The full dataset viewer is not available (click to read why). Only showing a preview of the rows.
Error code: DatasetGenerationCastError
Exception: DatasetGenerationCastError
Message: An error occurred while generating the dataset
All the data files must have the same columns, but at some point there are 1 new columns ({'Unnamed: 0.1'})
This happened while the csv dataset builder was generating data using
hf://datasets/ITMO-NSS/MADD_Benchmark_and_results/Datasets_for_generative_models_train/data_Drug_resist.csv (at revision 5383d8ed58ea482b77cd3ecb03a3044246c27dc2)
Please either edit the data files to have matching columns, or separate them into different configurations (see docs at https://hf.co/docs/hub/datasets-manual-configuration#multiple-configurations)
Traceback: Traceback (most recent call last):
File "/src/services/worker/.venv/lib/python3.9/site-packages/datasets/builder.py", line 1831, in _prepare_split_single
writer.write_table(table)
File "/src/services/worker/.venv/lib/python3.9/site-packages/datasets/arrow_writer.py", line 644, in write_table
pa_table = table_cast(pa_table, self._schema)
File "/src/services/worker/.venv/lib/python3.9/site-packages/datasets/table.py", line 2272, in table_cast
return cast_table_to_schema(table, schema)
File "/src/services/worker/.venv/lib/python3.9/site-packages/datasets/table.py", line 2218, in cast_table_to_schema
raise CastError(
datasets.table.CastError: Couldn't cast
Unnamed: 0: int64
Unnamed: 0.1: int64
canonical_smiles: string
QED: double
Synthetic Accessibility: double
PAINS: int64
SureChEMBL: int64
Glaxo: int64
Brenk: int64
IC50: int64
docking_score: double
-- schema metadata --
pandas: '{"index_columns": [{"kind": "range", "name": null, "start": 0, "' + 1557
to
{'Unnamed: 0': Value('int64'), 'docking_score': Value('float64'), 'canonical_smiles': Value('string'), 'QED': Value('float64'), 'Synthetic Accessibility': Value('float64'), 'PAINS': Value('int64'), 'SureChEMBL': Value('int64'), 'Glaxo': Value('int64'), 'Brenk': Value('int64'), 'IC50': Value('int64')}
because column names don't match
During handling of the above exception, another exception occurred:
Traceback (most recent call last):
File "/src/services/worker/src/worker/job_runners/config/parquet_and_info.py", line 1456, in compute_config_parquet_and_info_response
parquet_operations = convert_to_parquet(builder)
File "/src/services/worker/src/worker/job_runners/config/parquet_and_info.py", line 1055, in convert_to_parquet
builder.download_and_prepare(
File "/src/services/worker/.venv/lib/python3.9/site-packages/datasets/builder.py", line 894, in download_and_prepare
self._download_and_prepare(
File "/src/services/worker/.venv/lib/python3.9/site-packages/datasets/builder.py", line 970, in _download_and_prepare
self._prepare_split(split_generator, **prepare_split_kwargs)
File "/src/services/worker/.venv/lib/python3.9/site-packages/datasets/builder.py", line 1702, in _prepare_split
for job_id, done, content in self._prepare_split_single(
File "/src/services/worker/.venv/lib/python3.9/site-packages/datasets/builder.py", line 1833, in _prepare_split_single
raise DatasetGenerationCastError.from_cast_error(
datasets.exceptions.DatasetGenerationCastError: An error occurred while generating the dataset
All the data files must have the same columns, but at some point there are 1 new columns ({'Unnamed: 0.1'})
This happened while the csv dataset builder was generating data using
hf://datasets/ITMO-NSS/MADD_Benchmark_and_results/Datasets_for_generative_models_train/data_Drug_resist.csv (at revision 5383d8ed58ea482b77cd3ecb03a3044246c27dc2)
Please either edit the data files to have matching columns, or separate them into different configurations (see docs at https://hf.co/docs/hub/datasets-manual-configuration#multiple-configurations)Need help to make the dataset viewer work? Make sure to review how to configure the dataset viewer, and open a discussion for direct support.
Unnamed: 0 int64 | docking_score float64 | canonical_smiles string | QED float64 | Synthetic Accessibility float64 | PAINS int64 | SureChEMBL int64 | Glaxo int64 | Brenk int64 | IC50 int64 |
|---|---|---|---|---|---|---|---|---|---|
0 | -8.3 | Fc1cc(F)c2ccc(Oc3cncc4nnc(-c5ccc(OC(F)F)cc5)n34)cc2c1 | 0.332331 | 2.838249 | 0 | 0 | 0 | 0 | 0 |
1 | -4.5 | CN1/C(=C\C=N\NC(=O)c2ccccc2Br)C(C)(C)c2ccccc21 | 0.612385 | 2.464846 | 0 | 0 | 1 | 1 | 0 |
2 | 21.5 | O=C(c1ccc2cc(-c3cccc(OCc4ccccc4)c3)ccc2c1)N1CCCC(CO)C1 | 0.395257 | 2.541906 | 0 | 0 | 0 | 0 | 0 |
3 | -6.1 | Sc1nnc(-c2cccnc2)n1/N=C/c1cccs1 | 0.594794 | 2.70783 | 0 | 0 | 1 | 1 | 0 |
4 | -4.7 | Cc1c(Br)c(C(N)=O)nn1C | 0.749235 | 2.560828 | 0 | 0 | 0 | 0 | 0 |
5 | -5.7 | O=C(N/N=C/c1ccoc1)c1ccccc1O | 0.622669 | 2.25096 | 0 | 0 | 1 | 1 | 0 |
6 | -6 | CCCCNS(=O)(=O)c1cccc(NC(=O)[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c1 | 0.366039 | 3.331851 | 0 | 0 | 0 | 1 | 1 |
7 | -7 | CCN1CCN(C)C/C1=N\c1ccc([N+](=O)[O-])cc1C(=O)Nc1ccccc1 | 0.634569 | 2.614031 | 0 | 0 | 0 | 1 | 1 |
8 | -6.7 | CCNC(=O)C1(C)CCCN(C(=O)c2ccc(OC)c(F)c2)C1 | 0.924487 | 2.69066 | 0 | 0 | 0 | 0 | 0 |
9 | -6.5 | Cc1cc(OC(=O)c2cccc(Cl)c2)c([N+](=O)[O-])c(O)n1 | 0.531049 | 2.418675 | 0 | 0 | 0 | 1 | 0 |
10 | 3.1 | COCCNC(=O)c1cc2c(c(-c3cccc(C#CCN(C)C)c3)n1)[C@@H](CCO)N([S+]([O-])C(C)(C)C)C2 | 0.294384 | 4.322519 | 0 | 1 | 1 | 1 | 0 |
11 | -5.3 | Cc1cc(C)c(COc2ccc(/C=N/n3c(C)nnc3S)cc2)c(C)c1 | 0.542099 | 2.548605 | 0 | 0 | 1 | 1 | 0 |
12 | -7.7 | O=C(CCNC(=O)c1ccc(Cl)cc1)N[C@@H]1CCCc2ccccc21 | 0.858611 | 2.303891 | 0 | 0 | 0 | 0 | 0 |
13 | -6.8 | CC(=O)/C(=N\Nc1ccccc1)Oc1ccc(Br)cc1 | 0.525357 | 2.290745 | 0 | 0 | 0 | 1 | 0 |
14 | -5.8 | COc1ccc2cc(Br)c(=O)oc2c1 | 0.734908 | 2.09481 | 0 | 0 | 0 | 1 | 0 |
15 | -4.2 | C=CC(=O)NCOCCCC | 0.35551 | 2.567159 | 0 | 1 | 0 | 1 | 1 |
16 | -5.6 | COCc1n[nH]c(O)c1/C=N/N1CCOCC1 | 0.719638 | 3.279529 | 0 | 0 | 0 | 1 | 0 |
17 | -3.2 | CC(C)OCCO | 0.561387 | 2.15407 | 0 | 0 | 0 | 0 | 1 |
18 | -4.3 | CC(C)=CC(C)(C)C | 0.422475 | 2.801898 | 0 | 0 | 0 | 1 | 1 |
19 | -2.4 | COc1cc(C(=O)OCCN2CCN(CCOC(=O)c3cc(OC)c(OC)c(OC)c3)CC2)cc(OC)c1OC | 0.314997 | 2.349014 | 0 | 0 | 0 | 0 | 1 |
20 | 17.3 | CNC(=O)C[C@H]1CC[C@@H]2[C@H](COc3ccc(NC(=O)Nc4ccc(C)cc4)cc3C(=O)N2C)O1 | 0.64147 | 3.456144 | 0 | 0 | 0 | 0 | 0 |
21 | -2.7 | COc1cc(/C=N/NC(=O)Cn2ccc(C(F)(F)F)n2)cc(OC)c1OC | 0.581634 | 2.443773 | 0 | 0 | 1 | 1 | 0 |
22 | -5.6 | O=C(O)c1cccc(Cn2c(Cl)c(/C=N/NC(=O)c3ccccc3)sc2=O)c1 | 0.476857 | 2.336283 | 0 | 0 | 1 | 1 | 1 |
23 | -6.9 | CCO/C(O)=C\C1=Nc2cc(C)c(C)cc2NC(=O)C1 | 0.831632 | 3.139555 | 0 | 0 | 0 | 1 | 0 |
24 | -4.6 | CCCNC(=O)C[C@@H]1CC[C@@H]2[C@H](COC[C@H](O)CN2C(=O)c2cc(Cl)cc(Cl)c2)O1 | 0.70724 | 3.767329 | 0 | 0 | 0 | 0 | 0 |
25 | -6.3 | C/C(=N/NC(=O)c1ccccn1)c1ccco1 | 0.6445 | 2.182052 | 0 | 1 | 1 | 1 | 0 |
26 | -6.5 | Oc1ccc(/C=N/Nc2nc(-c3ccccc3F)nc3ccccc23)c(O)c1 | 0.366093 | 2.367037 | 1 | 0 | 0 | 1 | 0 |
27 | -7.8 | COc1ccc2c(c1)[nH]c1cccc(CNCc3ccccc3)c12 | 0.563548 | 2.01234 | 0 | 0 | 0 | 0 | 1 |
28 | 1.5 | COc1ccc(C(=O)N/N=C/c2ccc(OC(=O)c3cccs3)cc2)cc1 | 0.305857 | 2.021595 | 0 | 1 | 1 | 1 | 1 |
29 | -3.1 | NCCNCCO | 0.381452 | 2.341807 | 0 | 0 | 0 | 1 | 0 |
30 | -7.4 | COc1ccccc1/C=N/Nc1cc(C)nc2ccc(C)cc12 | 0.57701 | 2.114106 | 0 | 0 | 0 | 1 | 0 |
31 | -6.2 | CCOC(=O)c1cc2c(=O)n3cccc(C)c3nc2n(CC(C)C)/c1=N/C(=O)c1ccco1 | 0.34286 | 2.840301 | 1 | 0 | 0 | 1 | 0 |
32 | -6.9 | Oc1ccc(CCN2CCc3ccccc3C2)cc1O | 0.842008 | 1.978217 | 1 | 0 | 0 | 1 | 0 |
33 | -4.5 | CCCCCCCCCCCC(=O)OCC | 0.385043 | 1.648422 | 0 | 0 | 1 | 1 | 1 |
34 | -7.1 | Cc1cccc(C)c1NC(=O)C1(C)CN(S(C)(=O)=O)CC(=O)N1CC(F)(F)F | 0.801371 | 3.242294 | 0 | 0 | 0 | 0 | 1 |
35 | -7.1 | COc1cc(/C=N\NC(=O)CNC(=O)c2cccc([N+](=O)[O-])c2)ccc1O | 0.378329 | 2.13945 | 0 | 0 | 1 | 1 | 1 |
36 | -2.5 | COc1ccccc1C(=O)Nc1cc(NC(=O)c2ccccc2C(C)C)ccc1F | 0.570995 | 1.931077 | 0 | 0 | 0 | 0 | 0 |
37 | -4.5 | CC(=O)CC(=O)OC(C)(C)C | 0.449197 | 2.084303 | 0 | 0 | 0 | 1 | 1 |
38 | -7.4 | COc1ccc([C@H]2CC(=O)C[C@@H](CCn3cc(-c4cccnc4)nn3)O2)cc1 | 0.655214 | 3.344153 | 0 | 0 | 0 | 0 | 0 |
39 | -7.3 | CC(/C=C(\O)c1ccc(Br)cc1)=N/NC(=O)c1ccccc1 | 0.489371 | 2.188528 | 0 | 1 | 1 | 1 | 0 |
40 | -5.5 | O=C(CNC(=O)c1cccnc1)N/N=C/c1ccc(O)cc1O | 0.468808 | 2.248289 | 1 | 0 | 1 | 1 | 0 |
41 | -3.7 | O=C(N/N=C/c1ccccn1)c1cc(-c2ccccc2Cl)n[nH]1 | 0.571228 | 2.323239 | 0 | 0 | 1 | 1 | 0 |
42 | -6.9 | CC(/C=C/c1ccccc1)=N/NC(=O)Cn1nnc(N)n1 | 0.612108 | 2.640609 | 0 | 1 | 1 | 1 | 0 |
43 | -5.9 | Cn1cnc2c(F)c(Nc3ccc(Br)cc3F)c(C(=O)NOCCO)cc21 | 0.40457 | 2.828737 | 0 | 1 | 0 | 1 | 0 |
44 | -5.9 | COc1ccc(/C=N/Nc2nc3ccccc3[nH]2)c(OC)c1OC | 0.537417 | 2.295033 | 0 | 0 | 0 | 1 | 0 |
45 | 1.4 | Cc1ccc(-c2cc(C(=O)Nc3ccc(C(F)(F)F)cc3)c3ccccc3n2)cc1C | 0.396476 | 1.994419 | 0 | 0 | 0 | 0 | 0 |
46 | -5.7 | Cc1ccc(-n2nc3cc(C)c(NC(=O)COc4ccccc4)cc3n2)cc1 | 0.573665 | 2.055252 | 0 | 0 | 0 | 0 | 0 |
47 | 24.6 | COc1ccc2c(c1)C1CC1(C(=O)N1C3CC1CN(C)C3)Cn1c-2c(C2CCCCC2)c2ccc(C(=O)NS(=O)(=O)N(C)C)cc21 | 0.428985 | 5.088599 | 0 | 0 | 0 | 0 | 0 |
48 | -5.4 | Nc1cc(C(=O)N/N=C/c2cccc([N+](=O)[O-])c2)nnc1O | 0.419644 | 2.683682 | 0 | 0 | 1 | 1 | 0 |
49 | -4 | Nc1nc(=S)[nH][nH]1 | 0.419282 | 3.885726 | 0 | 0 | 0 | 1 | 0 |
50 | -6.8 | CC(Sc1ccccc1)C(=O)N/N=C/c1cccnc1 | 0.521884 | 2.522078 | 0 | 0 | 1 | 1 | 0 |
51 | -6.3 | O=C1C=CC(=O)N1c1ccc(Br)cc1[N+](=O)[O-] | 0.473238 | 2.458082 | 0 | 0 | 0 | 1 | 0 |
52 | 40 | CN(C)/C=N/C(=O)c1ccc(N2CCN(c3ncc(C(F)(F)F)cc3Cl)CC2)cc1 | 0.535362 | 2.603829 | 0 | 0 | 0 | 1 | 0 |
53 | -4.8 | FC(F)(F)c1ccc(N(c2cccnc2)C2CCN(C(c3ccccc3)C(F)(F)F)CC2)cc1 | 0.367281 | 3.148517 | 0 | 0 | 0 | 0 | 0 |
54 | -5.9 | C=C(C)c1cccc(C(=C)C)c1 | 0.614511 | 2.217661 | 0 | 1 | 0 | 0 | 1 |
55 | 5.3 | O=C(NCc1cccnc1)c1ccc2[nH]c([C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)nc2c1 | 0.322678 | 3.68735 | 0 | 0 | 0 | 0 | 0 |
56 | -6.1 | CN1CCN(c2ccc([N+](=O)[O-])cc2/C=N/NC(=O)c2ccc(F)cc2)CC1 | 0.48428 | 2.218187 | 0 | 0 | 1 | 1 | 0 |
57 | -7.4 | CC1(c2nc3ccccc3[nH]2)CCC(=O)N1Cc1ccc(F)cc1 | 0.798039 | 2.880973 | 0 | 0 | 0 | 0 | 0 |
58 | 1.7 | N#Cc1ccc(N2CCC(C(=O)N(CC3CC3)c3ccc(Cl)cc3)CC2)nc1 | 0.759459 | 2.398313 | 0 | 0 | 0 | 0 | 0 |
59 | -7.3 | CCc1noc(C)c1C(=O)N(CC)CC(=O)Nc1ccccc1C(F)(F)F | 0.826002 | 2.393786 | 0 | 0 | 0 | 0 | 0 |
60 | -6.6 | CC1CCCN(C/C(O)=C(\C#N)c2nc3ccccc3[nH]2)C1 | 0.673855 | 3.183444 | 0 | 0 | 0 | 1 | 0 |
61 | -2.9 | Cc1nn(-c2ccccc2)c(S)c1/C=N/c1ccc([N+](=O)[O-])cc1 | 0.336353 | 2.58651 | 0 | 0 | 1 | 1 | 0 |
62 | -5.1 | O=P(Cl)(Cl)c1ccccc1 | 0.62908 | 2.503516 | 0 | 1 | 1 | 1 | 1 |
63 | -6.3 | Cc1cnc(-c2ccccc2C(C)C)nc1NCC1CN(c2cccnc2)C1 | 0.688447 | 2.559203 | 0 | 0 | 0 | 0 | 0 |
64 | 9.6 | O=C(O)CCCCc1nc2cc(C3=NOC(CO)(c4ccccc4)C3)ccc2c(=O)n1-c1ccc(F)cc1 | 0.320836 | 3.263674 | 0 | 0 | 0 | 1 | 0 |
65 | -6.6 | C[C@H](CCC(=O)Nc1ccc(S(N)(=O)=O)cc1F)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3C[C@H](O)[C@]12C | 0.393745 | 4.509356 | 0 | 0 | 0 | 0 | 1 |
66 | 1.6 | COCCn1cnc2c(c1=O)c1nc3ccccc3nc1n2/N=C/c1ccc(OC)c(OC)c1 | 0.345377 | 2.648502 | 0 | 0 | 0 | 1 | 0 |
67 | -2 | O=C(N/N=C/c1c(Cl)cccc1Cl)c1ccc(-n2cnnn2)cc1 | 0.572036 | 2.257269 | 0 | 0 | 1 | 1 | 0 |
68 | 3.1 | C[C@@H]1O[C@@H](OC2CC(O)C3(CO)C4C(CCC3(O)C2)C2(O)CCC(C3=CC(=O)OC3)C2(C)C[C@H]4O)[C@H](O)[C@H](O)[C@H]1O | 0.140164 | 5.582648 | 0 | 0 | 1 | 1 | 0 |
69 | -5.3 | CCCCCC/C(=N/O)c1ccccn1 | 0.335953 | 2.272774 | 0 | 1 | 0 | 1 | 1 |
70 | 18.9 | CO[C@H]1CN(C)C(=O)c2cc(NC(=O)Nc3cc(Cl)cc(Cl)c3)ccc2OC[C@H](C)NC[C@@H]1C | 0.556683 | 4.058741 | 0 | 0 | 0 | 0 | 0 |
71 | -2.7 | CCc1nc2ccc(C(=O)Nc3cccc(NS(C)(=O)=O)c3)cn2c1N(C)C(=O)Cc1ccccc1 | 0.378958 | 2.589029 | 0 | 0 | 0 | 0 | 0 |
72 | -6 | Cc1ccc(N(SC(F)(Cl)Cl)S(=O)(=O)N(C)C)cc1 | 0.606096 | 2.961179 | 0 | 1 | 0 | 1 | 1 |
73 | -5.9 | OCCCNc1ncnc2c1ncn2[C@H]1CN(Cc2ccc(Cl)cc2)C[C@@H](CO)O1 | 0.461106 | 3.401718 | 0 | 0 | 0 | 1 | 0 |
74 | -7.5 | O=C(O)c1ccccc1N/N=C/C1=C(N2CCOCC2)/C(=C\c2ccccc2)CC1 | 0.557283 | 2.591519 | 1 | 0 | 0 | 1 | 0 |
75 | -6.3 | CCN(C(=O)CSc1nnnn1-c1ccccc1OC)C1CCS(=O)(=O)C1 | 0.615889 | 2.929613 | 0 | 0 | 0 | 0 | 0 |
76 | -4.1 | CC(C)CNCC(C)C | 0.610919 | 1.917866 | 0 | 0 | 0 | 0 | 1 |
77 | -5.8 | C=CC/N=C1/S/C(=C/c2ccc([N+](=O)[O-])cc2)C(=O)N1CC=C | 0.347377 | 2.750266 | 0 | 1 | 0 | 1 | 1 |
78 | -8.7 | c1ccc(CNc2nc(N3CCOc4ccccc43)nc3c2CCCC3)cc1 | 0.730791 | 2.378227 | 0 | 0 | 0 | 0 | 0 |
79 | -4.6 | C[C@@H]1O[C@H](C[N+](C)(C)C)C[C@@H]1O | 0.607294 | 4.217565 | 0 | 0 | 0 | 1 | 0 |
80 | -6.8 | CC(=N)/C(C#N)=C(/O)CSc1nnnn1-c1ccc(C)cc1C | 0.377645 | 2.915362 | 0 | 1 | 0 | 1 | 0 |
81 | -5.9 | FC(F)(F)c1ccc(Cl)cc1Cl | 0.612663 | 1.840423 | 0 | 0 | 0 | 0 | 1 |
82 | -5.8 | CCCCCCCC[S+]([O-])C(C)Cc1ccc2c(c1)OCO2 | 0.471296 | 3.584511 | 0 | 1 | 1 | 1 | 1 |
83 | -8.8 | C[C@]12CCC(=O)C[C@@H]1CC[C@@H]1[C@@H]2C(=O)C[C@]2(C)C(=O)CC[C@@H]12 | 0.689294 | 4.155878 | 0 | 0 | 0 | 0 | 1 |
84 | -5.2 | Cc1cc(Cl)c(C)cc1Cl | 0.564451 | 1.740004 | 0 | 0 | 0 | 0 | 1 |
85 | -7.6 | Cc1cccc(C)c1C(O)c1nc(-c2ccccc2Cl)c[nH]1 | 0.751392 | 3.055234 | 0 | 0 | 0 | 0 | 0 |
86 | -6.6 | CCOC(=O)C1(C)CCCN(C(=O)c2ccc3c(c2)OCO3)C1 | 0.799379 | 2.759635 | 0 | 0 | 0 | 0 | 0 |
87 | -8.1 | FC(F)(F)c1ccccc1-c1nc2c(c(NCc3ccc(-c4cccnc4)cc3)n1)CCC2 | 0.389498 | 2.429785 | 0 | 0 | 0 | 0 | 0 |
88 | -1.9 | Cc1cc(C)c([N+](=O)[O-])cc1-c1ccc(/C=N/NC(=O)c2nonc2N)o1 | 0.391956 | 2.756859 | 0 | 0 | 1 | 1 | 0 |
89 | -6 | COc1ccc2c(c1)CCC/C2=N\Nc1nc(C(=O)NN)cs1 | 0.451148 | 2.581352 | 0 | 1 | 1 | 1 | 0 |
90 | -3.1 | N#CNC(=N)N | 0.151385 | 3.821112 | 0 | 1 | 0 | 1 | 1 |
91 | -6.8 | CC(=O)NC1CCCN(O)C(=O)/C=C(\C)CCOC(=O)C(NC(C)=O)CCCN(O)C(=O)/C=C(\C)CCOC(=O)C(NC(C)=O)CCCN(O)C(=O)/C=C(\C)CCOC1=O | 0.131936 | 5.320891 | 0 | 0 | 0 | 1 | 0 |
92 | -7 | CN1CCN(c2ccccc2/C=N/NC(=O)c2cccnc2)CC1 | 0.68568 | 2.147364 | 0 | 0 | 1 | 1 | 0 |
93 | -6.3 | Cc1ccc(Sc2ncccc2/C=N/O)cc1 | 0.511372 | 2.401398 | 0 | 1 | 0 | 1 | 1 |
94 | -7.4 | O=C(NCC1CCCO1)c1cccc(S(=O)(=O)Nc2ccccc2Cl)c1 | 0.788161 | 2.405954 | 0 | 0 | 0 | 0 | 1 |
95 | -8.2 | O=C1C(Nc2cccc(Cl)c2)=C(N2CCCCC2)C(=O)c2ccccc21 | 0.866654 | 2.224895 | 1 | 0 | 1 | 0 | 0 |
96 | -7 | CN(C)c1ccc(/C=N/CC2COc3ccccc3O2)cc1 | 0.813387 | 2.847118 | 0 | 0 | 0 | 1 | 0 |
97 | -2.7 | N#CCNCC#N | 0.375504 | 3.445527 | 0 | 1 | 1 | 1 | 1 |
98 | -6 | COc1cc(/C=N/N2CCCCC2)cc([N+](=O)[O-])c1O | 0.517888 | 2.474875 | 0 | 0 | 0 | 1 | 1 |
99 | -2.9 | C=CC[C@H]1C2CC[C@H]3[C@@H]4CC[C@H]([C@H](C)CC[C@@H](CC)C(C)C)[C@@]4(C)CC[C@@H]3[C@@]2(C)CC[C@H]1O | 0.361387 | 4.707102 | 0 | 1 | 0 | 1 | 1 |
Dataset Card for Dataset Name
This dataset card aims to be a base template for new datasets. It has been generated using this raw template.
Dataset Details
Dataset Description
- Curated by: [More Information Needed]
- Funded by [optional]: Ministry of Economic Development of the Russian Federation (IGK 000000C313925P4C0002), agreement No139-15- 2025-010
- Shared by [optional]: [More Information Needed]
- Language(s) (NLP): English
- License: [More Information Needed]
Dataset Sources [optional]
- Repository: [More Information Needed]
- Paper [optional]: [More Information Needed]
- Demo [optional]: [More Information Needed]
Uses
Direct Use
[More Information Needed]
Out-of-Scope Use
[More Information Needed]
Dataset Structure
[More Information Needed]
Dataset Creation
Curation Rationale
[More Information Needed]
Source Data
Data Collection and Processing
[More Information Needed]
Who are the source data producers?
[More Information Needed]
Annotations [optional]
Annotation process
[More Information Needed]
Who are the annotators?
[More Information Needed]
Personal and Sensitive Information
[More Information Needed]
Bias, Risks, and Limitations
[More Information Needed]
Recommendations
Users should be made aware of the risks, biases and limitations of the dataset. More information needed for further recommendations.
Citation [optional]
arxiv.org/abs/2511.08217
BibTeX:
[More Information Needed]
APA:
arxiv.org/abs/2511.08217
[More Information Needed]
Glossary [optional]
[More Information Needed]
More Information [optional]
[More Information Needed]
Dataset Card Authors [optional]
[More Information Needed]
Dataset Card Contact
[More Information Needed]
- Downloads last month
- 33