| import os |
| import re |
| import pandas as pd |
| from io import StringIO |
| import rdkit |
| from rdkit import Chem |
| from rdkit.Chem import AllChem, Draw |
| import numpy as np |
| from PIL import Image, ImageDraw, ImageFont |
| import matplotlib.pyplot as plt |
| import matplotlib.patches as patches |
| from io import BytesIO |
| import tempfile |
| from rdkit import Chem, RDLogger |
| RDLogger.DisableLog('rdApp.*') |
|
|
| import pdb |
|
|
| class PeptideAnalyzer: |
| def __init__(self): |
| self.bond_patterns = [ |
| (r'OC\(=O\)', 'ester'), |
| (r'N\(C\)C\(=O\)', 'n_methyl'), |
| (r'N[0-9]C\(=O\)', 'proline'), |
| (r'NC\(=O\)', 'peptide'), |
| (r'C\(=O\)N\(C\)', 'n_methyl_reverse'), |
| (r'C\(=O\)N[12]?', 'peptide_reverse') |
| ] |
| |
| self.three_to_one = { |
| 'Ala': 'A', 'Cys': 'C', 'Asp': 'D', 'Glu': 'E', |
| 'Phe': 'F', 'Gly': 'G', 'His': 'H', 'Ile': 'I', |
| 'Lys': 'K', 'Leu': 'L', 'Met': 'M', 'Asn': 'N', |
| 'Pro': 'P', 'Gln': 'Q', 'Arg': 'R', 'Ser': 'S', |
| 'Thr': 'T', 'Val': 'V', 'Trp': 'W', 'Tyr': 'Y' |
| } |
| |
| def is_peptide(self, smiles): |
| """Check if the SMILES represents a peptide structure""" |
| |
| mol = Chem.MolFromSmiles(smiles) |
| if mol is None: |
| return False |
| |
| |
| peptide_bond_pattern = Chem.MolFromSmarts('[NH][C](=O)') |
| if mol.HasSubstructMatch(peptide_bond_pattern): |
| return True |
| |
| |
| n_methyl_pattern = Chem.MolFromSmarts('[N;H0;$(NC)](C)[C](=O)') |
| if mol.HasSubstructMatch(n_methyl_pattern): |
| return True |
| |
| return False |
|
|
| def is_cyclic(self, smiles): |
| """Improved cyclic peptide detection""" |
| |
| if smiles.endswith('C(=O)O'): |
| return False, [], [] |
| |
| |
| ring_numbers = re.findall(r'(?:^|[^c])[0-9](?=[A-Z@\(\)])', smiles) |
| |
| |
| aromatic_matches = re.findall(r'c[0-9](?:ccccc|c\[nH\]c)[0-9]', smiles) |
| aromatic_cycles = [] |
| for match in aromatic_matches: |
| numbers = re.findall(r'[0-9]', match) |
| aromatic_cycles.extend(numbers) |
| |
| |
| peptide_cycles = [n for n in ring_numbers if n not in aromatic_cycles] |
| |
| is_cyclic = len(peptide_cycles) > 0 and not smiles.endswith('C(=O)O') |
| return is_cyclic, peptide_cycles, aromatic_cycles |
| |
| def split_on_bonds(self, smiles): |
| """Split SMILES into segments with simplified Pro handling""" |
| positions = [] |
| used = set() |
| |
| |
| gly_pattern = r'NCC\(=O\)' |
| for match in re.finditer(gly_pattern, smiles): |
| if not any(p in range(match.start(), match.end()) for p in used): |
| positions.append({ |
| 'start': match.start(), |
| 'end': match.end(), |
| 'type': 'gly', |
| 'pattern': match.group() |
| }) |
| used.update(range(match.start(), match.end())) |
| |
| for pattern, bond_type in self.bond_patterns: |
| for match in re.finditer(pattern, smiles): |
| if not any(p in range(match.start(), match.end()) for p in used): |
| positions.append({ |
| 'start': match.start(), |
| 'end': match.end(), |
| 'type': bond_type, |
| 'pattern': match.group() |
| }) |
| used.update(range(match.start(), match.end())) |
|
|
| |
| positions.sort(key=lambda x: x['start']) |
| |
| |
| segments = [] |
| |
| if positions: |
| |
| if positions[0]['start'] > 0: |
| segments.append({ |
| 'content': smiles[0:positions[0]['start']], |
| 'bond_after': positions[0]['pattern'] |
| }) |
| |
| |
| for i in range(len(positions)-1): |
| current = positions[i] |
| next_pos = positions[i+1] |
| |
| if current['type'] == 'gly': |
| segments.append({ |
| 'content': 'NCC(=O)', |
| 'bond_before': positions[i-1]['pattern'] if i > 0 else None, |
| 'bond_after': next_pos['pattern'] |
| }) |
| else: |
| content = smiles[current['end']:next_pos['start']] |
| if content: |
| segments.append({ |
| 'content': content, |
| 'bond_before': current['pattern'], |
| 'bond_after': next_pos['pattern'] |
| }) |
| |
| |
| if positions[-1]['end'] < len(smiles): |
| segments.append({ |
| 'content': smiles[positions[-1]['end']:], |
| 'bond_before': positions[-1]['pattern'] |
| }) |
| |
| return segments |
|
|
| def clean_terminal_carboxyl(self, segment): |
| """Remove C-terminal carboxyl only if it's the true terminus""" |
| content = segment['content'] |
| |
| |
| |
| |
| |
| if 'C(=O)O' in content and not segment.get('bond_after'): |
| print('recognized?') |
| |
| cleaned = re.sub(r'\(C\(=O\)O\)', '', content) |
| |
| cleaned = re.sub(r'\(\)', '', cleaned) |
| print(cleaned) |
| return cleaned |
| return content |
| |
| def identify_residue(self, segment): |
| """Identify residue with Pro reconstruction""" |
| |
| content = self.clean_terminal_carboxyl(segment) |
| mods = self.get_modifications(segment) |
| |
| |
| |
| if 'c1ccccc1' in content: |
| if '[C@@H](c1ccccc1)' in content or '[C@H](c1ccccc1)' in content: |
| return '4', mods |
| |
| |
| if 'Cc1ccc' in content: |
| if 'OMe' in content or 'OCc1ccc' in content: |
| return '0A1', mods |
| elif 'Clc1ccc' in content: |
| return '200', mods |
| elif 'Brc1ccc' in content: |
| return '4BF', mods |
| elif 'C#Nc1ccc' in content: |
| return '4CF', mods |
| elif 'Ic1ccc' in content: |
| return 'PHI', mods |
| elif 'Fc1ccc' in content: |
| return 'PFF', mods |
| |
| |
| if 'c[nH]c2' in content: |
| if 'Oc2cccc2' in content: |
| return '0AF', mods |
| elif 'Fc2cccc2' in content: |
| return '4FW', mods |
| elif 'Clc2cccc2' in content: |
| return '6CW', mods |
| elif 'Brc2cccc2' in content: |
| return 'BTR', mods |
| elif 'COc2cccc2' in content: |
| return 'MOT5', mods |
| elif 'Cc2cccc2' in content: |
| return 'MTR5', mods |
| |
| |
| if 'CC(C)(C)[C@@H]' in content or 'CC(C)(C)[C@H]' in content: |
| return 'BUG', mods |
| |
| if 'CCCNC(=N)N' in content: |
| return 'CIR', mods |
| |
| if '[SeH]' in content: |
| return 'CSE', mods |
| |
| if '[NH3]CC[C@@H]' in content or '[NH3]CC[C@H]' in content: |
| return 'DAB', mods |
| |
| if 'C1CCCCC1' in content: |
| if 'C1CCCCC1[C@@H]' in content or 'C1CCCCC1[C@H]' in content: |
| return 'CHG', mods |
| elif 'C1CCCCC1C[C@@H]' in content or 'C1CCCCC1C[C@H]' in content: |
| return 'ALC', mods |
| |
| |
| if 'c1cccc2c1cccc2' in content: |
| if 'c1cccc2c1cccc2[C@@H]' in content or 'c1cccc2c1cccc2[C@H]' in content: |
| return 'NAL', mods |
| |
| |
| if 'c1cncc' in content: |
| return 'PYR4', mods |
| if 'c1cscc' in content: |
| return 'THA3', mods |
| if 'c1nnc' in content: |
| return 'TRZ4', mods |
| |
| |
| if 'OP(O)(O)O' in content: |
| if '[C@@H](COP' in content or '[C@H](COP' in content: |
| return 'SEP', mods |
| elif '[C@@H](OP' in content or '[C@H](OP' in content: |
| return 'TPO', mods |
| |
| |
| if 'c1c2ccccc2cc2c1cccc2' in content: |
| return 'ANTH', mods |
| if 'c1csc2c1cccc2' in content: |
| return 'BTH3', mods |
| if '[C@]12C[C@H]3C[C@@H](C2)C[C@@H](C1)C3' in content: |
| return 'ADAM', mods |
|
|
| |
| if 'FC(F)(F)' in content: |
| if 'CC(F)(F)F' in content: |
| return 'FLA', mods |
| if 'C(F)(F)F)c1' in content: |
| if 'c1ccccc1C(F)(F)F' in content: |
| return 'TFG2', mods |
| if 'c1cccc(c1)C(F)(F)F' in content: |
| return 'TFG3', mods |
| if 'c1ccc(cc1)C(F)(F)F' in content: |
| return 'TFG4', mods |
| |
| |
| if 'F' in content and 'c1' in content: |
| if 'c1ccc(c(c1)F)F' in content: |
| return 'F2F', mods |
| if 'cc(F)cc(c1)F' in content: |
| return 'WFP', mods |
| if 'Cl' in content and 'c1' in content: |
| if 'c1ccc(cc1Cl)Cl' in content: |
| return 'CP24', mods |
| if 'c1ccc(c(c1)Cl)Cl' in content: |
| return 'CP34', mods |
|
|
| |
| if 'O' in content and 'c1' in content: |
| if 'c1cc(O)cc(c1)O' in content: |
| return '3FG', mods |
| if 'c1ccc(c(c1)O)O' in content: |
| return 'DAH', mods |
| |
| |
| if 'C1CCCC1' in content: |
| return 'CPA3', mods |
| if 'C1CCCCC1' in content: |
| if 'CC1CCCCC1' in content: |
| return 'ALC', mods |
| else: |
| return 'CHG', mods |
|
|
| |
| if 'CCC[C@@H]' in content or 'CCC[C@H]' in content: |
| return 'NLE', mods |
| if 'CC[C@@H]' in content or 'CC[C@H]' in content: |
| if not any(x in content for x in ['CC(C)', 'COC', 'CN(']): |
| return 'ABA', mods |
| |
| |
| if 'c1cnc' in content: |
| if '[C@@H]1CN[C@@H](N1)F' in content: |
| return '2HF', mods |
| if 'c1cnc([nH]1)F' in content: |
| return '2HF1', mods |
| if 'c1c[nH]c(n1)F' in content: |
| return '2HF2', mods |
|
|
| |
| if '[SeH]' in content: |
| return 'CSE', mods |
| if 'S' in content: |
| if 'CSCc1ccccc1' in content: |
| return 'BCS', mods |
| if 'CCSC' in content: |
| return 'ESC', mods |
| if 'CCS' in content: |
| return 'HCS', mods |
|
|
| |
| if 'CN=[N]=N' in content: |
| return 'AZDA', mods |
| if '[NH]=[C](=[NH2])=[NH2]' in content: |
| if 'CCC[NH]=' in content: |
| return 'AGM', mods |
| if 'CC[NH]=' in content: |
| return 'GDPR', mods |
|
|
| if 'CCON' in content: |
| return 'CAN', mods |
| if '[C@@H]1C=C[C@@H](C=C1)' in content: |
| return 'ACZ', mods |
| if 'CCC(=O)[NH3]' in content: |
| return 'ONL', mods |
| if 'c1ccncc1' in content: |
| return 'PYR4', mods |
| if 'c1ccco1' in content: |
| return 'FUA2', mods |
| |
| if 'c1ccc' in content: |
| if 'c1ccc(cc1)c1ccccc1' in content: |
| return 'BIF', mods |
| if 'c1ccc(cc1)C(=O)c1ccccc1' in content: |
| return 'PBF', mods |
| if 'c1ccc(cc1)C(C)(C)C' in content: |
| return 'TBP4', mods |
| if 'c1ccc(cc1)[C](=[NH2])=[NH2]' in content: |
| return '0BN', mods |
| if 'c1cccc(c1)[C](=[NH2])=[NH2]' in content: |
| return 'APM', mods |
|
|
| |
| if 'O' in content: |
| if '[C@H]([C@H](C)O)O' in content: |
| return 'ILX', mods |
| if '[C@H]([C@@H](C)O)O' in content: |
| return 'ALO', mods |
| if '[C@H](COP(O)(O)O)' in content: |
| return 'SEP', mods |
| if '[C@H]([C@@H](C)OP(O)(O)O)' in content: |
| return 'TPO', mods |
| if '[C@H](c1ccc(O)cc1)O' in content: |
| return 'OMX', mods |
| if '[C@H](c1ccc(c(Cl)c1)O)O' in content: |
| return 'OMY', mods |
|
|
| |
| if 'n1' in content: |
| if 'n1cccn1' in content: |
| return 'PYZ1', mods |
| if 'n1nncn1' in content: |
| return 'TEZA', mods |
| if 'c2c(n1)cccc2' in content: |
| return 'QU32', mods |
| if 'c1cnc2c(c1)cccc2' in content: |
| return 'QU33', mods |
| if 'c1ccnc2c1cccc2' in content: |
| return 'QU34', mods |
| if 'c1ccc2c(c1)nccc2' in content: |
| return 'QU35', mods |
| if 'c1ccc2c(c1)cncc2' in content: |
| return 'QU36', mods |
| if 'c1cnc2c(n1)cccc2' in content: |
| return 'QX32', mods |
|
|
| |
| if 'N' in content: |
| if '[NH3]CC[C@@H]' in content: |
| return 'DAB', mods |
| if '[NH3]C[C@@H]' in content: |
| return 'DPP', mods |
| if '[NH3]CCCCCC[C@@H]' in content: |
| return 'HHK', mods |
| if 'CCC[NH]=[C](=[NH2])=[NH2]' in content: |
| return 'GBUT', mods |
| if '[NH]=[C](=S)=[NH2]' in content: |
| return 'THIC', mods |
|
|
| |
| if 'CC' in content: |
| if 'CCCC[C@@H]' in content: |
| return 'AHP', mods |
| if 'CCC([C@@H])(C)C' in content: |
| return 'I2M', mods |
| if 'CC[C@H]([C@@H])C' in content: |
| return 'IIL', mods |
| if '[C@H](CCC(C)C)' in content: |
| return 'HLEU', mods |
| if '[C@@H]([C@@H](C)O)C' in content: |
| return 'HLU', mods |
|
|
| |
| if '[C@@H]' in content: |
| if '[C@@H](C[C@@H](F))' in content: |
| return 'FGA4', mods |
| if '[C@@H](C[C@@H](O))' in content: |
| return '3GL', mods |
| if '[C@@H](C[C@H](C))' in content: |
| return 'LME', mods |
| if '[C@@H](CC[C@H](C))' in content: |
| return 'MEG', mods |
|
|
| |
| if 'S' in content: |
| if 'SCC[C@@H]' in content: |
| return 'HSER', mods |
| if 'SCCN' in content: |
| return 'SLZ', mods |
| if 'SC(=O)' in content: |
| return 'CSA', mods |
| if '[S@@](=O)' in content: |
| return 'SME', mods |
| if 'S(=O)(=O)' in content: |
| return 'OMT', mods |
|
|
| |
| if 'C=' in content: |
| if 'C=C[C@@H]' in content: |
| return '2AG', mods |
| if 'C=C[C@@H]' in content: |
| return 'LVG', mods |
| if 'C=Cc1ccccc1' in content: |
| return 'STYA', mods |
|
|
| |
| if '[C@@H]1Cc2c(C1)cccc2' in content: |
| return 'IGL', mods |
| if '[C](=[C](=O)=O)=O' in content: |
| return '26P', mods |
| if '[C](=[C](=O)=O)=C' in content: |
| return '2NP', mods |
| if 'c2cnc[nH]2' in content: |
| return 'HIS', mods |
| if 'c1cccc2c1cc(O)cc2' in content: |
| return 'NAO1', mods |
| if 'c1ccc2c(c1)cc(O)cc2' in content: |
| return 'NAO2', mods |
| |
| |
| if any([ |
| |
| (segment.get('bond_after', '').startswith(f'N{n}C(=O)') and 'CCC' in content and |
| any(f'[C@@H]{n}' in content or f'[C@H]{n}' in content for n in '123456789')) |
| for n in '123456789' |
| ]) or any([ |
| |
| (f'CCCN{n}' in content and content.endswith('=O') and |
| any(f'[C@@H]{n}' in content or f'[C@H]{n}' in content for n in '123456789')) |
| for n in '123456789' |
| ]) or any([ |
| |
| (content == f'CCC[C@H]{n}' and segment.get('bond_before', '').startswith(f'C(=O)N{n}')) or |
| (content == f'CCC[C@@H]{n}' and segment.get('bond_before', '').startswith(f'C(=O)N{n}')) or |
| |
| (f'N{n}CCC[C@H]{n}' in content) or |
| (f'N{n}CCC[C@@H]{n}' in content) |
| for n in '123456789' |
| ]): |
| return 'Pro', mods |
| |
| |
| if re.search(r'c[0-9]c\[nH\]c[0-9]ccccc[0-9][0-9]', content) and \ |
| 'c[nH]c' in content.replace(' ', ''): |
| return 'Trp', mods |
| |
| |
| if '[C@@H](CCCCN)' in content or '[C@H](CCCCN)' in content: |
| return 'Lys', mods |
| |
| |
| if '[C@@H](CCCNC(=N)N)' in content or '[C@H](CCCNC(=N)N)' in content: |
| return 'Arg', mods |
| |
| if ('C[C@H](CCCC)' in content or 'C[C@@H](CCCC)' in content) and 'CC(C)' not in content: |
| return 'Nle', mods |
| |
| |
| if ('C[C@H](CCCN)' in content or 'C[C@@H](CCCN)' in content) and 'CC(C)' not in content: |
| return 'Orn', mods |
| |
| |
| if ('Cc3cc2ccccc2c3' in content) and ('C[C@H]' in content or 'C[C@@H]' in content): |
| return '2Nal', mods |
| |
| |
| if 'N2CCCCC2' in content or 'CCCCC2' in content: |
| return 'Cha', mods |
| |
| |
| if ('C[C@H](CC)' in content or 'C[C@@H](CC)' in content) and not any(p in content for p in ['CC(C)', 'CCCC', 'CCC(C)']): |
| return 'Abu', mods |
| |
| |
| if ('N3CCCCC3' in content or 'CCCCC3' in content) and ('C[C@H]' in content or 'C[C@@H]' in content): |
| return 'Pip', mods |
|
|
| |
| if ('C[C@H](C1CCCCC1)' in content or 'C[C@@H](C1CCCCC1)' in content): |
| return 'Chg', mods |
| |
| |
| if ('Cc2ccc(F)cc2' in content) and ('C[C@H]' in content or 'C[C@@H]' in content): |
| return '4F-Phe', mods |
| |
| |
| if ('NCC(=O)' in content) or (content == 'C'): |
| |
| if segment.get('bond_before') and segment.get('bond_after'): |
| if ('C(=O)N' in segment['bond_before'] or 'C(=O)N(C)' in segment['bond_before']): |
| return 'Gly', mods |
| |
| elif segment.get('bond_before') and segment.get('bond_before').startswith('C(=O)N'): |
| return 'Gly', mods |
| |
| if 'CC(C)C[C@H]' in content or 'CC(C)C[C@@H]' in content: |
| return 'Leu', mods |
| if '[C@@H](CC(C)C)' in content or '[C@H](CC(C)C)' in content: |
| return 'Leu', mods |
|
|
| if '[C@@H]([C@@H](C)O)' in content or '[C@H]([C@H](C)O)' in content: |
| return 'Thr', mods |
| |
| if '[C@H](Cc2ccccc2)' in content or '[C@@H](Cc2ccccc2)' in content: |
| return 'Phe', mods |
| |
| if ('[C@H](C(C)C)' in content or |
| '[C@@H](C(C)C)' in content or |
| '[C@H]C(C)C' in content or |
| '[C@@H]C(C)C' in content): |
| if not any(p in content for p in ['CC(C)C[C@H]', 'CC(C)C[C@@H]']): |
| return 'Val', mods |
| |
| if '[C@H](COC(C)(C)C)' in content or '[C@@H](COC(C)(C)C)' in content: |
| return 'O-tBu', mods |
| |
| if any([ |
| 'CC[C@H](C)' in content, |
| 'CC[C@@H](C)' in content, |
| 'C(C)C[C@H]' in content and 'CC(C)C' not in content, |
| 'C(C)C[C@@H]' in content and 'CC(C)C' not in content |
| ]): |
| return 'Ile', mods |
| |
| if ('[C@H](C)' in content or '[C@@H](C)' in content): |
| if not any(p in content for p in ['C(C)C', 'COC', 'CN(', 'C(C)O', 'CC[C@H]', 'CC[C@@H]']): |
| return 'Ala', mods |
| |
| |
| if re.search(r'Cc[0-9]ccc\(O\)cc[0-9]', content): |
| return 'Tyr', mods |
|
|
| |
| |
| if '[C@H](CO)' in content or '[C@@H](CO)' in content: |
| if not ('C(C)O' in content or 'COC' in content): |
| return 'Ser', mods |
| |
| |
| if '[C@@H]([C@@H](C)O)' in content or '[C@H]([C@H](C)O)' in content or '[C@@H](C)O' in content or '[C@H](C)O' in content: |
| return 'Thr', mods |
| |
| |
| if '[C@H](CS)' in content or '[C@@H](CS)' in content: |
| return 'Cys', mods |
| |
| |
| if ('C[C@H](CCSC)' in content or 'C[C@@H](CCSC)' in content): |
| return 'Met', mods |
| |
| |
| if ('CC(=O)N' in content) and ('C[C@H]' in content or 'C[C@@H]' in content): |
| return 'Asn', mods |
| |
| |
| if ('CCC(=O)N' in content) and ('C[C@H]' in content or 'C[C@@H]' in content): |
| return 'Gln', mods |
| |
| |
| if ('CC(=O)O' in content) and ('C[C@H]' in content or 'C[C@@H]' in content): |
| return 'Asp', mods |
| |
| |
| if ('CCC(=O)O' in content) and ('C[C@H]' in content or 'C[C@@H]' in content): |
| return 'Glu', mods |
| |
| |
| if ('CCCNC(=N)N' in content) and ('C[C@H]' in content or 'C[C@@H]' in content): |
| return 'Arg', mods |
| |
| |
| if ('Cc2cnc[nH]2' in content) and ('C[C@H]' in content or 'C[C@@H]' in content): |
| return 'His', mods |
| |
| return None, mods |
|
|
| def get_modifications(self, segment): |
| """Get modifications based on bond types""" |
| mods = [] |
| if segment.get('bond_after'): |
| if 'N(C)' in segment['bond_after'] or segment['bond_after'].startswith('C(=O)N(C)'): |
| mods.append('N-Me') |
| if 'OC(=O)' in segment['bond_after']: |
| mods.append('O-linked') |
| return mods |
|
|
| def analyze_structure(self, smiles): |
| """Main analysis function with debug output""" |
| print("\nAnalyzing structure:", smiles) |
| |
| |
| segments = self.split_on_bonds(smiles) |
| |
| print("\nSegment Analysis:") |
| sequence = [] |
| for i, segment in enumerate(segments): |
| print(f"\nSegment {i}:") |
| print(f"Content: {segment['content']}") |
| print(f"Bond before: {segment.get('bond_before', 'None')}") |
| print(f"Bond after: {segment.get('bond_after', 'None')}") |
| |
| residue, mods = self.identify_residue(segment) |
| if residue: |
| if mods: |
| sequence.append(f"{residue}({','.join(mods)})") |
| else: |
| sequence.append(residue) |
| print(f"Identified as: {residue}") |
| print(f"Modifications: {mods}") |
| else: |
| print(f"Warning: Could not identify residue in segment: {segment['content']}") |
| |
| |
| is_cyclic, peptide_cycles, aromatic_cycles = self.is_cyclic(smiles) |
| three_letter = '-'.join(sequence) |
| one_letter = ''.join(self.three_to_one.get(aa.split('(')[0], 'X') for aa in sequence) |
| |
| if is_cyclic: |
| three_letter = f"cyclo({three_letter})" |
| one_letter = f"cyclo({one_letter})" |
| |
| print(f"\nFinal sequence: {three_letter}") |
| print(f"One-letter code: {one_letter}") |
| print(f"Is cyclic: {is_cyclic}") |
| |
| |
| |
| return three_letter, len(segments) |
| """return { |
| 'three_letter': three_letter, |
| #'one_letter': one_letter, |
| 'is_cyclic': is_cyclic |
| }""" |
| |
| def return_sequence(self, smiles): |
| """Main analysis function with debug output""" |
| print("\nAnalyzing structure:", smiles) |
| |
| |
| segments = self.split_on_bonds(smiles) |
| |
| print("\nSegment Analysis:") |
| sequence = [] |
| for i, segment in enumerate(segments): |
| print(f"\nSegment {i}:") |
| print(f"Content: {segment['content']}") |
| print(f"Bond before: {segment.get('bond_before', 'None')}") |
| print(f"Bond after: {segment.get('bond_after', 'None')}") |
| |
| residue, mods = self.identify_residue(segment) |
| if residue: |
| if mods: |
| sequence.append(f"{residue}({','.join(mods)})") |
| else: |
| sequence.append(residue) |
| print(f"Identified as: {residue}") |
| print(f"Modifications: {mods}") |
| else: |
| print(f"Warning: Could not identify residue in segment: {segment['content']}") |
| |
| return sequence |
|
|
| """ |
| def annotate_cyclic_structure(mol, sequence): |
| '''Create annotated 2D structure with clear, non-overlapping residue labels''' |
| # Generate 2D coordinates |
| # Generate 2D coordinates |
| AllChem.Compute2DCoords(mol) |
| |
| # Create drawer with larger size for annotations |
| drawer = Draw.rdMolDraw2D.MolDraw2DCairo(2000, 2000) # Even larger size |
| |
| # Get residue list and reverse it to match structural representation |
| if sequence.startswith('cyclo('): |
| residues = sequence[6:-1].split('-') |
| else: |
| residues = sequence.split('-') |
| residues = list(reversed(residues)) # Reverse the sequence |
| |
| # Draw molecule first to get its bounds |
| drawer.drawOptions().addAtomIndices = False |
| drawer.DrawMolecule(mol) |
| drawer.FinishDrawing() |
| |
| # Convert to PIL Image |
| img = Image.open(BytesIO(drawer.GetDrawingText())) |
| draw = ImageDraw.Draw(img) |
| |
| try: |
| # Try to use DejaVuSans as it's commonly available on Linux systems |
| font = ImageFont.truetype("/usr/share/fonts/truetype/dejavu/DejaVuSans.ttf", 60) |
| small_font = ImageFont.truetype("/usr/share/fonts/truetype/dejavu/DejaVuSans.ttf", 60) |
| except OSError: |
| try: |
| # Fallback to Arial if available (common on Windows) |
| font = ImageFont.truetype("arial.ttf", 60) |
| small_font = ImageFont.truetype("arial.ttf", 60) |
| except OSError: |
| # If no TrueType fonts are available, fall back to default |
| print("Warning: TrueType fonts not available, using default font") |
| font = ImageFont.load_default() |
| small_font = ImageFont.load_default() |
| # Get molecule bounds |
| conf = mol.GetConformer() |
| positions = [] |
| for i in range(mol.GetNumAtoms()): |
| pos = conf.GetAtomPosition(i) |
| positions.append((pos.x, pos.y)) |
| |
| x_coords = [p[0] for p in positions] |
| y_coords = [p[1] for p in positions] |
| min_x, max_x = min(x_coords), max(x_coords) |
| min_y, max_y = min(y_coords), max(y_coords) |
| |
| # Calculate scaling factors |
| scale = 150 # Increased scale factor |
| center_x = 1000 # Image center |
| center_y = 1000 |
| |
| # Add residue labels in a circular arrangement around the structure |
| n_residues = len(residues) |
| radius = 700 # Distance of labels from center |
| |
| # Start from the rightmost point (3 o'clock position) and go counterclockwise |
| # Offset by -3 positions to align with structure |
| offset = 0 # Adjust this value to match the structure alignment |
| for i, residue in enumerate(residues): |
| # Calculate position in a circle around the structure |
| # Start from 0 (3 o'clock) and go counterclockwise |
| angle = -(2 * np.pi * ((i + offset) % n_residues) / n_residues) |
| |
| # Calculate label position |
| label_x = center_x + radius * np.cos(angle) |
| label_y = center_y + radius * np.sin(angle) |
| |
| # Draw residue label |
| text = f"{i+1}. {residue}" |
| bbox = draw.textbbox((label_x, label_y), text, font=font) |
| padding = 10 |
| draw.rectangle([bbox[0]-padding, bbox[1]-padding, |
| bbox[2]+padding, bbox[3]+padding], |
| fill='white', outline='white') |
| draw.text((label_x, label_y), text, |
| font=font, fill='black', anchor="mm") |
| |
| # Add sequence at the top with white background |
| seq_text = f"Sequence: {sequence}" |
| bbox = draw.textbbox((center_x, 100), seq_text, font=small_font) |
| padding = 10 |
| draw.rectangle([bbox[0]-padding, bbox[1]-padding, |
| bbox[2]+padding, bbox[3]+padding], |
| fill='white', outline='white') |
| draw.text((center_x, 100), seq_text, |
| font=small_font, fill='black', anchor="mm") |
| |
| return img |
| """ |
| def annotate_cyclic_structure(mol, sequence): |
| """Create structure visualization with just the sequence header""" |
| |
| AllChem.Compute2DCoords(mol) |
| |
| |
| drawer = Draw.rdMolDraw2D.MolDraw2DCairo(2000, 2000) |
| |
| |
| drawer.drawOptions().addAtomIndices = False |
| drawer.DrawMolecule(mol) |
| drawer.FinishDrawing() |
| |
| |
| img = Image.open(BytesIO(drawer.GetDrawingText())) |
| draw = ImageDraw.Draw(img) |
| try: |
| small_font = ImageFont.truetype("/usr/share/fonts/truetype/dejavu/DejaVuSans.ttf", 60) |
| except OSError: |
| try: |
| small_font = ImageFont.truetype("arial.ttf", 60) |
| except OSError: |
| print("Warning: TrueType fonts not available, using default font") |
| small_font = ImageFont.load_default() |
| |
| |
| seq_text = f"Sequence: {sequence}" |
| bbox = draw.textbbox((1000, 100), seq_text, font=small_font) |
| padding = 10 |
| draw.rectangle([bbox[0]-padding, bbox[1]-padding, |
| bbox[2]+padding, bbox[3]+padding], |
| fill='white', outline='white') |
| draw.text((1000, 100), seq_text, |
| font=small_font, fill='black', anchor="mm") |
| |
| return img |
|
|
| def create_enhanced_linear_viz(sequence, smiles): |
| """Create an enhanced linear representation using PeptideAnalyzer""" |
| analyzer = PeptideAnalyzer() |
| |
| |
| fig = plt.figure(figsize=(15, 10)) |
| gs = fig.add_gridspec(2, 1, height_ratios=[1, 2]) |
| ax_struct = fig.add_subplot(gs[0]) |
| ax_detail = fig.add_subplot(gs[1]) |
| |
| |
| if sequence.startswith('cyclo('): |
| residues = sequence[6:-1].split('-') |
| else: |
| residues = sequence.split('-') |
| |
| |
| segments = analyzer.split_on_bonds(smiles) |
| |
| |
| print(f"Number of residues: {len(residues)}") |
| print(f"Number of segments: {len(segments)}") |
| |
| |
| ax_struct.set_xlim(0, 10) |
| ax_struct.set_ylim(0, 2) |
| |
| num_residues = len(residues) |
| spacing = 9.0 / (num_residues - 1) if num_residues > 1 else 9.0 |
| |
| |
| y_pos = 1.5 |
| for i in range(num_residues): |
| x_pos = 0.5 + i * spacing |
| |
| |
| rect = patches.Rectangle((x_pos-0.3, y_pos-0.2), 0.6, 0.4, |
| facecolor='lightblue', edgecolor='black') |
| ax_struct.add_patch(rect) |
| |
| |
| if i < num_residues - 1: |
| segment = segments[i] if i < len(segments) else None |
| if segment: |
| |
| bond_type = 'ester' if 'O-linked' in segment.get('bond_after', '') else 'peptide' |
| is_n_methylated = 'N-Me' in segment.get('bond_after', '') |
| |
| bond_color = 'red' if bond_type == 'ester' else 'black' |
| linestyle = '--' if bond_type == 'ester' else '-' |
| |
| |
| ax_struct.plot([x_pos+0.3, x_pos+spacing-0.3], [y_pos, y_pos], |
| color=bond_color, linestyle=linestyle, linewidth=2) |
| |
| |
| mid_x = x_pos + spacing/2 |
| bond_label = f"{bond_type}" |
| if is_n_methylated: |
| bond_label += "\n(N-Me)" |
| ax_struct.text(mid_x, y_pos+0.1, bond_label, |
| ha='center', va='bottom', fontsize=10, |
| color=bond_color) |
| |
| |
| ax_struct.text(x_pos, y_pos-0.5, residues[i], |
| ha='center', va='top', fontsize=14) |
| |
| |
| ax_detail.set_ylim(0, len(segments)+1) |
| ax_detail.set_xlim(0, 1) |
| |
| |
| segment_y = len(segments) |
| for i, segment in enumerate(segments): |
| y = segment_y - i |
| |
| |
| residue, mods = analyzer.identify_residue(segment) |
| if residue: |
| text = f"Residue {i+1}: {residue}" |
| if mods: |
| text += f" ({', '.join(mods)})" |
| color = 'blue' |
| else: |
| |
| text = f"Bond {i}: " |
| if 'O-linked' in segment.get('bond_after', ''): |
| text += "ester" |
| elif 'N-Me' in segment.get('bond_after', ''): |
| text += "peptide (N-methylated)" |
| else: |
| text += "peptide" |
| color = 'red' |
| |
| |
| ax_detail.text(0.05, y, text, fontsize=12, color=color) |
| ax_detail.text(0.5, y, f"SMILES: {segment.get('content', '')}", fontsize=10, color='gray') |
| |
| |
| if sequence.startswith('cyclo('): |
| ax_struct.annotate('', xy=(9.5, y_pos), xytext=(0.5, y_pos), |
| arrowprops=dict(arrowstyle='<->', color='red', lw=2)) |
| ax_struct.text(5, y_pos+0.3, 'Cyclic Connection', |
| ha='center', color='red', fontsize=14) |
| |
| |
| ax_struct.set_title("Peptide Structure Overview", pad=20) |
| ax_detail.set_title("Segment Analysis Breakdown", pad=20) |
| |
| |
| for ax in [ax_struct, ax_detail]: |
| ax.set_xticks([]) |
| ax.set_yticks([]) |
| ax.axis('off') |
| |
| plt.tight_layout() |
| return fig |
|
|
| class PeptideStructureGenerator: |
| """A class to generate 3D structures of peptides using different embedding methods""" |
| |
| @staticmethod |
| def prepare_molecule(smiles): |
| """Prepare molecule with proper hydrogen handling""" |
| mol = Chem.MolFromSmiles(smiles, sanitize=False) |
| if mol is None: |
| raise ValueError("Failed to create molecule from SMILES") |
| |
| |
| for atom in mol.GetAtoms(): |
| atom.UpdatePropertyCache(strict=False) |
| |
| |
| Chem.SanitizeMol(mol, |
| sanitizeOps=Chem.SANITIZE_FINDRADICALS| |
| Chem.SANITIZE_KEKULIZE| |
| Chem.SANITIZE_SETAROMATICITY| |
| Chem.SANITIZE_SETCONJUGATION| |
| Chem.SANITIZE_SETHYBRIDIZATION| |
| Chem.SANITIZE_CLEANUPCHIRALITY) |
| |
| mol = Chem.AddHs(mol) |
| return mol |
|
|
| @staticmethod |
| def get_etkdg_params(attempt=0): |
| """Get ETKDG parameters with optional modifications based on attempt number""" |
| params = AllChem.ETKDGv3() |
| params.randomSeed = -1 |
| params.maxIterations = 200 |
| params.numThreads = 4 |
| params.useBasicKnowledge = True |
| params.enforceChirality = True |
| params.useExpTorsionAnglePrefs = True |
| params.useSmallRingTorsions = True |
| params.useMacrocycleTorsions = True |
| params.ETversion = 2 |
| params.pruneRmsThresh = -1 |
| params.embedRmsThresh = 0.5 |
| |
| if attempt > 10: |
| params.bondLength = 1.5 + (attempt - 10) * 0.02 |
| params.useExpTorsionAnglePrefs = False |
| |
| return params |
|
|
| def generate_structure_etkdg(self, smiles, max_attempts=20): |
| """Generate 3D structure using ETKDG without UFF optimization""" |
| success = False |
| mol = None |
| |
| for attempt in range(max_attempts): |
| try: |
| mol = self.prepare_molecule(smiles) |
| params = self.get_etkdg_params(attempt) |
| |
| if AllChem.EmbedMolecule(mol, params) == 0: |
| success = True |
| break |
| except Exception as e: |
| continue |
| |
| if not success: |
| raise ValueError("Failed to generate structure with ETKDG") |
| |
| return mol |
|
|
| def generate_structure_uff(self, smiles, max_attempts=20): |
| """Generate 3D structure using ETKDG followed by UFF optimization""" |
| best_mol = None |
| lowest_energy = float('inf') |
| |
| for attempt in range(max_attempts): |
| try: |
| test_mol = self.prepare_molecule(smiles) |
| params = self.get_etkdg_params(attempt) |
| |
| if AllChem.EmbedMolecule(test_mol, params) == 0: |
| res = AllChem.UFFOptimizeMolecule(test_mol, maxIters=2000, |
| vdwThresh=10.0, confId=0, |
| ignoreInterfragInteractions=True) |
| |
| if res == 0: |
| ff = AllChem.UFFGetMoleculeForceField(test_mol) |
| if ff: |
| current_energy = ff.CalcEnergy() |
| if current_energy < lowest_energy: |
| lowest_energy = current_energy |
| best_mol = Chem.Mol(test_mol) |
| except Exception: |
| continue |
| |
| if best_mol is None: |
| raise ValueError("Failed to generate optimized structure") |
| |
| return best_mol |
|
|
| @staticmethod |
| def mol_to_sdf_bytes(mol): |
| """Convert RDKit molecule to SDF file bytes""" |
| |
| sio = StringIO() |
| writer = Chem.SDWriter(sio) |
| writer.write(mol) |
| writer.close() |
| |
| |
| return sio.getvalue().encode('utf-8') |
|
|
| def process_input(smiles_input=None, file_obj=None, show_linear=False, |
| show_segment_details=False, generate_3d=False, use_uff=False): |
| """Process input and create visualizations using PeptideAnalyzer""" |
| analyzer = PeptideAnalyzer() |
| temp_dir = tempfile.mkdtemp() if generate_3d else None |
| structure_files = [] |
| |
| |
| if smiles_input: |
| smiles = smiles_input.strip() |
| |
| |
| if not analyzer.is_peptide(smiles): |
| return "Error: Input SMILES does not appear to be a peptide structure.", None, None |
| |
| try: |
| |
| mol = Chem.MolFromSmiles(smiles) |
| if mol is None: |
| return "Error: Invalid SMILES notation.", None, None |
| |
| |
| if generate_3d: |
| generator = PeptideStructureGenerator() |
| |
| try: |
| |
| mol_etkdg = generator.generate_structure_etkdg(smiles) |
| etkdg_path = os.path.join(temp_dir, "structure_etkdg.sdf") |
| writer = Chem.SDWriter(etkdg_path) |
| writer.write(mol_etkdg) |
| writer.close() |
| structure_files.append(etkdg_path) |
| |
| |
| if use_uff: |
| mol_uff = generator.generate_structure_uff(smiles) |
| uff_path = os.path.join(temp_dir, "structure_uff.sdf") |
| writer = Chem.SDWriter(uff_path) |
| writer.write(mol_uff) |
| writer.close() |
| structure_files.append(uff_path) |
| |
| except Exception as e: |
| return f"Error generating 3D structures: {str(e)}", None, None, None |
| |
| |
| segments = analyzer.split_on_bonds(smiles) |
| |
| |
| sequence_parts = [] |
| output_text = "" |
| |
| |
| if show_segment_details: |
| output_text += "Segment Analysis:\n" |
| for i, segment in enumerate(segments): |
| output_text += f"\nSegment {i}:\n" |
| output_text += f"Content: {segment['content']}\n" |
| output_text += f"Bond before: {segment.get('bond_before', 'None')}\n" |
| output_text += f"Bond after: {segment.get('bond_after', 'None')}\n" |
| |
| residue, mods = analyzer.identify_residue(segment) |
| if residue: |
| if mods: |
| sequence_parts.append(f"{residue}({','.join(mods)})") |
| else: |
| sequence_parts.append(residue) |
| output_text += f"Identified as: {residue}\n" |
| output_text += f"Modifications: {mods}\n" |
| else: |
| output_text += f"Warning: Could not identify residue in segment: {segment['content']}\n" |
| output_text += "\n" |
| else: |
| |
| for segment in segments: |
| residue, mods = analyzer.identify_residue(segment) |
| if residue: |
| if mods: |
| sequence_parts.append(f"{residue}({','.join(mods)})") |
| else: |
| sequence_parts.append(residue) |
| |
| |
| is_cyclic, peptide_cycles, aromatic_cycles = analyzer.is_cyclic(smiles) |
| three_letter = '-'.join(sequence_parts) |
| one_letter = ''.join(analyzer.three_to_one.get(aa.split('(')[0], 'X') for aa in sequence_parts) |
| |
| if is_cyclic: |
| three_letter = f"cyclo({three_letter})" |
| one_letter = f"cyclo({one_letter})" |
| |
| |
| img_cyclic = annotate_cyclic_structure(mol, three_letter) |
| |
| |
| img_linear = None |
| if show_linear: |
| fig_linear = create_enhanced_linear_viz(three_letter, smiles) |
| buf = BytesIO() |
| fig_linear.savefig(buf, format='png', bbox_inches='tight', dpi=300) |
| buf.seek(0) |
| img_linear = Image.open(buf) |
| plt.close(fig_linear) |
|
|
| |
| summary = "Summary:\n" |
| summary += f"Sequence: {three_letter}\n" |
| summary += f"One-letter code: {one_letter}\n" |
| summary += f"Is Cyclic: {'Yes' if is_cyclic else 'No'}\n" |
| |
| |
| |
| |
| if structure_files: |
| summary += "\n3D Structures Generated:\n" |
| for filepath in structure_files: |
| summary += f"- {os.path.basename(filepath)}\n" |
| |
| return summary + output_text, img_cyclic, img_linear, structure_files if structure_files else None |
| |
| except Exception as e: |
| return f"Error processing SMILES: {str(e)}", None, None, None |
| |
| |
| if file_obj is not None: |
| try: |
| |
| if hasattr(file_obj, 'name'): |
| with open(file_obj.name, 'r') as f: |
| content = f.read() |
| else: |
| content = file_obj.decode('utf-8') if isinstance(file_obj, bytes) else str(file_obj) |
| |
| output_text = "" |
| for line in content.splitlines(): |
| smiles = line.strip() |
| if smiles: |
| |
| if not analyzer.is_peptide(smiles): |
| output_text += f"Skipping non-peptide SMILES: {smiles}\n" |
| continue |
| |
| |
| segments = analyzer.split_on_bonds(smiles) |
| sequence_parts = [] |
| |
| |
| if show_segment_details: |
| output_text += f"\nSegment Analysis for SMILES: {smiles}\n" |
| for i, segment in enumerate(segments): |
| output_text += f"\nSegment {i}:\n" |
| output_text += f"Content: {segment['content']}\n" |
| output_text += f"Bond before: {segment.get('bond_before', 'None')}\n" |
| output_text += f"Bond after: {segment.get('bond_after', 'None')}\n" |
| residue, mods = analyzer.identify_residue(segment) |
| if residue: |
| if mods: |
| sequence_parts.append(f"{residue}({','.join(mods)})") |
| else: |
| sequence_parts.append(residue) |
| output_text += f"Identified as: {residue}\n" |
| output_text += f"Modifications: {mods}\n" |
| else: |
| for segment in segments: |
| residue, mods = analyzer.identify_residue(segment) |
| if residue: |
| if mods: |
| sequence_parts.append(f"{residue}({','.join(mods)})") |
| else: |
| sequence_parts.append(residue) |
| |
| |
| is_cyclic, peptide_cycles, aromatic_cycles = analyzer.is_cyclic(smiles) |
| sequence = f"cyclo({'-'.join(sequence_parts)})" if is_cyclic else '-'.join(sequence_parts) |
| |
| output_text += f"\nSummary for SMILES: {smiles}\n" |
| output_text += f"Sequence: {sequence}\n" |
| output_text += f"Is Cyclic: {'Yes' if is_cyclic else 'No'}\n" |
| if is_cyclic: |
| output_text += f"Peptide Cycles: {', '.join(peptide_cycles)}\n" |
| |
| output_text += "-" * 50 + "\n" |
| |
| return output_text, None, None |
| |
| except Exception as e: |
| return f"Error processing file: {str(e)}", None, None |
| |
| return "No input provided.", None, None |
|
|
|
|
|
|