Dataset Viewer
Auto-converted to Parquet Duplicate
instruction
stringlengths
48
275
input
stringclasses
1 value
output
stringlengths
9
208
With the given product COc1cccc(C2CC(C)(C)c3cc(C(=O)NS(C)(=O)=O)ccc3N2)c1, suggest some likely reactants that were used in its synthesis.
COc1cccc(C2CC(C)(C)c3cc(C(=O)O)ccc3N2)c1.CS(N)(=O)=O
CC(Oc1ccc(C#N)cn1)C1CN(Cc2ccccc2)CC1c1ccc(C#N)cc1 Given the product provided, propose some possible reactants that could have been employed in its formation.
Here are possible reactants: CC(O)C1CN(Cc2ccccc2)CC1c1ccc(C#N)cc1.N#Cc1ccc(Cl)nc1 .
COc1c(C(C)NC(=O)OCc2ccccc2)cc(Cl)c(Cl)c1C1CNC1 Given the product provided, propose some possible reactants that could have been employed in its formation.
Here are possible reactants: COc1c(C(C)NC(=O)OCc2ccccc2)cc(Cl)c(Cl)c1C1CN(C(=O)OC(C)(C)C)C1 .
O=[N+]([O-])c1cc(F)c(Cl)c(Br)c1Cl Given the product provided, propose some possible reactants that could have been employed in its formation.
Here are possible reactants: BrBr.O=[N+]([O-])c1cc(F)c(Cl)cc1Cl .
Can you list the reactants that might result in the chemical product O=C(O)c1cnc(N2CC3CN(S(=O)(=O)c4ccc5ccccc5c4)CC3C2)nc1 ?
CCOC(=O)c1cnc(N2CC3CN(S(=O)(=O)c4ccc5ccccc5c4)CC3C2)nc1
To synthesis CCOC(=O)c1csc(N2CCC(O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C2)n1, what are the possible reactants? Write in the SMILES representation.
CC(C)(C)[Si](Cl)(c1ccccc1)c1ccccc1.CCOC(=O)c1csc(N2CCC(O)C2)n1
Can you identify the reactant(s) that might result in the given product CCCCCCCCCCCCCCCCCCCCCC(=O)Nc1ccc([N+](=O)[O-])cc1 ?
CCCCCCCCCCCCCCCCCCCCCC(=O)Cl.Nc1ccc([N+](=O)[O-])cc1
Do retrosynthesis with the product O=C(O)c1cccnc1 .
OK. The reactants may be COC(=O)c1cccnc1 .
Based on the given product, provide some plausible reactants that might have been utilized to prepare it. CN(C)C(=O)C(O)c1ccccc1-c1ccc2[nH]c(COc3ccc(C(F)(F)F)cc3)nc2c1
CNC.O=C(O)C(O)c1ccccc1-c1ccc2[nH]c(COc3ccc(C(F)(F)F)cc3)nc2c1
To synthesis Cc1c(CO)c2cnnc(NCc3ccccc3)c2n1Cc1ccccc1, what are the possible reactants? Write in the SMILES representation.
Cc1c(C=O)c2cnnc(NCc3ccccc3)c2n1Cc1ccccc1
CN1CCC(Sc2cc(F)cc(NC(=O)c3ccc(F)cc3Cl)c2)CC1 Given the product provided, propose some possible reactants that could have been employed in its formation.
Here are possible reactants: CN1CCC(Sc2cc(N)cc(F)c2)CC1.O=C(Cl)c1ccc(F)cc1Cl .
Suggest possible substances that may have been involved in the synthesis of the presented compound. CC(=O)OC(CCc1ccc(-c2ccccc2)cc1)CC(=O)OC(C)(C)C
CC(=O)OC(C)=O.CC(C)(C)OC(=O)CC(O)CCc1ccc(-c2ccccc2)cc1
Identify possible reactants that could have been used to create the specified product. CC(C)COC(=O)NCC1CN=C(c2ccccc2F)c2ccccc2N1C
CC(C)COC(=O)Cl.CN1c2ccccc2C(c2ccccc2F)=NCC1CN
Given the following product, please provide possible reactants. CN(c1nnc(C(F)(F)F)s1)C1CCN(Cc2ccc(F)cc2)CC1
Possible reactant(s): CN(c1nnc(C(F)(F)F)s1)C1CCNCC1.Fc1ccc(CCl)cc1 .
To synthesis COC(=O)COc1cccc2c1c1c(C(N)=O)cccc1n2Cc1cccc(C(F)(F)F)c1, what are the possible reactants? Write in the SMILES representation.
COC(=O)CBr.NC(=O)c1cccc2c1c1c(O)cccc1n2Cc1cccc(C(F)(F)F)c1
Given the following product, please provide possible reactants. O=C(O)c1ccc2c(c1)C(NC(=O)c1ccccc1Cl)CCO2
Possible reactant(s): COC(=O)c1ccc2c(c1)C(NC(=O)c1ccccc1Cl)CCO2 .
Based on the given product, provide some plausible reactants that might have been utilized to prepare it. O=C(Nc1cccc(-c2cnn(Cc3ccccc3)c2)c1)c1cc2cccc(O)c2oc1=O
Nc1cccc(-c2cnn(Cc3ccccc3)c2)c1.O=C(O)c1cc2cccc(O)c2oc1=O
Cc1[nH]c(C=C2C(=O)Nc3ccc(S(=O)(=O)Cc4c(Cl)cccc4Cl)cc32)c(C)c1C(=O)NCCN1CCN(C(=O)OC(C)(C)C)CC1 Given the product provided, propose some possible reactants that could have been employed in its formation.
Here are possible reactants: CC(C)(C)OC(=O)N1CCN(CCN)CC1.Cc1[nH]c(C=C2C(=O)Nc3ccc(S(=O)(=O)Cc4c(Cl)cccc4Cl)cc32)c(C)c1C(=O)O .
Nc1ccc(-c2nc3ccccc3s2)cc1Br Given the product provided, propose some possible reactants that could have been employed in its formation.
Here are possible reactants: BrBr.Nc1ccc(-c2nc3ccccc3s2)cc1 .
Provide the potential reactants that may be used to produce the product Cc1cc(Cl)cc2c1OCCC2=O .
The potential reactants: Cc1cc(Cl)ccc1OCCC(=O)O .
Can you list the reactants that might result in the chemical product COC(=O)c1ccc(Cl)c(Br)c1 ?
CO.O=C(O)c1ccc(Cl)c(Br)c1
Based on the given product, provide some plausible reactants that might have been utilized to prepare it. CC1CCN(C(=O)N2CCOc3ccc(-c4cnc(N)c(N)c4)cc3C2)CC1
CC1CCN(C(=O)N2CCOc3ccc(-c4cnc(N)c([N+](=O)[O-])c4)cc3C2)CC1
Based on the given product, provide some plausible reactants that might have been utilized to prepare it. CCOCc1cn(CC(=O)Nc2sc3c(c2C(N)=O)CCCC3)nc1C(F)(F)F
CCI.NC(=O)c1c(NC(=O)Cn2cc(CO)c(C(F)(F)F)n2)sc2c1CCCC2
Can you list the reactants that might result in the chemical product Nc1ncccc1-c1nc2cc(-c3cccnc3)cnc2n1-c1ccc(CNC(=O)c2ccccc2)cc1 ?
NCc1ccc(-n2c(-c3cccnc3N)nc3cc(-c4cccnc4)cnc32)cc1.O=C(O)c1ccccc1
Identify possible reactants that could have been used to create the specified product. O=C(NCC1CC1)c1ccc(OCc2c(-c3ccccc3)noc2C(F)(F)F)nc1
COC(=O)c1ccc(OCc2c(-c3ccccc3)noc2C(F)(F)F)nc1.NCC1CC1
Identify possible reactants that could have been used to create the specified product. OCc1cc(Cl)c2cn[nH]c2c1
O=C(O)c1cc(Cl)c2cn[nH]c2c1
Do retrosynthesis with the product CCCCCCCCCCOc1cc(CCl)cc(OCCCCCCCCCC)c1 .
OK. The reactants may be CCCCCCCCCCOc1cc(CO)cc(OCCCCCCCCCC)c1.O=S(Cl)Cl .
Given the following product, please provide possible reactants. CCC(=Cc1cccc(OC)c1)C(=O)O
Possible reactant(s): CCOC(=O)C(=Cc1cccc(OC)c1)CC .
C=C(C)C(=O)Nc1ccc(C(=O)O)cc1 Given the product provided, propose some possible reactants that could have been employed in its formation.
Here are possible reactants: C=C(C)C(=O)O.Nc1ccc(C(=O)O)cc1 .
Suggest possible substances that may have been involved in the synthesis of the presented compound. Cc1ccc(S(=O)(=O)Oc2ccc(O)c(O)c2)cc1
Cc1ccc(S(=O)(=O)Cl)cc1.Oc1ccc(O)c(O)c1
With the given product CN1C(=O)N(c2ccccn2)CC1C(=O)NCc1cccc(C(F)(F)F)c1Cl, suggest some likely reactants that were used in its synthesis.
CN1C(=O)N(c2ccccn2)CC1C(=O)O.NCc1cccc(C(F)(F)F)c1Cl
CCC(=O)C1=C(O)CC(c2c(C)c(N)c(C)c(C(C)=O)c2C)CC1=O Given the product provided, propose some possible reactants that could have been employed in its formation.
Here are possible reactants: CCC(=O)C1=C(O)CC(c2c(C)c(C(C)=O)c(C)c([N+](=O)[O-])c2C)CC1=O .
To synthesis CN1C(=O)CCc2c(OCC3CO3)ccc(OCc3ccccc3)c21, what are the possible reactants? Write in the SMILES representation.
CI.O=C1CCc2c(OCC3CO3)ccc(OCc3ccccc3)c2N1
Can you list the reactants that might result in the chemical product NC(=O)c1ccc(C(=O)O)cc1Br ?
COC(=O)c1ccc(C(N)=O)c(Br)c1
Based on the given product, provide some plausible reactants that might have been utilized to prepare it. COc1ccc(COC(C(C)C=O)C(C)CO[Si](C)(C)C(C)(C)C)cc1
COc1ccc(COC(C(C)CO)C(C)CO[Si](C)(C)C(C)(C)C)cc1
Could you tell which reactants might have been used to generate the following product? NCC(CNS(=O)(=O)c1cccc2cnccc12)c1ccccc1
NCC(CN)c1ccccc1.O=S(=O)(Cl)c1cccc2cnccc12
With the given product CC(C)(C)[Si](C)(C)OCc1cccc(N)n1, suggest some likely reactants that were used in its synthesis.
CC(C)(C)[Si](C)(C)Cl.Nc1cccc(CO)n1
Given the following product, please provide possible reactants. Cc1nc(N2CCOCC2)c2cccc([N+](=O)[O-])c2n1
Possible reactant(s): C1COCCN1.Cc1nc(Cl)c2cccc([N+](=O)[O-])c2n1 .
With the given product CC(C)(C)c1ccc(S(C)(=O)=O)c(N)c1, suggest some likely reactants that were used in its synthesis.
CC(C)(C)c1ccc(S(C)(=O)=O)c([N+](=O)[O-])c1
Could you tell which reactants might have been used to generate the following product? CCC(CN1C(=O)c2ccccc2C1=O)Nc1nc(Nc2ccc3ncccc3c2)c(C#N)cc1F
CCC(N)CN1C(=O)c2ccccc2C1=O.N#Cc1cc(F)c(Cl)nc1Nc1ccc2ncccc2c1
Provide the potential reactants that may be used to produce the product COC(=O)c1ccc([N+](=O)[O-])cc1C .
The potential reactants: CO.Cc1cc([N+](=O)[O-])ccc1C(=O)O .
Do retrosynthesis with the product COc1ccc(C(F)(F)F)cc1N .
OK. The reactants may be COc1ccc(C(F)(F)F)cc1[N+](=O)[O-] .
Could you tell which reactants might have been used to generate the following product? O=C(O)c1cc2ccccc2n1Cc1ccc(F)cc1
CCOC(=O)c1cc2ccccc2n1Cc1ccc(F)cc1
What reactants could lead to the production of the following product? CC(C)Nc1nc(-n2cc(C(=O)O)c(=O)c3cc(F)c(F)c(Cl)c32)c(F)cc1F
CCOC(=O)c1cn(-c2nc(NC(C)C)c(F)cc2F)c2c(Cl)c(F)c(F)cc2c1=O
With the given product CCCC1CCC(c2ccc3cc(OS(=O)(=O)C(F)(F)F)ccc3c2)CC1, suggest some likely reactants that were used in its synthesis.
CCCC1CCC(c2ccc3cc(O)ccc3c2)CC1.O=S(=O)(OS(=O)(=O)C(F)(F)F)C(F)(F)F
Provide the potential reactants that may be used to produce the product Cc1cc2cccc(Cn3c(=O)n(CCC(=O)O)c4ccccc43)c2n1C .
The potential reactants: COC(=O)CCn1c(=O)n(Cc2cccc3cc(C)n(C)c23)c2ccccc21 .
Given the following product, please provide possible reactants. Cc1ccc2c(c1)N(CC(=O)c1ccccc1C)C(=O)C(NC(=O)OC(C)(C)C)CN2C1CCCCC1
Possible reactant(s): Cc1ccc2c(c1)N(CC(=O)c1ccccc1C)C(=O)C(NC(=O)OC(C)(C)C)CN2C1C=CCCC1 .
Suggest possible substances that may have been involved in the synthesis of the presented compound. CSc1c(S(N)(=O)=O)ccn1C
CSc1c(S(=O)(=O)NC(C)(C)C)ccn1C
Based on the given product, provide some plausible reactants that might have been utilized to prepare it. O=C(CCc1ccccc1)Nc1cc2c3c(c1)c1c(n3CCC2)CCCCC1
Nc1cc2c3c(c1)c1c(n3CCC2)CCCCC1.O=C(Cl)CCc1ccccc1
Based on the given product, provide some plausible reactants that might have been utilized to prepare it. O=c1nc(N(Cc2nnn[nH]2)c2ccc(Cl)cc2)sc2ncccc12
N#CCN(c1ccc(Cl)cc1)c1nc(=O)c2cccnc2s1.[N-]=[N+]=[N-]
Identify possible reactants that could have been used to create the specified product. Cc1ccc(C(=O)c2c(-c3ccc(O)cc3)sc3cc(O)ccc23)cc1
COc1ccc(-c2sc3cc(OC)ccc3c2C(=O)c2ccc(C)cc2)cc1
Could you tell which reactants might have been used to generate the following product? CCN(c1ccc(F)c(C(=O)Nc2cnc3[nH]nc(OC)c3c2)c1F)S(=O)(=O)NC
CCN(c1ccc(F)c(C(=O)O)c1F)S(=O)(=O)NC.COc1n[nH]c2ncc(N)cc12
Provide the potential reactants that may be used to produce the product NC(=O)c1cc(-c2ccc(Cn3ccc4ccccc43)cc2)no1 .
The potential reactants: NC(=O)c1cc(-c2ccc(CBr)cc2)no1.c1ccc2[nH]ccc2c1 .
CCCON=C(C(=O)O)c1csc(N)n1 Given the product provided, propose some possible reactants that could have been employed in its formation.
Here are possible reactants: CCCON=C(C(=O)OCC)c1csc(N)n1 .
Given the following product, please provide possible reactants. CN(C)C1CCC(Oc2ncnc3sc4c(c23)C(CC(=O)Nc2ccc(F)cn2)CC4)CC1
Possible reactant(s): CN(C(=O)OC(C)(C)C)C1CCC(Oc2ncnc3sc4c(c23)C(CC(=O)Nc2ccc(F)cn2)CC4)CC1 .
What reactants could lead to the production of the following product? CCc1n[nH]c2cc(C(=O)OC)ccc12
CCc1n[nH]c2cc(C(=O)O)ccc12.CO
Based on the given product, provide some plausible reactants that might have been utilized to prepare it. N=C(N)c1ccc2c(CC(N)=O)c(OC(=O)c3ccc(NC=NNCCCCN4CCOCC4)cc3)ccc2c1
N=C(N)c1ccc2c(CC(N)=O)c(O)ccc2c1.O=C(O)c1ccc(NC=NNCCCCN2CCOCC2)cc1
Suggest possible substances that may have been involved in the synthesis of the presented compound. COC(=O)Cc1cc2ccc(F)cc2c(OS(=O)(=O)C(F)(F)F)c1C
COC(=O)Cc1cc2ccc(F)cc2c(O)c1C.O=S(=O)(OS(=O)(=O)C(F)(F)F)C(F)(F)F
Given the following product, please provide possible reactants. O=C(O)C1CCN(c2cccc(Br)c2)C1
Possible reactant(s): COC(=O)C1CCN(c2cccc(Br)c2)C1 .
Identify possible reactants that could have been used to create the specified product. CNc1ccc(C(=O)O)cc1S(=O)(=O)N1CCC1
C1CNC1.CNc1ccc(C(=O)O)cc1S(=O)(=O)Cl
Provide the potential reactants that may be used to produce the product CC(C)(C)C(=O)OCCOc1ccccc1 .
The potential reactants: CC(C)(C)C(=O)Cl.OCCOc1ccccc1 .
Identify possible reactants that could have been used to create the specified product. Cc1nc(N2CCN(CC3CC3)C2=O)sc1C(=O)NCc1cccnn1
Cc1nc(N2CCN(CC3CC3)C2=O)sc1C(=O)O.NCc1cccnn1
Do retrosynthesis with the product COc1ccc(-c2ccc(C#N)cc2)cc1 .
OK. The reactants may be COc1ccc(-c2ccc(C(N)=O)cc2)cc1 .
Cc1cccc(-c2nc(C(F)(F)F)ccc2CNC(=O)C(C)c2ccc(C#N)cc2)c1 Given the product provided, propose some possible reactants that could have been employed in its formation.
Here are possible reactants: CC(C(=O)O)c1ccc(C#N)cc1.Cc1cccc(-c2nc(C(F)(F)F)ccc2CN)c1 .
To synthesis COC(=O)Oc1cc(N)c(F)cc1F, what are the possible reactants? Write in the SMILES representation.
COC(=O)Oc1cc([N+](=O)[O-])c(F)cc1F
Identify possible reactants that could have been used to create the specified product. CNC(=O)c1cc(Oc2ccc3nc(SC)sc3c2Cl)ccn1
CNC(=O)c1cc(Cl)ccn1.CSc1nc2ccc(O)c(Cl)c2s1
Identify possible reactants that could have been used to create the specified product. COC(=O)C=Cc1ccc(N)cc1NC(=O)NC(=O)c1cc(F)c(F)cc1Cl
COC(=O)C=Cc1ccc([N+](=O)[O-])cc1NC(=O)NC(=O)c1cc(F)c(F)cc1Cl
Could you tell which reactants might have been used to generate the following product? Brc1cnc(N2CCCNCC2)nc1
C1CNCCNC1.Clc1ncc(Br)cn1
Based on the given product, provide some plausible reactants that might have been utilized to prepare it. CC(C)(CC(O)(C=O)C(F)(F)F)c1cc(F)ccc1F
CC(C)(CC(O)(CO)C(F)(F)F)c1cc(F)ccc1F
Can you list the reactants that might result in the chemical product CCCC(C(=O)OC)c1c(C)nc(N2CC(C)CC(C)C2)nc1-c1ccc(C)cc1 ?
CC1CNCC(C)C1.CCCC(C(=O)OC)c1c(C)nc(Cl)nc1-c1ccc(C)cc1
Identify possible reactants that could have been used to create the specified product. CC(C)(C)OC(=O)NC(CCNS(C)(=O)=O)c1ccc(Cl)cc1
CC(C)(C)OC(=O)NC(CCN)c1ccc(Cl)cc1.CS(=O)(=O)Cl
Can you list the reactants that might result in the chemical product Sc1nnnn1Cc1nnn[nH]1 ?
N#CCn1nnnc1S.[N-]=[N+]=[N-]
Based on the given product, provide some plausible reactants that might have been utilized to prepare it. Cc1cc2c(c3ccc(=O)[nH]c13)OC(CNC(=O)CCNC(=O)OCc1ccccc1)C2
Cc1cc2c(c3ccc(=O)[nH]c13)OC(CN)C2.O=C(O)CCNC(=O)OCc1ccccc1
COCc1c[nH]c(-c2ccc(O)cc2)n1 Given the product provided, propose some possible reactants that could have been employed in its formation.
Here are possible reactants: COCc1c[nH]c(-c2ccc(OCc3ccccc3)cc2)n1 .
To synthesis CN(C)CC(=O)Nc1ccc2[nH]c(C(=O)NCc3ccc(Cl)c(Oc4cc(Cl)cc(C#N)c4)c3F)cc2c1, what are the possible reactants? Write in the SMILES representation.
CN(C)CC(=O)O.N#Cc1cc(Cl)cc(Oc2c(Cl)ccc(CNC(=O)c3cc4cc(N)ccc4[nH]3)c2F)c1
Given the following product, please provide possible reactants. CC(C)n1cnnc1-c1nc2c(s1)CCOc1cc(C=O)ccc1-2
Possible reactant(s): CC(C)n1cnnc1-c1nc2c(s1)CCOc1cc(CO)ccc1-2 .
Identify possible reactants that could have been used to create the specified product. COC(=O)NCC1Cc2cc(Cl)cc(C3CCCCC3)c2O1
COC(=O)Cl.NCC1Cc2cc(Cl)cc(C3CCCCC3)c2O1
Could you tell which reactants might have been used to generate the following product? CC(C)(C)OC(=O)N1CCC(Oc2ccc([N+](=O)[O-])cc2)CC1
CC(C)(C)OC(=O)N1CCC(O)CC1.O=[N+]([O-])c1ccc(F)cc1
Provide the potential reactants that may be used to produce the product COC(=O)c1cc(C(F)(F)F)cc([N+](=O)[O-])c1C .
The potential reactants: CI.Cc1c(C(=O)O)cc(C(F)(F)F)cc1[N+](=O)[O-] .
Could you tell which reactants might have been used to generate the following product? Cc1c(CO)cccc1OCC(=O)OC(C)(C)C
CC(C)(C)OC(=O)CBr.Cc1c(O)cccc1CO
To synthesis CC(C)(C)OC(=O)NC(CCCCNS(=O)(=O)c1c(Cl)ccc(NC(=O)Nc2ccccc2Br)c1O)C(=O)O, what are the possible reactants? Write in the SMILES representation.
CC(C)(C)OC(=O)NC(CCCCNS(=O)(=O)c1c(Cl)ccc(N)c1O)C(=O)O.O=C=Nc1ccccc1Br
Can you list the reactants that might result in the chemical product CCNC(=O)c1ccc(C)c(-n2ccc3ccc(OCCN(C)C(C)C)cc3c2=O)c1 ?
CCNC(=O)c1ccc(C)c(-n2ccc3ccc(OCCCl)cc3c2=O)c1.CNC(C)C
With the given product Cn1cc(-c2ccnc(N3CCn4c(cc5c4CC(C)(C)C5)C3=O)c2CO)nc(Nc2ccn3ccnc3c2)c1=O, suggest some likely reactants that were used in its synthesis.
Cn1cc(-c2ccnc(N3CCn4c(cc5c4CC(C)(C)C5)C3=O)c2C=O)nc(Nc2ccn3ccnc3c2)c1=O
Suggest possible substances that may have been involved in the synthesis of the presented compound. O=C(OCc1cc2c3ccccc3n(Cc3cc(Cl)ccc3Cl)c2cn1)C1CC1
O=C(Cl)C1CC1.OCc1cc2c3ccccc3n(Cc3cc(Cl)ccc3Cl)c2cn1
To synthesis CC(c1oc2ccccc2c(=O)c1-c1cccc(F)c1)n1nc(-c2ccc(O)c(F)c2)c2c(N)ncnc21, what are the possible reactants? Write in the SMILES representation.
COc1ccc(-c2nn(C(C)c3oc4ccccc4c(=O)c3-c3cccc(F)c3)c3ncnc(N)c23)cc1F
With the given product CCCCc1noc(CO)c1COc1ccc(C(=O)NCC(F)(F)F)cn1, suggest some likely reactants that were used in its synthesis.
CCCCc1noc(CO)c1COc1ccc(C(=O)O)cn1.NCC(F)(F)F
What reactants could lead to the production of the following product? Oc1ccc(F)cc1-c1c(Cl)cccc1Cl
COc1ccc(F)cc1-c1c(Cl)cccc1Cl
O=C(CC1CCCC1)N1CCN(c2ncccc2C(F)(F)F)CC1 Given the product provided, propose some possible reactants that could have been employed in its formation.
Here are possible reactants: FC(F)(F)c1cccnc1N1CCNCC1.O=C(O)CC1CCCC1 .
Identify possible reactants that could have been used to create the specified product. CCCNC(=O)CCn1ccc(NC(=O)C(CC2CCCC2)c2ccc(S(C)(=O)=O)c(Cl)c2)n1
CCCN.CS(=O)(=O)c1ccc(C(CC2CCCC2)C(=O)Nc2ccn(CCC(=O)O)n2)cc1Cl
Based on the given product, provide some plausible reactants that might have been utilized to prepare it. O=[N+]([O-])c1cc2c(Nc3cc(Cl)c(Cl)cc3F)ncnc2cc1F
Nc1cc(Cl)c(Cl)cc1F.O=[N+]([O-])c1cc2c(Cl)ncnc2cc1F
To synthesis C=C(C)c1cccc(OC(C)=O)c1, what are the possible reactants? Write in the SMILES representation.
C=C(C)c1cccc(O)c1.CC(=O)OC(C)=O
Based on the given product, provide some plausible reactants that might have been utilized to prepare it. N#Cc1nc2ccc(OCc3ccccc3C(F)(F)F)cc2s1
FC(F)(F)c1ccccc1CBr.N#Cc1nc2ccc(O)cc2s1
What reactants could lead to the production of the following product? COc1c(Cl)ccc(-c2cc(NC(C)=O)ncc2CO)c1F
COc1c(Cl)ccc(-c2cc(NC(C)=O)ncc2C=O)c1F
Provide the potential reactants that may be used to produce the product CCOC(=O)COc1ccc2sc(S(N)(=O)=O)cc2c1 .
The potential reactants: CCO.NS(=O)(=O)c1cc2cc(OCC(=O)O)ccc2s1 .
With the given product C=CCCCOc1cc(C(=O)O)cc(C(F)(F)F)c1, suggest some likely reactants that were used in its synthesis.
C=CCCCO.O=C(O)c1cc(F)cc(C(F)(F)F)c1
Provide the potential reactants that may be used to produce the product CCOc1ccc(C=C2SC(=O)N(CC(=O)O)C2=O)cc1 .
The potential reactants: CCOc1ccc(C=C2SC(=O)N(CC(=O)OC(C)(C)C)C2=O)cc1 .
Suggest possible substances that may have been involved in the synthesis of the presented compound. COC(=O)c1ccc(C(=O)c2ccc(O)cc2)cc1
COC(=O)c1ccc(C(=O)c2ccc(OC)cc2)cc1
Based on the given product, provide some plausible reactants that might have been utilized to prepare it. Cc1ccccc1N1CCOCC1
C1COCCN1.Cc1ccccc1Br
To synthesis COc1cc2c(Nc3ccc4c(c3)NCC4)c(C#N)cnc2cc1O, what are the possible reactants? Write in the SMILES representation.
COc1cc2c(Nc3ccc4c(c3)NCC4)c(C#N)cnc2cc1OCc1ccccc1
COc1cc(Br)c(OC)c(CCl)c1 Given the product provided, propose some possible reactants that could have been employed in its formation.
Here are possible reactants: COc1cc(Br)c(OC)c(CO)c1.O=S(Cl)Cl .
End of preview. Expand in Data Studio
README.md exists but content is empty.
Downloads last month
6

Collection including IDEA-AI4S/MolInst_125K_Scaffold_RS_SMILES-SFT