Datasets:
Languages:
English
Size:
10M<n<100M
Tags:
biomedical
negative-results
benchmark
drug-target-interaction
clinical-trials
protein-protein-interaction
License:
| """Tests for DAVIS ETL pipeline.""" | |
| from pathlib import Path | |
| import pandas as pd | |
| import pytest | |
| from negbiodb.db import connect, create_database | |
| from negbiodb.etl_davis import ( | |
| classify_affinities, | |
| insert_compounds, | |
| insert_negative_results, | |
| insert_target_variants, | |
| insert_targets, | |
| load_davis_csvs, | |
| parse_gene_name, | |
| standardize_all_compounds, | |
| standardize_compound, | |
| standardize_all_targets, | |
| ) | |
| from negbiodb.db import refresh_all_pairs | |
| MIGRATIONS_DIR = Path(__file__).resolve().parent.parent / "migrations" | |
| # ============================================================ | |
| # Fixtures | |
| # ============================================================ | |
| def migrated_db(tmp_path): | |
| """Create a fresh migrated database.""" | |
| db_path = tmp_path / "test.db" | |
| create_database(db_path, MIGRATIONS_DIR) | |
| return db_path | |
| def sample_drugs_df(): | |
| return pd.DataFrame({ | |
| "Drug_Index": [0, 1], | |
| "CID": [11314340, 24889392], | |
| "Canonical_SMILES": [ | |
| "CC1=C2C=C(C=CC2=NN1)C3=CC(=CN=C3)OCC(CC4=CC=CC=C4)N", | |
| "CC(C)(C)C1=CC(=NO1)NC(=O)NC2=CC=C(C=C2)C3=CN4C5=C(C=C(C=C5)OCCN6CCOCC6)SC4=N3", | |
| ], | |
| "Isomeric_SMILES": ["", ""], | |
| }) | |
| def sample_proteins_df(): | |
| return pd.DataFrame({ | |
| "Protein_Index": [0, 1, 3], | |
| "Accession_Number": ["NP_055726.3", "NP_005148.2", "NP_005148.2"], | |
| "Gene_Name": ["AAK1", "ABL1(E255K)-phosphorylated", "ABL1(F317I)-phosphorylated"], | |
| "Sequence": ["MKKFF" * 20, "MLEICL" * 20, "MLEICL" * 20], | |
| }) | |
| def sample_affinities_df(): | |
| return pd.DataFrame({ | |
| "Drug_Index": [0, 0, 0, 1, 1, 1], | |
| "Protein_Index": [0, 1, 3, 0, 1, 3], | |
| "Affinity": [7.37, 5.0, 5.0, 5.0, 6.5, 5.0], | |
| }) | |
| def mock_refseq_mapping(): | |
| return { | |
| "NP_055726.3": "Q2M2I8", | |
| "NP_005148.2": "P00519", | |
| } | |
| # ============================================================ | |
| # TestParseGeneName | |
| # ============================================================ | |
| class TestParseGeneName: | |
| def test_simple_gene(self): | |
| assert parse_gene_name("AAK1") == ("AAK1", None) | |
| def test_mutation(self): | |
| assert parse_gene_name("ABL1(E255K)-phosphorylated") == ("ABL1", "E255K") | |
| def test_mutation_no_suffix(self): | |
| assert parse_gene_name("ABL1(T315I)") == ("ABL1", "T315I") | |
| def test_phosphorylated_only(self): | |
| assert parse_gene_name("ABL1-phosphorylated") == ("ABL1", None) | |
| def test_nonphosphorylated(self): | |
| assert parse_gene_name("ABL1-nonphosphorylated") == ("ABL1", None) | |
| def test_domain_selector_jh1(self): | |
| assert parse_gene_name("JAK1(JH1domain-catalytic)") == ("JAK1", None) | |
| def test_domain_selector_jh2(self): | |
| assert parse_gene_name("TYK2(JH2domain-pseudokinase)") == ("TYK2", None) | |
| def test_domain_selector_kin_dom(self): | |
| assert parse_gene_name("RPS6KA4(Kin.Dom.1-N-terminal)") == ("RPS6KA4", None) | |
| def test_species_selector(self): | |
| assert parse_gene_name("PFCDPK1(P.falciparum)") == ("PFCDPK1", None) | |
| def test_deletion_mutation(self): | |
| assert parse_gene_name("EGFR(E746-A750del)") == ("EGFR", "E746-A750del") | |
| # ============================================================ | |
| # TestStandardizeCompound | |
| # ============================================================ | |
| class TestStandardizeCompound: | |
| def test_valid_smiles(self): | |
| result = standardize_compound("c1ccccc1", 123) | |
| assert result is not None | |
| assert result["inchikey"].startswith("UHOVQNZJYSORNB") | |
| def test_inchikey_format(self): | |
| result = standardize_compound("CC(=O)O", 176) | |
| assert len(result["inchikey"]) == 27 | |
| assert result["inchikey"].count("-") == 2 | |
| def test_computes_properties(self): | |
| result = standardize_compound("c1ccccc1", 123) | |
| assert result["molecular_weight"] > 0 | |
| assert result["num_heavy_atoms"] == 6 | |
| assert result["pubchem_cid"] == 123 | |
| def test_invalid_smiles(self): | |
| result = standardize_compound("not_a_smiles", 0) | |
| assert result is None | |
| # ============================================================ | |
| # TestClassifyAffinities | |
| # ============================================================ | |
| class TestClassifyAffinities: | |
| def test_inactive_at_5(self): | |
| df = pd.DataFrame({"Affinity": [5.0]}) | |
| result = classify_affinities(df) | |
| assert result["classification"].iloc[0] == "inactive" | |
| def test_active_at_7(self): | |
| df = pd.DataFrame({"Affinity": [7.0]}) | |
| result = classify_affinities(df) | |
| assert result["classification"].iloc[0] == "active" | |
| def test_borderline(self): | |
| df = pd.DataFrame({"Affinity": [6.0]}) | |
| result = classify_affinities(df) | |
| assert result["classification"].iloc[0] == "borderline" | |
| def test_distribution(self, sample_affinities_df): | |
| result = classify_affinities(sample_affinities_df) | |
| counts = result["classification"].value_counts() | |
| assert counts["inactive"] == 4 | |
| assert counts["active"] == 1 | |
| assert counts["borderline"] == 1 | |
| # ============================================================ | |
| # TestInsertCompounds | |
| # ============================================================ | |
| class TestInsertCompounds: | |
| def test_insert_new(self, migrated_db): | |
| compounds = [standardize_compound("c1ccccc1", 241)] | |
| compounds[0]["drug_index"] = 0 | |
| with connect(migrated_db) as conn: | |
| mapping = insert_compounds(conn, compounds) | |
| conn.commit() | |
| assert 0 in mapping | |
| assert mapping[0] > 0 | |
| def test_idempotent(self, migrated_db): | |
| compounds = [standardize_compound("c1ccccc1", 241)] | |
| compounds[0]["drug_index"] = 0 | |
| with connect(migrated_db) as conn: | |
| m1 = insert_compounds(conn, compounds) | |
| m2 = insert_compounds(conn, compounds) | |
| conn.commit() | |
| assert m1[0] == m2[0] | |
| def test_returns_mapping(self, migrated_db, sample_drugs_df): | |
| compounds = standardize_all_compounds(sample_drugs_df) | |
| with connect(migrated_db) as conn: | |
| mapping = insert_compounds(conn, compounds) | |
| conn.commit() | |
| assert len(mapping) == 2 | |
| assert 0 in mapping | |
| assert 1 in mapping | |
| # ============================================================ | |
| # TestInsertTargets | |
| # ============================================================ | |
| class TestInsertTargets: | |
| def test_insert_new(self, migrated_db): | |
| targets = [{ | |
| "protein_index": 0, | |
| "uniprot_accession": "Q2M2I8", | |
| "gene_symbol": "AAK1", | |
| "amino_acid_sequence": "MKKFF" * 20, | |
| "sequence_length": 100, | |
| "target_family": "kinase", | |
| }] | |
| with connect(migrated_db) as conn: | |
| mapping = insert_targets(conn, targets) | |
| conn.commit() | |
| assert 0 in mapping | |
| def test_idempotent(self, migrated_db): | |
| targets = [{ | |
| "protein_index": 0, | |
| "uniprot_accession": "Q2M2I8", | |
| "gene_symbol": "AAK1", | |
| "amino_acid_sequence": "MKKFF" * 20, | |
| "sequence_length": 100, | |
| "target_family": "kinase", | |
| }] | |
| with connect(migrated_db) as conn: | |
| m1 = insert_targets(conn, targets) | |
| m2 = insert_targets(conn, targets) | |
| conn.commit() | |
| assert m1[0] == m2[0] | |
| def test_stores_sequence(self, migrated_db): | |
| seq = "MKKFF" * 20 | |
| targets = [{ | |
| "protein_index": 0, | |
| "uniprot_accession": "Q2M2I8", | |
| "gene_symbol": "AAK1", | |
| "amino_acid_sequence": seq, | |
| "sequence_length": len(seq), | |
| "target_family": "kinase", | |
| }] | |
| with connect(migrated_db) as conn: | |
| insert_targets(conn, targets) | |
| conn.commit() | |
| row = conn.execute( | |
| "SELECT amino_acid_sequence, sequence_length FROM targets WHERE uniprot_accession='Q2M2I8'" | |
| ).fetchone() | |
| assert row[0] == seq | |
| assert row[1] == len(seq) | |
| # ============================================================ | |
| # TestTargetVariants | |
| # ============================================================ | |
| class TestTargetVariants: | |
| def test_standardize_targets_uses_canonical_uniprot( | |
| self, | |
| sample_proteins_df, | |
| mock_refseq_mapping, | |
| ): | |
| targets = standardize_all_targets(sample_proteins_df, mock_refseq_mapping) | |
| accessions = {t["uniprot_accession"] for t in targets} | |
| # Canonical only: no mutation suffix in uniprot_accession | |
| assert accessions == {"Q2M2I8", "P00519"} | |
| assert all("_" not in acc for acc in accessions) | |
| # Variant labels are kept separately for later target_variants insertion | |
| labels = {t["variant_label"] for t in targets if t["variant_label"] is not None} | |
| assert labels == {"E255K", "F317I"} | |
| def test_insert_target_variants(self, migrated_db): | |
| targets = [ | |
| { | |
| "protein_index": 0, | |
| "uniprot_accession": "Q2M2I8", | |
| "gene_symbol": "AAK1", | |
| "amino_acid_sequence": "MKKFF" * 20, | |
| "sequence_length": 100, | |
| "target_family": "kinase", | |
| "variant_label": None, | |
| "raw_gene_name": "AAK1", | |
| }, | |
| { | |
| "protein_index": 1, | |
| "uniprot_accession": "P00519", | |
| "gene_symbol": "ABL1", | |
| "amino_acid_sequence": "MLEICL" * 20, | |
| "sequence_length": 120, | |
| "target_family": "kinase", | |
| "variant_label": "E255K", | |
| "raw_gene_name": "ABL1(E255K)-phosphorylated", | |
| }, | |
| { | |
| "protein_index": 3, | |
| "uniprot_accession": "P00519", | |
| "gene_symbol": "ABL1", | |
| "amino_acid_sequence": "MLEICL" * 20, | |
| "sequence_length": 120, | |
| "target_family": "kinase", | |
| "variant_label": "F317I", | |
| "raw_gene_name": "ABL1(F317I)-phosphorylated", | |
| }, | |
| ] | |
| with connect(migrated_db) as conn: | |
| target_map = insert_targets(conn, targets) | |
| prot_to_variant, n_variants = insert_target_variants(conn, targets, target_map) | |
| conn.commit() | |
| assert n_variants == 2 | |
| assert 1 in prot_to_variant | |
| assert 3 in prot_to_variant | |
| row = conn.execute( | |
| "SELECT COUNT(*) FROM target_variants WHERE source_db='davis'" | |
| ).fetchone() | |
| assert row[0] == 2 | |
| # ============================================================ | |
| # TestInsertNegativeResults | |
| # ============================================================ | |
| class TestInsertNegativeResults: | |
| def _setup_data(self, conn): | |
| """Insert minimal compound and target for testing.""" | |
| conn.execute( | |
| """INSERT INTO compounds | |
| (canonical_smiles, inchikey, inchikey_connectivity, pubchem_cid) | |
| VALUES ('c1ccccc1', 'IMNFDUFMRHMDMM-UHFFFAOYSA-N', 'IMNFDUFMRHMDMM', 241)""" | |
| ) | |
| cid = conn.execute("SELECT compound_id FROM compounds").fetchone()[0] | |
| conn.execute( | |
| """INSERT INTO targets (uniprot_accession, gene_symbol, sequence_length) | |
| VALUES ('Q2M2I8', 'AAK1', 100)""" | |
| ) | |
| tid = conn.execute("SELECT target_id FROM targets").fetchone()[0] | |
| return cid, tid | |
| def test_insert(self, migrated_db): | |
| with connect(migrated_db) as conn: | |
| cid, tid = self._setup_data(conn) | |
| inactive_df = pd.DataFrame({ | |
| "Drug_Index": [0], | |
| "Protein_Index": [0], | |
| "Affinity": [5.0], | |
| }) | |
| total, skipped = insert_negative_results( | |
| conn, inactive_df, {0: cid}, {0: tid}, | |
| ) | |
| conn.commit() | |
| assert total == 1 | |
| assert skipped == 0 | |
| def test_confidence_bronze(self, migrated_db): | |
| with connect(migrated_db) as conn: | |
| cid, tid = self._setup_data(conn) | |
| inactive_df = pd.DataFrame({ | |
| "Drug_Index": [0], | |
| "Protein_Index": [0], | |
| "Affinity": [5.0], | |
| }) | |
| insert_negative_results(conn, inactive_df, {0: cid}, {0: tid}) | |
| conn.commit() | |
| row = conn.execute( | |
| "SELECT confidence_tier FROM negative_results" | |
| ).fetchone() | |
| assert row[0] == "bronze" | |
| def test_result_type_hard_negative(self, migrated_db): | |
| with connect(migrated_db) as conn: | |
| cid, tid = self._setup_data(conn) | |
| inactive_df = pd.DataFrame({ | |
| "Drug_Index": [0], | |
| "Protein_Index": [0], | |
| "Affinity": [5.0], | |
| }) | |
| insert_negative_results(conn, inactive_df, {0: cid}, {0: tid}) | |
| conn.commit() | |
| row = conn.execute( | |
| "SELECT result_type FROM negative_results" | |
| ).fetchone() | |
| assert row[0] == "hard_negative" | |
| def test_skips_unmapped(self, migrated_db): | |
| with connect(migrated_db) as conn: | |
| cid, tid = self._setup_data(conn) | |
| inactive_df = pd.DataFrame({ | |
| "Drug_Index": [0, 99], | |
| "Protein_Index": [0, 0], | |
| "Affinity": [5.0, 5.0], | |
| }) | |
| total, skipped = insert_negative_results( | |
| conn, inactive_df, {0: cid}, {0: tid}, | |
| ) | |
| conn.commit() | |
| assert total == 1 | |
| assert skipped == 1 | |
| def test_records_variant_id_when_provided(self, migrated_db): | |
| with connect(migrated_db) as conn: | |
| cid, tid = self._setup_data(conn) | |
| conn.execute( | |
| """INSERT INTO target_variants | |
| (target_id, variant_label, raw_gene_name, source_db, source_record_id) | |
| VALUES (?, 'E255K', 'ABL1(E255K)-phosphorylated', 'davis', 'DAVIS:PROTEIN:1')""", | |
| (tid,), | |
| ) | |
| variant_id = conn.execute( | |
| "SELECT variant_id FROM target_variants WHERE source_record_id='DAVIS:PROTEIN:1'" | |
| ).fetchone()[0] | |
| inactive_df = pd.DataFrame({ | |
| "Drug_Index": [0], | |
| "Protein_Index": [1], | |
| "Affinity": [5.0], | |
| }) | |
| total, skipped = insert_negative_results( | |
| conn, | |
| inactive_df, | |
| {0: cid}, | |
| {1: tid}, | |
| variant_map={1: variant_id}, | |
| ) | |
| conn.commit() | |
| assert total == 1 | |
| assert skipped == 0 | |
| row = conn.execute( | |
| "SELECT variant_id FROM negative_results WHERE source_record_id='DAVIS:0_1'" | |
| ).fetchone() | |
| assert row[0] == variant_id | |
| # ============================================================ | |
| # TestRefreshPairs | |
| # ============================================================ | |
| class TestRefreshPairs: | |
| def test_creates_pair(self, migrated_db): | |
| with connect(migrated_db) as conn: | |
| conn.execute( | |
| """INSERT INTO compounds | |
| (canonical_smiles, inchikey, inchikey_connectivity) | |
| VALUES ('c1ccccc1', 'IMNFDUFMRHMDMM-UHFFFAOYSA-N', 'IMNFDUFMRHMDMM')""" | |
| ) | |
| conn.execute( | |
| """INSERT INTO targets (uniprot_accession, gene_symbol, sequence_length) | |
| VALUES ('Q2M2I8', 'AAK1', 100)""" | |
| ) | |
| conn.execute( | |
| """INSERT INTO negative_results | |
| (compound_id, target_id, result_type, confidence_tier, | |
| activity_type, activity_value, activity_unit, pchembl_value, | |
| inactivity_threshold, source_db, source_record_id, extraction_method, | |
| publication_year) | |
| VALUES (1, 1, 'hard_negative', 'bronze', | |
| 'Kd', 10000.0, 'nM', 5.0, | |
| 10000.0, 'davis', 'DAVIS:0_0', 'database_direct', 2011)""" | |
| ) | |
| count = refresh_all_pairs(conn) | |
| conn.commit() | |
| assert count == 1 | |
| def test_pair_confidence(self, migrated_db): | |
| with connect(migrated_db) as conn: | |
| conn.execute( | |
| """INSERT INTO compounds | |
| (canonical_smiles, inchikey, inchikey_connectivity) | |
| VALUES ('c1ccccc1', 'IMNFDUFMRHMDMM-UHFFFAOYSA-N', 'IMNFDUFMRHMDMM')""" | |
| ) | |
| conn.execute( | |
| """INSERT INTO targets (uniprot_accession, gene_symbol, sequence_length) | |
| VALUES ('Q2M2I8', 'AAK1', 100)""" | |
| ) | |
| conn.execute( | |
| """INSERT INTO negative_results | |
| (compound_id, target_id, result_type, confidence_tier, | |
| activity_type, activity_value, activity_unit, pchembl_value, | |
| inactivity_threshold, source_db, source_record_id, extraction_method, | |
| publication_year) | |
| VALUES (1, 1, 'hard_negative', 'bronze', | |
| 'Kd', 10000.0, 'nM', 5.0, | |
| 10000.0, 'davis', 'DAVIS:0_0', 'database_direct', 2011)""" | |
| ) | |
| refresh_all_pairs(conn) | |
| conn.commit() | |
| row = conn.execute( | |
| "SELECT best_confidence FROM compound_target_pairs" | |
| ).fetchone() | |
| assert row[0] == "bronze" | |
| # ============================================================ | |
| # Integration Test | |
| # ============================================================ | |
| class TestRunDavisETL: | |
| def test_full_etl(self, tmp_path): | |
| from negbiodb.etl_davis import run_davis_etl | |
| davis_dir = Path(__file__).resolve().parent.parent / "data" / "davis" | |
| if not davis_dir.exists(): | |
| pytest.skip("DAVIS data not downloaded") | |
| db_path = tmp_path / "test.db" | |
| # Use skip_api=True with a pre-built cache or accept partial results | |
| stats = run_davis_etl(db_path, data_dir=davis_dir, skip_api=True) | |
| # Should have standardized all 68 compounds | |
| assert stats["compounds_inserted"] == 68 | |
| # Results should only be inactive (pKd <= 5.0) | |
| with connect(db_path) as conn: | |
| row = conn.execute( | |
| "SELECT COUNT(*) FROM negative_results WHERE source_db='davis' AND pchembl_value > 5.0" | |
| ).fetchone() | |
| assert row[0] == 0 | |
| tier = conn.execute( | |
| "SELECT DISTINCT confidence_tier FROM negative_results WHERE source_db='davis'" | |
| ).fetchone() | |
| if tier: | |
| assert tier[0] == "bronze" | |