input stringlengths 108 173 | output stringclasses 2
values | __index_level_0__ int64 1 3.64k |
|---|---|---|
You are given two SMILES of molecules: c1(NC(CN2C(=O)CCC2)=O)c(C)cccc1C and c1(C(=O)O)ccccc1. Predict if they can form a cocrystal. | no | 2,375 |
You are given two SMILES of molecules: C(N1CCCC1CNC(c1cc(S(=O)(=O)N)ccc1OC)=O)C and C(O)(CCCCC(=O)O)=O. Predict if they can form a cocrystal. | yes | 6 |
You are given two SMILES of molecules: NC(=O)c1nccnc1 and c1ccccc1C(O)C(O)=O. Predict if they can form a cocrystal. | yes | 382 |
You are given two SMILES of molecules: c12c(n(CC)cc(C(O)=O)c1=O)nc(C)cc2 and c1c(O)c(O)cc(-c2oc3c(c(=O)c2O)c(O)cc(O)c3)c1. Predict if they can form a cocrystal. | yes | 3,164 |
You are given two SMILES of molecules: C1N(CC(Nc2c(C)cccc2C)=O)C(=O)CC1 and O=c1n(C)c(=O)c2[nH]cnc2n1C. Predict if they can form a cocrystal. | no | 2,659 |
You are given two SMILES of molecules: C(C(=O)N)N1C(=O)CCC1 and OC1C(O)C(O)C(O)C(O)C1O. Predict if they can form a cocrystal. | no | 2,936 |
You are given two SMILES of molecules: c1cc(-c2ccc(C(C)C(=O)O)cc2F)ccc1 and c1cc(O)ccc1CCN. Predict if they can form a cocrystal. | yes | 3,465 |
You are given two SMILES of molecules: O=C1CCCN1CC(=O)Nc1c(C)cccc1C and C(C(O)=O)(CC(O)=O)(C)C. Predict if they can form a cocrystal. | no | 2,246 |
You are given two SMILES of molecules: C1(=O)CCCN1CC(=O)Nc1c(C)cccc1C and c1(O)cc(C(=O)O)cc(O)c1. Predict if they can form a cocrystal. | no | 1,713 |
You are given two SMILES of molecules: O=C1N(CC(Nc2c(C)cccc2C)=O)CCC1 and c1c(C(=O)O)cccc1. Predict if they can form a cocrystal. | no | 2,372 |
You are given two SMILES of molecules: C(N1C(=O)CCC1)C(Nc1c(C)cccc1C)=O and C(=O)(O)c1ccc(CN)cc1. Predict if they can form a cocrystal. | no | 2,022 |
You are given two SMILES of molecules: c1(CC(C)C)ccc(C(C(O)=O)C)cc1 and c1c(O)cc(O)cc1. Predict if they can form a cocrystal. | no | 1,393 |
You are given two SMILES of molecules: n1ccc(C(N)=S)cc1CCC and OC(=O)CCCN. Predict if they can form a cocrystal. | no | 552 |
You are given two SMILES of molecules: n1c(=N)n(O)c(N)cc1N1CCCCC1 and O=C(O)c1cc(C(O)=O)cc(O)c1. Predict if they can form a cocrystal. | yes | 3,377 |
You are given two SMILES of molecules: C1CCN(CC)C1CNC(=O)c1c(OC)ccc(S(N)(=O)=O)c1 and C1CCNC1C(=O)O. Predict if they can form a cocrystal. | no | 222 |
You are given two SMILES of molecules: C(C)(C)Cc1ccc(C(C)C(=O)O)cc1 and c1ccnc(N)c1. Predict if they can form a cocrystal. | no | 1,382 |
You are given two SMILES of molecules: CC(c1ccccc1)C(=O)O and n1c[nH]cc1CC(C(=O)O)N. Predict if they can form a cocrystal. | no | 1,096 |
You are given two SMILES of molecules: c1(O)cc(C(OC)=O)cc(O)c1O and C1(C(O)=O)NCCC1. Predict if they can form a cocrystal. | yes | 3,145 |
You are given two SMILES of molecules: c1cc(S(N)(=O)=O)cc(C(NCC2N(CC)CCC2)=O)c1OC and C(O)(=O)CCCCC(=O)O. Predict if they can form a cocrystal. | yes | 8 |
You are given two SMILES of molecules: c1cc(C(N)=S)cc(CCC)n1 and c1(C(=O)O)c(C(=O)O)nccn1. Predict if they can form a cocrystal. | yes | 634 |
You are given two SMILES of molecules: c1c(C(NCC2N(CC)CCC2)=O)c(OC)ccc1S(=O)(=O)N and C(CC(N)C(=O)O)C(O)=O. Predict if they can form a cocrystal. | no | 316 |
You are given two SMILES of molecules: C(c1ccc(C(C(=O)O)C)cc1)C(C)C and C(CC(O)=O)CC(O)=O. Predict if they can form a cocrystal. | no | 1,328 |
You are given two SMILES of molecules: c1(C(N)=S)ccnc(CCC)c1 and c1(C(C(O)=O)C)ccc(CC(C)C)cc1. Predict if they can form a cocrystal. | no | 427 |
You are given two SMILES of molecules: Cc1cccc(C)c1NC(CN1CCCC1=O)=O and c1c(N)cccc1C(=O)N. Predict if they can form a cocrystal. | no | 1,993 |
You are given two SMILES of molecules: c1cc(OC)c(C(NCC2N(CC)CCC2)=O)cc1S(=O)(N)=O and c1(=O)nc(N)cc[nH]1. Predict if they can form a cocrystal. | no | 105 |
You are given two SMILES of molecules: C1N(CC(=O)Nc2c(C)cccc2C)C(=O)CC1 and O=C(O)C(N)Cc1ccccc1. Predict if they can form a cocrystal. | no | 2,619 |
You are given two SMILES of molecules: O=C(c1c(OC)ccc(S(N)(=O)=O)c1)NCC1N(CC)CCC1 and C(C(O)=O)CC(=O)C(O)=O. Predict if they can form a cocrystal. | no | 142 |
You are given two SMILES of molecules: c1c(S(N)(=O)=O)ccc(OC)c1C(=O)NCC1N(CC)CCC1 and O=C(c1cc(C(=O)O)cc(C(=O)O)c1)O. Predict if they can form a cocrystal. | no | 121 |
You are given two SMILES of molecules: C(=O)(CN1CCCC1=O)Nc1c(C)cccc1C and O=C(O)C(N)CCCCN. Predict if they can form a cocrystal. | no | 1,937 |
You are given two SMILES of molecules: Oc1c(C)ncc(CO)c1CO and C(=O)([CH]CCC(=O)O)O. Predict if they can form a cocrystal. | no | 2,868 |
You are given two SMILES of molecules: c1(C(=S)N)cc(CCC)ncc1 and O=S(c1ccccc1)(O)=O. Predict if they can form a cocrystal. | yes | 3,474 |
You are given two SMILES of molecules: c1cccc(C(C(=O)O)C)c1 and n1cc(O)ccc1. Predict if they can form a cocrystal. | no | 1,189 |
You are given two SMILES of molecules: O=C(Nc1c(C)cccc1C)CN1C(=O)CCC1 and Oc1ccccc1C(O)=O. Predict if they can form a cocrystal. | no | 2,639 |
You are given two SMILES of molecules: c1(C(=O)OC)cc(O)c(O)c(O)c1 and C1CCNC1C(=O)O. Predict if they can form a cocrystal. | yes | 3,147 |
You are given two SMILES of molecules: C(O)c1c(CO)cnc(C)c1O and C(CC(=O)C(=O)O)C(O)=O. Predict if they can form a cocrystal. | yes | 2,857 |
You are given two SMILES of molecules: C1C(=O)N(CC(Nc2c(C)cccc2C)=O)CC1 and O=C(O)c1cccc(O)c1O. Predict if they can form a cocrystal. | no | 1,689 |
You are given two SMILES of molecules: c1c(OC)c(C(=O)NCC2CCCN2CC)cc(S(=O)(=O)N)c1 and O=c1[nH]c(=O)[nH]cc1C. Predict if they can form a cocrystal. | no | 115 |
You are given two SMILES of molecules: C(N1C(=O)CCC1)C(Nc1c(C)cccc1C)=O and C(C(=O)N)C(C)=O. Predict if they can form a cocrystal. | no | 2,071 |
You are given two SMILES of molecules: n1c(N)c(Cl)ccc1 and c1ccc(C(F)(F)F)c(C(=O)O)c1C(F)(F)F. Predict if they can form a cocrystal. | yes | 3,233 |
You are given two SMILES of molecules: C(C(=O)Nc1c(C)cccc1C)N1CCCC1=O and O=C(C=CC(O)=O)O. Predict if they can form a cocrystal. | no | 1,885 |
You are given two SMILES of molecules: c1cc2c(ccc(OC)c2)cc1C(C(O)=O)C and C(CN)c1ccc(O)cc1. Predict if they can form a cocrystal. | yes | 3,443 |
You are given two SMILES of molecules: c12c(oc(=O)c(C(=O)C)c1)cc(O)cc2CO and C1NCCNC1. Predict if they can form a cocrystal. | yes | 3,392 |
You are given two SMILES of molecules: c1(C)ncc([N+](=O)[O-])n1CC(O)C and C(O)(C(=O)O)=O. Predict if they can form a cocrystal. | yes | 3,575 |
You are given two SMILES of molecules: O=C1CCCN1CC(=O)Nc1c(C)cccc1C and c1c(C(O)=O)cc(C(=O)O)cc1. Predict if they can form a cocrystal. | no | 2,457 |
You are given two SMILES of molecules: C(CN1CCCC1=O)(Nc1c(C)cccc1C)=O and C(N)(C(C)C)C(O)=O. Predict if they can form a cocrystal. | no | 2,676 |
You are given two SMILES of molecules: c1c(C(N)=S)cc(CCC)nc1 and c1(=O)c2c(ncn2C)n(C)c(=O)n1C. Predict if they can form a cocrystal. | no | 672 |
You are given two SMILES of molecules: C1CN(CC(=O)Nc2c(C)cccc2C)C(=O)C1 and C1(O)C(O)C(O)C(O)C(O)C1O. Predict if they can form a cocrystal. | no | 2,488 |
You are given two SMILES of molecules: O=S(N)(c1ccc(OC)c(C(=O)NCC2N(CC)CCC2)c1)=O and c12c(c(=O)n(C)c(=O)n1C)n(C)cn2. Predict if they can form a cocrystal. | no | 91 |
You are given two SMILES of molecules: CC(c1ccccc1)C(O)=O and O=C(C)N. Predict if they can form a cocrystal. | no | 1,109 |
You are given two SMILES of molecules: O=C1CCCN1CC(Nc1c(C)cccc1C)=O and OCC(C(O)C(O)C(O)CO)O. Predict if they can form a cocrystal. | no | 2,149 |
You are given two SMILES of molecules: C(=S)(N)c1cc(CCC)ncc1 and c1cccc(C(=O)O)c1C(=O)O. Predict if they can form a cocrystal. | yes | 591 |
You are given two SMILES of molecules: c1(NC(=O)CN2CCCC2=O)c(C)cccc1C and S(c1ccccc1)(=O)(=O)O. Predict if they can form a cocrystal. | no | 2,114 |
You are given two SMILES of molecules: C1CCN(c2cc(N)n(O)c(=N)n2)CC1 and c1(C(O)=O)cc(C(=O)O)cc(O)c1. Predict if they can form a cocrystal. | yes | 3,379 |
You are given two SMILES of molecules: c1ccc(Cl)c(N)n1 and c1c(C(F)(F)F)c(C(=O)O)c(C(F)(F)F)cc1. Predict if they can form a cocrystal. | yes | 3,236 |
You are given two SMILES of molecules: OC(c1ccc(N)cc1O)=O and [nH]1cnc(CC(N)C(O)=O)c1. Predict if they can form a cocrystal. | no | 888 |
You are given two SMILES of molecules: O=C1CCCN1CC(=O)Nc1c(C)cccc1C and Cc1ccc(C(=O)O)c(C)c1. Predict if they can form a cocrystal. | no | 2,310 |
You are given two SMILES of molecules: Clc1c(Cl)cccc1-c1c(N)nc(N)nn1 and FC(c1cccc(C(F)(F)F)c1C(=O)O)(F)F. Predict if they can form a cocrystal. | yes | 3,199 |
You are given two SMILES of molecules: c1(C(C(O)=O)C)cc2c(cc1)Sc1ccccc1C(=O)C2 and n1ccccc1C(N)=O. Predict if they can form a cocrystal. | no | 1,576 |
You are given two SMILES of molecules: C1CCN(CC(Nc2c(C)cccc2C)=O)C1=O and O=C(c1ccccc1)O. Predict if they can form a cocrystal. | no | 2,370 |
You are given two SMILES of molecules: c1(C)c(NC(=O)CN2C(=O)CCC2)c(C)ccc1 and c1c(O)cc(O)cc1C(O)=O. Predict if they can form a cocrystal. | no | 1,714 |
You are given two SMILES of molecules: c1(C(NCC2N(CC)CCC2)=O)c(OC)ccc(S(=O)(=O)N)c1 and n1cccc(C(=O)O)c1. Predict if they can form a cocrystal. | yes | 213 |
You are given two SMILES of molecules: O=C(O)c1c(O)cc(N)cc1 and O=C(O)c1cccnc1. Predict if they can form a cocrystal. | no | 778 |
You are given two SMILES of molecules: Clc1c(-c2nnc(N)nc2N)cccc1Cl and O=C(c1ccccc1)O. Predict if they can form a cocrystal. | yes | 3,212 |
You are given two SMILES of molecules: c1c2c(ccc1)C(=O)Cc1cc(C(C)C(=O)O)ccc1S2 and c1cc(C(N)=O)cnc1. Predict if they can form a cocrystal. | yes | 1,448 |
You are given two SMILES of molecules: Cc1c(NC(=O)CN2C(=O)CCC2)c(C)ccc1 and Oc1ccc(O)cc1C(=O)O. Predict if they can form a cocrystal. | yes | 2,252 |
You are given two SMILES of molecules: c1(N)ccc(C(=O)O)c(O)c1 and C(CCCCC(O)=O)C(=O)O. Predict if they can form a cocrystal. | no | 800 |
You are given two SMILES of molecules: C1CC(=O)N(CC(N)=O)C1 and C(O)c1c(O)c(C)ncc1CO. Predict if they can form a cocrystal. | no | 2,997 |
You are given two SMILES of molecules: C(C(Nc1c(C)cccc1C)=O)N1CCCC1=O and c1cccc(C(N)=O)c1N. Predict if they can form a cocrystal. | no | 2,095 |
You are given two SMILES of molecules: c1(NC(=O)CN2C(=O)CCC2)c(C)cccc1C and O=C(OCC)c1cc(O)c(O)c(O)c1. Predict if they can form a cocrystal. | no | 2,155 |
You are given two SMILES of molecules: C1c2cc(C(C(O)=O)C)ccc2Sc2ccccc2C1=O and c1c(N)ccc(C(=O)O)c1O. Predict if they can form a cocrystal. | no | 1,567 |
You are given two SMILES of molecules: C(=O)(CN1CCCC1=O)Nc1c(C)cccc1C and C(O)(=O)C(Cc1ccc(O)cc1)N. Predict if they can form a cocrystal. | no | 2,768 |
You are given two SMILES of molecules: c1cc(N)ncc1Cl and FC(c1cccc(C(F)(F)F)c1C(=O)O)(F)F. Predict if they can form a cocrystal. | yes | 3,227 |
You are given two SMILES of molecules: c1c2c(ccc1)C(=O)Cc1c(ccc(C(C)C(=O)O)c1)S2 and c1ccc(C(O)=O)cn1. Predict if they can form a cocrystal. | no | 1,518 |
You are given two SMILES of molecules: c1cc(C)c(NC(CN2C(=O)CCC2)=O)c(C)c1 and C(C(O)C(O)CO)(O)C(O)CO. Predict if they can form a cocrystal. | no | 2,147 |
You are given two SMILES of molecules: c1(O)ccc(-c2oc3c(c(=O)c2)c(O)cc(O)c3)cc1 and N1CCNCC1. Predict if they can form a cocrystal. | yes | 3,285 |
You are given two SMILES of molecules: OC(C(C)c1ccc(CC(C)C)cc1)=O and NC(C(O)=O)C. Predict if they can form a cocrystal. | no | 1,343 |
You are given two SMILES of molecules: N1(CC)CCCC1CNC(=O)c1c(OC)ccc(S(=O)(N)=O)c1 and c1c(OC)cc2c(CC(O)=O)c(C)n(C(c3ccc(Cl)cc3)=O)c2c1. Predict if they can form a cocrystal. | yes | 273 |
You are given two SMILES of molecules: N1(CC(Nc2c(C)cccc2C)=O)CCCC1=O and O=C(N)CC(C(=O)O)N. Predict if they can form a cocrystal. | no | 1,812 |
You are given two SMILES of molecules: O=C(c1c(OC)ccc(S(=O)(N)=O)c1)NCC1N(CC)CCC1 and O1C(OC2C(CO)OC(O)C(O)C2O)C(O)C(O)C(O)C1CO. Predict if they can form a cocrystal. | no | 71 |
You are given two SMILES of molecules: c1(C(O)=O)c(O)cc(N)cc1 and C(C=Cc1ccc(O)c(O)c1)(=O)O. Predict if they can form a cocrystal. | no | 720 |
You are given two SMILES of molecules: Cc1cccc(C)c1NC(=O)CN1C(=O)CCC1 and c1(N)ccc(C(O)=O)cc1. Predict if they can form a cocrystal. | no | 1,740 |
You are given two SMILES of molecules: c1cc(C(=O)O)c(O)cc1N and c12c(nc(N)[nH]c1=O)nc[nH]2. Predict if they can form a cocrystal. | no | 1,087 |
You are given two SMILES of molecules: c1(C(N)=O)nccnc1 and Cn1cnc2n(C)c(=O)n(C)c(=O)c12. Predict if they can form a cocrystal. | no | 394 |
You are given two SMILES of molecules: c1c(CCC)nccc1C(N)=S and Oc1c(OC)cc(C(=O)O)cc1. Predict if they can form a cocrystal. | no | 583 |
You are given two SMILES of molecules: c1(F)nc(C(N)=O)c(=O)[nH]c1 and c1(N)ncnc2nc[nH]c12. Predict if they can form a cocrystal. | yes | 3,518 |
You are given two SMILES of molecules: C1C(=O)N(CC(N)=O)CC1 and O=C(c1cccnc1)O. Predict if they can form a cocrystal. | no | 2,970 |
You are given two SMILES of molecules: Cc1c(NC(=O)CN2CCCC2=O)c(C)ccc1 and c1ccc(C(O)=O)cc1C(=O)O. Predict if they can form a cocrystal. | no | 2,452 |
You are given two SMILES of molecules: c1nc(CCC)cc(C(=S)N)c1 and c1cc(O)ccc1O. Predict if they can form a cocrystal. | no | 500 |
You are given two SMILES of molecules: C1N(CC(=O)Nc2c(C)cccc2C)C(=O)CC1 and OC(=O)CC(O)C(O)=O. Predict if they can form a cocrystal. | no | 2,467 |
You are given two SMILES of molecules: Cc1cccc(C)c1NC(CN1C(=O)CCC1)=O and c1c2c(ccc1)c(Cc1c3c(cccc3)cc(C(O)=O)c1O)c(O)c(C(O)=O)c2. Predict if they can form a cocrystal. | no | 2,697 |
You are given two SMILES of molecules: C(C(=O)Nc1c(C)cccc1C)N1C(=O)CCC1 and O=C(C(CC(=O)O)O)O. Predict if they can form a cocrystal. | no | 2,460 |
You are given two SMILES of molecules: c12ccccc1N(C(=O)N)c1ccccc1C=C2 and c1ccc(C(=O)N)cc1. Predict if they can form a cocrystal. | yes | 3,612 |
You are given two SMILES of molecules: c1c(N)n(O)c(=N)nc1N1CCCCC1 and c1(C(O)=O)ccccc1C. Predict if they can form a cocrystal. | yes | 3,323 |
You are given two SMILES of molecules: c12cc(O)cc(O)c1c(=O)cc(-c1ccc(O)cc1)o2 and N1CCNCC1. Predict if they can form a cocrystal. | yes | 3,284 |
You are given two SMILES of molecules: Cc1cccc(C)c1NC(=O)CN1C(=O)CCC1 and c1c(S(=O)(O)=O)cccc1. Predict if they can form a cocrystal. | no | 2,115 |
You are given two SMILES of molecules: O=C(CN1C(=O)CCC1)Nc1c(C)cccc1C and O=C(O)c1cc(OC)cc(C(=O)O)c1. Predict if they can form a cocrystal. | no | 1,763 |
You are given two SMILES of molecules: C1CN(CC(=O)Nc2c(C)cccc2C)C(=O)C1 and O=C(c1cc(C(=O)O)cc(C(=O)O)c1)O. Predict if they can form a cocrystal. | no | 2,757 |
You are given two SMILES of molecules: CC(Cc1ccc(C(C(O)=O)C)cc1)C and N1CCNCC1. Predict if they can form a cocrystal. | yes | 1,259 |
You are given two SMILES of molecules: C1CN(CC(=O)Nc2c(C)cccc2C)C(=O)C1 and OC(c1nc(C(=O)O)ccc1)=O. Predict if they can form a cocrystal. | yes | 2,722 |
You are given two SMILES of molecules: c1(C(=O)OC)cc(O)c(O)c(O)c1 and C1CNC(C(=O)O)C1. Predict if they can form a cocrystal. | yes | 3,142 |
End of preview. Expand in Data Studio
README.md exists but content is empty.
- Downloads last month
- 4