3-C through Visible Light-Mediated 3-Component Reaction",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.4c02700",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.4c02700"
} | 2 | |
What are the structural features of the photocatalyst used in the figure? | [
"The photocatalyst contains four N-carbazolyl groups and two cyano groups, with the cyano groups in the meta positions.",
"The photocatalyst contains four N-carbazolyl groups and two nitro groups, with the nitro groups in the meta positions.",
"The photocatalyst contains four N-phenyl groups and two cyano group... | 0 | {
"title": "Carbosulfonylation of Alkynes: A Direct Conversion of sp-C to sp3-C through Visible Light-Mediated 3-Component Reaction",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.4c02700",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.4c02700"
} | 0 | |
Which product can be generated from estrone, and what is its yield? | [
"7c. Its yield is 51%",
"7a. Its yield is 41%",
"7d. Its yield is 62%",
"7b. Its yield is 41%+25%"
] | 1 | {
"title": "Carbosulfonylation of Alkynes: A Direct Conversion of sp-C to sp3-C through Visible Light-Mediated 3-Component Reaction",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.4c02700",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.4c02700"
} | 0 | |
How many functionalized products were obtained from 3b? | [
"3",
"6",
"1",
"5"
] | 3 | {
"title": "Difluoroalkylation of Tertiary Amides and Lactams by an Iridium-Catalyzed Reductive Reformatsky Reaction",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.2c00438",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.2c00438"
} | 0 | |
How was product 6 in Scheme 5 obtained? Please write the specific reagents and reaction conditions. | [
"Product 3b was reacted with NaBH4 (1.5 equiv) in MeOH at room temperature for 12 h, which reduced the ester to primary alcohol 6, yield 81%.",
"Product 3b was reacted with DIBAL-H (1.05 equiv) in CH2Cl2 at −78°C for 1 h, which reduced the ester to primary alcohol 6, yield 81%.",
"Product 3b was reacted with Na... | 2 | {
"title": "Difluoroalkylation of Tertiary Amides and Lactams by an Iridium-Catalyzed Reductive Reformatsky Reaction",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.2c00438",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.2c00438"
} | 0 | |
In Scheme 5, why is KOH/MeOH hydrolysis used first and then HCl to obtain carboxylate 9? | [
"First use KOH/MeOH to saponify ester 3b to a carboxylic acid (forming a carboxylate or salt-type intermediate), then use strong acid HCl to provide an acidic environment, thereby obtaining the free carboxylic acid 9;",
"First use KOH/MeOH to remove impurities in the reaction, then use HCl to adjust the pH to fac... | 0 | {
"title": "Difluoroalkylation of Tertiary Amides and Lactams by an Iridium-Catalyzed Reductive Reformatsky Reaction",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.2c00438",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.2c00438"
} | 1 | |
Please briefly describe the reaction equation for the first step in Scheme 5: the Ir-catalyzed reductive coupling that synthesizes product 3b, including the main reactants, catalyst, reductant, and reaction conditions. | [
"Using N,N-dimethylbenzamide (1b), catalyzed by IrCl(CO)(PPh₃)₂ (1 mol%), with TMDS (1.5 equiv) in toluene (0.1 M) at room temperature for 20 min. Then add ethoxycarbonyl-α,α-difluoroalkene (2a'), warm slowly from 0 °C to room temperature, react for 20 min, to obtain the difluoro-substituted ester 3b, yield 67%.",
... | 0 | {
"title": "Difluoroalkylation of Tertiary Amides and Lactams by an Iridium-Catalyzed Reductive Reformatsky Reaction",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.2c00438",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.2c00438"
} | 0 | |
Starting from product 3b, which downstream functionalized derivatives are shown in Scheme 5? Please list for each derivative the corresponding reagents, reaction conditions, and yields. | [
"3b can be sequentially converted to:\n• Alcohol 6: NaBH4 (1.5 equiv), EtOH, room temperature, 24 h, yield 81%;\n• Amide 7: NH3 (20 equiv), MeOH, room temperature, 24 h, yield 85%;\n• Carboxylate 9: KOH (1.0 equiv), MeOH, room temperature, 24 h, then HCl (10 equiv), 1,4-dioxane/ether, room temperature, 20 min, quan... | 0 | {
"title": "Difluoroalkylation of Tertiary Amides and Lactams by an Iridium-Catalyzed Reductive Reformatsky Reaction",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.2c00438",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.2c00438"
} | 0 | |
Briefly describe the overall mechanistic pathway of this NHC-catalyzed reaction, including the major intermediates. | [
"3a generates the NHC catalyst under the action of base, which then undergoes nucleophilic addition with 1a to give intermediate (I); after proton transfer it forms the aza-Breslow intermediate II, which then adds to 2a to give intermediate (III); subsequent proton transfer and elimination generate 3a while regener... | 1 | {
"title": "N-Heterocyclic-Carbene-Catalyzed Imine Umpolung for the Cross-Coupling of Quinoxalin-2-ones with Isatins",
"journal": "JACS AU",
"doi": "10.1021/jacsau.4c01166",
"url": "https://pubs.acs.org/doi/10.1021/jacsau.4c01166"
} | 2 | |
In the above NHC catalytic cycle, which step is most likely the rate-determining step? Please state the reason. | [
"The most likely rate-determining step is the nucleophilic attack of the NHC catalyst on 1a to form tetrahedral intermediate I, because this process requires overcoming the strong C=O bond and significant steric hindrance, resulting in the highest energy barrier.",
"The most likely rate-determining step is the pr... | 2 | {
"title": "N-Heterocyclic-Carbene-Catalyzed Imine Umpolung for the Cross-Coupling of Quinoxalin-2-ones with Isatins",
"journal": "JACS AU",
"doi": "10.1021/jacsau.4c01166",
"url": "https://pubs.acs.org/doi/10.1021/jacsau.4c01166"
} | 2 | |
What is the key structural feature of reaction product 3a? | [
"Product 3a forms a novel heterocyclic framework spliced from a six-membered heterocyclic unit and a five-membered heterocycle derived from substrate 2a, in which one carbonyl is converted into a hydroxyl group connected to the newly formed C–C bond and the pyridine ring.",
"Product 3a forms a novel heterocyclic ... | 3 | {
"title": "N-Heterocyclic-Carbene-Catalyzed Imine Umpolung for the Cross-Coupling of Quinoxalin-2-ones with Isatins",
"journal": "JACS AU",
"doi": "10.1021/jacsau.4c01166",
"url": "https://pubs.acs.org/doi/10.1021/jacsau.4c01166"
} | 0 | |
Why is the aza-Breslow intermediate II generated in the mechanism? What role does it play in the subsequent reaction? | [
"The aza-Breslow intermediate II is formed by coupling of the NHC and 2a, possesses very strong nucleophilicity, and can perform a nucleophilic attack on the electron-rich aromatic ring of substrate 1a, thereby promoting cleavage of a new C–C bond and driving the cyclization process.",
"The aza-Breslow intermedia... | 2 | {
"title": "N-Heterocyclic-Carbene-Catalyzed Imine Umpolung for the Cross-Coupling of Quinoxalin-2-ones with Isatins",
"journal": "JACS AU",
"doi": "10.1021/jacsau.4c01166",
"url": "https://pubs.acs.org/doi/10.1021/jacsau.4c01166"
} | 2 | |
Write the Extended-SMILES (E-SMILES) representation of the starting substrate 1a in the reaction. | [
"N1(c2c(C)cc(C)cc2C)CN2CCCC2=N1<sep>",
"C(c1ccccc1)N1C(=O)[C@@](O)(c2nc3ccccc3n(C)c2=O)c2ccccc21<sep>",
"N1(Cc2ccccc2)C(=O)C(=O)c2ccccc21<sep>",
"Cn1c(=O)cnc2ccccc21<sep>"
] | 3 | {
"title": "N-Heterocyclic-Carbene-Catalyzed Imine Umpolung for the Cross-Coupling of Quinoxalin-2-ones with Isatins",
"journal": "JACS AU",
"doi": "10.1021/jacsau.4c01166",
"url": "https://pubs.acs.org/doi/10.1021/jacsau.4c01166"
} | 5 | |
How many structurally different sulfur Ylide substrates are used in the figure? | [
"8",
"6",
"9",
"7"
] | 0 | {
"title": "Sulfoxonium Ylides in Aminocatalysis: An Enantioselective Entry to Cyclopropane-Fused Chromanol Structures",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.2c02204",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.2c02204"
} | 0 | |
Please briefly describe the two-step process flow and reaction conditions of this reaction. | [
"Step 1: React aldehyde 1a with sulfoxonium ylide 2 in the presence of 20 mol% chiral catalyst, 20 mol% AcONa, and DCM at room temperature for 12 h; Step 2: Add the Wittig reagent Ph₃P=CHCO₂R to the resulting reaction mixture and continue to react at room temperature for 1 h to obtain product 4.",
"Step 1: React ... | 2 | {
"title": "Sulfoxonium Ylides in Aminocatalysis: An Enantioselective Entry to Cyclopropane-Fused Chromanol Structures",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.2c02204",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.2c02204"
} | 2 | |
What are the R² substituents in product 4? What are the product's E/Z and enantiomeric excess (ee)? | [
"R² includes EtO, MeO, n-BuO, i-BuO, t-BuO, allyloxy (allylO), benzyloxy (BnO), and phenyl (Ph), etc.; the products are mainly Z-isomers, E/Z > 9:1, with enantiomeric excess between 99%–100% ee.",
"R² includes EtO, MeO, n-BuO, i-BuO, allyloxy (allylO), benzyloxy (BnO), and phenyl (Ph), etc. (without t-BuO); the p... | 2 | {
"title": "Sulfoxonium Ylides in Aminocatalysis: An Enantioselective Entry to Cyclopropane-Fused Chromanol Structures",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.2c02204",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.2c02204"
} | 0 | |
What catalyst and auxiliary base were used in this reaction? What were the amounts of each? | [
"The catalyst was a chiral prolinol derivative (the green structure in the figure), 10 mol%; the auxiliary base was sodium acetate (AcONa), 20 mol%.",
"The catalyst was a chiral prolinol derivative (the green structure in the figure), 20 mol%; the auxiliary base was sodium acetate (AcONa), 20 mol%.",
"The catal... | 1 | {
"title": "Sulfoxonium Ylides in Aminocatalysis: An Enantioselective Entry to Cyclopropane-Fused Chromanol Structures",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.2c02204",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.2c02204"
} | 0 | |
What is the E-SMILES of reaction product 4? | [
"*OC(/C=C/[C@@H]1[C@@H](C(*)=O)[C@@H]1C1C(O)=CC=CC=1)=O<sep><a>0:R</a><a>8:R[2]</a>",
"*OC(/C=C/[C@@H]1[C@@H](C(*)=O)[C@@H]1C1C(O)=CC=CC=1)=O<sep><a>1:R</a><a>8:R[2]</a>",
"O(C)C(=O)/C=C/[C@@H]1[C@@H](C(=O)OC)[C@@H]1c1ccccc1O<sep>",
"c1(C(=O)[C@@H]2[C@@H](c3ccccc3O)[C@H]2/C=C/C(=O)OCC)ccccc1<sep>"
] | 0 | {
"title": "Sulfoxonium Ylides in Aminocatalysis: An Enantioselective Entry to Cyclopropane-Fused Chromanol Structures",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.2c02204",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.2c02204"
} | 5 | |
Compare the yields and regioselectivities (dr) of products 3ba, 3ca, and 3da, which correspond to substrate 1 bearing different aryl substituents (such as Cl, Me, OMe). How do electronic properties affect the reaction's performance? | [
"Product (3ba) is the substrate 1 phenyl ring para-substituted by a weak electron-withdrawing chlorine, yield 71%, dr 83:17; product (3ca) is the substrate 1 phenyl ring para-substituted by an electron-donating methyl group, yield 62%, dr 82:18; product (3da) is the substrate 1 phenyl ring para-substituted by a str... | 1 | {
"title": "Stereoselective Synthesis of Densely Substituted Pyrrolidines via a [3+2] Cycloaddition Reaction between Chiral N-tert-Butanesulfinylazadienes and Azomethine Ylides",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.3c02572",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.3c02572"
} | 3 | |
What is the E-SMILES of 3aa? | [
"[C@@H]1(C(=O)OC)[C@@H](c2ccccc2)[C@H](/C=N/[S@](C(C)(C)C)=O)[C@H](c2ccc(Br)cc2)N1<sep>",
"C(=O)(OC)[C@@H]1N[C@@H](c2ccc(Br)cc2)[C@@H](/C=N/[S@@](=O)C(C)(C)C)[C@@H]1c1ccccc1<sep>",
"C(=O)(OC)[C@H]1N[C@@H](c2ccccc2Br)[C@@H](/C=N/[S@@](=O)C(C)(C)C)[C@@H]1c1ccccc1<sep>",
"C(=O)(OC)[C@H]1N[C@@H](c2ccc(Br)cc2)[C@@... | 0 | {
"title": "Stereoselective Synthesis of Densely Substituted Pyrrolidines via a [3+2] Cycloaddition Reaction between Chiral N-tert-Butanesulfinylazadienes and Azomethine Ylides",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.3c02572",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.3c02572"
} | 5 | |
What kind of skeleton do the products obtained in Scheme 2 have? What is the naming rule for labels such as "3aa", "3ab", etc. in the figure? | [
"The products are substituted pyrrol-2-one-1-carboxylate derivatives, with the pyrrole ring bearing a sulfonyl group, an aryl group and an ester group, respectively. In the numbering \"3XY\", X refers to the index of substrate 2 (a–k), Y refers to the index of substrate 1 (a–g); the suffix \"'\" indicates the minor... | 3 | {
"title": "Stereoselective Synthesis of Densely Substituted Pyrrolidines via a [3+2] Cycloaddition Reaction between Chiral N-tert-Butanesulfinylazadienes and Azomethine Ylides",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.3c02572",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.3c02572"
} | 0 | |
What reaction conditions were used in this reaction? Please specify core elements such as the catalyst, solvent, and temperature. | [
"The reaction was carried out in toluene, using Ag2CO3 (10 mol%) as a basic co-catalyst, at room temperature (approximately 25 °C), with substrate 1 and substrate 2 mixed in a 2:1 molar ratio, the reaction concentration being about 0.4 M.",
"The reaction was carried out in toluene, using Ag2CO3 (10 mol%) as a bas... | 1 | {
"title": "Stereoselective Synthesis of Densely Substituted Pyrrolidines via a [3+2] Cycloaddition Reaction between Chiral N-tert-Butanesulfinylazadienes and Azomethine Ylides",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.3c02572",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.3c02572"
} | 0 | |
What types of compounds are the two classes of substrates 1 and 2 shown in Scheme 2, and what are their structural features? | [
"Substrate 1 is a series of chiral N-tert-butanesulfinyl imines ((S)-N-tert-butanesulfinyl imine), whose sulfinyl nitrogen atom is substituted with t-Bu, and different alkyl groups are attached to the imine carbon; substrate 2 is a series of α-imino esters (α-imino ester), bearing an aryl group (Ar) and a hydroxyl ... | 2 | {
"title": "Stereoselective Synthesis of Densely Substituted Pyrrolidines via a [3+2] Cycloaddition Reaction between Chiral N-tert-Butanesulfinylazadienes and Azomethine Ylides",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.3c02572",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.3c02572"
} | 0 | |
From the reaction type perspective, what kind of reaction is this? | [
"This reaction is an intermolecular asymmetric nucleophilic substitution reaction",
"This reaction is an intramolecular asymmetric rearrangement reaction",
"This reaction is an intramolecular asymmetric nucleophilic substitution reaction",
"This reaction is an intramolecular asymmetric nucleophilic addition r... | 2 | {
"title": "Enantioselective Phase-Transfer-Catalyzed Synthesis of Spirocyclic Azetidine Oxindoles",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.4c00358",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.4c00358"
} | 2 | |
In Scheme 1D, what additional reagents and catalysts are introduced in the one-pot tandem procedure? Compared with preparing the halogenated intermediate first and then cyclizing, what advantages does this method have? | [
"In the D-stage reaction, the α-diazo substrate I is first cleaved by a Cu(I) catalyst to generate a metal carbene, and NBu₄⁺ (tetrabutylammonium salt) is added as an additive to effect cyclization to give III. This one-pot method can reduce catalyst loading, simplify workup, and slightly improve enantioselectivity... | 2 | {
"title": "Enantioselective Phase-Transfer-Catalyzed Synthesis of Spirocyclic Azetidine Oxindoles",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.4c00358",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.4c00358"
} | 3 | |
In Scope B, how does introducing different substituents on the aromatic ring (4-Me, 5-Me, 5-F, 7-F) affect yield and enantiomeric selectivity? | [
"4-Me substitution gives a yield of 65%, er = 16:84; 5-Me increases to 90%, er = 2:98; 5-F gives a yield of 88%, er = 3:97; 7-F gives a yield of 58%, er = 2:98.",
"4-Me substitution gives a yield of 69%, er = 14:86; 5-Me increases to 87%, er = 4:96; 5-F gives a yield of 89%, er = 2:98; 7-F gives a yield of 56%, e... | 2 | {
"title": "Enantioselective Phase-Transfer-Catalyzed Synthesis of Spirocyclic Azetidine Oxindoles",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.4c00358",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.4c00358"
} | 3 | |
Please write the general equation of the reaction shown in Scheme 1A, and indicate the key reaction conditions such as the substrate, product, catalyst, base, solvent, temperature, and time. | [
"The reaction converts the chloro-substituted N-protected ortho-amino amide (substrate II) into the five-membered/four-membered spiro lactam product (III) via an intramolecular SN2 cyclization in the presence of 20 mol% Cat7 and 5 equivalents of CsOAc, in m-xylene (0.1 M) at 25 °C for 1 h (900 rpm). Yields are most... | 3 | {
"title": "Enantioselective Phase-Transfer-Catalyzed Synthesis of Spirocyclic Azetidine Oxindoles",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.4c00358",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.4c00358"
} | 0 | |
What is the E-SMILES of product 4? | [
"[N+](=O)([O-])c1ccc2c(c1)[C@]1(CCN1C(=O)OC(C)(C)C)C(=O)N2Cc1ccccc1<sep>",
"C1C=CC2N(*)C(=O)[C@@]3(N(*)CC3)C=2C=1<sep><r>0:Me</r><a>5:Bn</a><a>10:Boc</a>",
"COc1ccc2c(c1)[C@]1(CCN1C(=O)OC(C)(C)C)C(=O)N2Cc1ccccc1<sep>",
"COc1ccc2c(c1)[C@@]1(CCN1C(=O)OC(C)(C)C)C(=O)N2Cc1ccccc1<sep>"
] | 3 | {
"title": "Enantioselective Phase-Transfer-Catalyzed Synthesis of Spirocyclic Azetidine Oxindoles",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.4c00358",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.4c00358"
} | 5 | |
How many steps in the figure have yields exceeding 90%? | [
"4",
"1",
"2",
"3"
] | 3 | {
"title": "Biosourced Vanillin-Based Building Blocks for Organic Electronic Materials",
"journal": "JOURNAL OF ORGANIC CHEMISTRY",
"doi": "10.1021/acs.joc.1c01869",
"url": "https://pubs.acs.org/doi/10.1021/acs.joc.1c01869"
} | 0 | |
What are the reaction conditions and structural changes from molecule 5 to molecule 8? | [
"Using NaOH/MeOH as reagent, react at 70°C for 1 hour, causing the methyl ester group attached at the 2-position of the indole ring to be completely hydrolyzed to a carboxyl group, with the other functional groups remaining unchanged.",
"Using NaOH/MeOH-H2O as reagent, react at 70°C for 1 hour, causing the methyl... | 1 | {
"title": "Biosourced Vanillin-Based Building Blocks for Organic Electronic Materials",
"journal": "JOURNAL OF ORGANIC CHEMISTRY",
"doi": "10.1021/acs.joc.1c01869",
"url": "https://pubs.acs.org/doi/10.1021/acs.joc.1c01869"
} | 1 | |
What is the overall reaction goal of Scheme 2? | [
"Scheme 2, through a series of steps including ester hydrolysis, thermal decarboxylation, N-methylation, and double-bond oxidation, ultimately synthesizes the target molecule pyridine derivative 11.",
"Scheme 2, through a series of steps including ester hydrolysis, thermal decarboxylation, N-methylation, and doub... | 2 | {
"title": "Biosourced Vanillin-Based Building Blocks for Organic Electronic Materials",
"journal": "JOURNAL OF ORGANIC CHEMISTRY",
"doi": "10.1021/acs.joc.1c01869",
"url": "https://pubs.acs.org/doi/10.1021/acs.joc.1c01869"
} | 4 | |
Which route from 9 to 11 has a higher yield? | [
"Equally high",
"Oxidize first, then methylate",
"Methylate first, then oxidize",
"Cannot be compared"
] | 2 | {
"title": "Biosourced Vanillin-Based Building Blocks for Organic Electronic Materials",
"journal": "JOURNAL OF ORGANIC CHEMISTRY",
"doi": "10.1021/acs.joc.1c01869",
"url": "https://pubs.acs.org/doi/10.1021/acs.joc.1c01869"
} | 3 | |
Why is diphenyl ether (Ph2O) used and heated at 260 °C for 4 h in the step from molecule 8 to molecule 9? What kind of product is formed? | [
"The high-boiling diphenyl ether and the high temperature of 260 °C can effectively promote demethylation and aromatization of intermediate 8, producing pyrrole compound 9 with a yield of 80%.",
"The high-boiling diphenyl ether and the high temperature of 260 °C can effectively promote oxidative rearrangement of ... | 2 | {
"title": "Biosourced Vanillin-Based Building Blocks for Organic Electronic Materials",
"journal": "JOURNAL OF ORGANIC CHEMISTRY",
"doi": "10.1021/acs.joc.1c01869",
"url": "https://pubs.acs.org/doi/10.1021/acs.joc.1c01869"
} | 1 | |
Regarding the role of the membrane cell and unstirred conditions in reaction C, which of the following statements is correct? | [
"The membrane cell isolates the electrolyte from the electrode surface, preventing electrode passivation; not stirring reduces radical concentration and decreases side reactions.",
"The membrane cell separates the cathodic and anodic reaction regions, preventing intermediates or products from crossing between the... | 1 | {
"title": "Coupling of Alternating Current to Transition-Metal Catalysis: Examples of Nickel-Catalyzed Cross-Coupling",
"journal": "JOURNAL OF ORGANIC CHEMISTRY",
"doi": "10.1021/acs.joc.0c02350",
"url": "https://pubs.acs.org/doi/10.1021/acs.joc.0c02350"
} | 1 | |
What are the electrochemical conditions and apparatus configuration used for Reaction C? | [
"In a divided cell (divided cell), without stirring, driven by alternating current (AC 3 V, sine wave, 2 Hz), the cathode and anode alternate polarity to achieve the reduction and oxidation half-reactions.",
"In a divided cell (divided cell), without stirring, driven by alternating current (AC 3 V, sine wave, 20 ... | 0 | {
"title": "Coupling of Alternating Current to Transition-Metal Catalysis: Examples of Nickel-Catalyzed Cross-Coupling",
"journal": "JOURNAL OF ORGANIC CHEMISTRY",
"doi": "10.1021/acs.joc.0c02350",
"url": "https://pubs.acs.org/doi/10.1021/acs.joc.0c02350"
} | 0 | |
What type of electrochemical reaction does reaction C belong to? | [
"This reaction is a typical Kolbe coupling reaction, in which the amine is oxidized at the electrode to generate amine radicals, and then two amine radicals couple to form an N–N bond.",
"This reaction is an electrochemically promoted C–C cross-coupling reaction, in which the aryl bromide is reduced at the electr... | 2 | {
"title": "Coupling of Alternating Current to Transition-Metal Catalysis: Examples of Nickel-Catalyzed Cross-Coupling",
"journal": "JOURNAL OF ORGANIC CHEMISTRY",
"doi": "10.1021/acs.joc.0c02350",
"url": "https://pubs.acs.org/doi/10.1021/acs.joc.0c02350"
} | 2 | |
Why does using alternating current (AC) give C–N coupled products, while under direct current (DC) conditions mainly aryl–aryl coupled dimer products are obtained? | [
"AC can continuously oxidize the amine at the anode to generate nitrogen cations, promoting their combination with aryl radicals; whereas DC overreduces the amine at the cathode, leading to depletion of the amine, so the aryl radicals can only couple with each other to form dimers.",
"AC can avoid electrode surfa... | 2 | {
"title": "Coupling of Alternating Current to Transition-Metal Catalysis: Examples of Nickel-Catalyzed Cross-Coupling",
"journal": "JOURNAL OF ORGANIC CHEMISTRY",
"doi": "10.1021/acs.joc.0c02350",
"url": "https://pubs.acs.org/doi/10.1021/acs.joc.0c02350"
} | 2 | |
Write the E-SMILES of the reactant p-bromotrifluoromethylbenzene and the product N-(4-(CF3)phenyl)morpholine. | [
"p-Bromotrifluoromethylbenzene: C(c1ccc(Br)cc1)F(F)F<sep>\\nMorpholine: C1COCCN1<sep>\\nN-(4-(CF3)phenyl)morpholine: FC(F)(F)c1ccc(N2CCOCC2)cc1<sep>",
"p-Bromotrifluoromethylbenzene: C(c1ccc(Br)cc1)(F)(F)F<sep>\\nMorpholine: C1COCCN1<sep>\\nN-(4-(CF3)phenyl)morpholine: FC(F)(F)c1ccc(N2CCOCC2)cc1<sep>",
"p-Bromo... | 1 | {
"title": "Coupling of Alternating Current to Transition-Metal Catalysis: Examples of Nickel-Catalyzed Cross-Coupling",
"journal": "JOURNAL OF ORGANIC CHEMISTRY",
"doi": "10.1021/acs.joc.0c02350",
"url": "https://pubs.acs.org/doi/10.1021/acs.joc.0c02350"
} | 5 | |
Describe the overall reaction equation and the structural features of the products shown in the figure. | [
"In the BMIm–BF4 electrolytic system, heating generates BF3 as the Lewis acid catalyst; phenol (1) and diethyl 2-oxopropanedioate (2) undergo a nucleophilic substitution–cyclization reaction, the main product being a fused bicyclic structure containing an oxygen heterocycle and an α-hydroxy ketone moiety (product 3... | 1 | {
"title": "In Situ Anodically Oxidized BMIm-BF4: A Safe and Recyclable BF3 Source",
"journal": "JOURNAL OF ORGANIC CHEMISTRY",
"doi": "10.1021/acs.joc.1c00932",
"url": "https://pubs.acs.org/doi/10.1021/acs.joc.1c00932"
} | 2 | |
How many phenolic substrates were screened in the table? | [
"11",
"1",
"2",
"3"
] | 3 | {
"title": "In Situ Anodically Oxidized BMIm-BF4: A Safe and Recyclable BF3 Source",
"journal": "JOURNAL OF ORGANIC CHEMISTRY",
"doi": "10.1021/acs.joc.1c00932",
"url": "https://pubs.acs.org/doi/10.1021/acs.joc.1c00932"
} | 0 | |
Under the same BF₃ loading (30%), 50 °C, 4 h conditions, how do different R groups (4-OMe, H, 2-naphthol) affect the yield of product 3 and what are the reasons? | [
"When R = 4-OMe the yield is 79%, R = H is 86%, R = 2-naphthol is 88%. This indicates electron-donating and large π-conjugated substrates can both promote the reaction, while the neutral substrate has a slightly lower yield.",
"When R = 4-OMe the yield is 88%, R = H is 79%, R = 2-naphthol is 86%. This indicates a... | 2 | {
"title": "In Situ Anodically Oxidized BMIm-BF4: A Safe and Recyclable BF3 Source",
"journal": "JOURNAL OF ORGANIC CHEMISTRY",
"doi": "10.1021/acs.joc.1c00932",
"url": "https://pubs.acs.org/doi/10.1021/acs.joc.1c00932"
} | 3 | |
What are the key experimental conditions and procedures used in this reaction? | [
"Phenol (0.5 mmol) and diethyl ketomalonate (0.5 mmol) were added to a divided cell (BMIm–BF₄ as the electrolyte), and electrolyzed at a platinum electrode under an N₂ atmosphere at 10 A cm⁻² to generate BF₃. After electrolysis, the substrate was added to the anodic solution, stirred at the temperature (room temper... | 3 | {
"title": "In Situ Anodically Oxidized BMIm-BF4: A Safe and Recyclable BF3 Source",
"journal": "JOURNAL OF ORGANIC CHEMISTRY",
"doi": "10.1021/acs.joc.1c00932",
"url": "https://pubs.acs.org/doi/10.1021/acs.joc.1c00932"
} | 0 | |
Write the Extended SMILES (E-SMILES) of diethyl ketomaleate (substrate 2). | [
"O(CC)C(=O)C(=O)C(OCC)=O<sep>",
"O(C(=O)C(=O)C(OCC)=O)OC<sep>",
"O(C(=O)C(=O)C(OCC)=O)CC<sep>",
"O(C(=O)C(=O)C(OCC)=O)CC<sep><r>0:R</r>"
] | 2 | {
"title": "In Situ Anodically Oxidized BMIm-BF4: A Safe and Recyclable BF3 Source",
"journal": "JOURNAL OF ORGANIC CHEMISTRY",
"doi": "10.1021/acs.joc.1c00932",
"url": "https://pubs.acs.org/doi/10.1021/acs.joc.1c00932"
} | 5 | |
How does the steric hindrance of the amine affect the yield? Please explain with reference to 3c and 3d. | [
"From 3c (yield 75%) and 3d (yield 31%), it can be seen that the larger the steric hindrance of the amine, the more difficult it is for it to nucleophilically attack the intermediate, resulting in a significant decrease in yield.",
"From 3c (yield 75%) and 3d (yield 31%), it can be seen that the larger the steric... | 0 | {
"title": "Amide Bond Formation via the Rearrangement of Nitrile Imines Derived from N-2-Nitrophenyl Hydrazonyl Bromides",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.1c03993",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.1c03993"
} | 3 | |
Please describe in detail the steps and conditions of this amidation reaction. | [
"First react α-bromo hydrazone 1a with the amine (NHR2R3) in MeCN at 50 °C for 0.25 h, then add Et3N and continue the reaction for 0.5–1 h to afford the corresponding amide product.",
"First react α-bromo hydrazone 1a with Et3N in toluene at 50 °C for 0.25 h, then add the amine (NHR2R3) and continue under the sam... | 3 | {
"title": "Amide Bond Formation via the Rearrangement of Nitrile Imines Derived from N-2-Nitrophenyl Hydrazonyl Bromides",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.1c03993",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.1c03993"
} | 2 | |
Please provide the E-SMILES expression (Markush form) of the general formula of the product in this scheme. | [
"C(=O)(OC)[C@@H](NC(=O)CCCC)C(C)C<sep>",
"*C(N(*)*)=O<sep><a>0:R[1]</a><a>3:R[2]</a><a>4:R[3]</a>",
"*/C(=N/NC1C(*)=CC(Br)=CC=1)/Br<sep><a>0:R</a><a>6:NO2</a>",
"*C(N(*)*)=O<sep><a>0:R[1]</a><a>3:<dum></a><a>4:R[3]</a>"
] | 1 | {
"title": "Amide Bond Formation via the Rearrangement of Nitrile Imines Derived from N-2-Nitrophenyl Hydrazonyl Bromides",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.1c03993",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.1c03993"
} | 5 | |
What reaction theme is shown in Scheme 2? | [
"This reaction is the substrate scope of nucleophilic aromatic substitution (SNAr Substrate Scope), namely the reaction system that uses α-bromohydrazone (hydrazonyl bromide) with various amines under basic conditions to generate arylamines via nucleophilic aromatic substitution.",
"This reaction is the substrate... | 3 | {
"title": "Amide Bond Formation via the Rearrangement of Nitrile Imines Derived from N-2-Nitrophenyl Hydrazonyl Bromides",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.1c03993",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.1c03993"
} | 0 | |
Why is the yield 0 when the amine is p-nitroaniline (corresponding to 3s)? | [
"The –NO2 on p-nitroaniline is a strong electron-withdrawing group that significantly reduces the nucleophilicity of the amine nitrogen, making it unable to effectively attack the intermediate, thereby preventing product formation and giving a zero yield.",
"The –NO2 on p-nitroaniline undergoes coupling side reac... | 0 | {
"title": "Amide Bond Formation via the Rearrangement of Nitrile Imines Derived from N-2-Nitrophenyl Hydrazonyl Bromides",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.1c03993",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.1c03993"
} | 3 | |
Please provide the Extended-SMILES (E-SMILES) representation of the reactant diethyl maleate. | [
"C(=O)(/C=C\\C(=O)OCC)OCC<sep>",
"C(OCC)(/C=C\\\\C(OCC)=O)=O<sep>",
"C(OCC)(/C=C\\\\C(OCC)O)=O<sep>",
"C(C(=O)OCC)C(=O)OCC<sep>"
] | 1 | {
"title": "Moving Beyond Cyanoarene Thermally Activated Delayed Fluorescence Compounds as Photocatalysts: An Assessment of the Performance of a Pyrimidyl Sulfone Photocatalyst in Comparison to 4CzIPN",
"journal": "JOURNAL OF ORGANIC CHEMISTRY",
"doi": "10.1021/acs.joc.2c01137",
"url": "https://pubs.acs.org/doi... | 5 | |
What is the title of this reaction? | [
"Based on our experimental observations, the mechanism of the decarboxylative addition reaction of diethyl maleate with N-Boc-proline when using pDTCz-DPmS as the photocatalyst",
"Based on our experimental observations, the mechanism of the decarboxylative coupling reaction of diethyl maleate with N-Cbz-proline w... | 2 | {
"title": "Moving Beyond Cyanoarene Thermally Activated Delayed Fluorescence Compounds as Photocatalysts: An Assessment of the Performance of a Pyrimidyl Sulfone Photocatalyst in Comparison to 4CzIPN",
"journal": "JOURNAL OF ORGANIC CHEMISTRY",
"doi": "10.1021/acs.joc.2c01137",
"url": "https://pubs.acs.org/doi... | 2 | |
What role does diethyl maleate play in the photocatalytic cycle? Why can it be reduced by PC* to generate a radical anion? | [
"Diethyl maleate donates a hydrogen atom to the excited-state PC* via hydrogen atom transfer, generating an α-carbon radical, which then couples to give the target product assisted by a carbanion intermediate.",
"Diethyl maleate acts as an energy transfer species exchanging energy with PC*, and its α,β-unsaturate... | 3 | {
"title": "Moving Beyond Cyanoarene Thermally Activated Delayed Fluorescence Compounds as Photocatalysts: An Assessment of the Performance of a Pyrimidyl Sulfone Photocatalyst in Comparison to 4CzIPN",
"journal": "JOURNAL OF ORGANIC CHEMISTRY",
"doi": "10.1021/acs.joc.2c01137",
"url": "https://pubs.acs.org/doi... | 1 | |
Which of the following statements about the overall reaction process and the sequence of formation of key intermediates is correct? | [
"First, under visible light irradiation the pDTCz-DPmS photocatalyst (PC) is excited to the high-energy state PC*; PC* transfers an electron to diethyl maleate, generating the diethyl maleate radical anion; meanwhile, base deprotonates the N-Cbz-proline carboxylic acid to the carboxylate, and PC•+ oxidizes this car... | 2 | {
"title": "Moving Beyond Cyanoarene Thermally Activated Delayed Fluorescence Compounds as Photocatalysts: An Assessment of the Performance of a Pyrimidyl Sulfone Photocatalyst in Comparison to 4CzIPN",
"journal": "JOURNAL OF ORGANIC CHEMISTRY",
"doi": "10.1021/acs.joc.2c01137",
"url": "https://pubs.acs.org/doi... | 2 | |
Why convert the carboxylic acid of N-Cbz-proline to its carboxylate before performing photooxidation? | [
"The oxidation potential of the carboxylate is significantly lower than that of the non-deprotonated carboxylic acid, making it more easily single-electron oxidized by the excited photocatalyst (PC*) to generate a carboxyl radical intermediate, thereby efficiently triggering the subsequent decarboxylation and incre... | 0 | {
"title": "Moving Beyond Cyanoarene Thermally Activated Delayed Fluorescence Compounds as Photocatalysts: An Assessment of the Performance of a Pyrimidyl Sulfone Photocatalyst in Comparison to 4CzIPN",
"journal": "JOURNAL OF ORGANIC CHEMISTRY",
"doi": "10.1021/acs.joc.2c01137",
"url": "https://pubs.acs.org/doi... | 1 | |
How was product 6 prepared? Please describe in detail the two-step experimental operations and the reagents and conditions used. | [
"Step 1: TMSCN (in excess) was added in dichloromethane at room temperature, reacted for 1 h to generate the silanol hydrazone intermediate; Step 2: 2 M HCl and methanol were added to the reaction mixture, reacted at room temperature for 30 min to give product 6, overall yield 75%.",
"Step 1: TMSCN (in excess) wa... | 2 | {
"title": "Palladium-Catalyzed Access to Benzocyclobutenone-Derived Ketonitrones via C(sp2)-H Functionalization",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.2c01317",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.2c01317"
} | 4 | |
In the preparation of which compound was a benzyne intermediate encountered? | [
"2v",
"2u",
"3",
"4"
] | 3 | {
"title": "Palladium-Catalyzed Access to Benzocyclobutenone-Derived Ketonitrones via C(sp2)-H Functionalization",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.2c01317",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.2c01317"
} | 2 | |
In the tandem C–H activation/1,3-dipolar cycloaddition reaction, when dppe and rac-BINAP are used as ligands, what does the yield difference between products 2u and 2u' reflect? | [
"The different ligands' electronic and steric effects affect the selectivity of Pd-catalyzed insertion and dipolar cycloaddition. dppe has smaller steric hindrance, making the side product 2u' more easily formed; whereas rac-BINAP's larger steric bulk and chiral environment suppress the formation of 2u', increasing... | 0 | {
"title": "Palladium-Catalyzed Access to Benzocyclobutenone-Derived Ketonitrones via C(sp2)-H Functionalization",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.2c01317",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.2c01317"
} | 3 | |
What are the reactants, reaction conditions, and yield for generating product 3? | [
"The reactants are nitrone (2a) and N-methyl maleimide, reacted in toluene at 80 °C for 12 h, giving the target product 3 in 81% yield.",
"The reactants are nitrone (2a) and N-methyl maleimide, reacted in toluene at 80 °C for 2 h, giving the target product 3 in 81% yield.",
"The reactants are nitrone (2a) and m... | 1 | {
"title": "Palladium-Catalyzed Access to Benzocyclobutenone-Derived Ketonitrones via C(sp2)-H Functionalization",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.2c01317",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.2c01317"
} | 0 | |
What is the title of the first reaction in Scheme 3? Which two main reaction types does it belong to? | [
"The reaction title is \"1,3-dipolar cycloaddition and redox reaction\", mainly involves the 1,3-dipolar cycloaddition of a nitrone with N-methyl maleimide and the subsequent redox-driven ring-opening process.",
"The reaction title is \"1,3-dipolar cycloaddition and ring-opening reaction\", mainly involves the 1,... | 1 | {
"title": "Palladium-Catalyzed Access to Benzocyclobutenone-Derived Ketonitrones via C(sp2)-H Functionalization",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.2c01317",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.2c01317"
} | 0 | |
During the preparation of which compound is a low-temperature reaction required? | [
"3",
"4",
"6",
"5"
] | 2 | {
"title": "Chemo-, Regio-, and Stereoselective cis-Hydroboration of 1,3-Enynes: Copper-Catalyzed Access to (Z,Z)- and (Z,E)-2-Boryl-1,3-dienes",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.4c01929",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.4c01929"
} | 0 | |
Please summarize the four derivatization reactions (a–d) centered on 2-boryl-1,3-diene 2f in Scheme 4 and their corresponding products (3–6). | [
"Scheme 4 shows four reaction pathways starting from 2-boryl-1,3-diene 2f:\na) KHF₂/AcOH effects removal of Bpin to give the deborylated product 3 (yield 54%, >99∶1 Z∶E);\nb) Pd₂(dba)₃/SPhos-catalyzed Suzuki coupling with 4-iodobenzonitrile affords the arylated product 4 (yield 74%, >95∶5 Z∶E);\nc) H₂O₂/NaOH oxidat... | 2 | {
"title": "Chemo-, Regio-, and Stereoselective cis-Hydroboration of 1,3-Enynes: Copper-Catalyzed Access to (Z,Z)- and (Z,E)-2-Boryl-1,3-dienes",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.4c01929",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.4c01929"
} | 0 | |
What are the main functional groups in product 4 obtained by the coupling in reaction b? What is its Z:E stereochemical selectivity? | [
"Product 4 contains: two para-methoxy-substituted phenyl rings; a contiguous 1,3-diene chain; a para-cyano (–C≡N) substituent. The product retains the Z configuration preference of the original diene, Z:E =95:5.",
"Product 4 contains: two para-methyl-substituted phenyl rings; a contiguous 1,3-diene chain; a para-... | 2 | {
"title": "Chemo-, Regio-, and Stereoselective cis-Hydroboration of 1,3-Enynes: Copper-Catalyzed Access to (Z,Z)- and (Z,E)-2-Boryl-1,3-dienes",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.4c01929",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.4c01929"
} | 0 | |
What structural features does product 5 obtained in reaction c under H₂O₂/3 M NaOH conditions have? Please give the corresponding yield and E:Z ratio. | [
"Product 5 is an α,β,γ,δ-unsaturated ketone: the terminal of the diene backbone is oxidized to a carbonyl group (–C(=O)–), still retaining two para-methoxyphenyl rings. Yield 54%, stereoselectivity E:Z >99:1.",
"Product 5 is an α,β,γ,δ-unsaturated ketone: the terminal of the diene backbone is oxidized to a carbon... | 0 | {
"title": "Chemo-, Regio-, and Stereoselective cis-Hydroboration of 1,3-Enynes: Copper-Catalyzed Access to (Z,Z)- and (Z,E)-2-Boryl-1,3-dienes",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.4c01929",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.4c01929"
} | 0 | |
Which compound's preparation requires transition metal catalysis? | [
"3",
"5",
"4",
"6"
] | 2 | {
"title": "Chemo-, Regio-, and Stereoselective cis-Hydroboration of 1,3-Enynes: Copper-Catalyzed Access to (Z,Z)- and (Z,E)-2-Boryl-1,3-dienes",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.4c01929",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.4c01929"
} | 3 | |
How do different electron-donating/withdrawing substituents (such as OMe, NO2, CF3) affect the reaction yield? | [
"Experimental results show that electron-donating groups (such as OMe) and electron-withdrawing groups (such as Cl, Br) both give high yields (85–95%); whereas the strongly electron-withdrawing substituent NO2 significantly reduces the yield to 43%; CF3 substitution (electron-withdrawing) still has a good yield (93... | 0 | {
"title": "Intramolecular Cobalt Porphyrin-Catalyzed Alkylation of 1-Isoindolinones by Site-Selective Insertion into a C(sp3)-H Bond",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.4c02270",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.4c02270"
} | 3 | |
In this reaction, what are the E-SMILES of the products corresponding to the bromo-substituted and chloro-substituted substrates? | [
"E-SMILES of product from bromo-substituted substrate (X=Br): Brc1cc2C(=O)N(CC2C1)CCC<sep><r>1:X</r>\nE-SMILES of product from chloro-substituted substrate (X=Cl): Clc1cc2C(=O)N(CC2C1)CCC<sep><r>1:X</r>",
"E-SMILES of product from bromo-substituted substrate (X=Br): Brc1cc2C(=O)N(CC2C1)CCO<sep><r>1:X</r>\nE-SMILE... | 0 | {
"title": "Intramolecular Cobalt Porphyrin-Catalyzed Alkylation of 1-Isoindolinones by Site-Selective Insertion into a C(sp3)-H Bond",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.4c02270",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.4c02270"
} | 5 | |
Please write out the reaction title and the overall description of the reaction for this scheme. | [
"The title of the scheme is \"Intramolecular, Cobalt(II) Porphyrin-Catalyzed Alkylation of 1-Isoindolinones Starting from Hydrazones\". Overall, this reaction uses hydrazone precursors of 1-isoindolinone derivatives and, under Co(TPP) catalysis, at 80 °C in CH2Cl2 solvent, with DBU and CuI as co-catalysts, generate... | 1 | {
"title": "Intramolecular Cobalt Porphyrin-Catalyzed Alkylation of 1-Isoindolinones by Site-Selective Insertion into a C(sp3)-H Bond",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.4c02270",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.4c02270"
} | 0 | |
What are the main reagents and conditions in the reaction, respectively? | [
"Substrate is the hydrazone (2a) derived from 1-isoindolinone; base is 2.5 equivalents of DBU; catalyst is 1 mol% Co(TPP); solvent is o-dichlorobenzene; reaction concentration is 20 mM; temperature 60 °C; reaction time 4 hours.",
"Substrate is the hydrazone (2a) derived from 1-isoindolinone; base is 2.5 equivalen... | 1 | {
"title": "Intramolecular Cobalt Porphyrin-Catalyzed Alkylation of 1-Isoindolinones by Site-Selective Insertion into a C(sp3)-H Bond",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.4c02270",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.4c02270"
} | 0 | |
Which product has the highest yield? | [
"1p has the highest yield, at 91%.",
"1r has the highest yield, at 99%.",
"1n has the highest yield, at 93%.",
"1t has the highest yield, at 94%."
] | 1 | {
"title": "Intramolecular Cobalt Porphyrin-Catalyzed Alkylation of 1-Isoindolinones by Site-Selective Insertion into a C(sp3)-H Bond",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.4c02270",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.4c02270"
} | 0 | |
In this electrochemical coupling reaction, what electrochemical functions do the carbon anode and the iron cathode respectively perform? | [
"The carbon anode (anode) is mainly used to distribute current and does not directly participate in substrate transformation; the iron cathode (cathode) is responsible for both arene oxidation and proton reduction, thereby achieving the dehydrogenative coupling cycle.",
"The carbon anode (anode) is responsible fo... | 3 | {
"title": "Dehydrogenative Azolation of Arenes in a Microflow Electrochemical Reactor",
"journal": "JOURNAL OF ORGANIC CHEMISTRY",
"doi": "10.1021/acs.joc.1c01409",
"url": "https://pubs.acs.org/doi/10.1021/acs.joc.1c01409"
} | 1 | |
Please provide a Markush E-SMILES representation of a generic product, labeling the substituents R¹ and R² on the aromatic ring. | [
"*c1ccc(R1)c(-n2cccc2)c1<sep><a>0:R[2]</a><r>0:R[1]</r>",
"C1C=CC(N2C3C(=CC=CC=3)*=*2)=CC=1<sep><r>0:R[2]</r><r>2:R[1]</r><a>11:X</a><a>12:X</a>",
"*c1ccc(R1)c(-n2cccc2)c1<sep><a>1:R¹</a><r>0:R²</r>",
"*c1ccc(R1)c(-n2cccc2)c1<sep><a>0:R¹</a><r>1:R²</r>"
] | 1 | {
"title": "Dehydrogenative Azolation of Arenes in a Microflow Electrochemical Reactor",
"journal": "JOURNAL OF ORGANIC CHEMISTRY",
"doi": "10.1021/acs.joc.1c01409",
"url": "https://pubs.acs.org/doi/10.1021/acs.joc.1c01409"
} | 5 | |
Please write the English title of the electrochemical dehydrogenative C–N coupling reaction shown in the figure. | [
"Electrochemical Dehydrogenative C–N Coupling between Nitroarenes and Azoles in a Microflow Reactor.",
"Electrochemical Oxidative C–N Coupling between Azoles and Arenes in a Microflow Reactor.",
"Electrochemical Dehydrogenative C–O Coupling between Arenes and Azoles in a Microflow Reactor.",
"Electrochemical ... | 3 | {
"title": "Dehydrogenative Azolation of Arenes in a Microflow Electrochemical Reactor",
"journal": "JOURNAL OF ORGANIC CHEMISTRY",
"doi": "10.1021/acs.joc.1c01409",
"url": "https://pubs.acs.org/doi/10.1021/acs.joc.1c01409"
} | 0 | |
Regarding the reaction scheme of this electrochemical dehydrogenative C–N coupling, which of the following descriptions is correct? | [
"Using a substituted arene (Ar–H) and a nitrogen-containing heterocycle (Azole) as substrates, under conditions of room temperature, HFIP/CH₂Cl₂ (7∶3), Bu₄NPF₆ as supporting electrolyte, a flow electrochemical cell (carbon anode/iron cathode), current 20–30 mA, 10 min residence time, the substrate is oxidized at th... | 0 | {
"title": "Dehydrogenative Azolation of Arenes in a Microflow Electrochemical Reactor",
"journal": "JOURNAL OF ORGANIC CHEMISTRY",
"doi": "10.1021/acs.joc.1c01409",
"url": "https://pubs.acs.org/doi/10.1021/acs.joc.1c01409"
} | 2 | |
Why do electron-donating-substituted arenes (such as 2,4,6-trimethylbenzene) give higher yields in this coupling reaction than electron-withdrawing-substituted arenes? | [
"Electron-donating substituents (such as methyl, tert-butyl) enhance adsorption of the substrate on the electrode surface, making electron transfer more efficient; whereas electron-withdrawing groups (such as CHO, CO2Me) reduce the substrate's affinity for the electrode, resulting in lower yields.",
"Electron-don... | 2 | {
"title": "Dehydrogenative Azolation of Arenes in a Microflow Electrochemical Reactor",
"journal": "JOURNAL OF ORGANIC CHEMISTRY",
"doi": "10.1021/acs.joc.1c01409",
"url": "https://pubs.acs.org/doi/10.1021/acs.joc.1c01409"
} | 3 | |
In 3a–3m, how do different anhydrides affect the yields? Explain the reasons using 3e (2-sulfobenzoic anhydride, 65%) and 3g (tetrafluoro-phthalic anhydride, 30%) as examples. | [
"Aryl lanthanide reagents act as nucleophiles; conjugated electron-withdrawing groups attached to the anhydride can better enhance the electrophilicity of the carbonyl carbon, promoting the cyclization reaction. In 2-sulfobenzoic anhydride, the electrophilicity of the carbonyl is enhanced due to the conjugated elec... | 0 | {
"title": "Modular Synthetic Approach to Silicon-Rhodamine Homologues and Analogues via Bis-aryllanthanum Reagents",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.1c00512",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.1c00512"
} | 3 | |
Taking product 3b as an example, which anhydride does it originate from? What are the structural characteristics of the product? | [
"3b originates from the addition-cyclization reaction of diethyl maleate with an aryl lanthanum reagent; its product's core framework is two six-membered rings of 9,10-dihydroanthracene, one of the central carbons is substituted by dimethylsilyl, the other carbon forms a fused ring structure with diethyl maleate, a... | 1 | {
"title": "Modular Synthetic Approach to Silicon-Rhodamine Homologues and Analogues via Bis-aryllanthanum Reagents",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.1c00512",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.1c00512"
} | 0 | |
What are the key steps and experimental conditions of this reaction? | [
"Step 1: In THF, add 4.2 equivalents of t-BuLi at -78 °C for metalation for 1 h; Step 2: at the same temperature add 2.2 equivalents of LaCl3·2LiCl and react for 30 min to generate the aryl lanthanum reagent; Step 3: add 1.5 equivalents of an anhydride or ester, warm from -78 °C to room temperature and react for 2–... | 0 | {
"title": "Modular Synthetic Approach to Silicon-Rhodamine Homologues and Analogues via Bis-aryllanthanum Reagents",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.1c00512",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.1c00512"
} | 2 | |
What type of overall organic transformation is the reaction shown in Scheme 2a? | [
"The reaction first uses t-BuLi to desilylate aryl trimethylsilyl derivatives, then reacts with LaCl₃·2LiCl to generate aryl lanthanum reagents, and finally undergoes nucleophilic substitution with various anhydrides or esters to give multisubstituted aryl lactic acid products 3a–m.",
"The reaction first uses t-B... | 3 | {
"title": "Modular Synthetic Approach to Silicon-Rhodamine Homologues and Analogues via Bis-aryllanthanum Reagents",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.1c00512",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.1c00512"
} | 2 | |
Why should the aryllithium intermediate first be converted to an aryl-lanthanum reagent with LaCl₃·2LiCl, instead of directly reacting the aryllithium with the anhydride? | [
"Aryllithium reagents are too reactive, easily causing ring-opening, coupling, or side reactions with functional groups; whereas aryl-lanthanum reagents have better functional-group tolerance and controllable electrophilicity, which can improve the selectivity and yield of the desired addition−cyclization and reduc... | 2 | {
"title": "Modular Synthetic Approach to Silicon-Rhodamine Homologues and Analogues via Bis-aryllanthanum Reagents",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.1c00512",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.1c00512"
} | 1 | |
Describe the reduction step from 6b to product 19, including reagents, solvents, and yield. | [
"Treat the hemiacetal 6b in THF/acetonitrile (mixed solvents) with excess NaBH4 at room temperature, fully reducing the aldehyde and ketone on the ring to give the 1,3-diol product 19, yield 75%.",
"Treat the hemiacetal 6b in THF/MeOH (mixed solvents) with excess NaBH4 at room temperature, fully reducing the alde... | 3 | {
"title": "A Redox-Relay Heck Approach to Substituted Tetrahydrofurans",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.3c00769",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.3c00769"
} | 2 | |
In Scheme 3, what are the stereochemical features and enantiomeric ratio of the cyclic product 18 obtained by treating the allylsilane reagent with BF3·OEt2? | [
"Product 18 is a tetrahydrofuran bearing an exocyclic allyl and phenyl substituent; the allyl and phenyl are predominantly syn, and the obtained d.r. is 6.3:1.",
"Product 18 is a tetrahydrofuran bearing an exocyclic allyl and phenyl substituent; the allyl and phenyl are predominantly anti, but the actual d.r. is ... | 3 | {
"title": "A Redox-Relay Heck Approach to Substituted Tetrahydrofurans",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.3c00769",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.3c00769"
} | 0 | |
In the Pd(OAc)2/NaHCO3/TBAC system, when preparing 6b from 4 and 5b, what is the primary role of TBAC (tetrabutylammonium chloride) in the reaction? | [
"TBAC mainly acts as a ligand, stabilizing Pd(0) species through coordination and modulating the electron density at the metal center, thereby improving reaction selectivity and stereochemical control, rather than serving as a phase-transfer agent.",
"In this Pd-catalyzed carbon–carbon coupling system, TBAC prima... | 3 | {
"title": "A Redox-Relay Heck Approach to Substituted Tetrahydrofurans",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.3c00769",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.3c00769"
} | 1 | |
Please write out the title of Scheme 3 and the research object of that scheme. | [
"The title of Scheme 3 is \"Derivatization of Hemiacetal 19\", and the research object is compound 6b containing a chiral hemiacetal framework and its series of derivative products.",
"The title of Scheme 3 is \"Derivatization of Hemiacetal 6a\", and the research object is compound 6b containing a chiral hemiacet... | 3 | {
"title": "A Redox-Relay Heck Approach to Substituted Tetrahydrofurans",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.3c00769",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.3c00769"
} | 0 | |
What is the yield of the preparation of 6b? | [
"83%",
"72%",
"98%",
"77%"
] | 2 | {
"title": "A Redox-Relay Heck Approach to Substituted Tetrahydrofurans",
"journal": "ORGANIC LETTERS",
"doi": "10.1021/acs.orglett.3c00769",
"url": "https://pubs.acs.org/doi/10.1021/acs.orglett.3c00769"
} | 0 |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.