blob_id stringlengths 40 40 | directory_id stringlengths 40 40 | path stringlengths 3 616 | content_id stringlengths 40 40 | detected_licenses listlengths 0 112 | license_type stringclasses 2
values | repo_name stringlengths 5 115 | snapshot_id stringlengths 40 40 | revision_id stringlengths 40 40 | branch_name stringclasses 777
values | visit_date timestamp[us]date 2015-08-06 10:31:46 2023-09-06 10:44:38 | revision_date timestamp[us]date 1970-01-01 02:38:32 2037-05-03 13:00:00 | committer_date timestamp[us]date 1970-01-01 02:38:32 2023-09-06 01:08:06 | github_id int64 4.92k 681M ⌀ | star_events_count int64 0 209k | fork_events_count int64 0 110k | gha_license_id stringclasses 22
values | gha_event_created_at timestamp[us]date 2012-06-04 01:52:49 2023-09-14 21:59:50 ⌀ | gha_created_at timestamp[us]date 2008-05-22 07:58:19 2023-08-21 12:35:19 ⌀ | gha_language stringclasses 149
values | src_encoding stringclasses 26
values | language stringclasses 1
value | is_vendor bool 2
classes | is_generated bool 2
classes | length_bytes int64 3 10.2M | extension stringclasses 188
values | content stringlengths 3 10.2M | authors listlengths 1 1 | author_id stringlengths 1 132 |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
503cbc78d9f6e0910d577259e1c733d92a4a3a30 | 2eff2b24d5b6f5dffc42c9cbde6102ec9317502f | /src/Calculator.py | 8893fae57e0cb5134c33ea8b75b81954ec9c8cbf | [] | no_license | JakobKallestad/Python-Kattis | 599a14e71a8d5c52aae779b8db3d35f0e4d01e88 | 51656964e79cc861e53f574785aacb213ef10b46 | refs/heads/master | 2022-10-24T23:12:45.599813 | 2021-12-08T12:31:54 | 2021-12-08T12:31:54 | 156,881,692 | 2 | 1 | null | 2022-10-02T12:36:57 | 2018-11-09T15:34:09 | Python | UTF-8 | Python | false | false | 147 | py |
while True:
try:
line = input()
result = eval(line)
print("{:.2f}".format(result))
except EOFError:
break
| [
"Jakob.Kallestad@student.uib.no"
] | Jakob.Kallestad@student.uib.no |
5e502e6a8f31e345307af4c6bcc63e0a2132c326 | 4dbaea97b6b6ba4f94f8996b60734888b163f69a | /LeetCode/48.py | c4d4841c02151f4c9dd1b1d227a3fef532cd49d0 | [] | no_license | Ph0en1xGSeek/ACM | 099954dedfccd6e87767acb5d39780d04932fc63 | b6730843ab0455ac72b857c0dff1094df0ae40f5 | refs/heads/master | 2022-10-25T09:15:41.614817 | 2022-10-04T12:17:11 | 2022-10-04T12:17:11 | 63,936,497 | 2 | 0 | null | null | null | null | UTF-8 | Python | false | false | 667 | py | class Solution:
def rotate(self, matrix):
"""
:type matrix: List[List[int]]
:rtype: void Do not return anything, modify matrix in-place instead.
"""
matrix_len = len(matrix)
for i in range(matrix_len // 2):
for j in range(matrix_len - matrix_len //... | [
"54panguosheng@gmail.com"
] | 54panguosheng@gmail.com |
d41c16e629b4e5deaf26083d8fcecd79a433675b | 7f4191f0e12a70d465b15762ce83b57b4976d448 | /Chapter8/Xtreme_InjectCrawler/XtremeWebAPP/xtreme_server/migrations/0006_initial.py | 27e52ef1bae65d1cc75b98e05ce6a9b297056084 | [] | no_license | PacktPublishing/Hands-On-Penetration-Testing-with-Python | 33f72df57b9158e002f78330c1242e1fde777898 | 7b11c8e63e4ac350ba138161f60f7ce4c08ed7cd | refs/heads/master | 2023-02-06T04:52:12.475428 | 2023-01-30T10:03:47 | 2023-01-30T10:03:47 | 131,272,051 | 79 | 40 | null | null | null | null | UTF-8 | Python | false | false | 12,669 | py | # -*- coding: utf-8 -*-
from south.utils import datetime_utils as datetime
from south.db import db
from south.v2 import SchemaMigration
from django.db import models
class Migration(SchemaMigration):
def forwards(self, orm):
# Adding model 'Project'
db.create_table(u'xtreme_server_proje... | [
"furqankhan08@gmail.com"
] | furqankhan08@gmail.com |
2751437f81253f6762b521912bf1187f9551bfb7 | bfdab27f224d9cac02e319fe55b53172fbf8d1a2 | /motion_editor_core/data/atlas_old/motions/drive_pull_right.py | a5356f2535ecc1d9343c53befe481a534536d151 | [] | no_license | tu-darmstadt-ros-pkg/motion_editor | c18294b4f035f737ff33d1dcbdfa87d4bb4e6f71 | 178a7564b18420748e1ca4413849a44965823655 | refs/heads/master | 2020-04-06T12:37:30.763325 | 2016-09-15T14:11:48 | 2016-09-15T14:11:48 | 35,028,245 | 2 | 3 | null | 2015-05-05T13:20:27 | 2015-05-04T10:18:22 | Python | UTF-8 | Python | false | false | 2,338 | py | { 'drive_pull_right': { 'l_arm': [],
'l_leg': [],
'r_arm': [ { 'duration': 1.0,
'name': u'vm_arm_r_retract_up',
'positions': [ -0.2258,
-0.5361,
... | [
"martin.sven.oehler@gmail.com"
] | martin.sven.oehler@gmail.com |
7e7db89059aa6482d6801ca06d86ca389c337e25 | 4ca821475c57437bb0adb39291d3121d305905d8 | /models/research/swivel/vecs.py | 61a2b7a852dd4c1a577d240c1c990423ddcbb77c | [
"Apache-2.0"
] | permissive | yefcion/ShipRec | 4a1a893b2fd50d34a66547caa230238b0bf386de | c74a676b545d42be453729505d52e172d76bea88 | refs/heads/master | 2021-09-17T04:49:47.330770 | 2018-06-28T02:25:50 | 2018-06-28T02:25:50 | 112,176,613 | 0 | 1 | null | null | null | null | UTF-8 | Python | false | false | 3,226 | py | # Copyright 2016 Google Inc. All Rights Reserved.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable ... | [
"yefcion@163.com"
] | yefcion@163.com |
f9bcb3dcc1970423f97e39ba9072f214fd2b4bf9 | a2a14995c95e024644623ea26add2f27d186ea16 | /go.py | dff7c109c90a18c87abe03834f8ab27f33530049 | [
"MIT"
] | permissive | swdevbali/lit | 89db51ae912770ac4030a3c491ad775a68b95a4b | dbc01ee8e4e600a0a43e49ffd18873653cc3f7cc | refs/heads/master | 2021-01-21T00:25:50.001045 | 2013-02-16T13:52:50 | 2013-02-16T13:52:50 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 5,447 | py | #!/usr/bin/env python
# -*- coding: utf-8 -*-
import windows as winutils
from datetime import datetime
from utils import Query
from PyQt4.QtCore import (
Qt,
QAbstractListModel,
QMutex,
QMutexLocker
)
import itertools
import logging
from lcs import lcs
NAME_LIMIT = 42
class Task(object):
def _... | [
"answeror@gmail.com"
] | answeror@gmail.com |
0659d7826f012a4a77173ff1cd94f53a96dcf0ad | 1db2e2238b4ef9c1b6ca3b99508693ee254d6904 | /develop/align_atoms/make_alignment.py | e2c2c5a27921bc05091c8e561cda56f058e951c7 | [] | no_license | pgreisen/pythonscripts | 8674e08095f76edf08ef2059300349218079724c | 0aadf8f96d19b306c1bc44a772e766a06fe3408b | refs/heads/master | 2021-07-06T23:54:57.774342 | 2021-06-08T19:36:36 | 2021-06-08T19:36:36 | 22,017,192 | 3 | 0 | null | null | null | null | UTF-8 | Python | false | false | 3,251 | py | import os,shutil,sys
from translate_rotate import *
class pdbfile:
# Requires floating point number
# Returns floating point with correct
# number of digits for pdb
def set_number_digits(self,number):
return '%.3f' %number
def set_length_digit(self,number):
lngth = len(number)
if lngth == 7:
return ' ... | [
"pgreisen@gmail.com"
] | pgreisen@gmail.com |
226c4d09fa5cdc1ca4d9713500b37dcc362f0d99 | 15f321878face2af9317363c5f6de1e5ddd9b749 | /solutions_python/Problem_142/671.py | 10347da035e5343026f9408225894450ce90b99c | [] | no_license | dr-dos-ok/Code_Jam_Webscraper | c06fd59870842664cd79c41eb460a09553e1c80a | 26a35bf114a3aa30fc4c677ef069d95f41665cc0 | refs/heads/master | 2020-04-06T08:17:40.938460 | 2018-10-14T10:12:47 | 2018-10-14T10:12:47 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,367 | py |
def parseString(word):
dico = []
c = word[0]
cpt = 0
for i in xrange(len(word)):
if c != word[i]:
dico.append((word[i-1],cpt))
cpt = 1
c = word[i]
else:
cpt += 1
c = word[i]
dico.append((word[len(word)-1],cpt))
return dico
def checkSize(tab):
occ = len(tab[0])
for... | [
"miliar1732@gmail.com"
] | miliar1732@gmail.com |
d01277bf95b44d3ea01150d8c57d628e1b8f6eb4 | 163bbb4e0920dedd5941e3edfb2d8706ba75627d | /Code/CodeRecords/2180/60671/249029.py | 9b092ed28dbaf417cbff0c51b1ee7e7e1ab2000a | [] | no_license | AdamZhouSE/pythonHomework | a25c120b03a158d60aaa9fdc5fb203b1bb377a19 | ffc5606817a666aa6241cfab27364326f5c066ff | refs/heads/master | 2022-11-24T08:05:22.122011 | 2020-07-28T16:21:24 | 2020-07-28T16:21:24 | 259,576,640 | 2 | 1 | null | null | null | null | UTF-8 | Python | false | false | 339 | py | s1=input()
s2=input()
list1=[]
list2=[]
for x in range(len(s1)):
for i in range(len(s1) - x):
list1.append(s1[i:i + x + 1])
for x in range(len(s2)):
for i in range(len(s2) - x):
list2.append(s2[i:i + x + 1])
list1.sort()
list2.sort()
count=0
for mem in list1:
if(mem in list2):
count+... | [
"1069583789@qq.com"
] | 1069583789@qq.com |
e0beeb0e7fa4d5516f5433f69c91e40e77eabe06 | 659f10ae3ad036bbb6293b0cd585a4be2bc2dcc9 | /containers/migrations/0005_auto__add_field_container_meta.py | 7d9c7a532d2fabdceeeb662c0217c38e40611106 | [
"LicenseRef-scancode-warranty-disclaimer",
"Apache-2.0"
] | permissive | newrelic/shipyard | e58649adf46b65e30ea93307c53b064abc4495dc | e4e990583a646b77e7e1767682e1ecf94c278fb8 | refs/heads/master | 2023-07-22T11:47:31.472994 | 2013-09-27T19:13:37 | 2013-09-27T19:13:37 | 12,735,507 | 3 | 2 | null | 2023-07-06T03:58:58 | 2013-09-10T17:08:31 | Python | UTF-8 | Python | false | false | 5,101 | py | # -*- coding: utf-8 -*-
import datetime
from south.db import db
from south.v2 import SchemaMigration
from django.db import models
class Migration(SchemaMigration):
def forwards(self, orm):
# Adding field 'Container.meta'
db.add_column(u'containers_container', 'meta',
self.gf... | [
"ejhazlett@gmail.com"
] | ejhazlett@gmail.com |
f2bd9de4477cbf1af26d5d888aac1a5feddc1061 | 52b7ce215acacee6b3021793f36a3f3eba7196e0 | /tdi/util.py | c409d6e869390f41c5195340a1d18630d02548c9 | [
"Apache-2.0"
] | permissive | AvdN/tdi | 2829c545bdf08148db2a4d2d848ea731b920d2e3 | 5617ec1b1d9553fee537c55ae9e0eef8553fd101 | refs/heads/master | 2020-12-30T23:08:23.816115 | 2013-10-14T20:57:01 | 2013-10-14T20:57:01 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 18,696 | py | # -*- coding: ascii -*-
u"""
:Copyright:
Copyright 2006 - 2013
Andr\xe9 Malo or his licensors, as applicable
:License:
Licensed under the Apache License, Version 2.0 (the "License");
you may not use this file except in compliance with the License.
You may obtain a copy of the License at
http://www.apache.... | [
"ndparker@users.noreply.github.com"
] | ndparker@users.noreply.github.com |
03da3037aa5075dd5cc26a9b6f22f10ac33ea3dc | 3cc8af76b1fd487eea86610d7a07f477afeab048 | /setup.py | da827dc7ffda6b32ae816d398f0fb9cec5e512e5 | [
"Apache-2.0",
"CC-BY-NC-SA-4.0"
] | permissive | expresschen/HanLP | 20ff6d03b01b508e4395ea3532e8af712e065ebf | 24b48966e90dfafa1faa65765eb6f35e19cac801 | refs/heads/doc-zh | 2023-07-13T10:16:30.231114 | 2020-02-15T17:19:28 | 2021-08-24T02:15:49 | 401,305,599 | 1 | 0 | Apache-2.0 | 2021-08-30T10:37:28 | 2021-08-30T10:37:27 | null | UTF-8 | Python | false | false | 1,990 | py | # -*- coding:utf-8 -*-
# Author: hankcs
# Date: 2019-12-28 19:26
from os.path import abspath, join, dirname
from setuptools import find_packages, setup
this_dir = abspath(dirname(__file__))
with open(join(this_dir, 'README.md'), encoding='utf-8') as file:
long_description = file.read()
version = {}
with open(join(... | [
"jfservice@126.com"
] | jfservice@126.com |
4c5824d086f61db8d6a64e10bf494165a522f574 | 187a6558f3c7cb6234164677a2bda2e73c26eaaf | /jdcloud_sdk/services/ag/models/UpdateStepAsRuleSpec.py | defba859f89b925fee619a7ec0fa42170e4f650c | [
"Apache-2.0"
] | permissive | jdcloud-api/jdcloud-sdk-python | 4d2db584acc2620b7a866af82d21658cdd7cc227 | 3d1c50ed9117304d3b77a21babe899f939ae91cd | refs/heads/master | 2023-09-04T02:51:08.335168 | 2023-08-30T12:00:25 | 2023-08-30T12:00:25 | 126,276,169 | 18 | 36 | Apache-2.0 | 2023-09-07T06:54:49 | 2018-03-22T03:47:02 | Python | UTF-8 | Python | false | false | 1,341 | py | # coding=utf8
# Copyright 2018 JDCLOUD.COM
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed ... | [
"jdcloud-api@jd.com"
] | jdcloud-api@jd.com |
84191deb0a80f8875e115aa3f5eae0046025e1d7 | ca7aa979e7059467e158830b76673f5b77a0f5a3 | /Python_codes/p04031/s251975826.py | 5d8d02c8d8407057ca16c1bec6857fff705531e1 | [] | no_license | Aasthaengg/IBMdataset | 7abb6cbcc4fb03ef5ca68ac64ba460c4a64f8901 | f33f1c5c3b16d0ea8d1f5a7d479ad288bb3f48d8 | refs/heads/main | 2023-04-22T10:22:44.763102 | 2021-05-13T17:27:22 | 2021-05-13T17:27:22 | 367,112,348 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 400 | py | import math
import collections
import fractions
import itertools
import functools
import operator
def solve():
n = int(input())
a = list(map(int, input().split()))
cost = []
for i in range(-100, 101):
ramen = 0
for j in range(n):
ramen += abs(a[j]-i)**2
cost.append(r... | [
"66529651+Aastha2104@users.noreply.github.com"
] | 66529651+Aastha2104@users.noreply.github.com |
f95f8a329e6279fc0ee59df351c887432ee6fec1 | 93736e8d0d5517eb73af91eeda6e9b0f4b07439e | /Python/Intro_Python/exercise3.py | e85c0cc0eae27917d1839cebdafb0e37e1cd146e | [] | no_license | aayushgupta97/TTN | 0de1a5d3a25d7399d68a81ea51f17233f81029e0 | 324466cbdf0a9b0953dd4ae574bd0b3f753c4fd7 | refs/heads/master | 2020-04-21T12:18:25.721602 | 2019-04-15T11:09:13 | 2019-04-15T11:09:13 | 169,557,867 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,564 | py | from abc import ABC, abstractmethod
class Box(ABC):
def add(self, *items):
raise NotImplementedError()
def empty(self):
raise NotImplementedError()
def count(self):
raise NotImplementedError()
class Item():
def __init__(self, name, value):
self.name = name
se... | [
"aayushgupta2097@gmail.com"
] | aayushgupta2097@gmail.com |
f2e9d1fa4f806aa5430bcc405d3ed2f4ea3e94d2 | ca7aa979e7059467e158830b76673f5b77a0f5a3 | /Python_codes/p03165/s926838179.py | 74a1ba1007c89e718147b0b4242828dcbc0a88f7 | [] | no_license | Aasthaengg/IBMdataset | 7abb6cbcc4fb03ef5ca68ac64ba460c4a64f8901 | f33f1c5c3b16d0ea8d1f5a7d479ad288bb3f48d8 | refs/heads/main | 2023-04-22T10:22:44.763102 | 2021-05-13T17:27:22 | 2021-05-13T17:27:22 | 367,112,348 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 594 | py | s = input()
t = input()
dp = [[0]*(len(t)+1) for _ in range(len(s)+1)]
for i in range(len(s)):
for j in range(len(t)):
if s[i]==t[j]:
dp[i+1][j+1] = dp[i][j]+1
else:
if dp[i+1][j] < dp[i][j+1]:
dp[i+1][j+1] = dp[i][j+1]
else:
dp[i+1... | [
"66529651+Aastha2104@users.noreply.github.com"
] | 66529651+Aastha2104@users.noreply.github.com |
e91848d3129b01eeac17497f4be7ff57f9e5a2d5 | 215cafb0a79338a2a268c19629f07df20cf68f76 | /venv/bin/pip-3.8 | 6de21cb3dcc8b330bf64648feb3896c8b6bb5f2d | [] | no_license | safwanvk/erp | c95741c5873ebaa53a8a96093928745e02000be9 | d4e427dbb6b71eb9aa6e2d15a039e2e669c53cbe | refs/heads/master | 2022-12-08T12:38:36.817514 | 2020-08-16T15:10:55 | 2020-08-16T15:10:55 | 287,913,687 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 262 | 8 | #!/home/safwan/Desktop/projects/erp-pro/erp/venv/bin/python
# -*- coding: utf-8 -*-
import re
import sys
from pip._internal.cli.main import main
if __name__ == '__main__':
sys.argv[0] = re.sub(r'(-script\.pyw|\.exe)?$', '', sys.argv[0])
sys.exit(main())
| [
"safwanvalakundil@gmail.com"
] | safwanvalakundil@gmail.com |
9f2833105773edd29e1268cc3705ad9ff9dc2a1c | 98be00ee32971cade82d10c067aff532c3394a62 | /Competitions/Xtreme/xplore.py | f6e47c98fc808d7cc0c5fe1f897956f31365aa4a | [] | no_license | vigneshhari/Competitive_solutions | 5ab34933ea8d84eab67bdef9bb9e4562f6b90782 | 7a35e1386e5cff71cb5746b6797ccc0f03ceb3f4 | refs/heads/master | 2023-01-11T02:53:01.456863 | 2022-12-29T13:50:03 | 2022-12-29T13:50:03 | 115,146,700 | 4 | 2 | null | 2019-10-26T09:15:03 | 2017-12-22T20:03:51 | Python | UTF-8 | Python | false | false | 4,010 | py | import json
from collections import defaultdict
authors_citations = defaultdict(list)
for i in range(input()):
data = raw_input()
temp = json.loads(data)
citation_count = temp["citing_paper_count"]
for i in temp["authors"]["authors"]:
authors_citations[i["full_name"]].append(citation_count)
a... | [
"vichuhari100@gmail.com"
] | vichuhari100@gmail.com |
6d57c6855dd53ede783641ec65bed681aa69e10a | 1196fe960947b4a7d6bba5df6cdfc7010bb118fb | /examples/apikeys/apikeys.py | 8b921f815ddb9dc3eea6e33e1ad7b042f43026be | [
"MIT"
] | permissive | Nextdoor/sendgrid-python | a4afe5cda9015c7cf6a3a1303785fda05e844277 | a7c834b6391775b796969ef65a3ef259ccabf0f0 | refs/heads/master | 2021-01-22T11:12:08.221546 | 2016-04-22T21:20:07 | 2016-04-22T21:20:07 | 56,885,507 | 0 | 0 | null | 2016-04-22T21:11:50 | 2016-04-22T21:11:49 | null | UTF-8 | Python | false | false | 1,657 | py | import sendgrid
import json
import os
sg = sendgrid.SendGridAPIClient(apikey='YOUR_SENDGRID_API_KEY')
# You can also store your API key an .env variable 'SENDGRID_API_KEY'
##################################################
# List all API Keys belonging to the authenticated user #
# GET /api_keys #
response = sg.clie... | [
"elmer@thinkingserious.com"
] | elmer@thinkingserious.com |
df55ffe5751d160215654f44ca59df406536a410 | c03edd979ad6fd4a8abd155e3e63bcefbd93d5c2 | /Image/band_stats.py | 7b83630a66a15155d6b74a944ca88a2b17ef34e5 | [
"MIT"
] | permissive | xiangtaoxu/earthengine-py-examples | 538dafc88a22a351b762ba02df09db583df955bb | 76ae8e071a71b343f5e464077afa5b0ed2f9314c | refs/heads/master | 2022-11-03T03:16:11.933616 | 2020-06-12T15:47:52 | 2020-06-12T15:47:52 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,987 | py |
import ee
import geemap
# Create a map centered at (lat, lon).
Map = geemap.Map(center=[40, -100], zoom=4)
# get highest value
def maxValue(img, scale=30):
max_value = img.reduceRegion(**{
'reducer': ee.Reducer.max(),
'geometry': img.geometry(),
'scale': scale,
'maxPixels': 1e9
... | [
"giswqs@gmail.com"
] | giswqs@gmail.com |
9242782550ab6ddf1a26238b272e633e1ed1d3c8 | c342c8b9b2437d6474b9ae7da154ba47c6fc447c | /src/data/memory_store.py | 81d6cb406f3ba13f5011c2669584a64d0cdc0b4a | [] | no_license | nezaj/menu-api | 0d5118f3a1392f85e51700b5e8ac234bac605518 | bcf759b91893bf72821323c41f963923d9184e68 | refs/heads/master | 2021-01-10T07:09:15.664561 | 2015-11-16T21:28:45 | 2015-11-16T21:28:45 | 44,832,757 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 2,572 | py | """
Store implementation using in-memory data
"""
import json
import os
from .store_interface import StoreInterface
class MemoryStore(object):
__implements__ = (StoreInterface, )
def __init__(self, data_dir):
self.data_dir = data_dir
self.data = self._load_data(data_dir)
def _load_data(s... | [
"joeaverbukh@gmail.com"
] | joeaverbukh@gmail.com |
7ebec6c0a7924a9438dc5a473cc822f219125df8 | 402ed5374ab189c8599b56864c5ce066f34b26c6 | /tests/test_pdf_normal.py | e1fa17bd053bb3771266064aae86ee311b5c241c | [
"BSD-3-Clause"
] | permissive | kailiu77/zfit | db354e9c3eb4a41274af5363834fe231823c6d66 | 8bddb0ed3a0d76fde0aa2cdbf74434b0ee0ae8bb | refs/heads/master | 2020-10-01T23:49:55.751825 | 2019-12-06T15:48:47 | 2019-12-06T15:48:47 | 227,650,723 | 1 | 0 | BSD-3-Clause | 2019-12-12T16:33:54 | 2019-12-12T16:33:53 | null | UTF-8 | Python | false | false | 2,899 | py | # Copyright (c) 2019 zfit
import numpy as np
import pytest
import tensorflow as tf
import zfit
from zfit import Parameter
from zfit.models.dist_tfp import Gauss
from zfit.core.testing import setup_function, teardown_function, tester
mu1_true = 1.
mu2_true = 2.
mu3_true = 0.6
sigma1_true = 1.4
sigma2_true = 2.3
si... | [
"mayou36@jonas.eschle.com"
] | mayou36@jonas.eschle.com |
3e70f5bce473ccd4c866c43a7f594f03af071dca | f569978afb27e72bf6a88438aa622b8c50cbc61b | /douyin_open/EnterprisePersonaPersonaCreate/api/__init__.py | d436a85b96fd99e2b5e5d7a6b654b4348bb48850 | [] | no_license | strangebank/swagger-petstore-perl | 4834409d6225b8a09b8195128d74a9b10ef1484a | 49dfc229e2e897cdb15cbf969121713162154f28 | refs/heads/master | 2023-01-05T10:21:33.518937 | 2020-11-05T04:33:16 | 2020-11-05T04:33:16 | 310,189,316 | 1 | 0 | null | null | null | null | UTF-8 | Python | false | false | 208 | py | from __future__ import absolute_import
# flake8: noqa
# import apis into api package
from douyin_open.EnterprisePersonaPersonaCreate.api.enterprise_im_persona_create_api import EnterpriseImPersonaCreateApi
| [
"strangebank@gmail.com"
] | strangebank@gmail.com |
d44f23bdc3a2ebd7b826cebb9d784a04528b90e6 | 5af277b5819d74e61374d1d78c303ac93c831cf5 | /tabnet/experiment_covertype.py | c00ea76b7c9058be7df642fae0d69184a435f921 | [
"Apache-2.0"
] | permissive | Ayoob7/google-research | a2d215afb31513bd59bc989e09f54667fe45704e | 727ec399ad17b4dd1f71ce69a26fc3b0371d9fa7 | refs/heads/master | 2022-11-11T03:10:53.216693 | 2020-06-26T17:13:45 | 2020-06-26T17:13:45 | 275,205,856 | 2 | 0 | Apache-2.0 | 2020-06-26T16:58:19 | 2020-06-26T16:58:18 | null | UTF-8 | Python | false | false | 6,699 | py | # coding=utf-8
# Copyright 2020 The Google Research Authors.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicab... | [
"copybara-worker@google.com"
] | copybara-worker@google.com |
7d8af894f2c76cc47cf868d00ed53d834dc11006 | 138f2550bb088a0597e1e71124d9ae32b1fe59c9 | /xbrr/edinet/reader/element_schema.py | b78030ff98b2a4b89b4ca5131bc6e0a11deb5645 | [
"MIT"
] | permissive | chakki-works/xbrr | 9009539e1821c3d9c815f694eb52158ccbbeeb78 | a9783acbb6c23eb0be0e1fbfb47e5b0b0e2cbfb8 | refs/heads/master | 2022-07-22T22:30:17.054418 | 2021-06-16T13:27:40 | 2021-06-16T13:27:40 | 182,622,738 | 23 | 5 | MIT | 2022-07-15T18:42:36 | 2019-04-22T04:26:21 | Python | UTF-8 | Python | false | false | 1,947 | py | from xbrr.base.reader.base_element_schema import BaseElementSchema
class ElementSchema(BaseElementSchema):
def __init__(self,
name="", reference="", label="", alias="",
abstract="", data_type="",
period_type="", balance=""):
super().__init__()
se... | [
"icoxfog417@yahoo.co.jp"
] | icoxfog417@yahoo.co.jp |
bb394288997b3ae09c3bf5e93b767c0a5aa8fcdb | 7ad616ab89e9b67bd27df2df3c8ca7487c5e4564 | /ood/4_stack_overflow.py | 102433a9d98dbc8f0d47c4101d2b370291a90a1b | [] | no_license | zihuaweng/algorithm-snacks | cd7643c7d80d0bcb680336231214c1700fe74cc9 | aa3d88f861bb8b0aceb7ef6c6d05523f54202d77 | refs/heads/master | 2023-01-13T11:03:04.395542 | 2020-11-10T04:42:41 | 2020-11-10T04:42:41 | 149,380,311 | 1 | 1 | null | null | null | null | UTF-8 | Python | false | false | 3,997 | py | #!/usr/bin/env python3
# coding: utf-8
class QuestionStatus(Enum):
OPEN, CLOSED, ON_HOLD, DELETED = 1, 2, 3, 4
class QuestionClosingRemark(Enum):
DUPLICATE, OFF_TOPIC, TOO_BROAD, NOT_CONSTRUCTIVE, NOT_A_REAL_QUESTION, PRIMARILY_OPINION_BASED = 1, 2, 3, 4, 5, 6
class AccountStatus(Enum):
ACTIVE, CLOSED, CANC... | [
"zihuaw2@uci.edu"
] | zihuaw2@uci.edu |
b208e49da531e72d4264b91f912ebd1523d749d6 | 731c3f2f85f6002725322eedc0b2c8b5e74f610e | /0-jakc/jakc_hr/__openerp__.py | 2df1fff1bd5ba0cb87ac4230b96c9fe3ed3e6001 | [] | no_license | babarlhr/project-0021 | 1ac824657f893c8f25d6eb3b839051f350d7cc9d | e30b8a9f5d2147d3ca5b56b69ec5dbd22f712a91 | refs/heads/master | 2021-09-22T15:45:47.431000 | 2018-09-11T14:59:49 | 2018-09-11T14:59:52 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 398 | py | # -*- coding: utf-8 -*-
{
'name': 'Jakc Labs - HR Enhancement',
'version': '9.0.0.1.0',
'category': 'General',
'license': 'AGPL-3',
'summary': 'HR Enchancement',
'author': "Jakc Labs",
'website': 'http://www.jakc-labs.com/',
'depends': [
'hr'
],
'data': [
'views/... | [
"wahhid@gmail.com"
] | wahhid@gmail.com |
91b6b76a311bc1f86fdb741e4608f8220dbde146 | 30d61ce0b728f31a830db6b6b1954a32551990b2 | /src/gui_config/custom/sr_source_mode_tab.py | b2a24e0a0387ec82695aca2a32af5633db14603c | [
"MIT"
] | permissive | hgiesel/anki_set_randomizer | 6755dc8489b703887c55a5427bbbdab858f58a65 | 1a9a22480eb6c0e7f421dc08d36d14920e43dd3e | refs/heads/master | 2022-08-24T05:45:13.339132 | 2020-01-15T17:04:26 | 2020-01-30T13:56:50 | 197,258,760 | 5 | 0 | MIT | 2022-07-20T17:28:42 | 2019-07-16T19:56:27 | JavaScript | UTF-8 | Python | false | false | 1,391 | py | from aqt.qt import QWidget
from ...lib.config import deserialize_source_mode, deserialize_cloze_options, deserialize_occlusion_options
from ..sr_source_mode_tab_ui import Ui_SRSourceModeTab
class SRSourceModeTab(QWidget):
def __init__(self):
super().__init__()
self.ui = Ui_SRSourceModeTab()
... | [
"hengiesel@gmail.com"
] | hengiesel@gmail.com |
223bd273f49b7e533b590ec4dc1f9394ef62d3c7 | bfbe642d689b5595fc7a8e8ae97462c863ba267a | /bin/Python27/Lib/site-packages/OMPython/OMTypedParser.py | a0e4c90b6d536f97341c456f18de90f519d82e80 | [
"MIT",
"LicenseRef-scancode-other-permissive"
] | permissive | mcanthony/meta-core | 0c0a8cde1669f749a4880aca6f816d28742a9c68 | 3844cce391c1e6be053572810bad2b8405a9839b | refs/heads/master | 2020-12-26T03:11:11.338182 | 2015-11-04T22:58:13 | 2015-11-04T22:58:13 | 45,806,011 | 1 | 0 | null | 2015-11-09T00:34:22 | 2015-11-09T00:34:22 | null | UTF-8 | Python | false | false | 4,041 | py | #!/usr/bin/env python
# -*- coding: utf-8 -*-
__author__ = "Martin Sjölund"
__license__ = """
This file is part of OpenModelica.
Copyright (c) 1998-CurrentYear, Open Source Modelica Consortium (OSMC),
c/o Linköpings universitet, Department of Computer and Information Science,
SE-58183 Linköping, Sweden.
... | [
"kevin.m.smyth@gmail.com"
] | kevin.m.smyth@gmail.com |
6ddbc8154053d1a105be3ce47e7b58a27e253eb8 | de479d4a8af0e070b2bcae4186b15a8eb74971fb | /cn/iceknc/study/k_python_mini_web/__init__.py | 2c29f9732decc87fd29a825cf08dd49ab11e8eb8 | [] | no_license | iceknc/python_study_note | 1d8f6e38be57e4dc41a661c0a84d6ee223c5a878 | 730a35890b77ecca3d267fc875a68e96febdaa85 | refs/heads/master | 2020-05-19T18:44:55.957392 | 2019-09-27T01:15:54 | 2019-09-27T01:15:54 | 185,160,232 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 152 | py | # -*- coding: utf-8 -*-
# @Author: 徐志鹏
# @Date : 2019/5/29
# @Desc :
def main():
pass
if __name__ == "__main__":
main()
| [
"xzhipeng@lifecare.cn"
] | xzhipeng@lifecare.cn |
f66be245d49c0500c212fbf3f7565976f9419b1f | 80755ce68bf894bfa7c7cec50051b18a6069c552 | /nkamg_malware/collector/samples/file_monitor.py | 0d59cd857a599c427bd46b6fa686fa151a915729 | [
"Apache-2.0"
] | permissive | NKQiuKF/malware_update | 6538c9308dd7b476b687fca4ea120209207257bc | a875b5011fee2486da5618e01da61d730d6ac0dd | refs/heads/master | 2022-10-17T09:08:34.605641 | 2019-09-02T09:00:45 | 2019-09-02T09:00:45 | 205,817,190 | 0 | 0 | null | 2022-10-06T18:33:50 | 2019-09-02T08:59:47 | JavaScript | UTF-8 | Python | false | false | 2,497 | py | #!/usr/bin/env python
# -*- coding: utf-8 -*-
#Nankai University Information Security
#QiuKF 1055419050@qq.com
#get file results at fixed time
#create processed.csv at sub dirctories
#create Total_File_Data.csv at /collection
from multiprocessing import Process,Pool
import os
import pandas as pd
import time
import sy... | [
"453341288@qq.com"
] | 453341288@qq.com |
8d77c1ca5725c5efe3918715e630d4c0b280af6f | cf803d382d6e0bc7492d787e91a695a2fda944b8 | /model.py | a1971dd66b502e9a7ab9cad39d075165745a907a | [
"BSD-2-Clause"
] | permissive | parenthetical-e/fmri | d676d524cf1606f098864c5bf9e98607674db1ab | 32c5571d8767684ec6586320e85485cd89ed9327 | refs/heads/master | 2021-01-02T22:17:28.243141 | 2020-04-07T06:07:26 | 2020-04-07T06:07:26 | 3,848,746 | 4 | 1 | null | null | null | null | UTF-8 | Python | false | false | 1,361 | py | """
A set of functions for creating or maipulating files needed for design
matrices, both in spm and python.
"""
def spm_onsets(trialfile='', durations=3, recode=None):
"""
Map <trialfile> (a 1d csv) into onset/TR time which is determind by
<durations> (which can be an int if every trial had the same leng... | [
"Erik.Exists@gmail.com"
] | Erik.Exists@gmail.com |
4906a33c2bde49d3d89e48c0aa86f333a1aef478 | 1602b8f6f40e27269a6d9fe42dbc720a5127b175 | /fleet/category.py | 9b756897fb0f2b29b020ab0444a68c1526aa3707 | [] | no_license | mit-jp/fleet-model | a9f581c2cb56196a13e2db8ef883c1f8b61b2682 | 2c1b293299741a076384114572dc74a988bb8581 | refs/heads/master | 2020-04-11T01:30:26.634473 | 2017-01-29T04:08:31 | 2017-01-29T04:08:31 | 32,412,401 | 1 | 1 | null | null | null | null | UTF-8 | Python | false | false | 1,201 | py |
class Category:
"""Rudimentary ordered tree data structure for vehicle classes."""
_parent = None
_children = []
_label = ''
def __init__(self, label, children=dict(), parent=None):
self._parent = parent
self._label = label
try:
self._children = list([Category(k... | [
"mail@paul.kishimoto.name"
] | mail@paul.kishimoto.name |
87e8b16a2d83845e4d137ca080069e56f6a1690d | 6fcfb638fa725b6d21083ec54e3609fc1b287d9e | /python/awentzonline_keras-rtst/keras-rtst-master/keras_rtst/models/style_xfer.py | d88c20d29b26ef489cc52a716031330e201234f5 | [] | no_license | LiuFang816/SALSTM_py_data | 6db258e51858aeff14af38898fef715b46980ac1 | d494b3041069d377d6a7a9c296a14334f2fa5acc | refs/heads/master | 2022-12-25T06:39:52.222097 | 2019-12-12T08:49:07 | 2019-12-12T08:49:07 | 227,546,525 | 10 | 7 | null | 2022-12-19T02:53:01 | 2019-12-12T07:29:39 | Python | UTF-8 | Python | false | false | 5,226 | py | '''Texture Network for style transfer.'''
import time
import keras_vgg_buddy
import numpy as np
from keras import activations
from keras import backend as K
from keras.layers import advanced_activations
from keras.layers.core import Layer
from keras.layers.convolutional import AveragePooling2D
from keras.models import... | [
"659338505@qq.com"
] | 659338505@qq.com |
366ad807aedcc7af54f5060dcaa12dc46f0f7613 | 4beb10c8a8023f4945c996a1487ec1b3968cb5da | /f5_lbaas_dashboard/enabled/_1480_project_loadbalancersv2_panel.py | d89ef94a631dd6c077b8bc716031d61c12c3ef69 | [
"Apache-2.0"
] | permissive | F5Networks/f5-lbaas-dashboard | 7aebb669a27d8ebdc9feaa7f088f9158fb157046 | 62cb1dfbb87c94bdcb3f53f6ec2ab0004ac43d54 | refs/heads/master | 2023-03-28T01:59:58.666570 | 2022-09-27T01:16:34 | 2022-09-27T01:16:34 | 147,327,541 | 0 | 0 | Apache-2.0 | 2022-09-27T01:16:37 | 2018-09-04T10:15:51 | JavaScript | UTF-8 | Python | false | false | 993 | py | # Licensed under the Apache License, Version 2.0 (the "License"); you may
# not use this file except in compliance with the License. You may obtain
# a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# d... | [
"a.zong@f5.com"
] | a.zong@f5.com |
f0708c24fd6f6ad48737cffa37907961622cd1ca | 911e7b25961067339c31957ff41ebdb3c355d948 | /_utils/python/libs_my_test/test_http_util2.py | bce813fa41030ee2228f882b54d33f586e0f1d73 | [] | no_license | qlong2012/notes-1 | c93efcc9a70f786929ef7e4c053e266e2bf354ad | 78913e8235845d4a94dd19f730d607df754da7fe | refs/heads/master | 2020-05-20T01:05:04.678662 | 2019-04-25T10:06:37 | 2019-04-25T10:06:53 | 185,303,355 | 1 | 0 | null | 2019-05-07T02:10:14 | 2019-05-07T02:10:14 | null | UTF-8 | Python | false | false | 17,681 | py | #!python
# -*- coding:utf-8 -*-
"""
公用函数(http请求处理) http_util2.py 的测试
Created on 2019/3/14
Updated on 2019/3/14
@author: Holemar
依赖第三方库:
tornado==3.1.1
通过用线程启动一个 tornado 服务器来测试 http 请求
(使用 mock 的方式需要很了解 urllib 库，暂没那功力，做不到)
todo:测试 压缩 和 线程 时，使用读取日志的方式，不太精确。后续需优化
"""
import os
import logging
import unittest
import t... | [
"daillow@gmail.com"
] | daillow@gmail.com |
5bb9776224c4813a523963dc2805bc70a092fa60 | 40d5394eea0c1288fcdd57180a0141672cb198fa | /users/views.py | d8f37654f883f0bde0e2232915ec025e0a7e6ec4 | [
"MIT"
] | permissive | mornicamwende/ranker | 6c12b0297703ac559de84bb0b36396ec2738f970 | 107bcaad61bb5e726570a8250b55eb2e6245dc7a | refs/heads/master | 2023-01-07T00:18:54.192155 | 2020-10-27T17:07:21 | 2020-10-27T17:07:21 | 306,592,259 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,522 | py | from django.shortcuts import render, redirect
from django.contrib import messages
from .models import Profile
from django.contrib.auth.decorators import login_required
from .forms import UserRegisterForm, UserUpdateForm, ProfileUpdateForm
# Create your views here..
def register(request):
if request.method =='POST... | [
"mornicamwende@gmail.com"
] | mornicamwende@gmail.com |
449e5f4d3e112507dc7540c319584658b70805eb | 560df0c3f859ae2d4c279f4669f9ab8758c486fb | /old/Euler063.py | defeccb9479085d6e4df2722c16167b7442a9de6 | [] | no_license | gronkyzog/Puzzles | 0e7cdd7fa5ab8139d63a721cac5ee30e80728c7a | cdc145857f123a98f1323c95b5744d36ce50355f | refs/heads/master | 2021-03-13T00:01:17.715403 | 2015-02-22T11:59:03 | 2015-02-22T11:59:03 | 17,100,928 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 176 | py | import math
counter = 0
for p in range(1,1000):
for n in range(1,1000):
x = p**n
z = len(str(x))
if z == n:
counter +=1
print counter,p,n,x
if z > n:
break
| [
"smcnicol@gmail.com"
] | smcnicol@gmail.com |
b44c18c0337ef4ede7f2ee27dff0c56a32873a98 | 6b2a8dd202fdce77c971c412717e305e1caaac51 | /solutions_5639104758808576_0/Python/hongkai/standing_ovation.py | 85c7aaf75714250e3ffa80b7c69e7aa3067301b0 | [] | no_license | alexandraback/datacollection | 0bc67a9ace00abbc843f4912562f3a064992e0e9 | 076a7bc7693f3abf07bfdbdac838cb4ef65ccfcf | refs/heads/master | 2021-01-24T18:27:24.417992 | 2017-05-23T09:23:38 | 2017-05-23T09:23:38 | 84,313,442 | 2 | 4 | null | null | null | null | UTF-8 | Python | false | false | 378 | py | fin = open("../../Downloads/A-small-attempt0 (1).in", "r")
out = open("standing_ovation.out", "w")
cases = int(fin.readline())
for i in range(cases):
d, shy = fin.readline().split()
min = 0
curr = 0
for x in shy:
curr += int(x)
curr -= 1
if curr < min:
min = curr
... | [
"eewestman@gmail.com"
] | eewestman@gmail.com |
97f78d057353db5df358e1e31bac1b98392279f5 | 646b0a41238b96748c7d879dd1bf81858651eb66 | /archive/memd.archive/gulp/Potential.py | ac129df6be3cb0a4594a14181a7914d174181b84 | [] | no_license | danse-inelastic/molDynamics | ded0298f8219064e086472299e1383d3dff2dac3 | c8e0bfd9cb65bcfc238e7993b6e7550289d2b219 | refs/heads/master | 2021-01-01T19:42:29.904390 | 2015-05-03T17:27:38 | 2015-05-03T17:27:38 | 34,993,746 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 2,489 | py | #!/usr/bin/env python
#
# ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
#
# Brandon Keith
# California Institute of Technology
# (C) 2005 All Rights Reserved All Rights Reserved
#
# {LicenseText}
#
# ~~~~~~~~~~~~~~~~~~... | [
"jbrkeith@gmail.com"
] | jbrkeith@gmail.com |
9450412ca95624708fe0ba54ba1780d0d0691d95 | 4c639c521834f4349ba2165e72c5857ddecee625 | /acoustic_X_text_X_visual/AttComb_aXtXv/gender/attention_fusion_network/archived_models/archived_model_1_(MSE_best)/metrics.py | 9b7d3a09c1cd9ee948834703374dc115f06d923e | [] | no_license | arbaazQureshi/attention_based_multimodal_fusion_for_estimating_depression | f4ea86746d9961fe4b9cf4f88f6cec604a201656 | e4c57ac51c271c36c244c260b01a22fa1897ffcb | refs/heads/master | 2020-05-19T22:48:03.665953 | 2019-05-06T19:34:31 | 2019-05-06T19:34:31 | 185,252,875 | 7 | 4 | null | null | null | null | UTF-8 | Python | false | false | 1,110 | py | import numpy as np
import sklearn.metrics
from load_data import load_development_data
from load_model import load_model
import os
os.environ["CUDA_VISIBLE_DEVICES"]="1"
if __name__ == "__main__":
model = load_model()
model.load_weights('optimal_weights.h5')
dev_COVAREP_X_FORMANT, dev_facial_X_pose, dev_gaze_X_... | [
"arbaaz.qureshi29@gmail.com"
] | arbaaz.qureshi29@gmail.com |
a2453d90db22aca756d619b74b525d6186f4875d | 699c7f26a91106a2fc79bb15299ce0cee532a2dd | /xrayspecprocessing/multi.combine.group.py | ff57d3b4c05ec312c219fc8fc8133076e2dafd82 | [] | no_license | samconnolly/astro | 70581a4d3f2086716aace3b5db65b74aaaa5df95 | 3731be313592c13dbb8af898e9734b98d83c0cc2 | refs/heads/master | 2020-04-06T03:40:27.454279 | 2014-03-12T14:36:34 | 2014-03-12T14:36:34 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 2,509 | py | # multi.combine.group.py
# Uses the HEADAS tool addspec and grppha to sum sets of spectra, assign their
# summed background and response files and produce a grouped spectrum
# Uses a text file of input spectra. Does so from output file from listbinmin.py
# Sam Connolly 4/3/13
import os
# ====================== PARAM... | [
"sdc1g08@soton.ac.uk"
] | sdc1g08@soton.ac.uk |
d3249edfbd3bfe038c605e6a6c80a59a783bba05 | 4bd5e9b67d98bfcc9611bd8b774c9ab9f4f4d446 | /Python基础笔记/19/代码/2.协程.py | b87a5c7b38c3ac5ebbe4f72a39d93ec54e0ed60b | [] | no_license | zhenguo96/test1 | fe21510aea7feb674e52fd7a86d4177666f841c5 | 0d8de7e73e7e635d26462a0bc53c773d999498be | refs/heads/master | 2020-05-03T13:09:53.592103 | 2019-04-06T07:08:47 | 2019-04-06T07:08:47 | 178,646,627 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 231 | py | # 协程
def sub():
print("开始")
x = yield
print("x = ",x)
y = yield x + 1
print("x = ", x, "y = ", y)
yield
x1 = sub()
next(x1)
print(x1.send(3))
x1.send(4)
| [
"1148421588@qq.com"
] | 1148421588@qq.com |
2e6c96eebb6bfd7df53fac17a2a7426d3b7e2769 | 60eb98538025c61cf94a91f6c96f9ee81dcd3fdf | /monai/metrics/regression.py | 044f99f1a540fd04348675877a6d73fce7eb1cd9 | [
"Apache-2.0",
"LicenseRef-scancode-free-unknown"
] | permissive | gagandaroach/MONAI | 167e7746995d4b6136731881e22ad4df333b16a9 | 79b83d9fac41efae9b90ed2f9ad078d6d664bf64 | refs/heads/master | 2023-06-02T19:54:47.737846 | 2021-06-24T18:34:02 | 2021-06-24T18:34:02 | 270,741,899 | 0 | 0 | Apache-2.0 | 2020-06-08T16:29:32 | 2020-06-08T16:29:31 | null | UTF-8 | Python | false | false | 9,758 | py | # Copyright 2020 - 2021 MONAI Consortium
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
# http://www.apache.org/licenses/LICENSE-2.0
# Unless required by applicable law or agreed to in wri... | [
"noreply@github.com"
] | gagandaroach.noreply@github.com |
29d0e0ec5b2fe97cccdec9c22eb438321a537b2f | 68405fe5bec0b374867f44effda2cba3b6c1ebaa | /src/wscript | f00c671bc10cc29f13fb109cbb091ca449571257 | [] | no_license | unnonouno/oxelon | fce3dfd3d6d617d0268e34ed875e152989d60859 | 3686863b81db2dc23996cf305001e2ad56332086 | refs/heads/master | 2020-04-04T01:53:12.896018 | 2014-01-23T17:08:59 | 2014-01-23T17:08:59 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 51 | def build(bld):
bld.recurse(['oxelon', 'cmd'])
| [
"unnonouno@gmail.com"
] | unnonouno@gmail.com | |
3260dc302f4391afe755256b44ea9ca140f33a0e | 8ad8ee4e3a4e0e8ae0ed8e92c68cf122f5ba3723 | /jk_en/jk_en/sendEmail.py | e87f6f678832966b752cbb243ab64a762fe3c534 | [] | no_license | yangyangyanga/automatic_update | 5b5065713853c4a1225142ece4ea39be1a05d011 | 53c1777cbb84e489b887f38e2745477d6b6f4604 | refs/heads/master | 2020-05-25T21:18:24.979779 | 2019-05-22T08:34:02 | 2019-05-22T08:34:02 | 187,996,951 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 2,194 | py | import smtplib
from email.mime.text import MIMEText
from email.header import Header
from email.mime.multipart import MIMEMultipart
import pymysql
def sendEmail(subject='无标题',messageText='无内容'):
# accepter = 'zjlhyd0422@163.com'
accepter = "625786425@qq.com"
sender = "cyh6257@163.com"
# 三个参数：第一个为文本内容，第二个... | [
"1102213456@qq.com"
] | 1102213456@qq.com |
9a93a2420acc3eb462984f16192bf378b923dbf2 | 0f880fab72fe18a2e5c4718ba4bf78fbe800f988 | /code/CityList.py | 6dd00a6060c4d7c719719ac0c9f538ffcdc1ab89 | [] | no_license | clwater/GetCityGeo | ce208abb69130b091acaf9ac77b194035d7d96d4 | c82b922c25c07ace0245eaa20055bfe8290d7072 | refs/heads/master | 2021-01-19T17:33:09.171032 | 2017-08-24T16:23:00 | 2017-08-24T16:23:00 | 101,068,888 | 1 | 1 | null | null | null | null | UTF-8 | Python | false | false | 3,244 | py | #!/usr/bin/python
# -*- coding: UTF-8 -*-
import sys
reload(sys)
sys.setdefaultencoding( "utf-8" )
import requests
import json , re
import mysql.connector
conn = mysql.connector.connect(user='root', password='root', database='Utils')
def getCityGeo(cityname):
url = 'http://ditu.amap.com/service/poiInfo?query_... | [
"gengzhibo@gengzhibo.net"
] | gengzhibo@gengzhibo.net |
b4b07278d2bdd76b4fcc168e8ca4a5e2f2b61686 | 4a027b32b1e2dfebd6d65c9e7afce1f2e93f16bc | /webblog/blog/admin.py | c103bbbe9137099f88f5d13d6b08262854240b18 | [] | no_license | Jethet/DjangoProject-WebBlog | 92aa2959349129b2ef192163ab5637dbd4099224 | f64a79d889abe6a2d3caa9aa5350178d97b5c5eb | refs/heads/master | 2020-05-29T23:32:53.154542 | 2020-02-11T21:59:24 | 2020-02-11T21:59:24 | 189,438,086 | 1 | 0 | null | 2020-02-11T21:59:25 | 2019-05-30T15:28:38 | Python | UTF-8 | Python | false | false | 197 | py | from django.contrib import admin
# First import the model that you want to show up on the admin page:
from .models import Post
# Register your models on the admin page:
admin.site.register(Post)
| [
"henriette.hettinga@gmail.com"
] | henriette.hettinga@gmail.com |
ce555ee518fcfbdb43e59334bdddd885f194b341 | 1a24def8879972f21d846ffb3813632070e1cf12 | /Chapter08/0813exception-while-true.py | fa0b51fa722222322031c355be5fd5b499f32cbf | [] | no_license | mushahiroyuki/beginning-python | 03bb78c8d3f678ce39662a44046a308c99f29916 | 4d761d165203dbbe3604173c404f70a3eb791fd8 | refs/heads/master | 2023-08-16T12:44:01.336731 | 2023-07-26T03:41:22 | 2023-07-26T03:41:22 | 238,684,870 | 5 | 4 | null | 2023-09-06T18:34:01 | 2020-02-06T12:33:26 | Python | UTF-8 | Python | false | false | 397 | py | #ファイル名 Chapter08/0813exception-while-true.py
while True:
try:
x = int(input('最初の数を入れてください: '))
y = int(input('2番目の数を入れてください: '))
value = x / y
print(f'{x}/{y}は{value}です。')
except:
print('入力が正しくありません。再度入力してください。')
else:
break
| [
"hmusha@gmail.com"
] | hmusha@gmail.com |
5b3cbdb9ee3124e0fee05d82c702f0c9e56923ec | fc77fc08e983385521f7073e160cf05b8484dc9d | /Music App/mapp/db_setup.py | 7d68ace0c79aa6840b2127f24640c4be99f1da1e | [] | no_license | Icode4passion/Apps | e561a179147ab0f9bd074998f2b3e3a9bfedc539 | 51e5f2c9026a7f6a6efef33f4f54c9d7573a3070 | refs/heads/master | 2020-05-04T15:22:59.139023 | 2019-04-03T07:57:58 | 2019-04-03T07:57:58 | 179,238,161 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 551 | py | from sqlalchemy import create_engine
from sqlalchemy.orm import scoped_session, sessionmaker
from sqlalchemy.ext.declarative import declarative_base
engine = create_engine('sqlite:///mymusic.db', convert_unicode=True)
db_session = scoped_session(sessionmaker(autocommit=False,
... | [
"yogeerama@gmail.com"
] | yogeerama@gmail.com |
6ef1afb8fd47c9869fbc831c11b4d24aacbf704c | 9062c1b2b1715d4b5b34062dd52b6007fb2ca537 | /tensorflow/python/ops/collective_ops_gpu_test.py | d12d6240cf97e1d80b16ed5dd9f5a36901f73d69 | [
"Apache-2.0"
] | permissive | robotastic/tensorflow | 54c4c7cbcde5e9d374897d5038a96eb5feff16aa | b88f9f60de706dbe78acf9189b9fa04bdc7a6836 | refs/heads/master | 2020-08-30T06:13:07.176029 | 2019-11-05T01:49:44 | 2019-11-05T01:49:44 | 218,283,699 | 2 | 1 | Apache-2.0 | 2019-10-29T12:38:51 | 2019-10-29T12:38:50 | null | UTF-8 | Python | false | false | 12,428 | py | # Copyright 2019 The TensorFlow Authors. All Rights Reserved.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicab... | [
"gardener@tensorflow.org"
] | gardener@tensorflow.org |
192f1edf5a7c689278a89613efd7f7460b9516b8 | 1f6a85330596eb86a55e631ce5a0a643e200e977 | /muddery/server/typeclasses/script_room_interval.py | 2048e8b16d3f7555894ca832a36db1eb0acbe74d | [
"BSD-3-Clause"
] | permissive | kwer8080/muddery | ba41765c6245d33978b431ef490f10873ca8615c | 8b712eeb90cfee2d602aad4505a4929528d44afd | refs/heads/master | 2022-12-02T14:27:22.363386 | 2020-08-16T03:51:12 | 2020-08-16T03:51:12 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 3,549 | py | """
Scripts
Scripts are powerful jacks-of-all-trades. They have no in-game
existence and can be used to represent persistent game systems in some
circumstances. Scripts can also have a time component that allows them
to "fire" regularly or a limited number of times.
There is generally no "tree" of Scripts inheriting ... | [
"luyijun999@gmail.com"
] | luyijun999@gmail.com |
cb72bed745489fd0e982e080dff5966200d993e3 | eb9f655206c43c12b497c667ba56a0d358b6bc3a | /python/helpers/pydev/third_party/pep8/lib2to3/lib2to3/fixes/fix_intern.py | e7bb5052b4b5d9571da6b4b40941ddd27288a488 | [
"Apache-2.0",
"EPL-1.0"
] | permissive | JetBrains/intellij-community | 2ed226e200ecc17c037dcddd4a006de56cd43941 | 05dbd4575d01a213f3f4d69aa4968473f2536142 | refs/heads/master | 2023-09-03T17:06:37.560889 | 2023-09-03T11:51:00 | 2023-09-03T12:12:27 | 2,489,216 | 16,288 | 6,635 | Apache-2.0 | 2023-09-12T07:41:58 | 2011-09-30T13:33:05 | null | UTF-8 | Python | false | false | 1,405 | py | # Copyright 2006 Georg Brandl.
# Licensed to PSF under a Contributor Agreement.
"""Fixer for intern().
intern(s) -> sys.intern(s)"""
# Local imports
from .. import pytree
from .. import fixer_base
from ..fixer_util import Name, Attr, touch_import
class FixIntern(fixer_base.BaseFix):
BM_compatible = True
or... | [
"dmitry.trofimov@jetbrains.com"
] | dmitry.trofimov@jetbrains.com |
deac4dc9c416a85a1b186d22b702e4fd17d953c0 | 436177bf038f9941f67e351796668700ffd1cef2 | /venv/Lib/site-packages/sklearn/decomposition/_pca.py | 01906b2b0cc5586c35abeabb5c496f37ee7c9cf0 | [] | no_license | python019/matplotlib_simple | 4359d35f174cd2946d96da4d086026661c3d1f9c | 32e9a8e773f9423153d73811f69822f9567e6de4 | refs/heads/main | 2023-08-22T18:17:38.883274 | 2021-10-07T15:55:50 | 2021-10-07T15:55:50 | 380,471,961 | 29 | 0 | null | null | null | null | UTF-8 | Python | false | false | 24,683 | py | """ Principal Component Analysis.
"""
# Author: Alexandre Gramfort <alexandre.gramfort@inria.fr>
# Olivier Grisel <olivier.grisel@ensta.org>
# Mathieu Blondel <mathieu@mblondel.org>
# Denis A. Engemann <denis-alexander.engemann@inria.fr>
# Michael Eickenberg <michael.eickenberg@i... | [
"82611064+python019@users.noreply.github.com"
] | 82611064+python019@users.noreply.github.com |
6f64803b680f530118f50d12f840345200374827 | 001ca88155c90447ae3564bb51c503500d4fdcdd | /apps/christmas/migrations/0001_initial.py | 2f33cc812b526ca9d65d097c3b32136603943187 | [] | no_license | andre23arruda/cartas-de-natal | b7d5766b2806814dc7aaed1315b0d51d4aa53582 | b704b28137256e9c52a7d716e462334928c9d2bd | refs/heads/main | 2023-04-28T04:33:28.139797 | 2021-05-14T04:56:05 | 2021-05-14T04:56:05 | 367,122,010 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 729 | py | # Generated by Django 3.1.4 on 2021-05-13 03:00
from django.db import migrations, models
class Migration(migrations.Migration):
initial = True
dependencies = [
]
operations = [
migrations.CreateModel(
name='Letter',
fields=[
('id', models.AutoField(a... | [
"andre23arruda@gmail.com"
] | andre23arruda@gmail.com |
bd52bb1039bba3f6e62021f5e1b5035e90a422c1 | 7bc0075367290ff06565991e19033b13f0604f96 | /Mundo 2/aula13/desafio047.py | 531922ef5ea3d9c949fd2497d363dc2cbe2bf5db | [] | no_license | iamtheluiz/curso_em_video_python | 298acd90e36473fbf797ba7bf85d729d0ca28407 | aa4247b7d206771f9c9b08ad5d8585c3813ddaff | refs/heads/master | 2020-04-12T16:17:51.672662 | 2019-01-22T00:10:41 | 2019-01-22T00:10:41 | 162,608,169 | 1 | 0 | null | null | null | null | UTF-8 | Python | false | false | 268 | py | # imports
print("""
|******************|
| Desafio047 |
|******************|
""")
print("Números Pares de 1 até 50")
result = ""
for i in range(1, 51, 2):
if i == 1:
result += str(i + 1)
else:
result += ", "+str(i + 1)
print(result)
| [
"iamtheluiz.dev@gmail.com"
] | iamtheluiz.dev@gmail.com |
5291f471b2d5e46a05cd5e2ec8fd990b3acf7711 | 33114a0f96406008da69adac757b271229fb81bf | /__init__.py | 5488e89bfa7b2ba3c29c0da45814f981069162df | [] | no_license | ROB-Seismology/simpledb | 9f1eaf3ad4cd2367a03b5e79931a18959e9a370d | 4993dd472d1cb37023751ffca80e4dde7a6ad7fc | refs/heads/master | 2021-06-24T12:13:34.309067 | 2020-10-20T10:30:34 | 2020-10-20T10:30:34 | 90,835,016 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,309 | py | """
Module providing basic read-write access to SQL databases.
Currently supports MySQL, PostgreSQL and SQLite/SpatiaLite databases.
Author: Kris Vanneste, Royal Observatory of Belgium
"""
from __future__ import absolute_import, division, print_function, unicode_literals
## Reloading mechanism
try:
reloading
exce... | [
"kris.vanneste@oma.be"
] | kris.vanneste@oma.be |
7f788150cb65d8a9dd0618a8bae8840a7efe7aac | b788f1f8bfa8949177e28dd4be436572162c418b | /regular expression.py | 5622c6603c31b7c63a0a789938965fc66832786f | [] | no_license | KaziMotiour/pyhton-OOP | bc9506f3afe7686a7451de9a5448c759f3cdcbac | 8e85cbe31809a11293fb90d6e39b2d0293cff9b5 | refs/heads/master | 2022-02-18T09:40:05.274955 | 2019-09-02T17:46:53 | 2019-09-02T17:46:53 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,184 | py | import re
def multi_find(text_patterns,phrase):
for pat in test_patterns:
print("Search for pattern {}".format(pat))
print(re.findall(pat,phrase))
print('\n')
patterns = ['Team1', 'Team2']
text = "This is a starting! with Team1, 1234567, not to others arr arrr"
# for pattern in patterns:
... | [
"kmatiour30@gmail.com"
] | kmatiour30@gmail.com |
321383aac6ddb384a5de4743a8d8fba4a11a44cc | a6d36a861c156e9dd9c3f4733978f194bcc62c2c | /api/serializers.py | b284259aa9cd0eee350124e29334949953db0bd5 | [] | no_license | wjaccck/upfile | 091f3ba132748cef348ff8a9973eba009e5423fa | 2721cc29ca394ddcf9f415e4fba7e2b422e87701 | refs/heads/master | 2021-01-01T04:30:18.024584 | 2016-05-26T02:25:51 | 2016-05-26T02:25:51 | 57,368,745 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,960 | py | from rest_framework import serializers
from api.models import Up_file,Status,Azure_key,Dirs,Recode_dirs
class Up_fileSerializer(serializers.ModelSerializer):
status = serializers.SlugRelatedField(queryset=Status.objects.all(), slug_field='alias')
base_dir = serializers.SlugRelatedField(queryset=Dirs.objects.al... | [
"wjaccck@163.com"
] | wjaccck@163.com |
6b307266c03ec45f6004645eac1d4985b1bfbb4c | d5a5ff1ed1f508c47e9506a552bf44844bcdc071 | /payroll/apps.py | 8313bd0aaa30a056f07efb95e1823ad6458d08af | [] | no_license | sintaxyzcorp/prometeus | 5c9dc20e3c2f33ea6b257b850ff9505621302c47 | 2508603b6692023e0a9e40cb6cd1f08465a33f1c | refs/heads/master | 2021-09-01T09:31:36.868784 | 2017-12-26T07:58:27 | 2017-12-26T07:58:27 | 113,787,842 | 0 | 1 | null | 2017-12-18T08:25:31 | 2017-12-10T22:16:28 | JavaScript | UTF-8 | Python | false | false | 182 | py | # -*- coding: utf-8 -*-
from __future__ import unicode_literals
from django.apps import AppConfig
class PayrollConfig(AppConfig):
name = 'payroll'
verbose_name = 'Nomina'
| [
"carloxdev@gmail.com"
] | carloxdev@gmail.com |
da837fb82085ba56a201b6894220c72ba25ea444 | 38182d45f0b1f6228aeec03a876ee8213404d171 | /questionnaire/admin.py | be8327b50af90b1628c99da556843bb64cf84a85 | [] | no_license | alexzinoviev/MobileDoc | 1283ec5cd52d27510e54f22522b9e1a01b65d8f8 | 66c22f1b8fe96ad5630c3d33bcc26e5d815f48db | refs/heads/master | 2020-06-24T05:29:41.366198 | 2017-08-03T16:37:10 | 2017-08-03T16:37:10 | 96,920,344 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 448 | py | from django.contrib import admin
from .models import Questionnaire
# Register your models here.
@admin.register(Questionnaire)
class QuestionAdmin(admin.ModelAdmin):
list_display = ('question', 'category')
#admin.site.register(Questionnaire, QuestionAdmin)
# @admin.register(Product)
# class ProductAdmin(admin... | [
"shurik.zinovyev@gmail.com"
] | shurik.zinovyev@gmail.com |
51f34c3e0287e316f0918f7bae364df3289de792 | 966ea314bcd64f40bfaea457f914fcedbe26426a | /March-week3/testconversion.py | be419779776866290ed22ba1214ccc83499f7eda | [] | no_license | vandanasen/Python-Projects | 30caa85cf87ba712e1307b0441fed2d7fa9298a0 | 9b24a9f6af0374bb0d6a3a15c05099f49edfd581 | refs/heads/master | 2020-03-26T00:26:06.067905 | 2019-03-11T22:58:25 | 2019-03-11T22:58:25 | 144,320,263 | 1 | 0 | null | null | null | null | UTF-8 | Python | false | false | 480 | py | a_list=[1,1,2,3,3]
a = tuple(a_list)
print(a)
b = list(a)
print(len(b))
c = set(b)
print(len(c))
d=list(c)
print(len(d))
e=list(range(1, 11, 1))
print(e)
dict = dict([(1,2),(3,4),(5,6),(7,8),(9,10)])
print(dict)
t= tuple(list(dict.items()))
print(t)
v = tuple(dict.keys())
print(v)
k = tuple(dict.values())
print(k)
s = ... | [
"vandy_senthil@yahoo.com"
] | vandy_senthil@yahoo.com |
7f9cf2b44780a6c73735f0b55eb8a5f232bd2098 | 88e2c87d087e30dedda11cad8a2665e89f6ac32c | /tests/contrib/operators/test_opsgenie_alert_operator.py | 1b4467bc5a523be4b00ce8c701d2f578da10ece5 | [
"Apache-2.0",
"BSD-3-Clause",
"Python-2.0",
"MIT",
"BSD-2-Clause"
] | permissive | bigo-sg/airflow | 690805b782d3490c5d01047203ee4766f9695cf0 | e2933fc90d8fd9aeb61402f7a237778553762a17 | refs/heads/master | 2020-05-30T19:25:36.289802 | 2019-07-15T10:14:34 | 2019-07-15T10:14:34 | 189,924,188 | 2 | 1 | Apache-2.0 | 2019-10-18T06:30:14 | 2019-06-03T02:50:51 | Python | UTF-8 | Python | false | false | 4,788 | py | # -*- coding: utf-8 -*-
#
# Licensed to the Apache Software Foundation (ASF) under one
# or more contributor license agreements. See the NOTICE file
# distributed with this work for additional information
# regarding copyright ownership. The ASF licenses this file
# to you under the Apache License, Version 2.0 (the
#... | [
"ash_github@firemirror.com"
] | ash_github@firemirror.com |
a0083cab532c5db426c3e4e1e0041d4f1d5ec536 | 0cfb5831a748ebd46e438e3ad7e7a09c1d196499 | /com/chapter_09/section_04/task_9.4.5_importAllClass.py | 92d4e7f85081ee09dbfc6731f3670ef472dcf5a0 | [] | no_license | StevenGeGe/pythonFromIntroductionToPractice01 | 7cfe8cdb4bc5c0ddbe25b44976231d72d9e10108 | 9d2ba499056b30ded14180e6c4719ee48edd9772 | refs/heads/master | 2023-02-15T04:08:59.878711 | 2020-12-28T13:27:55 | 2020-12-28T13:27:55 | 310,980,820 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 330 | py | #!/usr/bin/python3
# -*- coding: utf-8 -*-
# @Time : 2020/11/25 20:34
# @Author : Yong
# @Email : Yong_GJ@163.com
# @File : task_9.4.5_importAllClass.py
# @Software: PyCharm
# 导入模块中所有的类
# from module_name import *
# 不推荐这样使用。
# 推荐使用：module_name.class_name 语法来访问类
| [
"Yong_GJ@163.com"
] | Yong_GJ@163.com |
babdbff65d7df7830fbc35159f977fcaebc87b48 | 7be7190aeceef43841274518d260bcd92e04e5a7 | /Mahouo-Account/sever/app/__init__.py | a0d44f9b8c1ba491d8fa05edb03452397aa3f1ee | [] | no_license | weivis/Mahouo | 078c440b41a686d355a49e3fc29175bc225dff2c | 81fd6919a884b97cb53ac3e97f1e48d78ddd4e63 | refs/heads/master | 2020-04-20T16:56:44.813853 | 2019-02-03T18:47:11 | 2019-02-03T18:47:11 | 168,974,099 | 10 | 1 | null | null | null | null | UTF-8 | Python | false | false | 956 | py | __author__ = 'Ran'
from flask import Flask # flask
from flask_cache import Cache # cache
from flask_login import LoginManager
from flask_cors import *
from flask_sqlalchemy import SQLAlchemy # sql
from datetime import timedelta
from app import config # config
#实例化app
app = Flask(__name__,
template_folder=... | [
"yvban@outlook.com"
] | yvban@outlook.com |
703dc8683d7f928f96e719bf5febd0627d683364 | 9a9e0398f26cee9864d48c4618c0a482e5475e83 | /Python/code/top_k_frequent_elements.py | 1e0b45c6c2186a3d5aa1760acecb875e104754cb | [] | no_license | CNife/leetcode | 92693c653bb41780ee431293286c3e909009e9b0 | 7cdd61692ecb52dd1613169e80b924dd39d35996 | refs/heads/main | 2021-06-22T21:22:12.997253 | 2021-03-18T07:07:15 | 2021-03-18T07:07:15 | 206,955,329 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 677 | py | from collections import defaultdict
from heapq import heappush, heapreplace
from typing import List, Tuple
from leetcode import test, sorted_list
def top_k_frequent(nums: List[int], k: int) -> List[int]:
counter = defaultdict(lambda: 0)
for num in nums:
counter[num] += 1
heap: List[Tuple[int, in... | [
"CNife@vip.qq.com"
] | CNife@vip.qq.com |
9c68c1a48ea5e7f1c1e9b39fb95197c685595749 | ca7aa979e7059467e158830b76673f5b77a0f5a3 | /Python_codes/p02260/s279877008.py | 38cfba9d040e317dbba645db4cba4794e44c61a4 | [] | no_license | Aasthaengg/IBMdataset | 7abb6cbcc4fb03ef5ca68ac64ba460c4a64f8901 | f33f1c5c3b16d0ea8d1f5a7d479ad288bb3f48d8 | refs/heads/main | 2023-04-22T10:22:44.763102 | 2021-05-13T17:27:22 | 2021-05-13T17:27:22 | 367,112,348 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 601 | py | input()
num_list = raw_input().split()
num_list = map(int, num_list)
def selection_sort(num_list, count):
for i in range(0, len(num_list)):
minj = i
for j in range(i, len(num_list)):
if num_list[j] < num_list[minj]:
minj = j
temp = num_list[minj]
... | [
"66529651+Aastha2104@users.noreply.github.com"
] | 66529651+Aastha2104@users.noreply.github.com |
39b8c01806e7f01b801d077e55cdbe99b11dd5a9 | 0883188e1648f982e3a27bf0b89c4c09dac3d3ef | /nmigen/test/compat/test_fifo.py | bc6b81cdee56cf3921aa32628db05c3a8a6097be | [
"BSD-2-Clause"
] | permissive | pbsds/nmigen | b44c0b212ddd2d88a6641243efbb632baacb66f7 | d964ba9cc45490b141c8c4c4c3d8add1a26a739d | refs/heads/master | 2022-12-04T10:32:52.573521 | 2020-07-31T13:17:39 | 2020-07-31T18:41:59 | 286,076,534 | 0 | 0 | BSD-2-Clause | 2020-08-08T16:12:24 | 2020-08-08T16:12:23 | null | UTF-8 | Python | false | false | 1,272 | py | import unittest
from itertools import count
from ...compat import *
from ...compat.genlib.fifo import SyncFIFO
from .support import SimCase
class SyncFIFOCase(SimCase, unittest.TestCase):
class TestBench(Module):
def __init__(self):
self.submodules.dut = SyncFIFO(64, 2)
self.syn... | [
"whitequark@whitequark.org"
] | whitequark@whitequark.org |
0d6bf526fcc135ca7f156726c43622f99a0c3269 | 53fab060fa262e5d5026e0807d93c75fb81e67b9 | /backup/user_053/ch160_2020_06_19_19_49_19_966261.py | 0eb7281b995c2be04327db8c79ad0fcf74f9446d | [] | no_license | gabriellaec/desoft-analise-exercicios | b77c6999424c5ce7e44086a12589a0ad43d6adca | 01940ab0897aa6005764fc220b900e4d6161d36b | refs/heads/main | 2023-01-31T17:19:42.050628 | 2020-12-16T05:21:31 | 2020-12-16T05:21:31 | 306,735,108 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 503 | py | import math
resultados = {}
valores = []
i = 0
for x in range(91):
# Aplica fórmula
y = 4*x*(180 - x)/(40500 - x*(180 - x))
# Converte para rad
x = x*math.pi/180
# Verifica diferença
dif = abs(y - math.sin(x))
# Adiciona na lista de diferenças
valores.append(dif)
# Adiciona diferenç... | [
"you@example.com"
] | you@example.com |
cee5b8650269efe733b6f7b95dcc8366a0fa8d3b | ba919c512e131de90427b1a6bfd29e1d7a2e22c8 | /debug/verification_test.py | a509b9d96a2cf195f0bfa7b8082cccaa8b3446a1 | [] | no_license | qq183727918/influence | 7d3b0106db55402630979b86455e4b82ebed2e98 | 75cb04453278d13dd82a6f319d6f9ecdfad5fb88 | refs/heads/master | 2023-01-22T23:00:51.979543 | 2020-12-08T11:12:12 | 2020-12-08T11:12:12 | 317,783,196 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,078 | py | # _*_ coding: UTF-8 _*_
# @Time : 2020/12/4 17:01
# @Author : LiuXiaoQiang
# @Site : http:www.cdtest.cn/
# @File : verification_test.py
# @Software : PyCharm
def verification():
from PIL import Image
# 转换灰度
# 使用路径导入图片
imgName = '13.png'
im = Image.open(imgName)
# 使用 byte 流导入图片
... | [
"lxq13925731395@163.com"
] | lxq13925731395@163.com |
05881bf793aa55eee51c75d99cdbe7a1085333a9 | 86fc644c327a8d6ea66fd045d94c7733c22df48c | /scripts/managed_cpe_services/customer/qos_service/policy_class_map_update/update_policy_class_map/update_policy_class_map.py | d79055588ad5e2c89764db215cca6b39ed2e3bd7 | [] | no_license | lucabrasi83/anutacpedeployment | bfe703657fbcf0375c92bcbe7560051817f1a526 | 96de3a4fd4adbbc0d443620f0c53f397823a1cad | refs/heads/master | 2021-09-24T16:44:05.305313 | 2018-10-12T02:41:18 | 2018-10-12T02:41:18 | 95,190,459 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 6,843 | py | #
# This computer program is the confidential information and proprietary trade
# secret of Anuta Networks, Inc. Possessions and use of this program must
# conform strictly to the license agreement between the user and
# Anuta Networks, Inc., and receipt or possession does not convey any rights
# to divulge, reproduce,... | [
"sebastien.pouplin@tatacommunications.com"
] | sebastien.pouplin@tatacommunications.com |
b2df8f27cd5d4d14b5223a244f2bcd6cf2720ddc | f64aaa4b0f78774464033148290a13453c96528e | /generated/intermediate/ansible-module-rest/azure_rm_frontdoorroutingrule.py | f59ed875aad2cbda07790fb752d5abdc38e7cce3 | [
"MIT"
] | permissive | audevbot/autorest.cli.debug | e8996270a6a931f243532f65782c7f8fbb1b55c6 | a507fb6e2dd7826212537f27d583f203aac1c28f | refs/heads/master | 2020-06-04T05:25:17.018993 | 2019-08-27T21:57:18 | 2019-08-27T21:57:18 | 191,876,321 | 0 | 0 | MIT | 2019-08-28T05:57:19 | 2019-06-14T04:35:39 | Python | UTF-8 | Python | false | false | 16,885 | py | #!/usr/bin/python
#
# Copyright (c) 2019 Zim Kalinowski, (@zikalino)
#
# GNU General Public License v3.0+ (see COPYING or https://www.gnu.org/licenses/gpl-3.0.txt)
from __future__ import absolute_import, division, print_function
__metaclass__ = type
ANSIBLE_METADATA = {'metadata_version': '1.1',
... | [
"audevbot@microsoft.com"
] | audevbot@microsoft.com |
a1d530110266afe81a9bbd327cde526441ccc73b | b79bce0cf363d2b6dd11371d378d78d48e973270 | /tests/test_custom_multi_output_classification.py | d9959a3efafdab09cb105e8eec4ea79477e7dcfa | [
"Apache-2.0"
] | permissive | CharlotteSean/Kashgari | 2d9338761b16d9804fb81ff92ce2ab1d256c80a7 | ab9970ecf6c0164416bfbbec1378c690b0f00d76 | refs/heads/master | 2022-01-22T03:52:12.284458 | 2019-07-17T03:48:04 | 2019-07-17T03:48:04 | 197,900,673 | 2 | 0 | Apache-2.0 | 2019-07-20T08:15:03 | 2019-07-20T08:15:03 | null | UTF-8 | Python | false | false | 4,917 | py | # encoding: utf-8
# author: BrikerMan
# contact: eliyar917@gmail.com
# blog: https://eliyar.biz
# file: test_custom_multi_output_classification.py
# time: 2019-05-22 13:36
import unittest
import numpy as np
import tensorflow as tf
import kashgari
from typing import Tuple, List, Optional, Dict, Any
from kashgari.laye... | [
"eliyar917@gmail.com"
] | eliyar917@gmail.com |
b6db08130173918bab964091422606ec2957af39 | a34ec07c3464369a88e68c9006fa1115f5b61e5f | /A_Basic/String/L0_1684_Count_the_Number_of_Consistent_Strings.py | 802755735771f634df680bf789b44d5b52ac935f | [] | no_license | 824zzy/Leetcode | 9220f2fb13e03d601d2b471b5cfa0c2364dbdf41 | 93b7f4448a366a709214c271a570c3399f5fc4d3 | refs/heads/master | 2023-06-27T02:53:51.812177 | 2023-06-16T16:25:39 | 2023-06-16T16:25:39 | 69,733,624 | 14 | 3 | null | 2022-05-25T06:48:38 | 2016-10-01T10:56:07 | Python | UTF-8 | Python | false | false | 213 | py | class Solution:
def countConsistentStrings(self, allowed: str, words: List[str]) -> int:
ans = 0
for word in words:
if all([w in allowed for w in word]): ans += 1
return ans | [
"zhengyuan.zhu@mavs.uta.edu"
] | zhengyuan.zhu@mavs.uta.edu |
9207c9cab23edfac359cbc19c3db823e8b193cb9 | 84d2efd222fa190c8b3efcad083dcf2c7ab30047 | /linRegNoSTD.py | 34a9e45c64ae6545a196ca7279c57aa4acfd4220 | [] | no_license | webclinic017/Capstone-2 | aedfc8692647f2e84114da5b2e32856d0de80586 | d476723f7893c7c5da14e24f28736a8f0ba7ff55 | refs/heads/master | 2023-01-23T06:44:36.868373 | 2020-12-03T19:44:51 | 2020-12-03T19:44:51 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 655 | py | import pandas as pd
import matplotlib.pyplot as plt
import numpy as np
import sklearn.linear_model
from alpha_vantage.timeseries import TimeSeries
api_key = '8FIYTT49ZEZT2GV5'
ts = TimeSeries(key=api_key, output_format='pandas')
data, meta_data = ts.get_daily_adjusted(symbol='SPY', outputsize = 'full')
data... | [
"noreply@github.com"
] | webclinic017.noreply@github.com |
a7784cf4b12ea9bed917ce26508e4c63ce253b6c | 12e42f4f34030b90c1841ece8d4efdd28925394f | /test/functional/wallet_scriptaddress2.py | 1f6b0e35dc51989b468955669c9f87acde059877 | [
"MIT"
] | permissive | GerardoTaboada/EducaCoin | 46d8aa08dd4b3859e59b739713ced08ec0b8c510 | c7f1be5dacd0a10464775c7eeb0eb799fc66cd43 | refs/heads/master | 2020-03-31T20:01:41.768383 | 2018-10-17T21:54:13 | 2018-10-17T21:54:13 | 152,522,009 | 2 | 1 | null | null | null | null | UTF-8 | Python | false | false | 3,921 | py | #!/usr/bin/env python3
# Copyright (c) 2015-2016 The Bitcoin Core developers
# Distributed under the MIT software license, see the accompanying
# file COPYING or http://www.opensource.org/licenses/mit-license.php.
#
# Test new Educacoin multisig prefix functionality.
#
from test_framework.test_framework import Bitcoi... | [
"you@example.com"
] | you@example.com |
74096f3871ce295e10d08f00012c88bc032e9da1 | f972e22df004b419d23b4b03d3c7e42e604a2e2b | /compute/wps/tasks/ophidia.py | 830321413d5463dd764a9eed4384191c13d65a43 | [] | no_license | OphidiaBigData/esgf-compute-wps | 9ec663b1701f2336f08117a6fb0725d71adfe078 | 8dd26dde385fbe861c78e432e0954725d7bf9b18 | refs/heads/master | 2020-04-28T10:20:49.718253 | 2019-02-04T09:46:43 | 2019-02-04T09:46:43 | 175,198,536 | 0 | 0 | null | 2019-03-12T11:39:20 | 2019-03-12T11:39:19 | null | UTF-8 | Python | false | false | 5,490 | py | import json
import os
import uuid
import cwt
from celery.utils.log import get_task_logger
from django.conf import settings
from PyOphidia import client
from wps import WPSError
from wps.tasks import base
__ALL__ = [
'PROCESSES',
'oph_submit',
]
logger = get_task_logger('wps.tasks.ophidia')
PROCESSES = {
... | [
"boutte.jason@gmail.com"
] | boutte.jason@gmail.com |
1d299fc35a1f1aa5feca93086cb650a6d0e1c2f3 | 8842d6c864f12dc8853d22b8a986b01acdf0e446 | /27_12_15_Nico3/LDA.pyx | c15e5a4eef6680c7665544e3191ce137506966f6 | [] | no_license | yukkyo/ResearchSource | 0d701aa09d3cfc5aae80a022445ecf14c42f0a07 | db497d19aae41ea57d7d6dd245714a477a7a1d4c | refs/heads/master | 2021-01-18T20:01:20.427148 | 2019-06-20T05:17:54 | 2019-06-20T05:17:54 | 24,621,316 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 5,397 | pyx | #!/usr/bin/env python
# -*- coding: utf-8 -*-
# cython: profile=True, boundscheck=False, wraparound=False
from __future__ import division
cimport cython
from libc.stdlib cimport rand, RAND_MAX
from libcpp.vector cimport vector
from libc.math cimport log, exp
from cpython.mem cimport PyMem_Malloc, PyMem_Realloc, PyMem_... | [
"yukkyo12221222@gmail.com"
] | yukkyo12221222@gmail.com |
9fc5b6e12ba33400052ec9e08c251ff1626f1477 | eb3683f9127befb9ef96d8eb801206cf7b84d6a7 | /testing/test_programs/numpy/basic_numpy/arrays/stypy_test_files/numpy_array_broadcasting_4__type_data.py | 99ec5d09a07932264cc57dd68828680219e497e5 | [] | no_license | ComputationalReflection/stypy | 61ec27333a12f76ac055d13f8969d3e0de172f88 | be66ae846c82ac40ba7b48f9880d6e3990681a5b | refs/heads/master | 2021-05-13T18:24:29.005894 | 2018-06-14T15:42:50 | 2018-06-14T15:42:50 | 116,855,812 | 2 | 0 | null | null | null | null | UTF-8 | Python | false | false | 844 | py | from testing.code_generation_testing.codegen_testing_common import instance_of_class_name
test_types = {
'__main__': {
'r4': instance_of_class_name("ndarray"),
'r5': instance_of_class_name("ndarray"),
'__name__': instance_of_class_name("str"),
'r2': instance_of_class_name("ndarray")... | [
"redondojose@uniovi.es"
] | redondojose@uniovi.es |
7c58362f81d2eebf86e77c4f52201dabd123be2d | e7b7cc34f77c71e61aa0fa05bcc62f54fc2fc0e1 | /AlgorithmCodeTemplates/algorithm/sliding_window_examples.py | 634c355c9efa3418e81eeafb9f04d218da1225cd | [] | no_license | sevenhe716/LeetCode | 41d2ef18f5cb317858c9b69d00bcccb743cbdf48 | 4a1747b6497305f3821612d9c358a6795b1690da | refs/heads/master | 2020-03-16T16:12:27.461172 | 2019-04-22T13:27:54 | 2019-04-22T13:27:54 | 130,221,784 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 4,002 | py | from collections import Counter
from collections import defaultdict
# [3] https://leetcode.com/problems/longest-substring-without-repeating-characters/
# variation with no pattern
def lengthOfLongestSubstring(s):
# create a default dict to maintain state
counter = defaultdict(int)
count, start, end, res =... | [
"429134862@qq.com"
] | 429134862@qq.com |
f52fb6152bba23a4c0a005ca2f666c5e95d07473 | 6d80ce7a1f44ddf5741fd190ddfe0d9be8e5f162 | /data/lmdbMaker.py | 0081b73ccebdd68d83571914b0342cb8bcb9817a | [
"MIT"
] | permissive | dun933/FudanOCR | dd8830ca4b8ebb08acd31326fcf5aa3c961886a0 | fd79b679044ea23fd9eb30691453ed0805d2e98b | refs/heads/master | 2021-04-03T19:50:47.646099 | 2020-03-16T08:43:59 | 2020-03-16T08:43:59 | 248,391,401 | 1 | 0 | MIT | 2020-03-19T02:23:11 | 2020-03-19T02:23:10 | null | UTF-8 | Python | false | false | 6,516 | py | #!/usr/bin/python
# -*- coding: utf-8 -*-
'''
Please execute the code with python2
'''
import os
import lmdb
import cv2
import numpy as np
def checkImageIsValid(imageBin):
if imageBin is None:
return False
try:
imageBuf = np.fromstring(imageBin, dtype=np.uint8)
img ... | [
"576194329@qq.com"
] | 576194329@qq.com |
25ea3ccf9694bbff46ace1ccdf8a44257540ba69 | 6fcfb638fa725b6d21083ec54e3609fc1b287d9e | /python/myfavouritekk_vdetlib/vdetlib-master/utils/log.py | 331282eee61fb52e30ff5a83431ec74d430c69e0 | [] | no_license | LiuFang816/SALSTM_py_data | 6db258e51858aeff14af38898fef715b46980ac1 | d494b3041069d377d6a7a9c296a14334f2fa5acc | refs/heads/master | 2022-12-25T06:39:52.222097 | 2019-12-12T08:49:07 | 2019-12-12T08:49:07 | 227,546,525 | 10 | 7 | null | 2022-12-19T02:53:01 | 2019-12-12T07:29:39 | Python | UTF-8 | Python | false | false | 175 | py | #!/usr/bin/env python
import logging
logging.basicConfig(
format='[%(asctime)s %(process)d %(filename)s:%(lineno)s %(levelname)s] %(message)s',
level=logging.DEBUG)
| [
"659338505@qq.com"
] | 659338505@qq.com |
e13fab0514aa87a22f4efac43760c2d877c23adb | 64a99161204051f6f2abb9e8d88a5508952c0115 | /examples/saveLoadV1/create_save.py | 61f2ff9f7627dd79c32b0c968455c4711de7a2ad | [
"MIT"
] | permissive | suny-downstate-medical-center/netpyne | d1ba5a258ba63c8ad8b0fa91a6d8bbd99f2e8d28 | 9d08867205b776bbb467554c49df9d8aba57dcf2 | refs/heads/development | 2023-08-23T22:48:26.020812 | 2023-08-16T14:20:23 | 2023-08-16T14:20:23 | 48,733,333 | 18 | 18 | MIT | 2023-09-11T16:01:19 | 2015-12-29T07:12:08 | Jupyter Notebook | UTF-8 | Python | false | false | 164 | py | from netpyne import sim
import params
# Create network and save
sim.create(netParams=params.netParams, simConfig=params.simConfig)
sim.gatherData()
sim.saveData()
| [
"salvadordura@gmail.com"
] | salvadordura@gmail.com |
46c205a3f435959086389638a9fd7fefd957308c | 99fa82f29a5b50a5595985acc460a0afaa6099a8 | /app/shopdj/sale/migrations/0004_invoice_total.py | a4f08cde3a2ed9f2afa42d4898d917d64e08dcca | [] | no_license | nnocturnnn/university_rep | a47cce9e29f96e9cc33293c76321e298e7628a4d | 4a8cd42f53dd112640a37ad5ff815ecf09ce1c25 | refs/heads/master | 2023-04-20T09:44:24.144760 | 2021-05-11T16:16:07 | 2021-05-11T16:16:07 | 304,661,340 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 380 | py | # Generated by Django 3.0.5 on 2020-07-02 05:59
from django.db import migrations, models
class Migration(migrations.Migration):
dependencies = [
('sale', '0003_auto_20200701_0535'),
]
operations = [
migrations.AddField(
model_name='invoice',
name='total',
... | [
"vikchehovich@gmail.com"
] | vikchehovich@gmail.com |
0d3dcd3a21ccefd0f1a1dfbce2f6cea60b4365f9 | 3ef70fe63acaa665e2b163f30f1abd0a592231c1 | /stackoverflow/venv/lib/python3.6/site-packages/twisted/conch/test/test_checkers.py | 4111f2169895e93fbeeaf8e2819916a1a8a017e1 | [
"MIT",
"LicenseRef-scancode-unknown-license-reference"
] | permissive | wistbean/learn_python3_spider | 14914b63691ac032955ba1adc29ad64976d80e15 | 40861791ec4ed3bbd14b07875af25cc740f76920 | refs/heads/master | 2023-08-16T05:42:27.208302 | 2023-03-30T17:03:58 | 2023-03-30T17:03:58 | 179,152,420 | 14,403 | 3,556 | MIT | 2022-05-20T14:08:34 | 2019-04-02T20:19:54 | Python | UTF-8 | Python | false | false | 31,498 | py | # Copyright (c) Twisted Matrix Laboratories.
# See LICENSE for details.
"""
Tests for L{twisted.conch.checkers}.
"""
from __future__ import absolute_import, division
try:
import crypt
except ImportError:
cryptSkip = 'cannot run without crypt module'
else:
cryptSkip = None
import os
from collections imp... | [
"354142480@qq.com"
] | 354142480@qq.com |
504b693788900fa8fe43fab87c1075ce5593cf3b | 6f2675eee55b7ebc5adf9c2176ced8cb59fc64d4 | /dataInterSrvKm/bak/20200113版本半接口半直连/billBoli600.py | 729c1391bc030f8184f66d7eb48bc789ce7a4078 | [] | no_license | wildmanwang/proDataInter | 8c2b65fa96ad45b21165d997b1769a28e12fc42a | f5a1f1fb195c66bf586bd999465c7e3b16453369 | refs/heads/master | 2023-06-07T11:57:16.763251 | 2023-06-03T08:54:56 | 2023-06-03T08:54:56 | 157,559,747 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 13,164 | py | # -*- coding:utf-8 -*-
"""
"""
__author__ = "Cliff.wang"
from superBillDCB import SuperBillDCB
from interMssql import MSSQL
import time, json
class BillBoli600(SuperBillDCB):
def __init__(self, sett):
super().__init__(sett)
self.station = [1,2,3,4,5,6,7,8] # 可用基站
self.db = MSSQL(sel... | [
"cliff.w@qq.com"
] | cliff.w@qq.com |
080121153af9a45d9084cd5f5233cdfb821defe7 | 23af1e2b1f29be62926ed6a8e39b4462f07f5f2b | /atcoder.jp/abc086/abc086_b/Main.py | 2caffef31e6e42003299d780de9ca6f6f538b840 | [] | no_license | IKDrocket/Atcoder | 8ef382577a377a8f35890b24a49f681f00f2f047 | fc19379de2ddf62a61b67eda33bf8aa29d503685 | refs/heads/main | 2023-02-09T11:58:00.353304 | 2021-01-02T12:06:20 | 2021-01-02T12:06:20 | 318,876,174 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 152 | py | a,b = input().split()
num = int(a+b)
for i in range(1,10101):
ans = i*i
if num == ans:
print("Yes")
break
else:
print("No")
| [
"ikdrocket@IKDrocket.local"
] | ikdrocket@IKDrocket.local |
c31db9e2643724ed66331b721d6a77560de6209a | 06167f625464c898ac95e752694a5931b9a55a55 | /src/admission/migrations/0001_initial.py | bacece5228ade3f6e66d8337c4fae54aa72fdb6d | [] | no_license | nazmul629/school_management_system | 16e2003b652b14174d6f59b4682ca366275f3207 | d0ff759645d9ba8f88d2aa63dbc867e7713455ed | refs/heads/master | 2021-06-19T18:06:56.539454 | 2019-04-20T12:35:24 | 2019-04-20T12:35:24 | 182,307,917 | 1 | 0 | null | 2021-03-20T08:15:23 | 2019-04-19T18:22:11 | CSS | UTF-8 | Python | false | false | 1,699 | py | # Generated by Django 2.0 on 2019-04-19 16:39
from django.db import migrations, models
import django.db.models.deletion
class Migration(migrations.Migration):
initial = True
dependencies = [
]
operations = [
migrations.CreateModel(
name='class_section',
fields=[
... | [
"nazmulhossain.qnh@gmail.com"
] | nazmulhossain.qnh@gmail.com |
6e7a8849b45d4e7ef435085fefc41204dd11f94a | bb150497a05203a718fb3630941231be9e3b6a32 | /framework/e2e/jit/test_Maxout_0.py | 34ed3c5b0baf796738184d4faee74db735487de9 | [] | no_license | PaddlePaddle/PaddleTest | 4fb3dec677f0f13f7f1003fd30df748bf0b5940d | bd3790ce72a2a26611b5eda3901651b5a809348f | refs/heads/develop | 2023-09-06T04:23:39.181903 | 2023-09-04T11:17:50 | 2023-09-04T11:17:50 | 383,138,186 | 42 | 312 | null | 2023-09-13T11:13:35 | 2021-07-05T12:44:59 | Python | UTF-8 | Python | false | false | 608 | py | #!/bin/env python
# -*- coding: utf-8 -*-
# encoding=utf-8 vi:ts=4:sw=4:expandtab:ft=python
"""
test jit cases
"""
import os
import sys
sys.path.append(os.path.abspath(os.path.dirname(os.getcwd())))
sys.path.append(os.path.join(os.path.abspath(os.path.dirname(os.getcwd())), "utils"))
from utils.yaml_loader import Ya... | [
"825276847@qq.com"
] | 825276847@qq.com |
0b923417f2c83d1b943f897a0e067b827cc724c3 | f07a42f652f46106dee4749277d41c302e2b7406 | /Data Set/bug-fixing-5/6d0b0f8338f7ffbc761ddc05cbdc620a99901074-<format_item>-fix.py | a42ce4e3bcf3cd32eb44b6e67fee46a95e4f787a | [] | no_license | wsgan001/PyFPattern | e0fe06341cc5d51b3ad0fe29b84098d140ed54d1 | cc347e32745f99c0cd95e79a18ddacc4574d7faa | refs/heads/main | 2023-08-25T23:48:26.112133 | 2021-10-23T14:11:22 | 2021-10-23T14:11:22 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,254 | py | def format_item(self, item):
d = item.as_dict()
containers = d['containers']
ports = d['ip_address']['ports']
resource_group = d['id'].split('resourceGroups/')[1].split('/')[0]
for port_index in range(len(ports)):
ports[port_index] = ports[port_index]['port']
for container_index in range... | [
"dg1732004@smail.nju.edu.cn"
] | dg1732004@smail.nju.edu.cn |
96fdbd1d69014c062a573ce6737c753189550b8e | 2031771d8c226806a0b35c3579af990dd0747e64 | /pyobjc-framework-CoreServices/PyObjCTest/test_textutils.py | 2ff838ec467acf264133c95ae598c609539c4881 | [
"MIT"
] | permissive | GreatFruitOmsk/pyobjc-mirror | a146b5363a5e39181f09761087fd854127c07c86 | 4f4cf0e4416ea67240633077e5665f5ed9724140 | refs/heads/master | 2018-12-22T12:38:52.382389 | 2018-11-12T09:54:18 | 2018-11-12T09:54:18 | 109,211,701 | 2 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,648 | py | from PyObjCTools.TestSupport import *
import CoreServices
class TestTextUtils (TestCase):
def assert_not_wrapped(self, name):
self.assertTrue(not hasattr(CoreServices, name), "%r exposed in bindings"%(name,))
def test_not_wrapped(self):
self.assert_not_wrapped('ScriptRunStatus')
self.... | [
"ronaldoussoren@mac.com"
] | ronaldoussoren@mac.com |
7226b9cda9c338dffe84746f1f19fd9278d6e255 | 15e818aada2b18047fa895690bc1c2afda6d7273 | /lib/python/h5log_loader.py | 5cce0d76a64f14935c96f0fea66de17adea3cff0 | [
"Apache-2.0"
] | permissive | ghomsy/makani | 4ee34c4248fb0ac355f65aaed35718b1f5eabecf | 818ae8b7119b200a28af6b3669a3045f30e0dc64 | refs/heads/master | 2023-01-11T18:46:21.939471 | 2020-11-10T00:23:31 | 2020-11-10T00:23:31 | 301,863,147 | 0 | 0 | Apache-2.0 | 2020-11-10T00:23:32 | 2020-10-06T21:51:21 | null | UTF-8 | Python | false | false | 27,053 | py | # Copyright 2020 Makani Technologies LLC
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to... | [
"luislarco@google.com"
] | luislarco@google.com |
fbeecaa4293179be24399fb4bb5c7eee64229141 | 50a8c057fd6d8cd0ec96ca9b79c9328432335650 | /ubisqsh.py | e945ad61a8de0c5092e765f01c13e8f9f6c84a5b | [
"MIT"
] | permissive | KurSh/qc_modem_tools | ee804b566f83e30dde13e4aaf2f55e1a95c74fda | fce2f00e226f0fce82f064d218bf6adb70ea8647 | refs/heads/master | 2023-07-07T19:16:43.556182 | 2020-12-25T20:25:52 | 2020-12-25T20:25:52 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,643 | py | #!/usr/bin/env python3
from struct import unpack
import os,sys
def parse_ubihdr(rf):
curpos=rf.tell()
magic = rf.read(4)
if magic == b"UBI#":
rf.seek(curpos+0x10)
hdrsize = unpack(">I", rf.read(4))[0]
blksize = unpack(">I", rf.read(4))[0]
data = unpack(">I", rf.read(4))[0]
... | [
"info@revskills.de"
] | info@revskills.de |
781782dc9fc9bab7ca93ae38f17db36d6e004b67 | bae5f696b76af428fb5555c147c4f1bcff1bb62e | /metalearn/examples/evaluate_test_data_envs.py | 1f25c6c717085714ed0519ac4b1425fe888f373f | [
"MIT"
] | permissive | cosmicBboy/ml-research | 1e309f881f9810e7a82a262d625db5d684752705 | 04fd31f68e7a44152caf6eaaf66ab59f136dd8f5 | refs/heads/master | 2021-01-24T09:58:25.662826 | 2020-08-10T22:08:23 | 2020-08-10T22:08:23 | 123,030,133 | 8 | 4 | MIT | 2019-06-29T20:13:37 | 2018-02-26T21:03:02 | Jupyter Notebook | UTF-8 | Python | false | false | 2,129 | py | """Evaluate controller after training."""
import joblib
import pandas as pd
import os
import torch
from pathlib import Path
from metalearn.metalearn_controller import MetaLearnController
from metalearn.inference.inference_engine import CASHInference
from metalearn.task_environment import TaskEnvironment
from metalea... | [
"niels.bantilan@gmail.com"
] | niels.bantilan@gmail.com |
db4c205a1c301818753f25df685020906cb5d83c | 7dccf283800b0b47aece8dc7f0c209f5fea527a2 | /ROCC/fitted_Q_iteration/fitted_Q_agents.py | 20ceb89aad9f568488536eed458b0c1b942392ae | [
"MIT"
] | permissive | ucl-cssb/ROCC | 4e713f513a96390c64df23eb414d8a8e374431cb | e7491672bcafc0fac08fe750829e4fac2805d35a | refs/heads/master | 2021-07-10T14:53:31.150305 | 2020-11-17T09:58:01 | 2020-11-17T09:58:01 | 218,557,979 | 13 | 1 | null | 2020-11-17T09:57:37 | 2019-10-30T15:20:47 | Python | UTF-8 | Python | false | false | 10,912 | py | import sys
import os
import numpy as np
import tensorflow as tf
import math
import random
from tensorflow import keras
'''
import torch
import torch.nn as nn
import torch.optim as optim
import torch.nn.functional as F
'''
import matplotlib.pyplot as plt
class FittedQAgent():
'''
abstract class for the Tor... | [
"zcqsntr@ucl.ac.uk"
] | zcqsntr@ucl.ac.uk |
5249a6811fad92b075afe3535e1eb24bef84ca78 | f2befaae3840bafd181cc712108e3b64caf2696f | /app/portal/horizon/openstack_dashboard/dashboards/settings/user/panel.py | 9b9781eb0b3ae92466380018fce619077f697488 | [
"Apache-2.0",
"LicenseRef-scancode-generic-cla"
] | permissive | F5Networks/f5-adcaas-openstack | 17d5c408d421dcfe542002e1f850b2d9f29f1663 | 02bd8a606215c0fa08b926bac1b092b5e8b278df | refs/heads/master | 2023-08-28T12:09:54.972191 | 2022-08-12T02:03:43 | 2022-08-12T02:03:43 | 164,592,273 | 4 | 23 | Apache-2.0 | 2022-08-12T02:03:44 | 2019-01-08T07:40:35 | Python | UTF-8 | Python | false | false | 863 | py | # Copyright 2012 Nebula, Inc.
#
# Licensed under the Apache License, Version 2.0 (the "License"); you may
# not use this file except in compliance with the License. You may obtain
# a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agree... | [
"a.zong@f5.com"
] | a.zong@f5.com |
f8e584f21699ce5bf51c3992ef099f5f3548d4d1 | 52fb627ec952bf647c625f9372581bff4764da76 | /wo_websocket.py | 71f69201f610ea526be8c98ac46edded4b559f1b | [] | no_license | syyunn/smpc-dl | b89071d277347e28979973e734b329f51020a6b0 | 41bd40ef7866062a53fb20bcff994c51f38f38d5 | refs/heads/master | 2020-08-06T00:17:01.474179 | 2019-10-05T16:39:14 | 2019-10-05T16:39:14 | 212,768,083 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 5,515 | py | import time
import torch
import torch.nn as nn
import torch.nn.functional as F
import torch.optim as optim
from torchvision import datasets, transforms
import syft as sy
hook = sy.TorchHook(torch)
class Arguments():
def __init__(self):
self.batch_size = 64
self.test_batch_size = 64
self.... | [
"syyun@snu.ac.kr"
] | syyun@snu.ac.kr |
60738160b15b49779d9eaf9e8d83139fd7afa508 | 6b2a8dd202fdce77c971c412717e305e1caaac51 | /solutions_5636311922769920_0/Python/sleepingfire/d.py | ba96e3d60f9df7e644e9b38c0dc4523c1c6882bd | [] | no_license | alexandraback/datacollection | 0bc67a9ace00abbc843f4912562f3a064992e0e9 | 076a7bc7693f3abf07bfdbdac838cb4ef65ccfcf | refs/heads/master | 2021-01-24T18:27:24.417992 | 2017-05-23T09:23:38 | 2017-05-23T09:23:38 | 84,313,442 | 2 | 4 | null | null | null | null | UTF-8 | Python | false | false | 988 | py | import sys, os, math
def main(K, C, S):
minimum = math.ceil(K / C)
if minimum > S:
return "IMPOSSIBLE"
cs = [1] * (C + 1)
for i in range(1, C+1):
cs[i] = C * cs[i-1]
tiles = []
idx = 1
depth = 0
for k in range(1, math.ceil(K / C) * C + 1):
idx = (idx - 1) * K +... | [
"alexandra1.back@gmail.com"
] | alexandra1.back@gmail.com |
a24387d89088254301d368ebf2e5e55d143a8c4c | 0f0f8b3b027f412930ca1890b0666538358a2807 | /dotop/addons/base/tests/test_translate.py | c61011c1179ece9a596ac5d562a30db71e6c1d7e | [] | no_license | konsoar/dotop_pos_v11 | 741bd5ca944dfd52eb886cab6f4b17b6d646e131 | 576c860917edd25661a72726d0729c769977f39a | refs/heads/master | 2021-09-06T13:25:34.783729 | 2018-02-07T02:11:12 | 2018-02-07T02:11:12 | 111,168,355 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 9,651 | py | # -*- coding: utf-8 -*-
# Part of dotop. See LICENSE file for full copyright and licensing details.
import unittest
from dotop.tools.translate import quote, unquote, xml_translate, html_translate
from dotop.tests.common import TransactionCase
class TranslationToolsTestCase(unittest.TestCase):
def test_quote_un... | [
"Administrator@20nuo003-PC"
] | Administrator@20nuo003-PC |
b0e17c91d87c7d7e5fcc3f873986d920f6918c16 | 21a561ec0d40554a43dc5a6dfab0f4f62ddb615d | /canteen/base/__init__.py | aaae304df48bbcbcb386327709ca4b1e4a9c8d98 | [
"MIT"
] | permissive | mindis/canteen | 2745a0ebec696d1fbfcc6c4c69582711a4a7e8e6 | a0cf38333417e879712394800a49eb9d0450f96f | refs/heads/master | 2020-12-25T19:15:21.612088 | 2014-02-24T11:29:59 | 2014-02-24T11:29:59 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 479 | py | # -*- coding: utf-8 -*-
'''
canteen base
~~~~~~~~~~~~
:author: Sam Gammon <sam@keen.io>
:copyright: (c) Keen IO, 2013
:license: This software makes use of the MIT Open Source License.
A copy of this license is included as ``LICENSE.md`` in
the root of the project.
'''
# import all... | [
"sam@keen.io"
] | sam@keen.io |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.