Mol-LLaMA SFT
Collection
RCR_RP: Reagents Prediction; RCR_CP: Catalyst Prediction; RCR_SP: Solvent Prediction; HTE_RAS: Reagent Selection • 17 items • Updated
instruction stringlengths 84 477 | input stringclasses 1
value | output stringlengths 11 209 |
|---|---|---|
O=Cc1cc([N+](=O)[O-])c(F)cc1F.C1CCOC1.Cl.[BH4-].[Na+] Considering the given starting materials, what might be the resulting product in a chemical reaction? | O=[N+]([O-])c1cc(CO)c(F)cc1F . | |
Consider that for a chemical reaction, if COC(=O)CCC1CCCCCCCCCCC1.CO.O.[Na+].[OH-] is/are the reactants and reagents, what can be the product? | O=C(O)CCC1CCCCCCCCCCC1 . | |
COC(=O)c1ccc(OCC(F)(F)C(F)F)cn1.C1CCOC1.O.[Li+].[OH-] Given the above reactants and reagents, what could be a probable product of their reaction? | A probable product could be O=C(O)c1ccc(OCC(F)(F)C(F)F)cn1 . | |
Predict a possible product from the listed reactants and reagents. CC(=O)OC(C)=O.Cc1cc(C)n(-c2cnc(CN)c(Nc3ccc(Cl)cc3)n2)n1.CCN(CC)CC.ClCCl.O=C([O-])O.[Na+] | CC(=O)NCc1ncc(-n2nc(C)cc2C)nc1Nc1ccc(Cl)cc1 . | |
Using C=CCBr.CCOc1ccc(Cc2cc(Br)c(O)cc2Cl)cc1.CC(C)=O.O=C([O-])[O-].[K+].[K+] as the reactants and reagents, tell me the potential product. | C=CCOc1cc(Cl)c(Cc2ccc(OCC)cc2)cc1Br . | |
CS(=O)(=O)c1ccc(C(CC2CCC(=O)CC2)C(=O)O)cc1Cl.Cc1cnc(N)cn1.Cc1cccc(C)n1.ClCCl.O=C1CCC(=O)N1Br.c1ccc(P(c2ccccc2)c2ccccc2)cc1 Considering the given starting materials, what might be the resulting product in a chemical reaction? | Cc1cnc(NC(=O)C(CC2CCC(=O)CC2)c2ccc(S(C)(=O)=O)c(Cl)c2)cn1 . | |
CCOCc1nc2c(N)nc3ccccc3c2n1NCCCNC(=O)OC(C)(C)C.CCO.Cl.O.[Na+].[OH-] Considering the given starting materials, what might be the resulting product in a chemical reaction? | CCOCc1nc2c(N)nc3ccccc3c2n1NCCCN . | |
C=CCBr.OCCCCCO.CCCCC(O)O.CCOC(C)=O.CN(C)C=O.[H-].[Na+] Considering the given starting materials, what might be the resulting product in a chemical reaction? | C=CCOCCCCCO . | |
Please provide a feasible product that could be formed using these reactants and reagents: C#CC1CCCC1.COc1cc(Br)c(F)cc1-n1c(=O)cnc2cc(S(=O)(=O)Nc3ccon3)ccc21.CC(C)NC(C)C.CCOC(C)=O.CN(C)C=O.[Cu]I.c1ccc([PH](c2ccccc2)(c2ccccc2)[Pd]([PH](c2ccccc2)(c2ccccc2)c2ccccc2)([PH](c2ccccc2)(c2ccccc2)c2ccccc2)[PH](c2ccccc2)(c2ccccc2... | COc1cc(C#CC2CCCC2)c(F)cc1-n1c(=O)cnc2cc(S(=O)(=O)Nc3ccon3)ccc21 . | |
A chemical reaction has started with the substance(s) CCI.COc1c(OC(F)F)ccc(-c2cccc3c2CCC3=O)c1O.CC#N.O=C([O-])[O-].[K+].[K+] as the reactants and reagents, what could be a probable product? | A probable product: CCOc1c(-c2cccc3c2CCC3=O)ccc(OC(F)F)c1OC . | |
A chemical reaction has started with the substance(s) COc1ccc2c(c1C(C)N1CCN(C(=O)OC(C)(C)C)CC1)OC(=Cc1n[nH]c3ccccc13)C2=O.C1COCCO1.Cl.ClCCl as the reactants and reagents, what could be a probable product? | A probable product: COc1ccc2c(c1C(C)N1CCNCC1)OC(=Cc1n[nH]c3ccccc13)C2=O . | |
Predict a possible product from the listed reactants and reagents. COCC(=O)Cl.Nc1cc([N+](=O)[O-])ccc1F.CCN(CC)CC.ClCCl.O | COCC(=O)Nc1cc([N+](=O)[O-])ccc1F . | |
Propose a potential product given these reactants and reagents. CN1CCC(c2c[nH]c3ccc(N)cc23)CC1.COC(=O)Cl.ClCCl | COC(=O)Nc1ccc2[nH]cc(C3CCN(C)CC3)c2c1 . | |
CC(C)(C)OC(=O)C(CCCC(F)(F)F)C(CCC(F)(F)F)C(=O)NC1N=C(c2ccccc2)c2ccccc2N(c2ccccn2)C1=O.ClCCl.O=C(O)C(F)(F)F Considering the given starting materials, what might be the resulting product in a chemical reaction? | O=C(O)C(CCCC(F)(F)F)C(CCC(F)(F)F)C(=O)NC1N=C(c2ccccc2)c2ccccc2N(c2ccccn2)C1=O . | |
Can you tell me the potential product of a chemical reaction that uses CCOC(=O)c1ccc(C=C(C)c2ccc3c(c2)C(C)(C)CCO3)cc1.CCO.O.O=S(=O)(O)O.[K+].[OH-] as the reactants and reagents? | Sure. A potential product: CC(=Cc1ccc(C(=O)O)cc1)c1ccc2c(c1)C(C)(C)CCO2 . | |
Propose a potential product given these reactants and reagents. CC(C)(C)[Si](C)(C)OCc1cccc(C(=C2CN(C(c3ccc(Cl)cc3)c3ccc(Cl)cc3)C2)S(C)(=O)=O)c1.C1CCOC1.CCCC[N+](CCCC)(CCCC)CCCC.ClCCl.[F-] | CS(=O)(=O)C(=C1CN(C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)C1)c1cccc(CO)c1 . | |
Predict a possible product from the listed reactants and reagents. CCOC(=O)c1nc(-c2ccc(N)cc2)nc(N2CCOCC2)c1OCC.O=C=Nc1ccccc1.Cc1ccccc1 | CCOC(=O)c1nc(-c2ccc(NC(=O)Nc3ccccc3)cc2)nc(N2CCOCC2)c1OCC . | |
Please provide a feasible product that could be formed using these reactants and reagents: CC1C(=O)NN=C2COc3ccc(C4=CCN(C(=O)OC(C)(C)C)CC4)cc3N21.CO.[Pd] . | CC1C(=O)NN=C2COc3ccc(C4CCN(C(=O)OC(C)(C)C)CC4)cc3N21 . | |
Consider that for a chemical reaction, if O=C(Cl)c1cccc(C(F)(F)F)c1.O=C1CCNCC2CC(Oc3cnc(C4CC4)cn3)CN12.CCN(CC)CC.CN(C)c1ccncc1.Cl.ClCCl is/are the reactants and reagents, what can be the product? | O=C(c1cccc(C(F)(F)F)c1)N1CCC(=O)N2CC(Oc3cnc(C4CC4)cn3)CC2C1 . | |
Please provide a feasible product that could be formed using these reactants and reagents: CC1(C)OB(c2ccc3cc(NC(=O)c4ccsc4)ccc3c2)OC1(C)C.CN(C)CCCNc1nccc2c(Br)cccc12.C1COCCO1.ClCCl.O.O=C([O-])[O-].[K+].[K+] . | CN(C)CCCNc1nccc2c(-c3ccc4cc(NC(=O)c5ccsc5)ccc4c3)cccc12 . | |
Based on the given reactants and reagents: CCOC(=O)CCCOc1cccc(CCCCCCOc2cc(Br)cc(OCc3ccccc3)c2)c1CCC(=O)OCC.OB(O)c1ccc2c(c1)OCO2.Cl[Pd]Cl.O=C([O-])[O-].[Cs+].[Cs+].[Fe+2].c1ccc(P(c2ccccc2)[c-]2cccc2)cc1.c1ccc(P(c2ccccc2)[c-]2cccc2)cc1, what product could potentially be produced? | The product can be CCOC(=O)CCCOc1cccc(CCCCCCOc2cc(OCc3ccccc3)cc(-c3ccc4c(c3)OCO4)c2)c1CCC(=O)OCC . | |
BrCCBr.Oc1cc(Br)ccc1Br.[Na+].[OH-] Given the above reactants and reagents, what could be a probable product of their reaction? | A probable product could be BrCCOc1cc(Br)ccc1Br . | |
Based on the given reactants and reagents: CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.CN.C1CCOC1, what product could potentially be produced? | The product can be CNC(=O)OC(C)(C)C . | |
Can you tell me the potential product of a chemical reaction that uses CCOC(=O)c1cnn(-c2nc3ccc(-c4ccccc4C)cc3c(=O)n2COCC[Si](C)(C)C)c1.C1COCCO1.Cl as the reactants and reagents? | Sure. A potential product: CCOC(=O)c1cnn(-c2nc3ccc(-c4ccccc4C)cc3c(=O)[nH]2)c1 . | |
O=C=Nc1ccccc1.OC1CN2CCC1CC2.CCCCCCCCCCCC(=O)[O-].CCCCCCCCCCCC(=O)[O-].CCCC[Sn+2]CCCC.Cc1ccccc1 Considering the given starting materials, what might be the resulting product in a chemical reaction? | O=C(Nc1ccccc1)OC1CN2CCC1CC2 . | |
CN(C)C=O.Fc1cccc(Br)c1.C1CCOC1.CC(C)NC(C)C.[Li]CCCC Given the above reactants and reagents, what could be a probable product of their reaction? | A probable product could be O=Cc1c(F)cccc1Br . | |
Cc1c(CCC(=O)O)c[nH]c1C=O.O=C1Cc2cc(I)ccc2N1.C1CCNCC1.CCO Given the above reactants and reagents, what could be a probable product of their reaction? | A probable product could be Cc1c(CCC(=O)O)c[nH]c1C=C1C(=O)Nc2ccc(I)cc21 . | |
Can you tell me the potential product of a chemical reaction that uses CC1COCc2nc3c(N)nc4cc(OCc5ccccc5)ccc4c3n21.CCO.ClC(Cl)Cl.[Pd] as the reactants and reagents? | Sure. A potential product: CC1COCc2nc3c(N)nc4cc(O)ccc4c3n21 . | |
Predict a possible product from the listed reactants and reagents. Cc1ccc([N+](=O)[O-])c(C(N)=O)c1.C.CO.[Pd] | Cc1ccc(N)c(C(N)=O)c1 . | |
CCOC(=O)c1coc(-c2ccc(OC(F)F)c3oc4ccc([N+](=O)[O-])cc4c23)n1.C.CCOC(C)=O.CO.[H][H].[Pd] Based on the reactants and reagents given above, suggest a possible product. | A possible product can be CCOC(=O)c1coc(-c2ccc(OC(F)F)c3oc4ccc(N)cc4c23)n1 . | |
CC(C)(C)OC(=O)Nc1ccc(O)c2ccccc12.Clc1ccnc(Cl)n1.C1CCC2=NCCCN2CC1.CC#N Based on the reactants and reagents given above, suggest a possible product. | A possible product can be CC(C)(C)OC(=O)Nc1ccc(Oc2ccnc(Cl)n2)c2ccccc12 . | |
Predict a possible product from the listed reactants and reagents. Cc1c(Nc2ccc(I)cc2F)c(N)c2n(c1=O)CCS2.O=S(=O)(Cl)C1CC1.CO.ClC(Cl)Cl.c1ccncc1 | Cc1c(Nc2ccc(I)cc2F)c(NS(=O)(=O)C2CC2)c2n(c1=O)CCS2 . | |
Propose a potential product given these reactants and reagents. FC(F)(F)c1cnc(Cl)c(Cl)c1.Oc1ccc(Cl)cc1.CS(C)=O.O.O=C([O-])[O-].[K+].[K+] | FC(F)(F)c1cnc(Oc2ccc(Cl)cc2)c(Cl)c1 . | |
Given the following reactants and reagents, please provide a possible product. CCC(C)N.Cc1nc(Cl)nc(Cl)c1[N+](=O)[O-].CCN(CC)CC.CCO | CCC(C)Nc1nc(Cl)nc(C)c1[N+](=O)[O-] . | |
Consider that for a chemical reaction, if CS(=O)(=O)Cl.O=[N+]([O-])c1ccc(N2CCNCC2)cc1.CCN(CC)CC.ClCCl.O=C([O-])O.[Na+] is/are the reactants and reagents, what can be the product? | CS(=O)(=O)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 . | |
CC(C)CC(NC(=O)OC(C)(C)C)C(=O)O.CNOC.CCN=C=NCCCN(C)C.CN(C)C=O.CN1CCOCC1.Cl.Cl.O.On1nnc2ccccc21 Considering the given starting materials, what might be the resulting product in a chemical reaction? | CON(C)C(=O)C(CC(C)C)NC(=O)OC(C)(C)C . | |
COC(=O)c1cnc(N)c([N+](=O)[O-])c1.C1CCOC1.CO.[Pd] Based on the reactants and reagents given above, suggest a possible product. | A possible product can be COC(=O)c1cnc(N)c(N)c1 . | |
Consider that for a chemical reaction, if CC(C)(C)OC(=O)N1CCC(C=O)(c2ccc(Cl)cc2)CC1.CN.CCO.[BH4-].[Na+] is/are the reactants and reagents, what can be the product? | CNCC1(c2ccc(Cl)cc2)CCN(C(=O)OC(C)(C)C)CC1 . | |
Predict a possible product from the listed reactants and reagents. CC(C)(C)OC(=O)NC1CC1c1ccc(N)cc1.Cc1cccc(C(=O)Cl)c1.CC#N.CCN(CC)CC.O | Cc1cccc(C(=O)Nc2ccc(C3CC3NC(=O)OC(C)(C)C)cc2)c1 . | |
Using CC(c1oc2ccccc2c(=O)c1-c1cccc(F)c1)n1nc(-c2ccc(CNC(=O)OC(C)(C)C)s2)c2c(N)ncnc21.ClCCl.O=C(O)C(F)(F)F as the reactants and reagents, tell me the potential product. | CC(c1oc2ccccc2c(=O)c1-c1cccc(F)c1)n1nc(-c2ccc(CN)s2)c2c(N)ncnc21 . | |
Predict the product of a chemical reaction with CS(=O)(=O)Nc1ccc(N2CCN(c3cc([N+](=O)[O-])ccn3)CC2)cc1.CO.[H][H].[Pd] as the reactants and reagents. | CS(=O)(=O)Nc1ccc(N2CCN(c3cc(N)ccn3)CC2)cc1 . | |
CCOC(=O)CN1CCCCC1.Cl Based on the reactants and reagents given above, suggest a possible product. | A possible product can be O=C(O)CN1CCCCC1 . | |
Predict the product of a chemical reaction with COC(=O)c1ccc(C=Cc2c(-c3ccccc3)noc2C)nc1.C1CCOC1.CO.Cl.O.O.[Li+].[OH-] as the reactants and reagents. | Cc1onc(-c2ccccc2)c1C=Cc1ccc(C(=O)O)cn1 . | |
C1CCN(CCCCC2CCNCC2)CC1.Cc1scc2c1N(C(=O)Cl)c1ccccc1NC2=O.CCOC(C)=O Given the above reactants and reagents, what could be a probable product of their reaction? | A probable product could be Cc1scc2c1N(C(=O)N1CCC(CCCCN3CCCCC3)CC1)c1ccccc1NC2=O . | |
Based on the given reactants and reagents: COc1ccc2nccc(-n3cc4c(n3)CCC(NC(=O)CCc3ccc(C)cc3)C4)c2n1.CC(C)C[AlH]CC(C)C.COc1ccc2nccc(-n3cc4c(n3)CCC(NCCCc3ccccc3C)C4)c2n1.ClCCl.O.O=C([O-])C(O)C(O)C(=O)[O-].[K+].[Na+], what product could potentially be produced? | The product can be COc1ccc2nccc(-n3cc4c(n3)CCC(NCCCc3ccc(C)cc3)C4)c2n1 . | |
Cc1cc([N+](=O)[O-])cnc1Oc1ccnc(NC(=O)C2CC2)c1.CO.ClCCl Given the above reactants and reagents, what could be a probable product of their reaction? | A probable product could be Cc1cc(N)cnc1Oc1ccnc(NC(=O)C2CC2)c1 . | |
COC(=O)C1CCC(Oc2ncccc2F)CC1.NN.CCCCO.O Based on the reactants and reagents given above, suggest a possible product. | A possible product can be NNC(=O)C1CCC(Oc2ncccc2F)CC1 . | |
CC(C)(C)OC(=O)N1CC2C(C1)C2NC(=O)OCC1c2ccccc2-c2ccccc21.ClCCl.O=C([O-])O.[Na+] Considering the given starting materials, what might be the resulting product in a chemical reaction? | O=C(NC1C2CNCC21)OCC1c2ccccc2-c2ccccc21 . | |
Predict the product of a chemical reaction with COC(=O)c1cc(Oc2ccc(-c3noc(C)n3)nc2)ccc1[N+](=O)[O-].C1CCOC1.CO.O=C(O)CC(O)(CC(=O)O)C(=O)O.[Na+].[OH-] as the reactants and reagents. | Cc1nc(-c2ccc(Oc3ccc([N+](=O)[O-])c(C(=O)O)c3)cn2)no1 . | |
Predict the product of a chemical reaction with CNOC.O=C(O)c1ccncc1.Cl.ClCCl.O=C(n1ccnc1)n1ccnc1.O=C=O as the reactants and reagents. | CON(C)C(=O)c1ccncc1 . | |
COC(=O)c1cccc([N+](=O)[O-])c1NCc1ccc(-c2ccccc2-c2nnnn2Cc2ccccc2)cc1.CO.Cl[Sn]Cl.O.O Considering the given starting materials, what might be the resulting product in a chemical reaction? | COC(=O)c1cccc(N)c1NCc1ccc(-c2ccccc2-c2nnnn2Cc2ccccc2)cc1 . | |
OCCNCC1CCN(Cc2ccccc2)C1.CO.[H][H].[Pd] Based on the reactants and reagents given above, suggest a possible product. | A possible product can be OCCNCC1CCNC1 . | |
Predict the product of a chemical reaction with CI.COCn1cc(-c2ccccc2)cc1CO.C1CCOC1.[Cl-].[H-].[NH4+].[Na+] as the reactants and reagents. | COCc1cc(-c2ccccc2)cn1COC . | |
CCOCCn1c(CN2CCNCC2)nc2cccnc21.c1ccc(OCC2CO2)cc1.CC(C)O Given the above reactants and reagents, what could be a probable product of their reaction? | A probable product could be CCOCCn1c(CN2CCN(CC(O)COc3ccccc3)CC2)nc2cccnc21 . | |
Propose a potential product given these reactants and reagents. O=[N+]([O-])c1cc(Cl)c(F)c(Cl)c1.CO.O.O=C[O-].[NH4+].[Zn] | Nc1cc(Cl)c(F)c(Cl)c1 . | |
Propose a potential product given these reactants and reagents. C=CCOc1cc(CC(=O)OC)c(C(C)=O)c(OCC=C)c1.CC[SiH](CC)CC.O=C(O)C(F)(F)F.O=C([O-])O.[Na+] | C=CCOc1cc(CC(=O)OC)c(CC)c(OCC=C)c1 . | |
A chemical reaction has started with the substance(s) CC(C)(C)[Si](C)(C)Cl.CC(O)C(Nc1ccc(C#N)c(C(F)(F)F)c1)C(=O)NNC(=O)c1ccc(C#N)cc1.CN(C)C=O.c1c[nH]cn1 as the reactants and reagents, what could be a probable product? | A probable product: CC(O[Si](C)(C)C(C)(C)C)C(Nc1ccc(C#N)c(C(F)(F)F)c1)C(=O)NNC(=O)c1ccc(C#N)cc1 . | |
Propose a potential product given these reactants and reagents. COC(=O)C(CC(C)C)NC(C(=O)N(C)C)c1ccc(F)cc1F.CO.O.[Li+].[OH-] | CC(C)CC(NC(C(=O)N(C)C)c1ccc(F)cc1F)C(=O)O . | |
Given the following reactants and reagents, please provide a possible product. CO.Cc1cc(C)c(C#N)c(Cl)n1.C[O-].[Na+] | COc1nc(C)cc(C)c1C#N . | |
Can you tell me the potential product of a chemical reaction that uses CC(C)(C)OC(=O)NCCOc1noc2ccc(F)c(C(=O)O)c12.N.C1CCOC1.CC(C)COC(=O)Cl.CCN(CC)CC as the reactants and reagents? | Sure. A potential product: CC(C)(C)OC(=O)NCCOc1noc2ccc(F)c(C(N)=O)c12 . | |
CC1(C)OB(B2OC(C)(C)C(C)(C)O2)OC1(C)C.Nc1ccc(S(=O)(=O)c2ccc(Br)cn2)cn1.C1COCCO1.CC(=O)[O-].[K+] Given the above reactants and reagents, what could be a probable product of their reaction? | A probable product could be CC1(C)OB(c2ccc(S(=O)(=O)c3ccc(N)nc3)nc2)OC1(C)C . | |
C[Si](C)(C)c1cc([N+](=O)[O-])cc([Si](C)(C)C)c1.[Pd].c1ccccc1 Considering the given starting materials, what might be the resulting product in a chemical reaction? | C[Si](C)(C)c1cc(N)cc([Si](C)(C)C)c1 . | |
Predict the product of a chemical reaction with CC1(C)OB(B2OC(C)(C)C(C)(C)O2)OC1(C)C.Nc1ncc(Br)cc1-c1nc2ccccc2o1.C1COCCO1.CC(=O)[O-].CCOC(C)=O.ClC(Cl)Cl.ClCCl.Cl[Pd]Cl.[Fe+2].[K+].c1ccc(P(c2ccccc2)[c-]2cccc2)cc1.c1ccc(P(c2ccccc2)[c-]2cccc2)cc1 as the reactants and reagents. | CC1(C)OB(c2cnc(N)c(-c3nc4ccccc4o3)c2)OC1(C)C . | |
Consider that for a chemical reaction, if Cn1cc(-c2cncc(N3CCn4c(cc5c4CCCC5)C3=O)c2C=O)cc(Nc2ccc(N3CCN(C4COC4)CC3)cn2)c1=O.CO.[BH4-].[Na+] is/are the reactants and reagents, what can be the product? | Cn1cc(-c2cncc(N3CCn4c(cc5c4CCCC5)C3=O)c2CO)cc(Nc2ccc(N3CCN(C4COC4)CC3)cn2)c1=O . | |
Predict a possible product from the listed reactants and reagents. COC(=O)c1cc2cc[nH]c2cc1Cl.C1CCOC1.[Li+].[Na+].[OH-].[OH-] | O=C(O)c1cc2cc[nH]c2cc1Cl . | |
CC(C)(C)OC(=O)c1cc(Oc2ccc3nc(NC4CCCCC4O)sc3c2)ccn1.CC#N.Cl Given the above reactants and reagents, what could be a probable product of their reaction? | A probable product could be O=C(O)c1cc(Oc2ccc3nc(NC4CCCCC4O)sc3c2)ccn1 . | |
Predict the product of a chemical reaction with CC(=O)c1cc(F)ccc1O.O=S(=O)(OS(=O)(=O)C(F)(F)F)C(F)(F)F.CCOCC.c1ccncc1 as the reactants and reagents. | CC(=O)c1cc(F)ccc1OS(=O)(=O)C(F)(F)F . | |
Consider that for a chemical reaction, if CC(C)(C)CC(=O)Cl.Nc1ccc2ncnc(N)c2c1.CCCN(CCC)CCC.CO.CO.Cl.ClC(Cl)Cl.ClC(Cl)Cl.c1ccncc1 is/are the reactants and reagents, what can be the product? | CC(C)(C)CC(=O)Nc1ccc2ncnc(N)c2c1 . | |
Consider that for a chemical reaction, if CC1CN(c2ccncc2N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)CC(NC(=O)OC(C)(C)C)C1O[Si](C)(C)C(C)(C)C.C1CCOC1.CCCC[N+](CCCC)(CCCC)CCCC.CCOC(C)=O.O.[F-] is/are the reactants and reagents, what can be the product? | CC1CN(c2ccncc2N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)CC(NC(=O)OC(C)(C)C)C1O . | |
C1COCCN1.Cn1nc(C(=O)O)c2c1-c1cc([N+](=O)[O-])ccc1SC2.C1CCOC1.CCCP1(=O)OP(=O)(CCC)OP(=O)(CCC)O1.CCN(CC)CC.CCOC(C)=O Given the above reactants and reagents, what could be a probable product of their reaction? | A probable product could be Cn1nc(C(=O)N2CCOCC2)c2c1-c1cc([N+](=O)[O-])ccc1SC2 . | |
Please provide a feasible product that could be formed using these reactants and reagents: COc1ccc(-c2nsnc2Cl)cc1.BrB(Br)Br.ClCCl . | Oc1ccc(-c2nsnc2Cl)cc1 . | |
A chemical reaction has started with the substance(s) CC(C)(C)OC(=O)N1CCC(C(=O)O)CC1.Nc1ccccc1.C1CCOC1.CCOC(C)=O.Cl.O.O=C(c1ncc[nH]1)c1ncc[nH]1 as the reactants and reagents, what could be a probable product? | A probable product: CC(C)(C)OC(=O)N1CCC(C(=O)Nc2ccccc2)CC1 . | |
CCOC(=O)C(F)(F)c1ccncc1.CCO.[BH4-].[Na+] Based on the reactants and reagents given above, suggest a possible product. | A possible product can be OCC(F)(F)c1ccncc1 . | |
Based on the given reactants and reagents: N#Cc1ccc(Br)cc1.O=C1CCCC1.BrBr.CC(C)[Mg]Cl.[Cl-].[Li+].[Mg], what product could potentially be produced? | The product can be N#Cc1ccc(C2(O)CCCC2)cc1 . | |
Using CC(C)(C)OC(=O)NNc1c(N)cnc2ccccc12.CC1(CCC(=O)O)OCCO1.CCN=C=NCCCN(C)C.CN(C)c1ccncc1.CN1CCOCC1.Cl.ClC(Cl)Cl.c1ccncc1 as the reactants and reagents, tell me the potential product. | CC(C)(C)OC(=O)NNc1c(NC(=O)CCC2(C)OCCO2)cnc2ccccc12 . | |
Propose a potential product given these reactants and reagents. Cc1ccc(Cl)c(O)c1F.N#Cc1cc(Cl)nc(Cl)c1.C1CCOC1.C1COCCOCCOCCOCCOCCO1.CC(C)(C)[O-].[K+] | Cc1ccc(Cl)c(Oc2cc(C#N)cc(Cl)n2)c1F . | |
Propose a potential product given these reactants and reagents. CCOC(COc1cnc(Cl)c(Cl)c1)OCC.COc1ccc2nc(Nc3ncnc4ccc(O)cc34)sc2n1.CC(=O)N(C)C.CC(C)(C)[O-].[Cl-].[K+].[NH4+] | CCOC(COc1cnc(Oc2ccc3ncnc(Nc4nc5ccc(OC)nc5s4)c3c2)c(Cl)c1)OCC . | |
CC(C)(C)OC(=O)N1CCC(N)CC1.CC(C)CN(c1ccc(F)cc1)S(=O)(=O)c1ccc(Cl)nc1.CC#N.CCN(C(C)C)C(C)C.CCOC(C)=O.O=C([O-])O.[Na+] Given the above reactants and reagents, what could be a probable product of their reaction? | A probable product could be CC(C)CN(c1ccc(F)cc1)S(=O)(=O)c1ccc(NC2CCN(C(=O)OC(C)(C)C)CC2)nc1 . | |
Consider that for a chemical reaction, if BrP(Br)Br.COc1ccc(Cn2nnc(-c3cccc(CO)c3)n2)cc1.ClCCl is/are the reactants and reagents, what can be the product? | COc1ccc(Cn2nnc(-c3cccc(CBr)c3)n2)cc1 . | |
Using CCOC(=O)c1sc(N2CCN(CCO[Si](C)(C)C(C)(C)C)C2=O)cc1C.CC(=O)O as the reactants and reagents, tell me the potential product. | CCOC(=O)c1sc(N2CCN(CCO)C2=O)cc1C . | |
COc1ccc(P2(=S)SP(=S)(c3ccc(OC)cc3)S2)cc1.N#CCC(=O)N1CCOCC1.C1CCOC1 Based on the reactants and reagents given above, suggest a possible product. | A possible product can be N#CCC(=S)N1CCOCC1 . | |
Propose a potential product given these reactants and reagents. COc1ccc2cc(C(C)C(=O)O)ccc2c1.OCCOc1ccc(OCCO)cc1.CCN(CC)CC.CCN=C=NCCCN(C)C.CN(C)C=O.Cl | COc1ccc2cc(C(C)C(=O)OCCOc3ccc(OCCO)cc3)ccc2c1 . | |
Given the following reactants and reagents, please provide a possible product. CC(C)(C)CC1NC(C(=O)O)C(c2cccc(Cl)c2F)C1(C#N)c1ccc(Cl)cc1F.CC(C)(C)[Si](C)(C)OCCn1ccc(N)cc1=O.CCN(C(C)C)C(C)C.ClCCl.O=P(Cl)(c1ccccc1)c1ccccc1 | CC(C)(C)CC1NC(C(=O)Nc2ccn(CCO[Si](C)(C)C(C)(C)C)c(=O)c2)C(c2cccc(Cl)c2F)C1(C#N)c1ccc(Cl)cc1F . | |
Based on the given reactants and reagents: O=C1OC(CCCCl)CN1c1ccccc1.c1cnc(N2CCNCC2)nc1.CCCCO.Cl.Cl.O=C([O-])[O-].[I-].[K+].[K+].[K+], what product could potentially be produced? | The product can be O=C1OC(CCCN2CCN(c3ncccn3)CC2)CN1c1ccccc1 . | |
Nc1ccc(Cl)c(S(=O)(=O)N2CCOCC2)c1O.O=C=Nc1cccc(Cl)c1Cl.NC(N)=O Considering the given starting materials, what might be the resulting product in a chemical reaction? | O=C(Nc1ccc(Cl)c(S(=O)(=O)N2CCOCC2)c1O)Nc1cccc(Cl)c1Cl . | |
Consider that for a chemical reaction, if COC(=O)c1cnc(OCC(F)(F)F)c(Br)c1.Cc1cc(B(O)O)ccc1Cl.CCCCCCC.CCOC(C)=O.CS(C)=O.O.O=C([O-])[O-].[Na+].[Na+] is/are the reactants and reagents, what can be the product? | COC(=O)c1cnc(OCC(F)(F)F)c(-c2ccc(Cl)c(C)c2)c1 . | |
Predict a possible product from the listed reactants and reagents. CC(=O)c1cccc2ccccc12.NO.Cl.c1ccncc1 | CC(=NO)c1cccc2ccccc12 . | |
A chemical reaction has started with the substance(s) COC(=O)Cc1cc2ccc(F)cc2c(C2CCN(S(=O)(=O)Cc3cccc(Cl)c3)CC2)c1C.C1CCOC1.O.O.[Li+].[OH-] as the reactants and reagents, what could be a probable product? | A probable product: Cc1c(CC(=O)O)cc2ccc(F)cc2c1C1CCN(S(=O)(=O)Cc2cccc(Cl)c2)CC1 . | |
Please provide a feasible product that could be formed using these reactants and reagents: Fc1c(N2CCC3(CC2)OCCO3)ccc2cccnc12.C1CCOC1.Cl.[Na+].[OH-] . | O=C1CCN(c2ccc3cccnc3c2F)CC1 . | |
Based on the given reactants and reagents: CNc1ccc(S(=O)(=O)N2CCC(NC(=O)OC(C)(C)C)CC2)cc1.O=C(Cl)C1CCOCC1.C1CCOC1.CCN(C(C)C)C(C)C, what product could potentially be produced? | The product can be CN(C(=O)C1CCOCC1)c1ccc(S(=O)(=O)N2CCC(NC(=O)OC(C)(C)C)CC2)cc1 . | |
Given the following reactants and reagents, please provide a possible product. CC(=O)NCC1(O)CCN(C)CC1.C1CCOC1.[Al+3].[H-].[H-].[H-].[H-].[Li+] | CCNCC1(O)CCN(C)CC1 . | |
Predict the product of a chemical reaction with CI.O=C(O)c1c(Br)ccc(F)c1F.CN(C)C=O.O.O=C([O-])[O-].[K+].[K+] as the reactants and reagents. | COC(=O)c1c(Br)ccc(F)c1F . | |
Using Cc1ccc(S(=O)(=O)OCC2Cc3ccc(O)cc3O2)cc1.O=S(=O)(OS(=O)(=O)C(F)(F)F)C(F)(F)F.CCN(C(C)C)C(C)C.ClCCl as the reactants and reagents, tell me the potential product. | Cc1ccc(S(=O)(=O)OCC2Cc3ccc(OS(=O)(=O)C(F)(F)F)cc3O2)cc1 . | |
Please provide a feasible product that could be formed using these reactants and reagents: CCO.O=C(O)c1cc(F)c([N+](=O)[O-])cc1F.CN(C)C=O.Cl.O.O=C([O-])[O-].[Cs+].[Cs+] . | CCOc1cc(C(=O)O)c(F)cc1[N+](=O)[O-] . | |
Cc1nn(C2CCCCO2)c2nc(-c3ccc(O)cc3)cc(CN3CC(C)(C)N(Cc4ccccc4)CC3(C)C)c12.CO Given the above reactants and reagents, what could be a probable product of their reaction? | A probable product could be Cc1nn(C2CCCCO2)c2nc(-c3ccc(O)cc3)cc(CN3CC(C)(C)NCC3(C)C)c12 . | |
Predict a possible product from the listed reactants and reagents. CCc1nc(-c2ccccc2)cn1-c1ccc(CCN=[N+]=[N-])cc1.CO.[Pd] | CCc1nc(-c2ccccc2)cn1-c1ccc(CCN)cc1 . | |
Can you tell me the potential product of a chemical reaction that uses CCI.CCc1cnc(CC)c(NC2CN(C(=O)OCc3ccccc3)CC2O)n1.CN(C)C=O.[H-].[Na+] as the reactants and reagents? | Sure. A potential product: CCOC1CN(C(=O)OCc2ccccc2)CC1Nc1nc(CC)cnc1CC . | |
Predict a possible product from the listed reactants and reagents. CCNCC1COc2ccccc2O1.O=c1ccc2ccc(OCCCBr)cc2o1.CCN(C(C)C)C(C)C.CN(C)C=O | CCN(CCCOc1ccc2ccc(=O)oc2c1)CC1COc2ccccc2O1 . | |
Propose a potential product given these reactants and reagents. COC(=O)c1cc(C)c(C(=O)OC)c([N+](=O)[O-])c1C.C1COCCO1.O.[Na+].[OH-] | COC(=O)c1c(C)cc(C(=O)O)c(C)c1[N+](=O)[O-] . | |
Consider that for a chemical reaction, if COC(=O)CCN.CC1CN(C(=O)COc2ccc(Cl)cc2C=O)C(C)CN1Cc1ccc(F)cc1.CC(=O)O.CCN(CC)CC.CCOC(C)=O.CO.Cl.[BH3-]C#N.[Na+] is/are the reactants and reagents, what can be the product? | COC(=O)CCNCc1cc(Cl)ccc1OCC(=O)N1CC(C)N(Cc2ccc(F)cc2)CC1C . |