Datasets:
The full dataset viewer is not available (click to read why). Only showing a preview of the rows.
Error code: DatasetGenerationCastError
Exception: DatasetGenerationCastError
Message: An error occurred while generating the dataset
All the data files must have the same columns, but at some point there are 13 new columns ({'optical_gap', 'V_OC', 'complement', 'J_SC', 'construction', 'electrochemical_gap', 'inchlKEY', 'fill_factor', 'HOMO', 'architecture', 'LUMO', 'doi', 'PCE'}) and 6 missing columns ({'Jsc', 'LUMO(eV)', 'PCE_max(%)', 'Voc(V)', 'Unnamed: 0', 'HOMO(eV)'}).
This happened while the csv dataset builder was generating data using
hf://datasets/Tommy-DING/organic-solar-cell-molecule-property-prediction/HOPV.csv (at revision d02548c5b81637a521067b64443606616d0411be), [/tmp/hf-datasets-cache/medium/datasets/18445530606988-config-parquet-and-info-Tommy-DING-organic-solar--8a6251ae/hub/datasets--Tommy-DING--organic-solar-cell-molecule-property-prediction/snapshots/d02548c5b81637a521067b64443606616d0411be/CEPDB.csv (origin=hf://datasets/Tommy-DING/organic-solar-cell-molecule-property-prediction@d02548c5b81637a521067b64443606616d0411be/CEPDB.csv), /tmp/hf-datasets-cache/medium/datasets/18445530606988-config-parquet-and-info-Tommy-DING-organic-solar--8a6251ae/hub/datasets--Tommy-DING--organic-solar-cell-molecule-property-prediction/snapshots/d02548c5b81637a521067b64443606616d0411be/HOPV.csv (origin=hf://datasets/Tommy-DING/organic-solar-cell-molecule-property-prediction@d02548c5b81637a521067b64443606616d0411be/HOPV.csv), /tmp/hf-datasets-cache/medium/datasets/18445530606988-config-parquet-and-info-Tommy-DING-organic-solar--8a6251ae/hub/datasets--Tommy-DING--organic-solar-cell-molecule-property-prediction/snapshots/d02548c5b81637a521067b64443606616d0411be/NFA.csv (origin=hf://datasets/Tommy-DING/organic-solar-cell-molecule-property-prediction@d02548c5b81637a521067b64443606616d0411be/NFA.csv), /tmp/hf-datasets-cache/medium/datasets/18445530606988-config-parquet-and-info-Tommy-DING-organic-solar--8a6251ae/hub/datasets--Tommy-DING--organic-solar-cell-molecule-property-prediction/snapshots/d02548c5b81637a521067b64443606616d0411be/PD.csv (origin=hf://datasets/Tommy-DING/organic-solar-cell-molecule-property-prediction@d02548c5b81637a521067b64443606616d0411be/PD.csv), /tmp/hf-datasets-cache/medium/datasets/18445530606988-config-parquet-and-info-Tommy-DING-organic-solar--8a6251ae/hub/datasets--Tommy-DING--organic-solar-cell-molecule-property-prediction/snapshots/d02548c5b81637a521067b64443606616d0411be/PFD.csv (origin=hf://datasets/Tommy-DING/organic-solar-cell-molecule-property-prediction@d02548c5b81637a521067b64443606616d0411be/PFD.csv)]
Please either edit the data files to have matching columns, or separate them into different configurations (see docs at https://hf.co/docs/hub/datasets-manual-configuration#multiple-configurations)
Traceback: Traceback (most recent call last):
File "/usr/local/lib/python3.12/site-packages/datasets/builder.py", line 1887, in _prepare_split_single
writer.write_table(table)
File "/usr/local/lib/python3.12/site-packages/datasets/arrow_writer.py", line 675, in write_table
pa_table = table_cast(pa_table, self._schema)
^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^
File "/usr/local/lib/python3.12/site-packages/datasets/table.py", line 2272, in table_cast
return cast_table_to_schema(table, schema)
^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^
File "/usr/local/lib/python3.12/site-packages/datasets/table.py", line 2218, in cast_table_to_schema
raise CastError(
datasets.table.CastError: Couldn't cast
smiles: string
doi: string
inchlKEY: string
construction: string
architecture: string
complement: string
HOMO: double
LUMO: double
electrochemical_gap: double
optical_gap: double
PCE: double
V_OC: double
J_SC: double
fill_factor: double
-- schema metadata --
pandas: '{"index_columns": [{"kind": "range", "name": null, "start": 0, "' + 1891
to
{'Unnamed: 0': Value('int64'), 'smiles': Value('string'), 'PCE_max(%)': Value('float64'), 'Voc(V)': Value('float64'), 'Jsc': Value('float64'), 'HOMO(eV)': Value('float64'), 'LUMO(eV)': Value('float64')}
because column names don't match
During handling of the above exception, another exception occurred:
Traceback (most recent call last):
File "/src/services/worker/src/worker/job_runners/config/parquet_and_info.py", line 1347, in compute_config_parquet_and_info_response
parquet_operations = convert_to_parquet(builder)
^^^^^^^^^^^^^^^^^^^^^^^^^^^
File "/src/services/worker/src/worker/job_runners/config/parquet_and_info.py", line 980, in convert_to_parquet
builder.download_and_prepare(
File "/usr/local/lib/python3.12/site-packages/datasets/builder.py", line 884, in download_and_prepare
self._download_and_prepare(
File "/usr/local/lib/python3.12/site-packages/datasets/builder.py", line 947, in _download_and_prepare
self._prepare_split(split_generator, **prepare_split_kwargs)
File "/usr/local/lib/python3.12/site-packages/datasets/builder.py", line 1736, in _prepare_split
for job_id, done, content in self._prepare_split_single(
^^^^^^^^^^^^^^^^^^^^^^^^^^^
File "/usr/local/lib/python3.12/site-packages/datasets/builder.py", line 1889, in _prepare_split_single
raise DatasetGenerationCastError.from_cast_error(
datasets.exceptions.DatasetGenerationCastError: An error occurred while generating the dataset
All the data files must have the same columns, but at some point there are 13 new columns ({'optical_gap', 'V_OC', 'complement', 'J_SC', 'construction', 'electrochemical_gap', 'inchlKEY', 'fill_factor', 'HOMO', 'architecture', 'LUMO', 'doi', 'PCE'}) and 6 missing columns ({'Jsc', 'LUMO(eV)', 'PCE_max(%)', 'Voc(V)', 'Unnamed: 0', 'HOMO(eV)'}).
This happened while the csv dataset builder was generating data using
hf://datasets/Tommy-DING/organic-solar-cell-molecule-property-prediction/HOPV.csv (at revision d02548c5b81637a521067b64443606616d0411be), [/tmp/hf-datasets-cache/medium/datasets/18445530606988-config-parquet-and-info-Tommy-DING-organic-solar--8a6251ae/hub/datasets--Tommy-DING--organic-solar-cell-molecule-property-prediction/snapshots/d02548c5b81637a521067b64443606616d0411be/CEPDB.csv (origin=hf://datasets/Tommy-DING/organic-solar-cell-molecule-property-prediction@d02548c5b81637a521067b64443606616d0411be/CEPDB.csv), /tmp/hf-datasets-cache/medium/datasets/18445530606988-config-parquet-and-info-Tommy-DING-organic-solar--8a6251ae/hub/datasets--Tommy-DING--organic-solar-cell-molecule-property-prediction/snapshots/d02548c5b81637a521067b64443606616d0411be/HOPV.csv (origin=hf://datasets/Tommy-DING/organic-solar-cell-molecule-property-prediction@d02548c5b81637a521067b64443606616d0411be/HOPV.csv), /tmp/hf-datasets-cache/medium/datasets/18445530606988-config-parquet-and-info-Tommy-DING-organic-solar--8a6251ae/hub/datasets--Tommy-DING--organic-solar-cell-molecule-property-prediction/snapshots/d02548c5b81637a521067b64443606616d0411be/NFA.csv (origin=hf://datasets/Tommy-DING/organic-solar-cell-molecule-property-prediction@d02548c5b81637a521067b64443606616d0411be/NFA.csv), /tmp/hf-datasets-cache/medium/datasets/18445530606988-config-parquet-and-info-Tommy-DING-organic-solar--8a6251ae/hub/datasets--Tommy-DING--organic-solar-cell-molecule-property-prediction/snapshots/d02548c5b81637a521067b64443606616d0411be/PD.csv (origin=hf://datasets/Tommy-DING/organic-solar-cell-molecule-property-prediction@d02548c5b81637a521067b64443606616d0411be/PD.csv), /tmp/hf-datasets-cache/medium/datasets/18445530606988-config-parquet-and-info-Tommy-DING-organic-solar--8a6251ae/hub/datasets--Tommy-DING--organic-solar-cell-molecule-property-prediction/snapshots/d02548c5b81637a521067b64443606616d0411be/PFD.csv (origin=hf://datasets/Tommy-DING/organic-solar-cell-molecule-property-prediction@d02548c5b81637a521067b64443606616d0411be/PFD.csv)]
Please either edit the data files to have matching columns, or separate them into different configurations (see docs at https://hf.co/docs/hub/datasets-manual-configuration#multiple-configurations)Need help to make the dataset viewer work? Make sure to review how to configure the dataset viewer, and open a discussion for direct support.
Unnamed: 0 int64 | smiles string | PCE_max(%) float64 | Voc(V) float64 | Jsc float64 | HOMO(eV) float64 | LUMO(eV) float64 |
|---|---|---|---|---|---|---|
0 | c1cnc(s1)-c1ccc2c(c1)[se]c1c2ccc2ccc3cocc3c12 | 2.466159 | 0.980867 | 38.695335 | -5.580867 | -3.057529 |
1 | c1ncc(s1)-c1ccc2cc3c(cnc4ccc5ccccc5c34)cc2c1 | 4.432374 | 1.031611 | 66.125351 | -5.631611 | -3.402825 |
2 | c1ccc(nc1)-c1[SiH2]c(cc1)-c1ccc(nc1)-c1cccc2nsnc12 | 6.266756 | 1.022057 | 94.365982 | -5.622056 | -3.618294 |
3 | c1ccc(o1)-c1cc2sc3c(ccc4ccoc34)c2cn1 | 0.961135 | 1.007794 | 14.677781 | -5.607794 | -2.6727 |
4 | c1cc2sc3c(cnc4cc(oc34)-c3cccc4=CCC=c34)c2cn1 | 5.311643 | 0.739755 | 110.506691 | -5.339755 | -3.438893 |
5 | c1[SiH2]c(cc1)-c1ccc(-c2cccs2)c2c[nH]cc12 | 2.31692 | 0.358397 | 99.493301 | -4.958397 | -2.987447 |
6 | C1=Cc2[se]c3c([se]c4cc(-c5scc6[SiH2]C=Cc56)c5cscc5c34)c2[SiH2]1 | 4.076927 | 0.671622 | 93.423325 | -5.271623 | -3.259273 |
7 | [nH]1ccc2[se]c3c(cnc4cc(cnc34)-c3scc4sccc34)c12 | 3.031236 | 0.784585 | 59.460365 | -5.384584 | -3.094574 |
8 | [nH]1c2ccncc2c2c1c1cnc(cc1c1ccccc21)-c1ccc[se]1 | 2.159016 | 0.988871 | 33.601891 | -5.588871 | -2.998404 |
9 | c1ccc([se]1)-c1ccc(o1)-c1[SiH2]c(cc1)-c1cncs1 | 5.757183 | 0.538213 | 164.627853 | -5.138213 | -3.461589 |
10 | c1sc(-c2cc3cc4ncc5ccc6c[nH]cc6c5c4cc3s2)c2nccnc12 | 9.733543 | 0.650458 | 230.302795 | -5.250458 | -3.658649 |
11 | c1cc2c3c[nH]cc3c3c4oc(cc4[se]c3c2[se]1)-c1cncs1 | 2.074358 | 0.415537 | 76.828262 | -5.015537 | -2.87847 |
12 | c1cc2[se]c3c(ncc4cc(-c5ncncn5)c5=C[SiH2]C=c5c34)c2o1 | 8.207726 | 1.183942 | 106.694023 | -5.783942 | -3.861284 |
13 | C1=Cc2c([SiH2]1)c1[se]c(cc1c1cocc21)-c1cncc2nsnc12 | 10.923757 | 0.739721 | 227.275146 | -5.339721 | -3.997537 |
14 | [nH]1ccc2cnc3c4sc(cc4sc3c12)-c1cncc2nsnc12 | 9.775275 | 0.954625 | 157.595505 | -5.554625 | -3.908863 |
15 | c1cc2sc3c4oc(cc4oc3c2c2cscc12)-c1cccc2ccccc12 | 2.542223 | 0.537651 | 72.771362 | -5.137651 | -2.96679 |
16 | c1ccc([se]1)-c1cc2oc3c([se]c4ccc5=CCC=c5c34)c2c2=C[SiH2]C=c12 | 4.921617 | 0.34487 | 219.634171 | -4.94487 | -3.567298 |
17 | [nH]1c2C=C([SiH2]c2c2[nH]c3ccncc3c12)c1scc2nccnc12 | 5.605011 | 0.397728 | 216.889313 | -4.997728 | -3.608516 |
18 | [nH]1c2ccc3nsnc3c2c2c1c1sc(cc1c1=CCC=c21)-c1ccc[se]1 | 3.034456 | 0.338113 | 138.123001 | -4.938114 | -3.19253 |
19 | c1cc2oc3c(c4cocc4c4cc(-c5ncncn5)c5=CCC=c5c34)c2cn1 | 8.413336 | 0.708774 | 182.68718 | -5.308774 | -3.781328 |
20 | C1=Cc2c(C1)c1c(cc(-c3scc4[SiH2]C=Cc34)c3=CCC=c13)c1ccccc21 | 3.370971 | 0.477714 | 108.601295 | -5.077713 | -3.166147 |
21 | [nH]1c(cc2cc3[se]c4cccnc4c3cc12)-c1scc2ccsc12 | 2.039168 | 0.669261 | 46.892693 | -5.269261 | -2.844799 |
22 | c1ccc(o1)-c1cnc(s1)-c1sc(-c2scc3ccsc23)c2sccc12 | 4.386876 | 0.404238 | 167.018799 | -5.004239 | -3.333581 |
23 | [nH]-1c2-cccn-c2-c2ccc3ccc4c[SiH2]cc4c3c-12 | 4.941617 | 0.966286 | 78.706566 | -5.566286 | -3.444907 |
24 | c1sc(c2C=C[SiH2]c12)-c1cc2c3c[nH]cc3c3ccncc3c2c2=C[SiH2]C=c12 | 6.384475 | 0.580022 | 169.405701 | -5.180022 | -3.498847 |
25 | c1[SiH2]c2cc3c(cc2-c1)c1cscc1c1ccc2cocc2c31 | 2.622347 | 0.767044 | 52.615986 | -5.367043 | -3.009596 |
26 | c1cc2sc3c4CC(=Cc4sc3c2[se]1)c1scc2[SiH2]C=Cc12 | 3.064902 | 0.490012 | 96.262642 | -5.090012 | -3.099647 |
27 | [nH]1c2cc([se]c2c2cnc3ccccc3c12)-c1cccc2nsnc12 | 7.690645 | 0.884809 | 133.770599 | -5.484809 | -3.71617 |
28 | c1sc(-c2ncc(s2)-c2sc(-c3scc4occc34)c3cc[nH]c23)c2cc[SiH2]c12 | 4.724352 | 0.281039 | 258.716003 | -4.881039 | -3.319481 |
29 | c1c-c2c(-[s]1)c1[o]-c3ccc4cscc4c3-c1c1c[SiH2]cc21 | 4.335051 | 0.527075 | 126.581345 | -5.127075 | -3.319638 |
30 | c1cc2ncc3c(ncc4cc(-c5cncc6nsnc56)c5c[nH]cc5c34)c2[se]1 | 10.686573 | 0.99904 | 164.627853 | -5.59904 | -3.914208 |
31 | [nH]1c2cc(sc2c2c1c1[SiH2]C=Cc1c1=CCC=c21)C1=CC=CC1 | 0.489533 | 0.025183 | 299.176208 | -4.625183 | -3.146959 |
32 | C1=CC2=C([SiH2]1)C=C(C2)c1cc2occc2c2cscc12 | 2.743214 | 0.387106 | 109.062904 | -4.987106 | -3.077141 |
33 | c1ccc(nc1)C1=Cc2c(C1)c1sc3ccc4cscc4c3c1c1=CCC=c21 | 3.314821 | 0.254013 | 200.840485 | -4.854013 | -3.210498 |
34 | c1ccc(-c2ccc([se]2)-c2ncncn2)c2nsnc12 | 7.383239 | 1.396279 | 81.38089 | -5.996279 | -3.8975 |
35 | [nH]1c2C=C([SiH2]c2c2cc3c(ccc4ccccc34)cc12)c1scc2nccnc12 | 7.161613 | 0.50547 | 218.053558 | -5.10547 | -3.721472 |
36 | [nH]1c2C=C(Cc2c2sccc12)c1scc2C=C[SiH2]c12 | 1.29854 | 0.286844 | 69.671921 | -4.886844 | -2.691936 |
37 | c1ccc(s1)-c1sc(-c2sc(-c3scc4cc[se]c34)c3ccoc23)c2ccoc12 | 3.596965 | 0.207803 | 266.398987 | -4.807803 | -3.257612 |
38 | [nH]1c2cc3C=C[SiH2]c3cc2c2c1cc(-c1cncc3nsnc13)c1cocc21 | 9.469912 | 0.642274 | 226.920135 | -5.242274 | -3.898506 |
39 | c1cc2c3cscc3c3c(cnc4cc(ccc34)-c3scc4C=C[SiH2]c34)c2s1 | 3.244415 | 1.013068 | 49.288464 | -5.613068 | -3.217616 |
40 | [nH]1c2ccsc2c2ncc3C=C([SiH2]c3c12)c1scc2cc[se]c12 | 3.333016 | 0.609972 | 84.095932 | -5.209972 | -3.130189 |
41 | [nH]1c2cc(sc2c2c3cscc3c3C=C[SiH2]c3c12)-c1scc2cc[se]c12 | 2.295511 | 0.266903 | 132.364868 | -4.866903 | -3.092816 |
42 | c1ccc([se]1)-c1sc(-c2ncc(s2)-c2scc3nccnc23)c2[se]ccc12 | 7.483171 | 0.565902 | 203.512863 | -5.165902 | -3.727206 |
43 | c1ncc(s1)-c1cc2cnc3c(c4c[nH]cc4c4ccc5c[nH]cc5c34)c2o1 | 1.356805 | 0.199357 | 104.744888 | -4.799357 | -2.863738 |
44 | c1ccc(o1)-c1cc2oc3c(oc4ccc5=CCC=c5c34)c2c2cocc12 | 2.399596 | 0.218001 | 169.405701 | -4.818001 | -3.141093 |
45 | [nH]1c(cc2oc3c(cnc4ccncc34)c12)-c1ccccc1 | 1.248765 | 0.951245 | 20.203922 | -5.551245 | -2.749485 |
46 | c1c-c2ccc3c4[se]ccc4c4c[nH]cc4c3c2-[s]1 | 0.713366 | 0.63752 | 17.221298 | -5.23752 | -2.368433 |
47 | c1c-c2cnc3c(ccc4ccc5c[SiH2]cc5c34)c2-nc1 | 4.616314 | 0.844827 | 84.095932 | -5.444827 | -3.364982 |
48 | c1ccc(o1)-c1cnc2c3cnc4ccc5cscc5c4c3c3=C[SiH2]C=c3c2c1 | 5.909305 | 0.983246 | 92.495766 | -5.583246 | -3.564291 |
49 | [nH]1ccc2c3nsnc3c3cc(-c4scc5nccnc45)c4=C[SiH2]C=c4c3c12 | 9.392513 | 0.708722 | 203.963898 | -5.308722 | -3.871938 |
50 | [nH]1cccc1-c1ccc2c(c1)c1cocc1c1c3ccccc3c3=C[SiH2]C=c3c21 | 4.753213 | 0.596601 | 122.616974 | -5.196601 | -3.366259 |
51 | C1=Cc2c([SiH2]1)c1ncc(cc1c1cscc21)-c1cccc2=C[SiH2]C=c12 | 6.42969 | 0.803759 | 123.115196 | -5.403759 | -3.576268 |
52 | c1cc2oc3c(oc4cc(-c5cccc6nsnc56)c5c[nH]cc5c34)c2s1 | 5.813644 | 0.321287 | 278.485626 | -4.921287 | -3.408867 |
53 | c1ccc(nc1)-c1cc2ccc3c(oc4ccc5cscc5c34)c2c2cscc12 | 2.792066 | 0.682191 | 62.989388 | -5.282191 | -3.027456 |
54 | c1ccc(s1)-c1ccc(-c2sc(-c3nccs3)c3[se]ccc23)c2ccccc12 | 3.145229 | 0.752453 | 64.331055 | -5.352453 | -3.107155 |
55 | [nH]1ccc2[SiH2]c3cc(ncc3-c12)-c1scc2[se]ccc12 | 2.187831 | 0.625326 | 53.846146 | -5.225327 | -2.879637 |
56 | [nH]1ccc2Cc3c(sc4cc(-c5cccc6c[nH]cc56)c5cscc5c34)-c12 | 0.536434 | 0.110042 | 75.024986 | -4.710042 | -2.557743 |
57 | c1ccc(-c2cc3c4c[nH]cc4c4ccc5nsnc5c4c3o2)c2c[nH]cc12 | 2.79682 | 0.203282 | 211.74472 | -4.803282 | -3.185066 |
58 | [nH]1c(cc2ncc3c4ccccc4c4cscc4c3c12)-c1scc2ccsc12 | 2.509898 | 0.740183 | 52.187286 | -5.340183 | -2.974488 |
59 | [nH]1c2cc[se]c2c2c3cocc3c3cc([se]c3c12)-c1cncc2nsnc12 | 8.960807 | 0.496389 | 277.826019 | -5.096389 | -3.951808 |
60 | c1sc(-c2sc(-c3cccc4cCcc34)c3occc23)c2occc12 | 2.656901 | 0.205739 | 198.749908 | -4.805739 | -3.171982 |
61 | [nH]1cccc1-c1[SiH2]c(cc1)-c1sc(-c2scc3nccnc23)c2ccoc12 | 2.634724 | 0.139034 | 291.650391 | -4.739034 | -3.670634 |
62 | c1ccc([se]1)-c1cc2oc3c4cnccc4sc3c2c2cocc12 | 3.16511 | 0.767922 | 63.433567 | -5.367922 | -3.114416 |
63 | c1cc2c(o1)c1oc3cc(-c4scc5CC=Cc45)c4cocc4c3c1c1=CCC=c21 | 1.692829 | 0.243079 | 107.179924 | -4.843079 | -2.922077 |
64 | C1=Cc2oc3c4CC(=Cc4sc3c2C1)c1ccco1 | 0.736345 | 0.139254 | 81.38089 | -4.739254 | -2.639045 |
65 | [nH]1ccc2c3c[nH]cc3c3c4ccc(cc4c4=CCC=c4c3c12)-c1ccc[se]1 | 0.946265 | 0.136496 | 106.694023 | -4.736496 | -2.813442 |
66 | c1ccc(s1)C1=Cc2ncc3c(ccc4ccc5=CCC=c5c34)c2C1 | 3.641321 | 0.537496 | 104.263229 | -5.137496 | -3.197853 |
67 | c1sc(-c2ccc(s2)-c2ccc(o2)-c2scc3ccCc23)c2cc[SiH2]c12 | 2.591733 | 0.541346 | 73.682312 | -5.141346 | -2.978139 |
68 | C1=Cc2c([SiH2]1)c1c3cocc3c3cc(cnc3c1c1nsnc21)-c1cccnc1 | 7.15063 | 1.11643 | 98.573547 | -5.71643 | -3.740351 |
69 | c1ccc(cn1)-c1cc2sc3c([se]c4ccc5cscc5c34)c2c2cscc12 | 3.593779 | 0.679636 | 81.38089 | -5.279636 | -3.181239 |
70 | C1=Cc2ncc3c(sc4cc(-c5nccs5)c5c[nH]cc5c34)c2C1 | 2.79209 | 0.576202 | 74.576508 | -5.176202 | -3.023155 |
71 | c1Cc(cc1)-c1sc(-c2ccc(o2)-c2ccc[se]2)c2ccsc12 | 2.142909 | 0.191472 | 172.24498 | -4.791472 | -3.127292 |
72 | c1cc2cc3[se]c4cc([se]c4c3cc2s1)-c1cccnc1 | 2.352325 | 0.935592 | 38.695335 | -5.535592 | -3.013744 |
73 | c1cnc(s1)-c1ccc(-c2sc(-c3ccc[se]3)c3cc[nH]c23)c2c[SiH2]cc12 | 5.56494 | 0.297329 | 288.051849 | -4.897329 | -3.802422 |
74 | c1sc(-c2cc3ncc4c(ccc5ccc6nsnc6c45)c3cn2)c2ccoc12 | 7.18887 | 0.960571 | 115.180405 | -5.560571 | -3.688245 |
75 | c1cc2ncc3c([se]c4cc(-c5scc6cc[se]c56)c5=C[SiH2]C=c5c34)c2o1 | 9.209312 | 0.720971 | 196.587967 | -5.320971 | -3.691679 |
76 | c1[SiH2]c(cc1)-c1sc(-c2sc(-c3cncs3)c3sccc23)c2occc12 | 5.47932 | 0.382238 | 220.617813 | -4.982238 | -3.609953 |
77 | [nH]1c(cc2ccc3c4ccccc4c4nsnc4c3c12)-c1scc2[se]ccc12 | 4.303906 | 0.69487 | 95.325066 | -5.294869 | -3.295838 |
78 | c1sc(-c2sc(-c3ccc(s3)-c3scc4sccc34)c3cc[SiH2]c23)c2occc12 | 3.119478 | 0.501153 | 95.798668 | -5.101152 | -3.107223 |
79 | c1Cc(cc1)-c1sc(-c2ccc(s2)-c2cccc3cscc23)c2cc[se]c12 | 2.85715 | 0.321769 | 136.658524 | -4.921769 | -3.169369 |
80 | c1ccc(s1)-c1sc(-c2sc(-c3scc4cc[SiH2]c34)c3cc[nH]c23)c2cc[nH]c12 | 0.180877 | 0.00957 | 290.881042 | -4.60957 | -3.093771 |
81 | C1=CC=C([SiH2]1)c1cc2ncc3c4occc4cnc3c2o1 | 3.320986 | 1.00389 | 50.912994 | -5.603889 | -3.224241 |
82 | c1cc2cnc(cc2[se]1)-c1cc2c(ccc3c[nH]cc23)[se]1 | 1.600047 | 0.402207 | 61.225277 | -5.002207 | -2.731278 |
83 | c1ccc(o1)-c1ccc(-c2sc(-c3ncncn3)c3ccoc23)c2cscc12 | 6.181579 | 0.667602 | 142.504761 | -5.267602 | -3.538562 |
84 | [nH]1c(cc2sc3c4sccc4[se]c3c12)-c1cccc2=CCC=c12 | 2.781327 | 0.3316 | 129.087845 | -4.9316 | -3.138051 |
85 | c1sc(C2=Cc3cnc4c(ccc5ccncc45)c3[SiH2]2)c2CC=Cc12 | 3.951288 | 1.022725 | 59.460365 | -5.622725 | -3.331457 |
86 | c1Cc(cc1)-c1cnc(-c2sc(-c3ccccn3)c3[se]ccc23)c2nsnc12 | 9.284899 | 0.57761 | 247.394424 | -5.17761 | -3.937265 |
87 | c1sc(-c2cc3[se]c4c(c5cocc5c5ccccc45)c3s2)c2nccnc12 | 9.775382 | 0.661956 | 227.275146 | -5.261956 | -3.669372 |
88 | c1sc(-c2ncc(s2)-c2sc(-c3ncncn3)c3occc23)c2cc[SiH2]c12 | 7.264929 | 0.991449 | 112.773865 | -5.591449 | -3.706826 |
89 | [nH]1ccc2c3cocc3c3c(cnc4cc(ccc34)-c3cccc4c[nH]cc34)c12 | 1.894948 | 0.45334 | 64.331055 | -5.05334 | -2.810202 |
90 | [nH]1c(cc2cc3c4cocc4ccc3cc12)-c1cccc2cocc12 | 2.356725 | 0.548515 | 66.125351 | -5.148515 | -2.918911 |
91 | [nH]1ccc2[nH]c3c4[nH]c(cc4c4cocc4c3c12)-c1cncs1 | 0.224074 | 0.051805 | 66.568123 | -4.651805 | -2.426014 |
92 | C1=Cc2c([SiH2]1)c1CC(=Cc1c1ccccc21)c1scc2C=C[SiH2]c12 | 3.486722 | 0.61785 | 86.852379 | -5.21785 | -3.159363 |
93 | c1sc(C2=Cc3ncc4c5cnccc5c5=C[SiH2]C=c5c4c3[SiH2]2)c2cc[nH]c12 | 8.254843 | 0.589228 | 215.611877 | -5.189229 | -3.575308 |
94 | c1ccc(s1)-c1ccc(s1)-c1cnc(s1)-c1scc2cc[SiH2]c12 | 3.938717 | 0.793741 | 76.370102 | -5.393741 | -3.256059 |
95 | c1[SiH2]c(cc1)-c1ccc(o1)-c1cnc(-c2scc3ccsc23)c2nsnc12 | 9.022362 | 0.543765 | 255.361984 | -5.143765 | -3.928544 |
96 | C1=Cc2sc3cc4cc(cnc4cc3c2C1)-c1scc2ccoc12 | 2.771938 | 0.663148 | 64.331055 | -5.263148 | -3.018183 |
97 | c1ccc(s1)-c1sc(-c2sc(-c3scc4ccsc34)c3[se]ccc23)c2occc12 | 3.619113 | 0.255873 | 217.683594 | -4.855873 | -3.230422 |
98 | c1cc2c(cc(-c3cc4ccccc4s3)c3c[nH]cc23)s1 | 1.238485 | 0.518841 | 36.73703 | -5.118841 | -2.571688 |
99 | c1ccc(-c2cc3c4ccccc4c4ccc5cocc5c4c3cn2)c2cocc12 | 3.2125 | 0.687698 | 71.894073 | -5.287698 | -3.110216 |
Organic Solar Cell Molecule Property Prediction
Summary
This Hugging Face dataset repository publishes raw CSV tables for organic solar cell (OSC) molecule/device property prediction, used in the paper:
“RingFormer: A Ring-Enhanced Graph Transformer for Organic Solar Cell Property Prediction” (AAAI 2025).
It includes five datasets: CEPDB, HOPV, PFD, NFA, and PD.
Files in this repo
CEPDB.csvHOPV.csvPFD.csvNFA.csvPD.csv
Important
- This repository contains raw/tabular CSV files only.
- The processed ring-graph data and the code to generate it are provided in the RingFormer GitHub repository:
https://github.com/TommyDzh/RingFormer
Dataset Overview
| DATASET | #GRAPHS | AVG. # NODES | AVG. # EDGES | AVG. # RINGS |
|---|---|---|---|---|
| CEPDB | 2.2M | 27.6 | 33.3 | 6.7 |
| HOPV | 350 | 42.7 | 49.3 | 7.5 |
| PFD | 1055 | 77.1 | 84.2 | 8.2 |
| NFA | 654 | 118.2 | 133.0 | 15.8 |
| PD | 277 | 80.7 | 88.2 | 8.5 |
Schema (Columns)
CEPDB.csv
Header:
smiles, PCE (%), Voc (V), Jsc, HOMO (eV), LUMO (eV)
smiles: molecule SMILESPCE (%): power conversion efficiency (percent)Voc (V): open-circuit voltage (volts)Jsc: short-circuit current density (unit as provided in the original file; commonly mA/cm²)HOMO (eV): HOMO energy level (eV; typically negative)LUMO (eV): LUMO energy level (eV; typically negative)
HOPV.csv
Header:
smiles,doi,inchlKEY,construction,architecture,complement,HOMO,LUMO,electrochemical_gap,optical_gap,PCE,V_OC,J_SC,fill_factor
smiles: molecule SMILESdoi: reference DOIinchlKEY: InChIKey (kept as-is from the original file, including spelling)construction: material category (e.g., polymer)architecture: device architecture (e.g., bulk)complement: complementary material (e.g., PC61BM/PC71BM)HOMO,LUMO: energy levels (commonly in eV; values typically negative)electrochemical_gap,optical_gap: gap-related quantities (commonly in eV)PCE: power conversion efficiency (commonly %)V_OC: open-circuit voltage (commonly V)J_SC: short-circuit current density (commonly mA/cm²; see original file for units)fill_factor: fill factor (raw data may store it in percent-like values)
Missing values can appear as nan.
PFD.csv
Header:
Nickname,PCE_max(%),PCE_ave(%),Voc,Jsc,FF,Mw,Mn,PDI,Monomer,HOMO,LUMO,bandgap,SMILES
Nickname: material/polymer nicknamePCE_max(%),PCE_ave(%): max/average PCE (percent)Voc,Jsc,FF: device metricsMw,Mn,PDI: molecular weight related fieldsMonomer: monomer-related field (kept as-is)HOMO,LUMO,bandgap: electronic propertiesSMILES: structure SMILES
NFA.csv and PD.csv
Both share the same header (kept exactly as in the original CSV, including quotes/hyphens):
PCE_max(%),PCE_ave(%),Jsc(mA/cm2),FF,Voc(V),HOMO_n(eV),'-LUMO_n(eV),Eg_n(eV),n(SMILES),M (g/mol),HOMO_n(eV),'-LUMO_n(eV),Eg_n(eV),p(SMILES),Mw (kg/mol),Mn(kg/mol),PDI
This can be interpreted as a paired-material record (n / p) with device performance:
PCE_max(%),PCE_ave(%),Jsc(mA/cm2),FF,Voc(V): device performance- First group (
... n(SMILES)): n-side material properties and SMILES M (g/mol): molecular mass field (unit in header)- Second group (
... p(SMILES)): p-side material properties and SMILES
(column names are not renamed in the raw file) Mw (kg/mol),Mn(kg/mol),PDI: molecular-weight related fields (units in headers)
How to Use
This repository provides raw CSVs. Example:
import pandas as pd
df_cepdb = pd.read_csv("CEPDB.csv")
df_hopv = pd.read_csv("HOPV.csv")
df_pfd = pd.read_csv("PFD.csv")
df_nfa = pd.read_csv("NFA.csv")
df_pd = pd.read_csv("PD.csv")
For ring-graph construction and training, use the scripts in the RingFormer GitHub repository (e.g., generate_ring_graphs.py, train.py as described in the upstream README).
Citation
If you use this dataset, please cite:
@inproceedings{ding2025ringformer,
title={RingFormer: a ring-enhanced graph transformer for organic solar cell property prediction},
author={Ding, Zhihao and Zhang, Ting and Li, Yiran and Shi, Jieming and Zhang, Chen Jason},
booktitle={Proceedings of the AAAI Conference on Artificial Intelligence},
volume={39},
number={1},
pages={155--163},
year={2025}
}
License
This repository republishes the original CSV tables used by RingFormer for reproducibility and re-processing. Please refer to the upstream RingFormer GitHub repository for licensing/usage terms of the data. If the upstream repository does not clearly specify a license for the data, please verify compliance before downstream use.
- Downloads last month
- 75